aqui va los pdfs y eso. editar gitignore pa coger esto

.gitignore

@@ -1,5 +1,5 @@
 /bootstrap/compiled.php
-/vendor
+
 composer.phar
 composer.lock
 .env.*.php
@@ -7,11 +7,17 @@ composer.lock
 .DS_Store
 Thumbs.db
 app/database/csv/*
-app/config/local/*
-app/config/app.php
+app/config/packages/*
+app/config/testing/*
 app/config/database.php
+app/config/*
+
+!app/config/app.php
 node_modules/
-app/config/
+vendor/*
+!vendor/barryvdh/
+!vendor/dompdf/
+
 app/controllers/AuthController.php
 app/controllers/AuthController.php
 bootstrap/start.php

app/config/app.php

@@ -0,0 +1,208 @@
+<?php
+error_reporting(error_reporting() & ~E_DEPRECATED);
+return array(
+
+	/*
+	|--------------------------------------------------------------------------
+	| Application Debug Mode
+	|--------------------------------------------------------------------------
+	|
+	| When your application is in debug mode, detailed error messages with
+	| stack traces will be shown on every error that occurs within your
+	| application. If disabled, a simple generic error page is shown.
+	|
+	*/
+
+	//'debug' => $_ENV['APP_DEBUG'] ?: false,
+
+	'debug' => true,
+	/*
+	|--------------------------------------------------------------------------
+	| Application URL
+	|--------------------------------------------------------------------------
+	|
+	| This URL is used by the console to properly generate URLs when using
+	| the Artisan command line tool. You should set this to the root of
+	| your application so that it is used when running Artisan tasks.
+	|
+	*/ //$_ENV['APP_URL'] ?:
+
+	'url' =>  'http://localhost',
+
+	/*
+	|--------------------------------------------------------------------------
+	| Application Timezone
+	|--------------------------------------------------------------------------
+	|
+	| Here you may specify the default timezone for your application, which
+	| will be used by the PHP date and date-time functions. We have gone
+	| ahead and set this to a sensible default for you out of the box.
+	|
+	*/
+
+	'timezone' => 'America/Puerto_Rico',
+
+	/*
+	|--------------------------------------------------------------------------
+	| Application Locale Configuration
+	|--------------------------------------------------------------------------
+	|
+	| The application locale determines the default locale that will be used
+	| by the translation service provider. You are free to set this value
+	| to any of the locales which will be supported by the application.
+	|
+	*/
+
+	'locale' => 'en',
+
+	/*
+	|--------------------------------------------------------------------------
+	| Application Fallback Locale
+	|--------------------------------------------------------------------------
+	|
+	| The fallback locale determines the locale to use when the current one
+	| is not available. You may change the value to correspond to any of
+	| the language folders that are provided through your application.
+	|
+	*/
+
+	'fallback_locale' => 'en',
+
+	/*
+	|--------------------------------------------------------------------------
+	| Encryption Key
+	|--------------------------------------------------------------------------
+	|
+	| This key is used by the Illuminate encrypter service and should be set
+	| to a random, 32 character string, otherwise these encrypted strings
+	| will not be safe. Please do this before deploying an application!
+	|
+	*/
+
+	// 'key' => 'YourSecretKey!!!',
+	'key' => 'JozBz0yQBrZ5kEcPvgxch3RR3E3INSGs',
+
+	'cipher' => MCRYPT_RIJNDAEL_256,
+
+	/*
+	|--------------------------------------------------------------------------
+	| Autoloaded Service Providers
+	|--------------------------------------------------------------------------
+	|
+	| The service providers listed here will be automatically loaded on the
+	| request to your application. Feel free to add your own services to
+	| this array to grant expanded functionality to your applications.
+	|
+	*/
+
+	'providers' => array(
+
+		'Illuminate\Foundation\Providers\ArtisanServiceProvider',
+		'Illuminate\Auth\AuthServiceProvider',
+		'Illuminate\Cache\CacheServiceProvider',
+		'Illuminate\Session\CommandsServiceProvider',
+		'Illuminate\Foundation\Providers\ConsoleSupportServiceProvider',
+		'Illuminate\Routing\ControllerServiceProvider',
+		'Illuminate\Cookie\CookieServiceProvider',
+		'Illuminate\Database\DatabaseServiceProvider',
+		'Illuminate\Encryption\EncryptionServiceProvider',
+		'Illuminate\Filesystem\FilesystemServiceProvider',
+		'Illuminate\Hashing\HashServiceProvider',
+		'Illuminate\Html\HtmlServiceProvider',
+		'Illuminate\Log\LogServiceProvider',
+		'Illuminate\Mail\MailServiceProvider',
+		'Illuminate\Database\MigrationServiceProvider',
+		'Illuminate\Pagination\PaginationServiceProvider',
+		'Illuminate\Queue\QueueServiceProvider',
+		'Illuminate\Redis\RedisServiceProvider',
+		'Illuminate\Remote\RemoteServiceProvider',
+		'Illuminate\Auth\Reminders\ReminderServiceProvider',
+		'Illuminate\Database\SeedServiceProvider',
+		'Illuminate\Session\SessionServiceProvider',
+		'Illuminate\Translation\TranslationServiceProvider',
+		'Illuminate\Validation\ValidationServiceProvider',
+		'Illuminate\View\ViewServiceProvider',
+		'Illuminate\Workbench\WorkbenchServiceProvider',
+		'Way\Generators\GeneratorsServiceProvider',
+		'Barryvdh\DomPDF\ServiceProvider',
+		// 'Cornford\Backup\Providers\BackupServiceProvider',
+		'Zizaco\Entrust\EntrustServiceProvider',
+		//To be able to use PDF
+		//'Thujohn\Pdf\PdfServiceProvider',
+
+	),
+
+	/*
+	|--------------------------------------------------------------------------
+	| Service Provider Manifest
+	|--------------------------------------------------------------------------
+	|
+	| The service provider manifest is used by Laravel to lazy load service
+	| providers which are not needed for each request, as well to keep a
+	| list of all of the services. Here, you may set its storage spot.
+	|
+	*/
+
+	'manifest' => storage_path() . '/meta',
+
+	/*
+	|--------------------------------------------------------------------------
+	| Class Aliases
+	|--------------------------------------------------------------------------
+	|
+	| This array of class aliases will be registered when this application
+	| is started. However, feel free to register as many as you wish as
+	| the aliases are "lazy" loaded so they don't hinder performance.
+	|
+	*/
+
+	'aliases' => array(
+
+		'App'               => 'Illuminate\Support\Facades\App',
+		'Artisan'           => 'Illuminate\Support\Facades\Artisan',
+		'Auth'              => 'Illuminate\Support\Facades\Auth',
+		//'Backup'	        => 'Cornford\Backup\Facades\Backup',
+		'Filesystem'        => 'Illuminate\Filesystem\Filesystem',
+		'Blade'             => 'Illuminate\Support\Facades\Blade',
+		'Cache'             => 'Illuminate\Support\Facades\Cache',
+		'ClassLoader'       => 'Illuminate\Support\ClassLoader',
+		'Config'            => 'Illuminate\Support\Facades\Config',
+		'Controller'        => 'Illuminate\Routing\Controller',
+		'Cookie'            => 'Illuminate\Support\Facades\Cookie',
+		'Crypt'             => 'Illuminate\Support\Facades\Crypt',
+		'DB'                => 'Illuminate\Support\Facades\DB',
+		'Eloquent'          => 'Illuminate\Database\Eloquent\Model',
+		'Event'             => 'Illuminate\Support\Facades\Event',
+		'File'              => 'Illuminate\Support\Facades\File',
+		'Form'              => 'Illuminate\Support\Facades\Form',
+		'Hash'              => 'Illuminate\Support\Facades\Hash',
+		'HTML'              => 'Illuminate\Support\Facades\HTML',
+		'Input'             => 'Illuminate\Support\Facades\Input',
+		'Lang'              => 'Illuminate\Support\Facades\Lang',
+		'Log'               => 'Illuminate\Support\Facades\Log',
+		'Mail'              => 'Illuminate\Support\Facades\Mail',
+		'Paginator'         => 'Illuminate\Support\Facades\Paginator',
+		'Password'          => 'Illuminate\Support\Facades\Password',
+		'Queue'             => 'Illuminate\Support\Facades\Queue',
+		'Redirect'          => 'Illuminate\Support\Facades\Redirect',
+		'Redis'             => 'Illuminate\Support\Facades\Redis',
+		'Request'           => 'Illuminate\Support\Facades\Request',
+		'Response'          => 'Illuminate\Support\Facades\Response',
+		'Route'             => 'Illuminate\Support\Facades\Route',
+		'Schema'            => 'Illuminate\Support\Facades\Schema',
+		'Seeder'            => 'Illuminate\Database\Seeder',
+		'Session'           => 'Illuminate\Support\Facades\Session',
+		'SoftDeletingTrait' => 'Illuminate\Database\Eloquent\SoftDeletingTrait',
+		'SSH'               => 'Illuminate\Support\Facades\SSH',
+		'Str'               => 'Illuminate\Support\Str',
+		'URL'               => 'Illuminate\Support\Facades\URL',
+		'Validator'         => 'Illuminate\Support\Facades\Validator',
+		'View'              => 'Illuminate\Support\Facades\View',
+		'PDF'				=> 'Barryvdh\DomPDF\Facade',
+		//'PDF' 				=> 'Thujohn\Pdf\PdfFacade',
+		'Entrust' => 'Zizaco\Entrust\EntrustFacade'
+
+
+	),
+
+);

vendor/barryvdh/laravel-dompdf/.gitignore

@@ -0,0 +1,4 @@
+/vendor
+composer.phar
+composer.lock
+.DS_Store

vendor/barryvdh/laravel-dompdf/composer.json

@@ -0,0 +1,28 @@
+{
+    "name": "barryvdh/laravel-dompdf",
+    "description": "A DOMPDF Wrapper for Laravel",
+    "license": "MIT",
+    "keywords": ["laravel", "dompdf", "pdf"],
+    "authors": [
+        {
+            "name": "Barry vd. Heuvel",
+            "email": "barryvdh@gmail.com"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0",
+        "illuminate/support": "~4.0",
+        "dompdf/dompdf": "0.6.*"
+    },
+
+    "autoload": {
+        "psr-4": {
+            "Barryvdh\\DomPDF\\": "src"
+        }
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "0.4-dev"
+        }
+    }
+}

vendor/barryvdh/laravel-dompdf/readme.md

@@ -0,0 +1,47 @@
+## DOMPDF Wrapper for Laravel 4
+
+Require this package in your composer.json and update composer. This will download the package and the dompdf + fontlib libraries also.
+
+    "barryvdh/laravel-dompdf": "0.4.*"
+
+After updating composer, add the ServiceProvider to the providers array in app/config/app.php
+
+    'Barryvdh\DomPDF\ServiceProvider',
+
+You can optionally use the facade for shorter code. Add this to your facades:
+
+    'PDF' => 'Barryvdh\DomPDF\Facade',
+
+You can create a new DOMPDF instance and load a HTML string, file or view name. You can save it to a file, or stream (show in browser) or download.
+
+    $pdf = App::make('dompdf');
+    $pdf->loadHTML('<h1>Test</h1>');
+    return $pdf->stream();
+
+Or use the facade:
+
+    $pdf = PDF::loadView('pdf.invoice', $data);
+    return $pdf->download('invoice.pdf');
+
+You can chain the methods:
+
+    return PDF::loadFile(public_path().'/myfile.html')->save('/path-to/my_stored_file.pdf')->stream('download.pdf');
+
+You can change the orientation and paper size, and hide or show errors (by default, errors are shown when debug is on)
+
+    PDF::loadHTML($html)->setPaper('a4')->setOrientation('landscape')->setWarnings(false)->save('myfile.pdf')
+
+If you need the output as a string, you can get the rendered PDF with the output() function, so you can save/output it yourself.
+
+You can  publish the config-file to change some settings (default paper etc).
+
+    php artisan config:publish barryvdh/laravel-dompdf
+
+### Tip: UTF-8 support
+In your templates, set the UTF-8 Metatag:
+
+    <meta http-equiv="Content-Type" content="text/html; charset=utf-8"/>
+
+### License
+
+This DOMPDF Wrapper for Laravel4 is open-sourced software licensed under the [MIT license](http://opensource.org/licenses/MIT)

vendor/barryvdh/laravel-dompdf/src/Facade.php

@@ -0,0 +1,45 @@
+<?php
+namespace Barryvdh\DomPDF;
+
+use Illuminate\Support\Facades\Facade as IlluminateFacade;
+
+class Facade extends IlluminateFacade {
+
+    /**
+     * Get the registered name of the component.
+     *
+     * @return string
+     */
+    protected static function getFacadeAccessor() { return 'dompdf'; }
+
+    /**
+     * Resolve a new instance
+     */
+    public static function __callStatic($method, $args)
+    {
+        $instance = static::$app->make(static::getFacadeAccessor());
+
+        switch (count($args))
+        {
+            case 0:
+                return $instance->$method();
+
+            case 1:
+                return $instance->$method($args[0]);
+
+            case 2:
+                return $instance->$method($args[0], $args[1]);
+
+            case 3:
+                return $instance->$method($args[0], $args[1], $args[2]);
+
+            case 4:
+                return $instance->$method($args[0], $args[1], $args[2], $args[3]);
+
+            default:
+                return call_user_func_array(array($instance, $method), $args);
+        }
+    }
+
+
+}

vendor/barryvdh/laravel-dompdf/src/PDF.php

@@ -0,0 +1,255 @@
+<?php
+
+namespace Barryvdh\DomPDF;
+
+use Exception;
+use Illuminate\Config\Repository as ConfigRepository;
+use Illuminate\Filesystem\Filesystem;
+use Illuminate\Http\Response;
+
+/**
+ * A Laravel wrapper for DOMPDF
+ *
+ * @package laravel-dompdf
+ * @author Barry vd. Heuvel
+ */
+class PDF
+{
+
+    /** @var \DOMPDF  */
+    protected $dompdf;
+
+    /** @var \Illuminate\Config\Repository  */
+    protected $config;
+
+    /** @var \Illuminate\Filesystem\Filesystem  */
+    protected $files;
+
+    /** @var \Illuminate\View\Factory  */
+    protected $view;
+
+    protected $rendered = false;
+    protected $orientation;
+    protected $paper;
+    protected $showWarnings;
+    protected $public_path;
+
+    /**
+     *
+     * @param \Illuminate\Config\Repository $config
+     * @param \Illuminate\Filesystem\Filesystem $files
+     * @param \Illuminate\View\Factory $view
+     * @param string $publicPath
+     */
+    public function __construct(ConfigRepository $config, Filesystem $files, /* Illuminate\View\Factory */ $view, $publicPath)
+    {
+        $this->config = $config;
+        $this->files = $files;
+        $this->view = $view;
+        $this->public_path = $publicPath;
+
+        $this->showWarnings = $this->config->get('laravel-dompdf::show_warnings', false);
+
+        //To prevent old configs from not working..
+        if ($this->config->has('laravel-dompdf::paper')) {
+            $this->paper = $this->config->get('laravel-dompdf::paper');
+        } else {
+            $this->paper = 'portrait';
+        }
+
+        $this->orientation = $this->config->get('laravel-dompdf::orientation') ?: 'portrait';
+
+        $this->dompdf = new \DOMPDF();
+        $this->dompdf->set_base_path(realpath($publicPath));
+    }
+
+    /**
+     * Get the DomPDF instance
+     *
+     * @return \DOMPDF
+     */
+    public function getDomPDF()
+    {
+        return $this->dompdf;
+    }
+
+    /**
+     * Set the paper size (default A4)
+     *
+     * @param string $paper
+     * @param string $orientation
+     * @return $this
+     */
+    public function setPaper($paper, $orientation = null)
+    {
+        $this->paper = $paper;
+        if ($orientation) {
+            $this->orientation = $orientation;
+        }
+        return $this;
+    }
+
+    /**
+     * Set the orientation (default portrait)
+     *
+     * @param string $orientation
+     * @return static
+     */
+    public function setOrientation($orientation)
+    {
+        $this->orientation = $orientation;
+        return $this;
+    }
+
+    /**
+     * Show or hide warnings
+     *
+     * @param bool $warnings
+     * @return $this
+     */
+    public function setWarnings($warnings)
+    {
+        $this->showWarnings = $warnings;
+        return $this;
+    }
+
+    /**
+     * Load a HTML string
+     *
+     * @param string $string
+     * @param string $encoding Not used yet
+     * @return static
+     */
+    public function loadHTML($string, $encoding = null)
+    {
+        $string = $this->convertEntities($string);
+        $this->dompdf->load_html($string, $encoding);
+        $this->rendered = false;
+        return $this;
+    }
+
+    /**
+     * Load a HTML file
+     *
+     * @param string $file
+     * @return static
+     */
+    public function loadFile($file)
+    {
+        $this->dompdf->load_html_file($file);
+        $this->rendered = false;
+        return $this;
+    }
+
+    /**
+     * Load a View and convert to HTML
+     *
+     * @param string $view
+     * @param array $data
+     * @param array $mergeData
+     * @param string $encoding Not used yet
+     * @return static
+     */
+    public function loadView($view, $data = array(), $mergeData = array(), $encoding = null)
+    {
+        $html = $this->view->make($view, $data, $mergeData)->render();
+        return $this->loadHTML($html, $encoding);
+    }
+
+    /**
+     * Output the PDF as a string.
+     *
+     * @return string The rendered PDF as string
+     */
+    public function output()
+    {
+        if (!$this->rendered) {
+            $this->render();
+        }
+        return $this->dompdf->output();
+    }
+
+    /**
+     * Save the PDF to a file
+     *
+     * @param $filename
+     * @return static
+     */
+    public function save($filename)
+    {
+        $this->files->put($filename, $this->output());
+        return $this;
+    }
+
+    /**
+     * Make the PDF downloadable by the user
+     *
+     * @param string $filename
+     * @return \Illuminate\Http\Response
+     */
+    public function download($filename = 'document.pdf')
+    {
+        $output = $this->output();
+        return new Response($output, 200, array(
+            'Content-Type' => 'application/pdf',
+            'Content-Disposition' =>  'attachment; filename="' . $filename . '"'
+        ));
+    }
+
+    /**
+     * Return a response with the PDF to show in the browser
+     *
+     * @param string $filename
+     * @return \Illuminate\Http\Response
+     */
+    public function stream($filename = 'document.pdf')
+    {
+        $output = $this->output();
+        return new Response($output, 200, array(
+            'Content-Type' => 'application/pdf',
+            'Content-Disposition' =>  'inline; filename="' . $filename . '"',
+        ));
+    }
+
+    /**
+     * Render the PDF
+     */
+    protected function render()
+    {
+        if (!$this->dompdf) {
+            throw new Exception('DOMPDF not created yet');
+        }
+
+        $this->dompdf->set_paper($this->paper, $this->orientation);
+
+        $this->dompdf->render();
+
+        if ($this->showWarnings) {
+            global $_dompdf_warnings;
+            if (count($_dompdf_warnings)) {
+                $warnings = '';
+                foreach ($_dompdf_warnings as $msg) {
+                    $warnings .= $msg . "\n";
+                }
+                // $warnings .= $this->dompdf->get_canvas()->get_cpdf()->messages;
+                if (!empty($warnings)) {
+                    throw new Exception($warnings);
+                }
+            }
+        }
+        $this->rendered = true;
+    }
+
+
+    protected function convertEntities($subject)
+    {
+        $entities = array(
+            '€' => '&#0128;',
+        );
+
+        foreach ($entities as $search => $replace) {
+            $subject = str_replace($search, $replace, $subject);
+        }
+        return $subject;
+    }
+}

vendor/barryvdh/laravel-dompdf/src/ServiceProvider.php

@@ -0,0 +1,77 @@
+<?php
+namespace Barryvdh\DomPDF;
+
+use Exception;
+use Illuminate\Support\ServiceProvider as IlluminateServiceProvider;
+
+class ServiceProvider extends IlluminateServiceProvider {
+
+    /**
+     * Indicates if loading of the provider is deferred.
+     *
+     * @var bool
+     */
+    protected $defer = true;
+
+    /**
+     * Register the service provider.
+     *
+     * @throws \Exception
+     * @return void
+     */
+    public function register()
+    {
+        $this->app['config']->package('barryvdh/laravel-dompdf', __DIR__ . '/config');
+
+        $defines = $this->app['config']->get('laravel-dompdf::defines') ?: array();
+        foreach ($defines as $key => $value) {
+            $this->define($key, $value);
+        }
+
+        //Still load these values, in case config is not used.
+        $this->define("DOMPDF_ENABLE_REMOTE", true);
+        $this->define("DOMPDF_ENABLE_AUTOLOAD", false);
+        $this->define("DOMPDF_CHROOT", $this->app['path.base']);
+        $this->define("DOMPDF_LOG_OUTPUT_FILE", $this->app['path.storage'] . '/logs/dompdf.html');
+
+        $config_file = $this->app['config']->get(
+            'laravel-dompdf::config_file'
+        ) ?: $this->app['path.base'] . '/vendor/dompdf/dompdf/dompdf_config.inc.php';
+
+        if (file_exists($config_file)) {
+            require_once $config_file;
+        } else {
+            throw new Exception(
+                "$config_file cannot be loaded, please configure correct config file (config.php: config_file)"
+            );
+        }
+        
+        $this->app->bind('dompdf', function ($app) {
+                return new PDF($app['config'], $app['files'], $app['view'], $app['path.public']);
+            });
+    }
+
+    /**
+     * Get the services provided by the provider.
+     *
+     * @return array
+     */
+    public function provides()
+    {
+        return array('dompdf');
+    }
+
+    /**
+     * Define a value, if not already defined
+     * 
+     * @param string $name
+     * @param string $value
+     */
+    protected function define($name, $value)
+    {
+        if (!defined($name)) {
+            define($name, $value);
+        }
+    }
+
+}

vendor/barryvdh/laravel-dompdf/src/config/config.php

@@ -0,0 +1,266 @@
+<?php
+
+return array(
+
+    /*
+    |--------------------------------------------------------------------------
+    | Settings
+    |--------------------------------------------------------------------------
+    |
+    | Set some default values. It is possible to add all defines that can be set
+    | in dompdf_config.inc.php. You can also override the entire config file.
+    |
+    */
+    'show_warnings' => false,   // Throw an Exception on warnings from dompdf
+    'orientation' => 'portrait',
+    'defines' => array(
+        /**
+         * The location of the DOMPDF font directory
+         *
+         * The location of the directory where DOMPDF will store fonts and font metrics
+         * Note: This directory must exist and be writable by the webserver process.
+         * *Please note the trailing slash.*
+         *
+         * Notes regarding fonts:
+         * Additional .afm font metrics can be added by executing load_font.php from command line.
+         *
+         * Only the original "Base 14 fonts" are present on all pdf viewers. Additional fonts must
+         * be embedded in the pdf file or the PDF may not display correctly. This can significantly
+         * increase file size unless font subsetting is enabled. Before embedding a font please
+         * review your rights under the font license.
+         *
+         * Any font specification in the source HTML is translated to the closest font available
+         * in the font directory.
+         *
+         * The pdf standard "Base 14 fonts" are:
+         * Courier, Courier-Bold, Courier-BoldOblique, Courier-Oblique,
+         * Helvetica, Helvetica-Bold, Helvetica-BoldOblique, Helvetica-Oblique,
+         * Times-Roman, Times-Bold, Times-BoldItalic, Times-Italic,
+         * Symbol, ZapfDingbats.
+         */
+        "DOMPDF_FONT_DIR" => storage_path('fonts/'), // advised by dompdf (https://github.com/dompdf/dompdf/pull/782)
+
+        /**
+         * The location of the DOMPDF font cache directory
+         *
+         * This directory contains the cached font metrics for the fonts used by DOMPDF.
+         * This directory can be the same as DOMPDF_FONT_DIR
+         *
+         * Note: This directory must exist and be writable by the webserver process.
+         */
+        "DOMPDF_FONT_CACHE" => storage_path('fonts/'),
+
+        /**
+         * The location of a temporary directory.
+         *
+         * The directory specified must be writeable by the webserver process.
+         * The temporary directory is required to download remote images and when
+         * using the PFDLib back end.
+         */
+        "DOMPDF_TEMP_DIR" => sys_get_temp_dir(),
+
+        /**
+         * ==== IMPORTANT ====
+         *
+         * dompdf's "chroot": Prevents dompdf from accessing system files or other
+         * files on the webserver.  All local files opened by dompdf must be in a
+         * subdirectory of this directory.  DO NOT set it to '/' since this could
+         * allow an attacker to use dompdf to read any files on the server.  This
+         * should be an absolute path.
+         * This is only checked on command line call by dompdf.php, but not by
+         * direct class use like:
+         * $dompdf = new DOMPDF();	$dompdf->load_html($htmldata); $dompdf->render(); $pdfdata = $dompdf->output();
+         */
+        "DOMPDF_CHROOT" => realpath(base_path()),
+
+        /**
+         * Whether to use Unicode fonts or not.
+         *
+         * When set to true the PDF backend must be set to "CPDF" and fonts must be
+         * loaded via load_font.php.
+         *
+         * When enabled, dompdf can support all Unicode glyphs. Any glyphs used in a
+         * document must be present in your fonts, however.
+         */
+        "DOMPDF_UNICODE_ENABLED" => true,
+
+        /**
+         * Whether to enable font subsetting or not.
+         */
+        "DOMPDF_ENABLE_FONTSUBSETTING" => false,
+
+        /**
+         * The PDF rendering backend to use
+         *
+         * Valid settings are 'PDFLib', 'CPDF' (the bundled R&OS PDF class), 'GD' and
+         * 'auto'. 'auto' will look for PDFLib and use it if found, or if not it will
+         * fall back on CPDF. 'GD' renders PDFs to graphic files. {@link
+         * Canvas_Factory} ultimately determines which rendering class to instantiate
+         * based on this setting.
+         *
+         * Both PDFLib & CPDF rendering backends provide sufficient rendering
+         * capabilities for dompdf, however additional features (e.g. object,
+         * image and font support, etc.) differ between backends.  Please see
+         * {@link PDFLib_Adapter} for more information on the PDFLib backend
+         * and {@link CPDF_Adapter} and lib/class.pdf.php for more information
+         * on CPDF. Also see the documentation for each backend at the links
+         * below.
+         *
+         * The GD rendering backend is a little different than PDFLib and
+         * CPDF. Several features of CPDF and PDFLib are not supported or do
+         * not make any sense when creating image files.  For example,
+         * multiple pages are not supported, nor are PDF 'objects'.  Have a
+         * look at {@link GD_Adapter} for more information.  GD support is
+         * experimental, so use it at your own risk.
+         *
+         * @link http://www.pdflib.com
+         * @link http://www.ros.co.nz/pdf
+         * @link http://www.php.net/image
+         */
+        "DOMPDF_PDF_BACKEND" => "CPDF",
+
+        /**
+         * PDFlib license key
+         *
+         * If you are using a licensed, commercial version of PDFlib, specify
+         * your license key here.  If you are using PDFlib-Lite or are evaluating
+         * the commercial version of PDFlib, comment out this setting.
+         *
+         * @link http://www.pdflib.com
+         *
+         * If pdflib present in web server and auto or selected explicitely above,
+         * a real license code must exist!
+         */
+        //"DOMPDF_PDFLIB_LICENSE" => "your license key here",
+
+        /**
+         * html target media view which should be rendered into pdf.
+         * List of types and parsing rules for future extensions:
+         * http://www.w3.org/TR/REC-html40/types.html
+         *   screen, tty, tv, projection, handheld, print, braille, aural, all
+         * Note: aural is deprecated in CSS 2.1 because it is replaced by speech in CSS 3.
+         * Note, even though the generated pdf file is intended for print output,
+         * the desired content might be different (e.g. screen or projection view of html file).
+         * Therefore allow specification of content here.
+         */
+        "DOMPDF_DEFAULT_MEDIA_TYPE" => "screen",
+
+        /**
+         * The default paper size.
+         *
+         * North America standard is "letter"; other countries generally "a4"
+         *
+         * @see CPDF_Adapter::PAPER_SIZES for valid sizes ('letter', 'legal', 'A4', etc.)
+         */
+        "DOMPDF_DEFAULT_PAPER_SIZE" => "a4",
+
+        /**
+         * The default font family
+         *
+         * Used if no suitable fonts can be found. This must exist in the font folder.
+         * @var string
+         */
+        "DOMPDF_DEFAULT_FONT" => "serif",
+
+        /**
+         * Image DPI setting
+         *
+         * This setting determines the default DPI setting for images and fonts.  The
+         * DPI may be overridden for inline images by explictly setting the
+         * image's width & height style attributes (i.e. if the image's native
+         * width is 600 pixels and you specify the image's width as 72 points,
+         * the image will have a DPI of 600 in the rendered PDF.  The DPI of
+         * background images can not be overridden and is controlled entirely
+         * via this parameter.
+         *
+         * For the purposes of DOMPDF, pixels per inch (PPI) = dots per inch (DPI).
+         * If a size in html is given as px (or without unit as image size),
+         * this tells the corresponding size in pt.
+         * This adjusts the relative sizes to be similar to the rendering of the
+         * html page in a reference browser.
+         *
+         * In pdf, always 1 pt = 1/72 inch
+         *
+         * Rendering resolution of various browsers in px per inch:
+         * Windows Firefox and Internet Explorer:
+         *   SystemControl->Display properties->FontResolution: Default:96, largefonts:120, custom:?
+         * Linux Firefox:
+         *   about:config *resolution: Default:96
+         *   (xorg screen dimension in mm and Desktop font dpi settings are ignored)
+         *
+         * Take care about extra font/image zoom factor of browser.
+         *
+         * In images, <img> size in pixel attribute, img css style, are overriding
+         * the real image dimension in px for rendering.
+         *
+         * @var int
+         */
+        "DOMPDF_DPI" => 96,
+
+        /**
+         * Enable inline PHP
+         *
+         * If this setting is set to true then DOMPDF will automatically evaluate
+         * inline PHP contained within <script type="text/php"> ... </script> tags.
+         *
+         * Enabling this for documents you do not trust (e.g. arbitrary remote html
+         * pages) is a security risk.  Set this option to false if you wish to process
+         * untrusted documents.
+         *
+         * @var bool
+         */
+        "DOMPDF_ENABLE_PHP" => false,
+
+        /**
+         * Enable inline Javascript
+         *
+         * If this setting is set to true then DOMPDF will automatically insert
+         * JavaScript code contained within <script type="text/javascript"> ... </script> tags.
+         *
+         * @var bool
+         */
+        "DOMPDF_ENABLE_JAVASCRIPT" => true,
+
+        /**
+         * Enable remote file access
+         *
+         * If this setting is set to true, DOMPDF will access remote sites for
+         * images and CSS files as required.
+         * This is required for part of test case www/test/image_variants.html through www/examples.php
+         *
+         * Attention!
+         * This can be a security risk, in particular in combination with DOMPDF_ENABLE_PHP and
+         * allowing remote access to dompdf.php or on allowing remote html code to be passed to
+         * $dompdf = new DOMPDF(, $dompdf->load_html(...,
+         * This allows anonymous users to download legally doubtful internet content which on
+         * tracing back appears to being downloaded by your server, or allows malicious php code
+         * in remote html pages to be executed by your server with your account privileges.
+         *
+         * @var bool
+         */
+        "DOMPDF_ENABLE_REMOTE" => true,
+
+        /**
+         * A ratio applied to the fonts height to be more like browsers' line height
+         */
+        "DOMPDF_FONT_HEIGHT_RATIO" => 1.1,
+
+        /**
+         * Enable CSS float
+         *
+         * Allows people to disabled CSS float support
+         * @var bool
+         */
+        "DOMPDF_ENABLE_CSS_FLOAT" => false,
+
+
+        /**
+         * Use the more-than-experimental HTML5 Lib parser
+         */
+        "DOMPDF_ENABLE_HTML5PARSER" => false,
+
+
+    ),
+
+
+);

vendor/barryvdh/laravel-ide-helper/.gitignore

@@ -0,0 +1,3 @@
+/vendor
+composer.lock
+.idea

vendor/barryvdh/laravel-ide-helper/composer.json

@@ -0,0 +1,36 @@
+{
+    "name": "barryvdh/laravel-ide-helper",
+    "description": "Laravel IDE Helper, generates correct PHPDocs for all Facade classes, to improve auto-completion.",
+    "keywords": ["laravel", "autocomplete", "ide", "helper", "phpstorm", "netbeans", "sublime", "codeintel", "phpdoc"],
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "Barry vd. Heuvel",
+            "email": "barryvdh@gmail.com"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0",
+        "illuminate/support": "4.x",
+        "illuminate/console": "4.x",
+        "illuminate/filesystem": "4.x",
+        "phpdocumentor/reflection-docblock": "2.0.x",
+        "symfony/class-loader": "~2.3"
+    },
+    "require-dev": {
+        "doctrine/dbal": "~2.3"
+    },
+    "suggest": {
+        "doctrine/dbal": "Load information from the database about models for phpdocs (~2.3)"
+    },
+    "autoload": {
+        "psr-4": {
+            "Barryvdh\\LaravelIdeHelper\\": "src"
+        }
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "1.11-dev"
+        }
+    }
+}

vendor/barryvdh/laravel-ide-helper/provides.json

@@ -0,0 +1,5 @@
+{
+  "providers": [
+    "Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider"
+  ]
+}

vendor/barryvdh/laravel-ide-helper/readme.md

@@ -0,0 +1,97 @@
+## Laravel IDE Helper Generator
+[![Latest Stable Version](https://poser.pugx.org/barryvdh/laravel-ide-helper/version.png)](https://packagist.org/packages/barryvdh/laravel-ide-helper) [![Total Downloads](https://poser.pugx.org/barryvdh/laravel-ide-helper/d/total.png)](https://packagist.org/packages/barryvdh/laravel-ide-helper)
+
+### Complete phpDocs, directly from the source
+
+_Checkout [this Laracasts video](https://laracasts.com/series/how-to-be-awesome-in-phpstorm/episodes/15) for a quick introduction/explanation!_
+
+This packages generates a file that your IDE can understand, so it can provide accurate autocompletion. Generation is done, based on the files in your project, so they are alway up-to-date.
+If you don't want to generate it, you can add a pre-generated file to the root folder of your laravel project. (But this isn't as up-to-date as self generated files)
+
+* Generated version: https://gist.github.com/barryvdh/5227822
+
+Note: You do need CodeIntel for Sublime Text: https://github.com/SublimeCodeIntel/SublimeCodeIntel
+
+### Automatic phpDoc generation for Laravel Facades
+
+Require this package in your composer.json and run composer update (or run `composer require barryvdh/laravel-ide-helper:1.*` directly):
+
+    "barryvdh/laravel-ide-helper": "1.*"
+
+After updating composer, add the ServiceProvider to the providers array in app/config/app.php
+
+    'Barryvdh\LaravelIdeHelper\IdeHelperServiceProvider',
+
+You can now re-generate the docs yourself (for future updates) in artisan
+
+    php artisan ide-helper:generate
+
+Note: bootstrap/compiled.php has to be cleared first, so run `php artisan clear-compiled` before generating (and `php artisan optimize` after..)
+
+You can configure your composer.json to do this after each commit:
+
+    "scripts":{
+        "post-update-cmd":[
+            "php artisan clear-compiled",
+            "php artisan ide-helper:generate",
+            "php artisan optimize",
+        ]
+    },
+
+You can also publish the config-file to change implementations (ie. interface to specific class) or set defaults for --helpers or --sublime.
+
+    php artisan config:publish barryvdh/laravel-ide-helper
+
+The generator tries to identify the real class, but if it cannot be found, you can define it in the config file.
+
+Some classes need a working database connection. If you do not have a working default connection, some facades will not be included.
+You can use a in-memory sqlite driver, using the -M option.
+
+You can choose to include helper files. This is not enabled by default, but you can override this with the --helpers (-H) option.
+The Illuminate/Support/helpers.php is already set-up, but you can add/remove your own files in the config file.
+
+
+### Automatic phpDocs for Models
+
+> **Note:** Since v1.10 you need to require `doctrine/dbal: ~2.3` in your own composer.json. 
+
+If you don't want to write your properties yourself, you can use the command `ide-helper:models` to generate
+phpDocs, based on table columns, relations and getters/setters. You can write the comments directly to your Model file, using the `--write (-W)` option. By default, you are asked to overwrite or write to a separate file (\_ide\_helper\_models.php) (You can force No with `--nowrite (-N)`).
+Please make sure to backup your models, before writing the info.
+It should keep the existing comments and only append new properties/methods. The existing phpdoc is replaced, or added if not found.
+With the `--reset (-R)` option, the existing phpdocs are ignored, only the newly found columns/relations are saved as phpdocs.
+
+    php artisan ide-helper:models Post
+
+    /**
+     * An Eloquent Model: 'Post'
+     *
+     * @property integer $id
+     * @property integer $author_id
+     * @property string $title
+     * @property string $text
+     * @property \Carbon\Carbon $created_at
+     * @property \Carbon\Carbon $updated_at
+     * @property-read \User $author
+     * @property-read \Illuminate\Database\Eloquent\Collection|\Comment[] $comments
+     */
+
+By default, models in app/models are scanned. The optional argument tells what models to use (also outside app/models).
+
+    php artisan ide-helper:models Post User
+
+You can also scan a different directory, using the --dir option (relative from the base path):
+
+    php artisan ide-helper:models --dir="app/workbench/name/package/models" --dir="app/src/Model"
+   
+You can publish the config file (`php artisan config:publish barryvdh/laravel-ide-helper`) and set the default directories.
+
+Models can be ignored using the --ignore (-I) option
+
+    php artisan ide-helper:models --ignore="Post,User"
+
+Note: With namespaces, wrap your model name in " signs: `php artisan ide-helper:models "API\User"`, or escape the slashes (`Api\\User`)
+
+### License
+
+The Laravel IDE Helper Generator is open-sourced software licensed under the [MIT license](http://opensource.org/licenses/MIT)

vendor/barryvdh/laravel-ide-helper/src/Alias.php

@@ -0,0 +1,276 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+class Alias
+{
+
+    protected $alias;
+    protected $facade;
+    protected $extends = null;
+    protected $classType = 'class';
+    protected $namespace = '__root';
+    protected $root = null;
+    protected $classes = array();
+    protected $methods = array();
+    protected $usedMethods = array();
+    protected $valid = false;
+    protected $magicMethods = array();
+    protected $interfaces = array();
+
+    /**
+     * @param string $alias
+     * @param string $facade
+     * @param array $magicMethods
+     * @param array $interfaces
+     */
+    public function __construct($alias, $facade, $magicMethods = array(), $interfaces = array())
+    {
+        $this->alias = $alias;
+        $this->magicMethods = $magicMethods;
+        $this->interfaces = $interfaces;
+
+        // Make the class absolute
+        $facade = '\\' . ltrim($facade, '\\');
+        $this->facade = $facade;
+
+
+        $this->detectRoot();
+
+        if ((!$this->isTrait() && $this->root)) {
+            $this->valid = true;
+        } else {
+            return;
+        }
+
+        $this->addClass($this->root);
+        $this->detectNamespace();
+        $this->detectClassType();
+
+
+    }
+
+    /**
+     * Add one or more classes to analyze
+     *
+     * @param array|string $classes
+     */
+    public function addClass($classes)
+    {
+        $classes = (array)$classes;
+        foreach ($classes as $class) {
+            if (class_exists($class) || interface_exists($class)) {
+                $this->classes[] = $class;
+            }else{
+                echo "Class not exists: $class\r\n";
+            }
+        }
+    }
+
+    /**
+     * Check if this class is valid to process.
+     * @return bool
+     */
+    public function isValid()
+    {
+        return $this->valid;
+    }
+
+    /**
+     * Get the classtype, 'interface' or 'class'
+     *
+     * @return string
+     */
+    public function getClasstype()
+    {
+        return $this->classType;
+    }
+
+    /**
+     * Get the class which this alias extends
+     *
+     * @return null|string
+     */
+    public function getExtends()
+    {
+        return $this->extends;
+    }
+
+    /**
+     * Get the Alias by which this class is called
+     *
+     * @return string
+     */
+    public function getAlias()
+    {
+        return $this->alias;
+    }
+
+    /**
+     * Get the namespace from the alias
+     *
+     * @return string
+     */
+    public function getNamespace()
+    {
+        return $this->namespace;
+    }
+
+    /**
+     * Get the methods found by this Alias
+     *
+     * @return array
+     */
+    public function getMethods()
+    {
+        $this->addMagicMethods();
+        $this->detectMethods();
+        return $this->methods;
+    }
+
+    /**
+     * Detect the namespace
+     */
+    protected function detectNamespace()
+    {
+        if (strpos($this->alias, '\\')) {
+            $nsParts = explode('\\', $this->alias);
+            $this->short = array_pop($nsParts);
+            $this->namespace = implode('\\', $nsParts);
+        }
+    }
+
+    /**
+     * Detect the class type
+     */
+    protected function detectClassType()
+    {
+        //Some classes extend the facade
+        if (interface_exists($this->facade)) {
+            $this->classType = 'interface';
+            $this->extends = $this->facade;
+        } else {
+            $this->classType = 'class';
+            if (class_exists($this->facade)) {
+                $this->extends = $this->facade;
+            }
+        }
+    }
+
+    /**
+     * Get the real root of a facade
+     *
+     * @return bool|string
+     */
+    protected function detectRoot()
+    {
+        $facade = $this->facade;
+
+        try {
+            //If possible, get the facade root
+            if (method_exists($facade, 'getFacadeRoot')) {
+                $root = get_class($facade::getFacadeRoot());
+            } else {
+                $root = $facade;
+            }
+
+            //If it doesn't exist, skip it
+            if (!class_exists($root) && !interface_exists($root)) {
+                $this->error("Class $root is not found.");
+                return;
+            }
+
+            $this->root = $root;
+
+            //When the database connection is not set, some classes will be skipped
+        } catch (\PDOException $e) {
+            $this->error(
+                "PDOException: " . $e->getMessage() . "\nPlease configure your database connection correctly, or use the sqlite memory driver (-M). Skipping $facade."
+            );
+        } catch (\Exception $e) {
+            $this->error("Exception: " . $e->getMessage() . "\nSkipping $facade.");
+        }
+    }
+
+    /**
+     * Detect if this class is a trait or not.
+     *
+     * @return bool
+     */
+    protected function isTrait()
+    {
+        // Check if the facade is not a Trait
+        if (function_exists('trait_exists') && trait_exists($this->facade)) {
+            return true;
+        }
+        return false;
+    }
+
+    /**
+     * Add magic methods, as defined in the configuration files
+     */
+    protected function addMagicMethods()
+    {
+        foreach($this->magicMethods as $magic => $real){
+            list($className, $name) = explode('::', $real);
+            if(!class_exists($className) && !interface_exists($className)){
+                continue;
+            }
+            $method = new \ReflectionMethod($className, $name);
+            $class = new \ReflectionClass($className);
+
+            if(!in_array($method->name, $this->usedMethods)){
+                if($class !== $this->root){
+                    $this->methods[] = new Method($method, $this->alias, $class, $magic, $this->interfaces);
+                }
+                $this->usedMethods[] = $magic;
+            }
+        }
+    }
+
+    /**
+     * Get the methods for one or multiple classes.
+     *
+     * @return string
+     */
+    protected function detectMethods()
+    {
+
+        foreach ($this->classes as $class) {
+            $reflection = new \ReflectionClass($class);
+
+            $methods = $reflection->getMethods(\ReflectionMethod::IS_PUBLIC);
+            if ($methods) {
+                foreach ($methods as $method) {
+                    if (!in_array($method->name, $this->usedMethods)) {
+                        // Only add the methods to the output when the root is not the same as the class.
+                        // And don't add the __*() methods
+                        if ($this->extends !== $class && $method->name !== '__clone') {
+                            $this->methods[] = new Method($method, $this->alias, $reflection, $method->name, $this->interfaces);
+                        }
+                        $this->usedMethods[] = $method->name;
+                    }
+                }
+            }
+        }
+    }
+
+    /**
+     * Output an error.
+     *
+     * @param  string  $string
+     * @return void
+     */
+    protected function error($string)
+    {
+        echo $string . "\r\n";
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/Console/GeneratorCommand.php

@@ -0,0 +1,158 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper\Console;
+
+use Barryvdh\LaravelIdeHelper\Generator;
+use Illuminate\Config\Repository as ConfigRepository;
+use Illuminate\Console\Command;
+use Illuminate\Filesystem\Filesystem;
+use Symfony\Component\Console\Input\InputOption;
+use Symfony\Component\Console\Input\InputArgument;
+
+
+/**
+ * A command to generate autocomplete information for your IDE
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ */
+class GeneratorCommand extends Command
+{
+
+    /**
+     * The console command name.
+     *
+     * @var string
+     */
+    protected $name = 'ide-helper:generate';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Generate a new IDE Helper file.';
+
+    /** @var \Illuminate\Config\Repository */
+    protected $config;
+
+    /** @var \Illuminate\Filesystem\Filesystem */
+    protected $files;
+
+    /** @var \Illuminate\View\Factory */
+    protected $view;
+
+    protected $onlyExtend;
+
+
+    /**
+     *
+     * @param \Illuminate\Config\Repository $config
+     * @param \Illuminate\Filesystem\Filesystem $files
+     * @param \Illuminate\View\Factory $view
+     */
+    public function __construct(
+        ConfigRepository $config,
+        Filesystem $files, /* Illuminate\View\Factory */
+        $view
+    ) {
+        $this->config = $config;
+        $this->files = $files;
+        $this->view = $view;
+        parent::__construct();
+    }
+
+    /**
+     * Execute the console command.
+     *
+     * @return void
+     */
+    public function fire()
+    {
+        if (file_exists($compiled = base_path() . '/bootstrap/compiled.php')) {
+            $this->error(
+                'Error generating IDE Helper: first delete bootstrap/compiled.php (php artisan clear-compiled)'
+            );
+        } else {
+            $filename = $this->argument('filename');
+
+            if ($this->option('memory')) {
+                $this->useMemoryDriver();
+            }
+
+
+            $helpers = '';
+            if ($this->option('helpers') || ($this->config->get('laravel-ide-helper::include_helpers'))) {
+                foreach ($this->config->get('laravel-ide-helper::helper_files', array()) as $helper) {
+                    if (file_exists($helper)) {
+                        $helpers .= str_replace(array('<?php', '?>'), '', $this->files->get($helper));
+                    }
+                }
+            } else {
+                $helpers = '';
+            }
+
+            $generator = new Generator($this->config, $this->view, $this->getOutput(), $helpers);
+            $content = $generator->generate();
+            $written = $this->files->put($filename, $content);
+
+            if ($written !== false) {
+                $this->info("A new helper file was written to $filename");
+            } else {
+                $this->error("The helper file could not be created at $filename");
+            }
+        }
+    }
+
+    protected function useMemoryDriver()
+    {
+        //Use a sqlite database in memory, to avoid connection errors on Database facades
+        $this->config->set(
+            'database.connections.sqlite',
+            array(
+                'driver' => 'sqlite',
+                'database' => ':memory:',
+            )
+        );
+        $this->config->set('database.default', 'sqlite');
+    }
+
+    /**
+     * Get the console command arguments.
+     *
+     * @return array
+     */
+    protected function getArguments()
+    {
+        return array(
+            array(
+                'filename',
+                InputArgument::OPTIONAL,
+                'The path to the helper file',
+                $this->config->get('laravel-ide-helper::filename')
+            ),
+        );
+    }
+
+    /**
+     * Get the console command options.
+     *
+     * @return array
+     */
+    protected function getOptions()
+    {
+        return array(
+            array('helpers', "H", InputOption::VALUE_NONE, 'Include the helper files'),
+            array('memory', "M", InputOption::VALUE_NONE, 'Use sqlite memory driver'),
+            array('sublime', "S", InputOption::VALUE_NONE, 'DEPRECATED: Use different style for SublimeText CodeIntel'),
+        );
+    }
+
+}

vendor/barryvdh/laravel-ide-helper/src/Console/ModelsCommand.php

@@ -0,0 +1,510 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper\Console;
+
+use Illuminate\Console\Command;
+use Illuminate\Support\Str;
+use Symfony\Component\Console\Input\InputOption;
+use Symfony\Component\Console\Input\InputArgument;
+use Symfony\Component\ClassLoader\ClassMapGenerator;
+use phpDocumentor\Reflection\DocBlock;
+use phpDocumentor\Reflection\DocBlock\Context;
+use phpDocumentor\Reflection\DocBlock\Tag;
+use phpDocumentor\Reflection\DocBlock\Serializer as DocBlockSerializer;
+
+/**
+ * A command to generate autocomplete information for your IDE
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ */
+class ModelsCommand extends Command
+{
+
+    /**
+     * The console command name.
+     *
+     * @var string
+     */
+    protected $name = 'ide-helper:models';
+    protected $filename = '_ide_helper_models.php';
+
+    /**
+     * The console command description.
+     *
+     * @var string
+     */
+    protected $description = 'Generate autocompletion for models';
+
+    protected $properties = array();
+    protected $methods = array();
+    protected $write = false;
+    protected $dirs = array();
+    protected $reset;
+
+
+    /**
+     * Execute the console command.
+     *
+     * @return void
+     */
+    public function fire()
+    {
+        $filename = $this->option('filename');
+        $this->write = $this->option('write');
+        $this->dirs = array_merge(
+            $this->laravel['config']->get('laravel-ide-helper::model_locations'),
+            $this->option('dir')
+        );
+        $model = $this->argument('model');
+        $ignore = $this->option('ignore');
+        $this->reset = $this->option('reset');
+
+        //If filename is default and Write is not specified, ask what to do
+        if (!$this->write && $filename === $this->filename && !$this->option('nowrite')) {
+            if ($this->confirm(
+                "Do you want to overwrite the existing model files? Choose no to write to $filename instead? (Yes/No): "
+            )
+            ) {
+                $this->write = true;
+            }
+        }
+
+        $content = $this->generateDocs($model, $ignore);
+
+        if (!$this->write) {
+            $written = \File::put($filename, $content);
+            if ($written !== false) {
+                $this->info("Model information was written to $filename");
+            } else {
+                $this->error("Failed to write model information to $filename");
+            }
+        }
+    }
+
+
+    /**
+     * Get the console command arguments.
+     *
+     * @return array
+     */
+    protected function getArguments()
+    {
+        return array(
+            array('model', InputArgument::OPTIONAL | InputArgument::IS_ARRAY, 'Which models to include', array()),
+        );
+    }
+
+    /**
+     * Get the console command options.
+     *
+     * @return array
+     */
+    protected function getOptions()
+    {
+        return array(
+            array('filename', 'F', InputOption::VALUE_OPTIONAL, 'The path to the helper file', $this->filename),
+            array('dir', 'D', InputOption::VALUE_OPTIONAL | InputOption::VALUE_IS_ARRAY, 'The model dir', array()),
+            array('write', 'W', InputOption::VALUE_NONE, 'Write to Model file'),
+            array('nowrite', 'N', InputOption::VALUE_NONE, 'Don\'t write to Model file'),
+            array('reset', 'R', InputOption::VALUE_NONE, 'Remove the original phpdocs instead of appending'),
+            array('ignore', 'I', InputOption::VALUE_OPTIONAL, 'Which models to ignore', ''),
+        );
+    }
+
+    protected function generateDocs($loadModels, $ignore = '')
+    {
+
+
+        $output = "<?php
+/**
+ * An helper file for your Eloquent Models
+ * Copy the phpDocs from this file to the correct Model,
+ * And remove them from this file, to prevent double declarations.
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ */
+\n\n";
+
+        $hasDoctrine = interface_exists('Doctrine\DBAL\Driver');
+
+        if (empty($loadModels)) {
+            $models = $this->loadModels();
+        } else {
+            $models = array();
+            foreach ($loadModels as $model) {
+                $models = array_merge($models, explode(',', $model));
+            }
+        }
+
+        $ignore = explode(',', $ignore);
+
+        foreach ($models as $name) {
+            if (in_array($name, $ignore)) {
+                $this->comment("Ignoring model '$name'");
+                continue;
+            } else {
+                $this->comment("Loading model '$name'");
+            }
+            $this->properties = array();
+            $this->methods = array();
+            if (class_exists($name)) {
+                try {
+                    // handle abstract classes, interfaces, ...
+                    $reflectionClass = new \ReflectionClass($name);
+                    if (!$reflectionClass->IsInstantiable()) {
+                        throw new \Exception($name . ' is not instanciable.');
+                    } elseif (!$reflectionClass->isSubclassOf('Illuminate\Database\Eloquent\Model')) {
+                        $this->comment("Class '$name' is not a model");
+                        continue;
+                    }
+
+                    $model = new $name();
+                    if ($hasDoctrine) {
+                        $this->getPropertiesFromTable($model);
+                    }
+                    $this->getPropertiesFromMethods($model);
+                    $output .= $this->createPhpDocs($name);
+                } catch (\Exception $e) {
+                    $this->error("Exception: " . $e->getMessage() . "\nCould not analyze class $name.");
+                }
+            } else {
+                $this->error("Class $name does not exist");
+            }
+
+        }
+
+        if (!$hasDoctrine) {
+            $this->error(
+                "Warning: 'doctrine/dbal: ~2.3' is required to load database information. Please require that in your composer.json and run 'composer update'."
+            );
+        }
+
+        return $output;
+
+    }
+
+
+    protected function loadModels()
+    {
+        $models = array();
+        foreach ($this->dirs as $dir) {
+            $dir = base_path() . '/' . $dir;
+            if (file_exists($dir)) {
+                foreach (ClassMapGenerator::createMap($dir) as $model => $path) {
+                    $models[] = $model;
+                }
+            }
+        }
+        return $models;
+    }
+
+    /**
+     * Load the properties from the database table.
+     *
+     * @param \Illuminate\Database\Eloquent\Model $model
+     */
+    protected function getPropertiesFromTable($model)
+    {
+        $table = $model->getConnection()->getTablePrefix() . $model->getTable();
+        $schema = $model->getConnection()->getDoctrineSchemaManager($table);
+        $schema->getDatabasePlatform()->registerDoctrineTypeMapping('enum', 'string');
+
+        $columns = $schema->listTableColumns($table);
+
+        if ($columns) {
+            foreach ($columns as $column) {
+                $name = $column->getName();
+                if (in_array($name, $model->getDates())) {
+                    $type = '\Carbon\Carbon';
+                } else {
+                    $type = $column->getType()->getName();
+                    switch ($type) {
+                        case 'string':
+                        case 'text':
+                        case 'date':
+                        case 'time':
+                        case 'guid':
+                        case 'datetimetz':
+                        case 'datetime':
+                            $type = 'string';
+                            break;
+                        case 'integer':
+                        case 'bigint':
+                        case 'smallint':
+                            $type = 'integer';
+                            break;
+                        case 'decimal':
+                        case 'float':
+                            $type = 'float';
+                            break;
+                        case 'boolean':
+                            $type = 'boolean';
+                            break;
+                        default:
+                            $type = 'mixed';
+                            break;
+                    }
+                }
+
+
+                $this->setProperty($name, $type, true, true);
+                $this->setMethod(
+                    Str::camel("where_" . $name),
+                    '\Illuminate\Database\Query\Builder|\\' . get_class($model),
+                    array('$value')
+                );
+            }
+        }
+    }
+
+    /**
+     * @param \Illuminate\Database\Eloquent\Model $model
+     */
+    protected function getPropertiesFromMethods($model)
+    {
+        $methods = get_class_methods($model);
+        if ($methods) {
+            foreach ($methods as $method) {
+                if (Str::startsWith($method, 'get') && Str::endsWith(
+                        $method,
+                        'Attribute'
+                    ) && $method !== 'getAttribute'
+                ) {
+                    //Magic get<name>Attribute
+                    $name = Str::snake(substr($method, 3, -9));
+                    if (!empty($name)) {
+                        $this->setProperty($name, null, true, null);
+                    }
+                } elseif (Str::startsWith($method, 'set') && Str::endsWith(
+                        $method,
+                        'Attribute'
+                    ) && $method !== 'setAttribute'
+                ) {
+                    //Magic set<name>Attribute
+                    $name = Str::snake(substr($method, 3, -9));
+                    if (!empty($name)) {
+                        $this->setProperty($name, null, null, true);
+                    }
+                } elseif (Str::startsWith($method, 'scope') && $method !== 'scopeQuery') {
+                    //Magic set<name>Attribute
+                    $name = Str::camel(substr($method, 5));
+                    if (!empty($name)) {
+                        $reflection = new \ReflectionMethod($model, $method);
+                        $args = $this->getParameters($reflection);
+                        //Remove the first ($query) argument
+                        array_shift($args);
+                        $this->setMethod($name, '\\' . $reflection->class, $args);
+                    }
+                } elseif (!method_exists('Eloquent', $method) && !Str::startsWith($method, 'get')) {
+
+                    //Use reflection to inspect the code, based on Illuminate/Support/SerializableClosure.php
+                    $reflection = new \ReflectionMethod($model, $method);
+
+                    $file = new \SplFileObject($reflection->getFileName());
+                    $file->seek($reflection->getStartLine() - 1);
+
+                    $code = '';
+                    while ($file->key() < $reflection->getEndLine()) {
+                        $code .= $file->current();
+                        $file->next();
+                    }
+                    $begin = strpos($code, 'function(');
+                    $code = substr($code, $begin, strrpos($code, '}') - $begin + 1);
+
+                    foreach (array(
+                                 'hasMany',
+                                 'belongsToMany',
+                                 'hasOne',
+                                 'belongsTo',
+                                 'morphTo',
+                                 'morphMany',
+                                 'morphToMany'
+                             ) as $relation) {
+                        $search = '$this->' . $relation . '(';
+                        if ($pos = stripos($code, $search)) {
+                            $code = substr($code, $pos + strlen($search));
+                            $arguments = explode(',', substr($code, 0, stripos($code, ')')));
+                            //Remove quotes, ensure 1 \ in front of the model
+                            $returnModel = "\\" . ltrim(trim($arguments[0], " \"'"), "\\");
+                            if ($relation === "belongsToMany" or $relation === 'hasMany' or $relation === 'morphMany' or $relation === 'morphToMany') {
+                                //Collection or array of models (because Collection is Arrayable)
+                                $this->setProperty(
+                                    $method,
+                                    '\Illuminate\Database\Eloquent\Collection|' . $returnModel . '[]',
+                                    true,
+                                    null
+                                );
+                            } else {
+                                //Single model is returned
+                                $this->setProperty($method, $returnModel, true, null);
+                            }
+                        }
+                    }
+
+                }
+            }
+        }
+    }
+
+    /**
+     * @param string $name
+     * @param string|null $type
+     * @param bool|null $read
+     * @param bool|null $write
+     */
+    protected function setProperty($name, $type = null, $read = null, $write = null)
+    {
+        if (!isset($this->properties[$name])) {
+            $this->properties[$name] = array();
+            $this->properties[$name]['type'] = 'mixed';
+            $this->properties[$name]['read'] = false;
+            $this->properties[$name]['write'] = false;
+        }
+        if ($type !== null) {
+            $this->properties[$name]['type'] = $type;
+        }
+        if ($read !== null) {
+            $this->properties[$name]['read'] = $read;
+        }
+        if ($write !== null) {
+            $this->properties[$name]['write'] = $write;
+        }
+    }
+
+    protected function setMethod($name, $type = '', $arguments = array())
+    {
+        if (!isset($this->methods[$name])) {
+            $this->methods[$name] = array();
+            $this->methods[$name]['type'] = $type;
+            $this->methods[$name]['arguments'] = $arguments;
+        }
+    }
+
+    /**
+     * @param string $class
+     * @return string
+     */
+    protected function createPhpDocs($class)
+    {
+
+        $reflection = new \ReflectionClass($class);
+        $namespace = $reflection->getNamespaceName();
+        $classname = $reflection->getShortName();
+        $originalDoc = $reflection->getDocComment();
+
+        if ($this->reset) {
+            $phpdoc = new DocBlock('', new Context($namespace));
+        } else {
+            $phpdoc = new DocBlock($reflection, new Context($namespace));
+        }
+
+        if (!$phpdoc->getText()) {
+            $phpdoc->setText($class);
+        }
+
+        $properties = array();
+        $methods = array();
+        foreach ($phpdoc->getTags() as $tag) {
+            $name = $tag->getName();
+            if ($name == "property" || $name == "property-read" || $name == "property-write") {
+                $properties[] = $tag->getVariableName();
+            } elseif ($name == "method") {
+                $methods[] = $tag->getMethodName();
+            }
+        }
+
+        foreach ($this->properties as $name => $property) {
+            $name = "\$$name";
+            if (in_array($name, $properties)) {
+                continue;
+            }
+            if ($property['read'] && $property['write']) {
+                $attr = 'property';
+            } elseif ($property['write']) {
+                $attr = 'property-write';
+            } else {
+                $attr = 'property-read';
+            }
+            $tag = Tag::createInstance("@{$attr} {$property['type']} {$name}", $phpdoc);
+            $phpdoc->appendTag($tag);
+        }
+
+        foreach ($this->methods as $name => $method) {
+            if (in_array($name, $methods)) {
+                continue;
+            }
+            $arguments = implode(', ', $method['arguments']);
+            $tag = Tag::createInstance("@method static {$method['type']} {$name}({$arguments}) ", $phpdoc);
+            $phpdoc->appendTag($tag);
+        }
+
+        $serializer = new DocBlockSerializer();
+        $serializer->getDocComment($phpdoc);
+        $docComment = $serializer->getDocComment($phpdoc);
+
+
+        if ($this->write) {
+            $filename = $reflection->getFileName();
+            $contents = \File::get($filename);
+            if ($originalDoc) {
+                $contents = str_replace($originalDoc, $docComment, $contents);
+            } else {
+                $needle = "class {$classname}";
+                $replace = "{$docComment}\nclass {$classname}";
+                $pos = strpos($contents, $needle);
+                if ($pos !== false) {
+                    $contents = substr_replace($contents, $replace, $pos, strlen($needle));
+                }
+            }
+            if (\File::put($filename, $contents)) {
+                $this->info('Written new phpDocBlock to ' . $filename);
+            }
+        }
+
+        $output = "namespace {$namespace}{\n{$docComment}\n\tclass {$classname} {}\n}\n\n";
+        return $output;
+    }
+
+    /**
+     * Get the parameters and format them correctly
+     *
+     * @param $method
+     * @return array
+     */
+    public function getParameters($method)
+    {
+        //Loop through the default values for paremeters, and make the correct output string
+        $params = array();
+        $paramsWithDefault = array();
+        foreach ($method->getParameters() as $param) {
+            $paramStr = '$' . $param->getName();
+            $params[] = $paramStr;
+            if ($param->isOptional()) {
+                $default = $param->getDefaultValue();
+                if (is_bool($default)) {
+                    $default = $default ? 'true' : 'false';
+                } elseif (is_array($default)) {
+                    $default = 'array()';
+                } elseif (is_null($default)) {
+                    $default = 'null';
+                } elseif (is_int($default)) {
+                    //$default = $default;
+                } else {
+                    $default = "'" . trim($default) . "'";
+                }
+                $paramStr .= " = $default";
+            }
+            $paramsWithDefault[] = $paramStr;
+        }
+        return $paramsWithDefault;
+    }
+
+}

vendor/barryvdh/laravel-ide-helper/src/Generator.php

@@ -0,0 +1,196 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Illuminate\Foundation\AliasLoader;
+use Illuminate\Config\Repository as ConfigRepository;
+use Symfony\Component\Console\Output\OutputInterface;
+
+class Generator
+{
+    /** @var \Illuminate\Config\Repository */
+    protected $config;
+
+    /** @var \Illuminate\View\Factory */
+    protected $view;
+
+    /** @var \Symfony\Component\Console\Output\OutputInterface */
+    protected $output;
+
+    protected $extra = array();
+    protected $magic = array();
+    protected $interfaces = array();
+    protected $helpers;
+
+    /**
+     * @param \Illuminate\Config\Repository $config
+     * @param \Illuminate\View\Factory $view
+     * @param \Symfony\Component\Console\Output\OutputInterface $output
+     * @param string $helpers
+     */
+    public function __construct(ConfigRepository $config,
+        /* Illuminate\View\Factory */ $view,
+        OutputInterface $output = null,
+        $helpers = ''
+    ) {
+        $this->config = $config;
+        $this->view = $view;
+
+        // Find the drivers to add to the extra/interfaces
+        $this->detectDrivers();
+
+        $this->extra = array_merge($this->extra, $this->config->get('laravel-ide-helper::extra'));
+        $this->magic = array_merge($this->magic, $this->config->get('laravel-ide-helper::magic'));
+        $this->interfaces = array_merge($this->interfaces, $this->config->get('laravel-ide-helper::interfaces'));
+        $this->helpers = $helpers;
+    }
+
+    /**
+     * Generate the helper file contents;
+     *
+     * @return string;
+     */
+    public function generate()
+    {
+        $app = app();
+        return $this->view->make('laravel-ide-helper::ide-helper')
+            ->with('namespaces', $this->getNamespaces())
+            ->with('helpers', $this->helpers)
+            ->with('version', $app::VERSION)
+            ->render();
+    }
+
+    protected function detectDrivers()
+    {
+        try{
+            if (class_exists('Cache')) {
+                $class = get_class(\Auth::driver());
+                $this->extra['Auth'] = array($class);
+                $this->interfaces['\Illuminate\Auth\UserProviderInterface'] = $class;
+            }
+        }catch (\Exception $e) {}
+
+        try{
+            if (class_exists('DB')) {
+                $class = get_class(\DB::connection());
+                $this->extra['DB'] = array($class);
+                $this->interfaces['\Illuminate\Database\ConnectionInterface'] = $class;
+            }
+        }catch (\Exception $e) {}
+
+        try{
+            if (class_exists('Cache')) {
+                $driver = get_class(\Cache::driver());
+                $store = get_class(\Cache::getStore());
+                $this->extra['Cache'] = array($driver, $store);
+                $this->interfaces['\Illuminate\Cache\StoreInterface'] = $store;
+            }
+        }catch (\Exception $e) {}
+
+        try{
+            if (class_exists('Queue')) {
+                $class = get_class(\Queue::connection());
+                $this->extra['Queue'] = array($class);
+                $this->interfaces['\Illuminate\Queue\QueueInterface'] = $class;
+            }
+        }catch (\Exception $e) {}
+
+        try{
+            if (class_exists('SSH')){
+                $class = get_class(\SSH::connection());
+                $this->extra['SSH'] = array($class);
+                $this->interfaces['\Illuminate\Remote\ConnectionInterface'] = $class;
+            }
+        }catch (\Exception $e) {}
+
+        // Make all interface classes absolute
+        foreach ($this->interfaces as &$interface) {
+            $interface = '\\' . ltrim($interface, '\\');
+        }
+    }
+
+    /**
+     * Find all namespaces/aliases that are valid for us to render
+     *
+     * @return array
+     */
+    protected function getNamespaces()
+    {
+        $namespaces = array();
+
+        // Get all aliases
+        foreach (AliasLoader::getInstance()->getAliases() as $name => $facade) {
+            $magicMethods = array_key_exists($name, $this->magic) ? $this->magic[$name] : array();
+            $alias = new Alias($name, $facade, $magicMethods, $this->interfaces);
+            if ($alias->isValid()) {
+
+                //Add extra methods, from other classes (magic static calls)
+                if (array_key_exists($name, $this->extra)) {
+                    $alias->addClass($this->extra[$name]);
+                }
+
+                $namespace = $alias->getNamespace();
+                if (!isset($namespaces[$namespace])) {
+                    $namespaces[$namespace] = array();
+                }
+                $namespaces[$namespace][] = $alias;
+            }
+
+        }
+
+        return $namespaces;
+    }
+
+    /**
+     * Get the driver/connection/store from the managers
+     *
+     * @param $alias
+     * @return array|bool|string
+     */
+    public function getDriver($alias)
+    {
+        try {
+            if ($alias == "Auth") {
+                $driver = \Auth::driver();
+            } elseif ($alias == "DB") {
+                $driver = \DB::connection();
+            } elseif ($alias == "Cache") {
+                $driver = get_class(\Cache::driver());
+                $store = get_class(\Cache::getStore());
+                return array($driver, $store);
+            } elseif ($alias == "Queue") {
+                $driver = \Queue::connection();
+            } else {
+                return false;
+            }
+
+            return get_class($driver);
+        } catch (\Exception $e) {
+            $this->error("Could not determine driver/connection for $alias.");
+            return false;
+        }
+    }
+
+    /**
+     * Write a string as error output.
+     *
+     * @param  string  $string
+     * @return void
+     */
+    protected function error($string)
+    {
+        if($this->output){
+            $this->output->writeln("<error>$string</error>");
+        }else{
+            echo $string . "\r\n";
+        }
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/IdeHelperServiceProvider.php

@@ -0,0 +1,70 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use Illuminate\Support\ServiceProvider;
+use Barryvdh\LaravelIdeHelper\Console\GeneratorCommand;
+use Barryvdh\LaravelIdeHelper\Console\Generator2Command;
+Use Barryvdh\LaravelIdeHelper\Console\ModelsCommand;
+
+class IdeHelperServiceProvider extends ServiceProvider
+{
+
+    /**
+     * Indicates if loading of the provider is deferred.
+     *
+     * @var bool
+     */
+    protected $defer = true;
+
+    /**
+     * Bootstrap the application events.
+     *
+     * @return void
+     */
+    public function boot()
+    {
+        $this->package('barryvdh/laravel-ide-helper', 'laravel-ide-helper', __DIR__);
+    }
+
+    /**
+     * Register the service provider.
+     *
+     * @return void
+     */
+    public function register()
+    {
+        $this->app['command.ide-helper.generate'] = $this->app->share(
+            function ($app) {
+                return new GeneratorCommand($app['config'], $app['files'], $app['view']);
+            }
+        );
+
+        $this->app['command.ide-helper.models'] = $this->app->share(
+            function () {
+                return new ModelsCommand();
+            }
+        );
+
+        $this->commands('command.ide-helper.generate', 'command.ide-helper.models');
+    }
+
+    /**
+     * Get the services provided by the provider.
+     *
+     * @return array
+     */
+    public function provides()
+    {
+        return array('command.ide-helper.generate', 'command.ide-helper.models');
+    }
+
+}

vendor/barryvdh/laravel-ide-helper/src/Method.php

@@ -0,0 +1,300 @@
+<?php
+/**
+ * Laravel IDE Helper Generator
+ *
+ * @author    Barry vd. Heuvel <barryvdh@gmail.com>
+ * @copyright 2014 Barry vd. Heuvel / Fruitcake Studio (http://www.fruitcakestudio.nl)
+ * @license   http://www.opensource.org/licenses/mit-license.php MIT
+ * @link      https://github.com/barryvdh/laravel-ide-helper
+ */
+
+namespace Barryvdh\LaravelIdeHelper;
+
+use phpDocumentor\Reflection\DocBlock;
+use phpDocumentor\Reflection\DocBlock\Context;
+use phpDocumentor\Reflection\DocBlock\Tag;
+use phpDocumentor\Reflection\DocBlock\Tag\ReturnTag;
+use phpDocumentor\Reflection\DocBlock\Tag\ParamTag;
+use phpDocumentor\Reflection\DocBlock\Serializer as DocBlockSerializer;
+
+class Method
+{
+    /** @var \phpDocumentor\Reflection\DocBlock  */
+    protected $phpdoc;
+
+    /** @var \ReflectionMethod  */
+    protected $method;
+
+    protected $output = '';
+    protected $name;
+    protected $namespace;
+    protected $params = array();
+    protected $params_with_default = array();
+    protected $interfaces = array();
+    protected $return = null;
+
+    /**
+     * @param \ReflectionMethod $method
+     * @param string $alias
+     * @param string $class
+     * @param string|null $methodName
+     * @param array $interfaces
+     */
+    public function __construct(\ReflectionMethod $method, $alias, $class, $methodName = null, $interfaces = array())
+    {
+        $this->method = $method;
+        $this->interfaces = $interfaces;
+        $this->name = $methodName ?: $method->name;
+        $this->namespace = $method->getDeclaringClass()->getNamespaceName();
+
+        //Create a DocBlock and serializer instance
+        $this->phpdoc = new DocBlock($method, new Context($this->namespace));
+
+        //Normalize the description and inherit the docs from parents/interfaces
+        try {
+            $this->normalizeDescription();
+            $this->normalizeParams();
+            $this->normalizeReturn();
+        } catch (\Exception $e) {}
+
+        //Get the parameters, including formatted default values
+        $this->getParameters($method);
+
+        //Make the method static
+        $this->phpdoc->appendTag(Tag::createInstance('@static', $this->phpdoc));
+
+        //Reference the 'real' function in the declaringclass
+        $declaringClass = $method->getDeclaringClass();
+        $this->declaringClassName = '\\' . ltrim($declaringClass->name, '\\');
+        $this->root = '\\' . ltrim($class->getName(), '\\');
+    }
+
+    /**
+     * Get the class wherein the function resides
+     *
+     * @return string
+     */
+    public function getDeclaringClass()
+    {
+        return $this->declaringClassName;
+    }
+
+    /**
+     * Return the class from which this function would be called
+     *
+     * @return string
+     */
+    public function getRoot()
+    {
+        return $this->root;
+    }
+
+    /**
+     * Get the docblock for this method
+     *
+     * @param string $prefix
+     * @return mixed
+     */
+    public function getDocComment($prefix = "\t\t")
+    {
+        $serializer = new DocBlockSerializer(1, $prefix);
+        return $serializer->getDocComment($this->phpdoc);
+    }
+
+    /**
+     * Get the method name
+     *
+     * @return string
+     */
+    public function getName()
+    {
+        return $this->name;
+    }
+
+    /**
+     * Get the parameters for this method
+     *
+     * @param bool $implode Wether to implode the array or not
+     * @return string
+     */
+    public function getParams($implode = true)
+    {
+        return $implode ? implode(', ', $this->params) : $this->params;
+    }
+
+    /**
+     * Get the parameters for this method including default values
+     *
+     * @param bool $implode Wether to implode the array or not
+     * @return string
+     */
+    public function getParamsWithDefault($implode = true)
+    {
+        return $implode ? implode(', ', $this->params_with_default) : $this->params_with_default;
+    }
+
+    /**
+     * Get the description and get the inherited docs.
+     *
+     */
+    protected function normalizeDescription()
+    {
+        //Get the short + long description from the DocBlock
+        $description = $this->phpdoc->getText();
+
+        //Loop through parents/interfaces, to fill in {@inheritdoc}
+        if (strpos($description, '{@inheritdoc}') !== false) {
+            $inheritdoc = $this->getInheritDoc($this->method);
+            $inheritDescription = $inheritdoc->getText();
+
+            $description = str_replace('{@inheritdoc}', $inheritDescription, $description);
+            $this->phpdoc->setText($description);
+
+            //Add the tags that are inherited
+            $inheritTags = $inheritdoc->getTags();
+            if ($inheritTags) {
+                foreach ($inheritTags as $tag) {
+                    $tag->setDocBlock();
+                    $this->phpdoc->appendTag($tag);
+                }
+            }
+        }
+    }
+
+    /**
+     * Normalize the parameters
+     */
+    protected function normalizeParams()
+    {
+        //Get the return type and adjust them for beter autocomplete
+        $paramTags = $this->phpdoc->getTagsByName('param');
+        if ($paramTags) {
+            /** @var ParamTag $tag */
+            foreach($paramTags as $tag){
+                // Convert the keywords
+                $content = $this->convertKeywords($tag->getContent());
+                $tag->setContent($content);
+
+                // Get the expanded type and re-set the content
+                $content = $tag->getType() . ' ' . $tag->getVariableName() . ' ' . $tag->getDescription();
+                $tag->setContent(trim($content));
+            }
+        }
+    }
+
+    /**
+     * Normalize the return tag (make full namespace, replace interfaces)
+     */
+    protected function normalizeReturn()
+    {
+        //Get the return type and adjust them for beter autocomplete
+        $returnTags = $this->phpdoc->getTagsByName('return');
+        if ($returnTags) {
+            /** @var ReturnTag $tag */
+            $tag = reset($returnTags);
+            // Get the expanded type
+            $returnValue = $tag->getType();
+
+            // Replace the interfaces
+            foreach($this->interfaces as $interface => $real){
+                $returnValue = str_replace($interface, $real, $returnValue);
+            }
+
+            // Set the changed content
+            $tag->setContent($returnValue . ' ' . $tag->getDescription());
+            $this->return = $returnValue;
+        }else{
+            $this->return = null;
+        }
+    }
+
+    /**
+     * Convert keywwords that are incorrect.
+     *
+     * @param  string $string
+     * @return string
+     */
+    protected function convertKeywords($string)
+    {
+        $string = str_replace('\Closure', 'Closure', $string);
+        $string = str_replace('Closure', '\Closure', $string);
+        $string = str_replace('dynamic', 'mixed', $string);
+
+        return $string;
+    }
+
+    /**
+     * Should the function return a value?
+     *
+     * @return bool
+     */
+    public function shouldReturn()
+    {
+        if($this->return !== "void" && $this->method->name !== "__construct"){
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * Get the parameters and format them correctly
+     *
+     * @param $method
+     * @return array
+     */
+    public function getParameters($method)
+    {
+        //Loop through the default values for paremeters, and make the correct output string
+        $params = array();
+        $paramsWithDefault = array();
+        foreach ($method->getParameters() as $param) {
+            $paramStr = '$' . $param->getName();
+            $params[] = $paramStr;
+            if ($param->isOptional()) {
+                $default = $param->getDefaultValue();
+                if (is_bool($default)) {
+                    $default = $default ? 'true' : 'false';
+                } elseif (is_array($default)) {
+                    $default = 'array()';
+                } elseif (is_null($default)) {
+                    $default = 'null';
+                } elseif (is_int($default)) {
+                    //$default = $default;
+                } else {
+                    $default = "'" . trim($default) . "'";
+                }
+                $paramStr .= " = $default";
+            }
+            $paramsWithDefault[] = $paramStr;
+        }
+
+        $this->params = $params;
+        $this->params_with_default = $paramsWithDefault;
+    }
+
+    /**
+     * @param \ReflectionMethod $reflectionMethod
+     * @return string
+     */
+    protected function getInheritDoc($reflectionMethod)
+    {
+        $parentClass = $reflectionMethod->getDeclaringClass()->getParentClass();
+
+        //Get either a parent or the interface
+        if ($parentClass) {
+            $method = $parentClass->getMethod($reflectionMethod->getName());
+        } else {
+            $method = $reflectionMethod->getPrototype();
+        }
+        if ($method) {
+            $phpdoc = new DocBlock($method);
+            if (strpos($phpdoc->getText(), '{@inheritdoc}') !== false) {
+                //Not at the end yet, try another parent/interface..
+                return $this->getInheritDoc($method);
+            } else {
+                return $phpdoc;
+            }
+        }
+    }
+}

vendor/barryvdh/laravel-ide-helper/src/config/config.php

@@ -0,0 +1,78 @@
+<?php
+
+return array(
+
+    /*
+    |--------------------------------------------------------------------------
+    | Filename
+    |--------------------------------------------------------------------------
+    |
+    | The default path to the helper file
+    |
+    */
+
+    'filename' => '_ide_helper.php',
+
+    /*
+    |--------------------------------------------------------------------------
+    | Helper files to include
+    |--------------------------------------------------------------------------
+    |
+    | Include helper files. By default not included, but can be toggled with the
+    | -- helpers (-H) option. Extra helper files can be included.
+    |
+    */
+
+    'include_helpers' => false,
+
+    'helper_files' => array(
+        base_path().'/vendor/laravel/framework/src/Illuminate/Support/helpers.php',
+    ),
+
+    /*
+    |--------------------------------------------------------------------------
+    | Model locations to include
+    |--------------------------------------------------------------------------
+    |
+    | Define in which directories the ide-helper:models command should look
+    | for models.
+    |
+    */
+
+    'model_locations' => array(
+        'app/models',
+    ),
+
+
+    /*
+    |--------------------------------------------------------------------------
+    | Extra classes
+    |--------------------------------------------------------------------------
+    |
+    | These implementations are not really extended, but called with magic functions
+    |
+    */
+
+    'extra' => array(
+        'Artisan' => array('Illuminate\Foundation\Artisan'),
+        'Eloquent' => array('Illuminate\Database\Eloquent\Builder', 'Illuminate\Database\Query\Builder'),
+        'Session' => array('Illuminate\Session\Store'),
+    ),
+
+    'magic' => array(
+        'Log' => array(
+            'debug'     => 'Monolog\Logger::addDebug',
+            'info'      => 'Monolog\Logger::addInfo',
+            'notice'    => 'Monolog\Logger::addNotice',
+            'warning'   => 'Monolog\Logger::addWarning',
+            'error'     => 'Monolog\Logger::addError',
+            'critical'  => 'Monolog\Logger::addCritical',
+            'alert'     => 'Monolog\Logger::addAlert',
+            'emergency' => 'Monolog\Logger::addEmergency',
+        )
+    ),
+    'interfaces' => array(
+        '\Illuminate\Auth\UserInterface' => '\User',
+    )
+
+);

vendor/barryvdh/laravel-ide-helper/src/views/ide-helper.php

@@ -0,0 +1,39 @@
+<?= '<?php' ?>
+
+/**
+ * An helper file for Laravel 4, to provide autocomplete information to your IDE
+ * Generated for Laravel <?= $version ?> on <?= date("Y-m-d") ?>.
+ *
+ * @author Barry vd. Heuvel <barryvdh@gmail.com>
+ * @see https://github.com/barryvdh/laravel-ide-helper
+ */
+
+<?php foreach($namespaces as $namespace => $aliases): ?>
+namespace <?= $namespace == '__root' ? '' : $namespace ?>{
+<?php if($namespace == '__root'): ?>
+    exit("This file should not be included, only analyzed by your IDE");
+<?= $helpers ?>
+<?php endif; ?>
+<?php foreach($aliases as $alias): ?>
+
+    <?= $alias->getClassType() ?> <?= $alias->getAlias() ?> <?= $alias->getExtends() ? 'extends ' . $alias->getExtends() : '' ?>{
+        <?php foreach($alias->getMethods() as $method): ?>
+
+        <?= trim($method->getDocComment()) ?>
+
+        public static function <?= $method->getName() ?>(<?= $method->getParamsWithDefault() ?>){<?php if($method->getDeclaringClass() !== $method->getRoot()): ?>
+
+            //Method inherited from <?= $method->getDeclaringClass() ?>
+            <?php endif; ?>
+
+            <?= $method->shouldReturn() ? 'return ': '' ?><?= $method->getRoot() ?>::<?= $method->getName() ?>(<?= $method->getParams() ?>);
+        }
+        <?php endforeach; ?>
+
+    }
+
+<?php endforeach; ?>
+
+}
+
+<?php endforeach; ?>

vendor/dompdf/dompdf/.gitattributes

@@ -0,0 +1,13 @@
+*.json  text
+*.xml		text
+*.php		text
+*.LGPL	text
+*.md    text
+*.skel 	text
+*.css   text
+*.inc		text
+*.js    text
+*.html  text
+*.txt   text
+*.svg   text
+

vendor/dompdf/dompdf/.gitignore

@@ -0,0 +1,8 @@
+.DS_Store
+composer.lock
+vendor
+.idea
+.project
+lib/fonts/*.afm.php
+lib/fonts/*.ufm.php
+lib/fonts/log.htm

vendor/dompdf/dompdf/.gitmodules

@@ -0,0 +1,3 @@
+[submodule "lib/php-font-lib"]
+	path = lib/php-font-lib
+	url = https://github.com/PhenX/php-font-lib.git

vendor/dompdf/dompdf/CONTRIBUTING.md

@@ -0,0 +1,76 @@
+# How to contribute
+
+- [Getting help](#getting-help)
+- [Submitting bug reports](#submitting-bug-reports)
+- [Contributing code](#contributing-code)
+
+## Getting help
+
+Community discussion, questions, and informal bug reporting is done on the
+[dompdf Google group](http://groups.google.com/group/dompdf). You may also 
+seek help on
+[StackOverflow](http://stackoverflow.com/questions/tagged/dompdf).
+
+## Submitting bug reports
+
+The preferred way to report bugs is to use the
+[GitHub issue tracker](http://github.com/dompdf/dompdf/issues). Before 
+reporting a bug, read these pointers.
+
+**Please search inside the bug tracker to see if the bug you found is not already reported.**
+
+**Note:** The issue tracker is for *bugs* and *feature requests*, not requests for help.
+Questions should be asked on the
+[dompdf Google group](http://groups.google.com/group/dompdf) instead.
+
+### Reporting bugs effectively
+
+- dompdf is maintained by volunteers. They don't owe you anything, so be
+  polite. Reports with an indignant or belligerent tone tend to be moved to the
+  bottom of the pile.
+
+- Include information about **the PHP version on which the problem occurred**. Even
+  if you tested several PHP version on different servers, and the problem occurred
+  in all of them, mention this fact in the bug report.
+  Also include the operating system it's installed on. PHP configuration can also help,
+  and server error logs (like Apache logs)
+
+- Mention which release of dompdf you're using (the zip, the master branch, etc).
+  Preferably, try also with the current development snapshot, to ensure the
+  problem has not already been fixed.
+
+- Mention very precisely what went wrong. "X is broken" is not a good bug
+  report. What did you expect to happen? What happened instead? Describe the
+  exact steps a maintainer has to take to make the problem occur. We can not
+  fix something that we can not observe.
+
+- If the problem can not be reproduced in any of the demos included in the
+  dompdf distribution, please provide an HTML document that demonstrates
+  the problem. There are a few options to show us your code:
+   - [JS Fiddle](http://jsfiddle.net/)
+   - [dompdf debug helper](http://eclecticgeek.com/dompdf/debug.php) (provided by @bsweeney)
+   - Include the HTML/CSS inside the bug report, with
+   [code highlighting](https://github.com/adam-p/markdown-here/wiki/Markdown-Cheatsheet#wiki-code).
+
+## Contributing code
+
+- Make sure you have a [GitHub Account](https://github.com/signup/free)
+- Fork [dompdf](https://github.com/dompdf/dompdf/)
+  ([how to fork a repo](https://help.github.com/articles/fork-a-repo))
+- *Make your changes on the dev branch* or the most appropriate feature branch. Please only patch 
+  the master branch if you are attempting to address an urgent bug in the released code.
+- Add a simple test file in `www/test/`, with a comprehensive name.
+- Submit a pull request
+([how to create a pull request](https://help.github.com/articles/fork-a-repo))
+
+### Coding standards
+
+- 2 spaces per indentation level, no tabs.
+- spaces inside `if` like this:
+```php
+if ( $foo == "bar" ) {
+  //
+}
+```
+- booleans in lowercase
+- opening braces *always* on the same line

vendor/dompdf/dompdf/LICENSE.LGPL

@@ -0,0 +1,456 @@
+		  GNU LESSER GENERAL PUBLIC LICENSE
+		       Version 2.1, February 1999
+
+ Copyright (C) 1991, 1999 Free Software Foundation, Inc.
+     59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+[This is the first released version of the Lesser GPL.  It also counts
+ as the successor of the GNU Library Public License, version 2, hence
+ the version number 2.1.]
+
+			    Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+Licenses are intended to guarantee your freedom to share and change
+free software--to make sure the software is free for all its users.
+
+  This license, the Lesser General Public License, applies to some
+specially designated software packages--typically libraries--of the
+Free Software Foundation and other authors who decide to use it.  You
+can use it too, but we suggest you first think carefully about whether
+this license or the ordinary General Public License is the better
+strategy to use in any particular case, based on the explanations below.
+
+  When we speak of free software, we are referring to freedom of use,
+not price.  Our General Public Licenses are designed to make sure that
+you have the freedom to distribute copies of free software (and charge
+for this service if you wish); that you receive source code or can get
+it if you want it; that you can change the software and use pieces of
+it in new free programs; and that you are informed that you can do
+these things.
+
+  To protect your rights, we need to make restrictions that forbid
+distributors to deny you these rights or to ask you to surrender these
+rights.  These restrictions translate to certain responsibilities for
+you if you distribute copies of the library or if you modify it.
+
+  For example, if you distribute copies of the library, whether gratis
+or for a fee, you must give the recipients all the rights that we gave
+you.  You must make sure that they, too, receive or can get the source
+code.  If you link other code with the library, you must provide
+complete object files to the recipients, so that they can relink them
+with the library after making changes to the library and recompiling
+it.  And you must show them these terms so they know their rights.
+
+  We protect your rights with a two-step method: (1) we copyright the
+library, and (2) we offer you this license, which gives you legal
+permission to copy, distribute and/or modify the library.
+
+  To protect each distributor, we want to make it very clear that
+there is no warranty for the free library.  Also, if the library is
+modified by someone else and passed on, the recipients should know
+that what they have is not the original version, so that the original
+author's reputation will not be affected by problems that might be
+introduced by others.
+
+  Finally, software patents pose a constant threat to the existence of
+any free program.  We wish to make sure that a company cannot
+effectively restrict the users of a free program by obtaining a
+restrictive license from a patent holder.  Therefore, we insist that
+any patent license obtained for a version of the library must be
+consistent with the full freedom of use specified in this license.
+
+  Most GNU software, including some libraries, is covered by the
+ordinary GNU General Public License.  This license, the GNU Lesser
+General Public License, applies to certain designated libraries, and
+is quite different from the ordinary General Public License.  We use
+this license for certain libraries in order to permit linking those
+libraries into non-free programs.
+
+  When a program is linked with a library, whether statically or using
+a shared library, the combination of the two is legally speaking a
+combined work, a derivative of the original library.  The ordinary
+General Public License therefore permits such linking only if the
+entire combination fits its criteria of freedom.  The Lesser General
+Public License permits more lax criteria for linking other code with
+the library.
+
+  We call this license the "Lesser" General Public License because it
+does Less to protect the user's freedom than the ordinary General
+Public License.  It also provides other free software developers Less
+of an advantage over competing non-free programs.  These disadvantages
+are the reason we use the ordinary General Public License for many
+libraries.  However, the Lesser license provides advantages in certain
+special circumstances.
+
+  For example, on rare occasions, there may be a special need to
+encourage the widest possible use of a certain library, so that it becomes
+a de-facto standard.  To achieve this, non-free programs must be
+allowed to use the library.  A more frequent case is that a free
+library does the same job as widely used non-free libraries.  In this
+case, there is little to gain by limiting the free library to free
+software only, so we use the Lesser General Public License.
+
+  In other cases, permission to use a particular library in non-free
+programs enables a greater number of people to use a large body of
+free software.  For example, permission to use the GNU C Library in
+non-free programs enables many more people to use the whole GNU
+operating system, as well as its variant, the GNU/Linux operating
+system.
+
+  Although the Lesser General Public License is Less protective of the
+users' freedom, it does ensure that the user of a program that is
+linked with the Library has the freedom and the wherewithal to run
+that program using a modified version of the Library.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.  Pay close attention to the difference between a
+"work based on the library" and a "work that uses the library".  The
+former contains code derived from the library, whereas the latter must
+be combined with the library in order to run.
+
+		  GNU LESSER GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License Agreement applies to any software library or other
+program which contains a notice placed by the copyright holder or
+other authorized party saying it may be distributed under the terms of
+this Lesser General Public License (also called "this License").
+Each licensee is addressed as "you".
+
+  A "library" means a collection of software functions and/or data
+prepared so as to be conveniently linked with application programs
+(which use some of those functions and data) to form executables.
+
+  The "Library", below, refers to any such software library or work
+which has been distributed under these terms.  A "work based on the
+Library" means either the Library or any derivative work under
+copyright law: that is to say, a work containing the Library or a
+portion of it, either verbatim or with modifications and/or translated
+straightforwardly into another language.  (Hereinafter, translation is
+included without limitation in the term "modification".)
+
+  "Source code" for a work means the preferred form of the work for
+making modifications to it.  For a library, complete source code means
+all the source code for all modules it contains, plus any associated
+interface definition files, plus the scripts used to control compilation
+and installation of the library.
+
+  Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running a program using the Library is not restricted, and output from
+such a program is covered only if its contents constitute a work based
+on the Library (independent of the use of the Library in a tool for
+writing it).  Whether that is true depends on what the Library does
+and what the program that uses the Library does.
+  
+  1. You may copy and distribute verbatim copies of the Library's
+complete source code as you receive it, in any medium, provided that
+you conspicuously and appropriately publish on each copy an
+appropriate copyright notice and disclaimer of warranty; keep intact
+all the notices that refer to this License and to the absence of any
+warranty; and distribute a copy of this License along with the
+Library.
+
+  You may charge a fee for the physical act of transferring a copy,
+and you may at your option offer warranty protection in exchange for a
+fee.
+
+  2. You may modify your copy or copies of the Library or any portion
+of it, thus forming a work based on the Library, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) The modified work must itself be a software library.
+
+    b) You must cause the files modified to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    c) You must cause the whole of the work to be licensed at no
+    charge to all third parties under the terms of this License.
+
+    d) If a facility in the modified Library refers to a function or a
+    table of data to be supplied by an application program that uses
+    the facility, other than as an argument passed when the facility
+    is invoked, then you must make a good faith effort to ensure that,
+    in the event an application does not supply such function or
+    table, the facility still operates, and performs whatever part of
+    its purpose remains meaningful.
+
+    (For example, a function in a library to compute square roots has
+    a purpose that is entirely well-defined independent of the
+    application.  Therefore, Subsection 2d requires that any
+    application-supplied function or table used by this function must
+    be optional: if the application does not supply it, the square
+    root function must still compute square roots.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Library,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Library, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote
+it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Library.
+
+In addition, mere aggregation of another work not based on the Library
+with the Library (or with a work based on the Library) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may opt to apply the terms of the ordinary GNU General Public
+License instead of this License to a given copy of the Library.  To do
+this, you must alter all the notices that refer to this License, so
+that they refer to the ordinary GNU General Public License, version 2,
+instead of to this License.  (If a newer version than version 2 of the
+ordinary GNU General Public License has appeared, then you can specify
+that version instead if you wish.)  Do not make any other change in
+these notices.
+
+  Once this change is made in a given copy, it is irreversible for
+that copy, so the ordinary GNU General Public License applies to all
+subsequent copies and derivative works made from that copy.
+
+  This option is useful when you wish to copy part of the code of
+the Library into a program that is not a library.
+
+  4. You may copy and distribute the Library (or a portion or
+derivative of it, under Section 2) in object code or executable form
+under the terms of Sections 1 and 2 above provided that you accompany
+it with the complete corresponding machine-readable source code, which
+must be distributed under the terms of Sections 1 and 2 above on a
+medium customarily used for software interchange.
+
+  If distribution of object code is made by offering access to copy
+from a designated place, then offering equivalent access to copy the
+source code from the same place satisfies the requirement to
+distribute the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  5. A program that contains no derivative of any portion of the
+Library, but is designed to work with the Library by being compiled or
+linked with it, is called a "work that uses the Library".  Such a
+work, in isolation, is not a derivative work of the Library, and
+therefore falls outside the scope of this License.
+
+  However, linking a "work that uses the Library" with the Library
+creates an executable that is a derivative of the Library (because it
+contains portions of the Library), rather than a "work that uses the
+library".  The executable is therefore covered by this License.
+Section 6 states terms for distribution of such executables.
+
+  When a "work that uses the Library" uses material from a header file
+that is part of the Library, the object code for the work may be a
+derivative work of the Library even though the source code is not.
+Whether this is true is especially significant if the work can be
+linked without the Library, or if the work is itself a library.  The
+threshold for this to be true is not precisely defined by law.
+
+  If such an object file uses only numerical parameters, data
+structure layouts and accessors, and small macros and small inline
+functions (ten lines or less in length), then the use of the object
+file is unrestricted, regardless of whether it is legally a derivative
+work.  (Executables containing this object code plus portions of the
+Library will still fall under Section 6.)
+
+  Otherwise, if the work is a derivative of the Library, you may
+distribute the object code for the work under the terms of Section 6.
+Any executables containing that work also fall under Section 6,
+whether or not they are linked directly with the Library itself.
+
+  6. As an exception to the Sections above, you may also combine or
+link a "work that uses the Library" with the Library to produce a
+work containing portions of the Library, and distribute that work
+under terms of your choice, provided that the terms permit
+modification of the work for the customer's own use and reverse
+engineering for debugging such modifications.
+
+  You must give prominent notice with each copy of the work that the
+Library is used in it and that the Library and its use are covered by
+this License.  You must supply a copy of this License.  If the work
+during execution displays copyright notices, you must include the
+copyright notice for the Library among them, as well as a reference
+directing the user to the copy of this License.  Also, you must do one
+of these things:
+
+    a) Accompany the work with the complete corresponding
+    machine-readable source code for the Library including whatever
+    changes were used in the work (which must be distributed under
+    Sections 1 and 2 above); and, if the work is an executable linked
+    with the Library, with the complete machine-readable "work that
+    uses the Library", as object code and/or source code, so that the
+    user can modify the Library and then relink to produce a modified
+    executable containing the modified Library.  (It is understood
+    that the user who changes the contents of definitions files in the
+    Library will not necessarily be able to recompile the application
+    to use the modified definitions.)
+
+    b) Use a suitable shared library mechanism for linking with the
+    Library.  A suitable mechanism is one that (1) uses at run time a
+    copy of the library already present on the user's computer system,
+    rather than copying library functions into the executable, and (2)
+    will operate properly with a modified version of the library, if
+    the user installs one, as long as the modified version is
+    interface-compatible with the version that the work was made with.
+
+    c) Accompany the work with a written offer, valid for at
+    least three years, to give the same user the materials
+    specified in Subsection 6a, above, for a charge no more
+    than the cost of performing this distribution.
+
+    d) If distribution of the work is made by offering access to copy
+    from a designated place, offer equivalent access to copy the above
+    specified materials from the same place.
+
+    e) Verify that the user has already received a copy of these
+    materials or that you have already sent this user a copy.
+
+  For an executable, the required form of the "work that uses the
+Library" must include any data and utility programs needed for
+reproducing the executable from it.  However, as a special exception,
+the materials to be distributed need not include anything that is
+normally distributed (in either source or binary form) with the major
+components (compiler, kernel, and so on) of the operating system on
+which the executable runs, unless that component itself accompanies
+the executable.
+
+  It may happen that this requirement contradicts the license
+restrictions of other proprietary libraries that do not normally
+accompany the operating system.  Such a contradiction means you cannot
+use both them and the Library together in an executable that you
+distribute.
+
+  7. You may place library facilities that are a work based on the
+Library side-by-side in a single library together with other library
+facilities not covered by this License, and distribute such a combined
+library, provided that the separate distribution of the work based on
+the Library and of the other library facilities is otherwise
+permitted, and provided that you do these two things:
+
+    a) Accompany the combined library with a copy of the same work
+    based on the Library, uncombined with any other library
+    facilities.  This must be distributed under the terms of the
+    Sections above.
+
+    b) Give prominent notice with the combined library of the fact
+    that part of it is a work based on the Library, and explaining
+    where to find the accompanying uncombined form of the same work.
+
+  8. You may not copy, modify, sublicense, link with, or distribute
+the Library except as expressly provided under this License.  Any
+attempt otherwise to copy, modify, sublicense, link with, or
+distribute the Library is void, and will automatically terminate your
+rights under this License.  However, parties who have received copies,
+or rights, from you under this License will not have their licenses
+terminated so long as such parties remain in full compliance.
+
+  9. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Library or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Library (or any work based on the
+Library), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Library or works based on it.
+
+  10. Each time you redistribute the Library (or any work based on the
+Library), the recipient automatically receives a license from the
+original licensor to copy, distribute, link with or modify the Library
+subject to these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties with
+this License.
+
+  11. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Library at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Library by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Library.
+
+If any portion of this section is held invalid or unenforceable under any
+particular circumstance, the balance of the section is intended to apply,
+and the section as a whole is intended to apply in other circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  12. If the distribution and/or use of the Library is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Library under this License may add
+an explicit geographical distribution limitation excluding those countries,
+so that distribution is permitted only in or among countries not thus
+excluded.  In such case, this License incorporates the limitation as if
+written in the body of this License.
+
+  13. The Free Software Foundation may publish revised and/or new
+versions of the Lesser General Public License from time to time.
+Such new versions will be similar in spirit to the present version,
+but may differ in detail to address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Library
+specifies a version number of this License which applies to it and
+"any later version", you have the option of following the terms and
+conditions either of that version or of any later version published by
+the Free Software Foundation.  If the Library does not specify a
+license version number, you may choose any version ever published by
+the Free Software Foundation.
+
+  14. If you wish to incorporate parts of the Library into other free
+programs whose distribution conditions are incompatible with these,
+write to the author to ask for permission.  For software which is
+copyrighted by the Free Software Foundation, write to the Free
+Software Foundation; we sometimes make exceptions for this.  Our
+decision will be guided by the two goals of preserving the free status
+of all derivatives of our free software and of promoting the sharing
+and reuse of software generally.
+
+			    NO WARRANTY
+
+  15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO
+WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW.
+EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR
+OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY
+KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE.  THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE
+LIBRARY IS WITH YOU.  SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME
+THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+  16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN
+WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY
+AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU
+FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR
+CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE
+LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING
+RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A
+FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF
+SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH
+DAMAGES.

vendor/dompdf/dompdf/README.md

@@ -0,0 +1,133 @@
+[![Latest Stable Version](https://poser.pugx.org/dompdf/dompdf/v/stable.png)](https://packagist.org/packages/dompdf/dompdf) [![Total Downloads](https://poser.pugx.org/dompdf/dompdf/downloads.png)](https://packagist.org/packages/dompdf/dompdf) [![Latest Unstable Version](https://poser.pugx.org/dompdf/dompdf/v/unstable.png)](https://packagist.org/packages/dompdf/dompdf) [![License](https://poser.pugx.org/dompdf/dompdf/license.png)](https://packagist.org/packages/dompdf/dompdf)
+
+**dompdf is an HTML to PDF converter**.
+At its heart, dompdf is (mostly) [CSS 2.1](http://www.w3.org/TR/CSS2/) compliant
+HTML layout and rendering engine written in PHP. It is a style-driven renderer:
+it will download and read external stylesheets, inline style tags, and the style
+attributes of individual HTML elements. It also supports most presentational
+HTML attributes.
+
+----
+
+**Check out the [Demo](http://pxd.me/dompdf/www/examples.php) and ask any
+question on [StackOverflow](http://stackoverflow.com/questions/tagged/dompdf) or
+on the [Google Groups](http://groups.google.com/group/dompdf)**
+
+----
+
+[![Follow us on Twitter](http://twitter-badges.s3.amazonaws.com/twitter-a.png)](http://www.twitter.com/dompdf)
+[![Follow us on Google+](https://ssl.gstatic.com/images/icons/gplus-32.png)](https://plus.google.com/108710008521858993320?prsrc=3)
+
+Features
+========
+ * handles most CSS 2.1 and a few CSS3 properties, including @import, @media &
+   @page rules
+ * supports most presentational HTML 4.0 attributes
+ * supports external stylesheets, either local or through http/ftp (via
+   fopen-wrappers)
+ * supports complex tables, including row & column spans, separate & collapsed
+   border models, individual cell styling
+ * image support (gif, png (8, 24 and 32 bit with alpha channel), bmp & jpeg)
+ * no dependencies on external PDF libraries, thanks to the R&OS PDF class
+ * inline PHP support
+ 
+Requirements
+============
+ * PHP 5.0+ (5.3+ recommended)
+ * DOM extension
+ * GD extension
+
+Recommendations
+============
+ * MBString extension: provides internationalization support. This extension is
+   *not* enabled by default. dompdf has limited internationalization support
+   when this extension is not enabled.
+ * opcache (OPcache, XCache, APC, etc.): improves performance
+
+About Fonts & Character Encoding
+============
+PDF documents internally support the following fonts: Helvetica, Times-Roman,
+Courier, Zapf-Dingbats, & Symbol. These fonts only support Windows ANSI
+encoding. In order for a PDF to display characters that are not available in
+Windows ANSI you must supply an external font. dompdf will embed any referenced
+font in the PDF so long as it has been pre-loaded or is accessible to dompdf and
+reference in CSS @font-face rules. See the
+[font overview](https://github.com/dompdf/dompdf/wiki/About-Fonts-and-Character-Encoding)
+for more information on how to use fonts.
+
+The [DejaVu TrueType fonts](http://dejavu-fonts.org) have been pre-installed to
+give dompdf decent Unicode character coverage by default. To use the DejaVu
+fonts reference the font in your stylesheet, e.g. `body { font-family: DejaVu
+Sans; }` (for DejaVu Sans).
+
+Easy Installation
+============
+Install with git
+---
+From the command line switch to the directory where dompdf will reside and run
+the following commands:
+
+```sh
+git clone https://github.com/dompdf/dompdf.git .
+git submodule init
+git submodule update
+```
+
+Install with composer
+---
+To install with Composer, simply add the requirement to your `composer.json`
+file:
+
+```json
+{
+  "require" : {
+    "dompdf/dompdf" : "0.6.*"
+  }
+}
+```
+
+And run Composer to update your dependencies:
+
+```bash
+$ curl -sS http://getcomposer.org/installer | php
+$ php composer.phar update
+```
+    
+Before you can use the Composer installation of DOMPDF in your application you
+must disable dompdf's default auto-loader, include the Composer autoloader, and
+load the dompdf configuration file:
+
+```php
+// somewhere early in your project's loading, require the Composer autoloader
+// see: http://getcomposer.org/doc/00-intro.md
+require 'vendor/autoload.php';
+
+// disable DOMPDF's internal autoloader if you are using Composer
+define('DOMPDF_ENABLE_AUTOLOAD', false);
+
+// include DOMPDF's default configuration
+require_once '/path/to/vendor/dompdf/dompdf/dompdf_config.inc.php';
+```
+
+Download and install
+---
+Download an archive of dompdf and extract it into the directory where dompdf
+will reside
+ * You can download stable copies of dompdf from
+   https://github.com/dompdf/dompdf/tags
+ * Or download a nightly (the latest, unreleased code) from
+   http://eclecticgeek.com/dompdf
+
+Limitations (Known Issues)
+==========================
+ * not particularly tolerant to poorly-formed HTML input. To avoid any
+   unexpected rendering issues you should either enable the built-in HTML5
+   parser (via the `DOMPDF_ENABLE_HTML5PARSER` configuration constant) or run
+   your HTML through a HTML validator/cleaner (such as Tidy).
+ * large files or large tables can take a while to render
+ * CSS float is not supported (but is in the works, enable it through the
+   `DOMPDF_ENABLE_CSS_FLOAT` configuration constant).
+ 
+If you find this project useful, please consider making a donation.
+(Any funds donated will be used to help further development on this project.)	
+[![Donate button](https://www.paypal.com/en_US/i/btn/btn_donate_SM.gif)](http://goo.gl/DSvWf)

vendor/dompdf/dompdf/composer.json

@@ -0,0 +1,23 @@
+{
+    "name": "dompdf/dompdf",
+    "type": "library",
+    "description": "DOMPDF is a CSS 2.1 compliant HTML to PDF converter",
+    "homepage": "https://github.com/dompdf/dompdf",
+    "license": "LGPL",
+    "authors": [
+        {
+            "name": "Fabien Ménager",
+            "email": "fabien.menager@gmail.com"
+        },
+        {
+            "name": "Brian Sweeney",
+            "email": "eclecticgeek@gmail.com"
+        }
+    ],
+    "autoload": {
+        "classmap": ["include/"]
+    },
+    "require": {
+        "phenx/php-font-lib": "0.2.*"
+    }
+}

vendor/dompdf/dompdf/dompdf.php

@@ -0,0 +1,279 @@
+<?php
+/**
+ * Command line utility to use dompdf.
+ * Can also be used with HTTP GET parameters
+ * 
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Display command line usage
+ */
+function dompdf_usage() {
+  $default_paper_size = DOMPDF_DEFAULT_PAPER_SIZE;
+  
+  echo <<<EOD
+  
+Usage: {$_SERVER["argv"][0]} [options] html_file
+
+html_file can be a filename, a url if fopen_wrappers are enabled, or the '-' character to read from standard input.
+
+Options:
+ -h             Show this message
+ -l             List available paper sizes
+ -p size        Paper size; something like 'letter', 'A4', 'legal', etc.  
+                  The default is '$default_paper_size'
+ -o orientation Either 'portrait' or 'landscape'.  Default is 'portrait'
+ -b path        Set the 'document root' of the html_file.  
+                  Relative urls (for stylesheets) are resolved using this directory.  
+                  Default is the directory of html_file.
+ -f file        The output filename.  Default is the input [html_file].pdf
+ -v             Verbose: display html parsing warnings and file not found errors.
+ -d             Very verbose: display oodles of debugging output: every frame 
+                  in the tree printed to stdout.
+ -t             Comma separated list of debugging types (page-break,reflow,split)
+ 
+EOD;
+exit;
+}
+
+/**
+ * Parses command line options
+ * 
+ * @return array The command line options
+ */
+function getoptions() {
+
+  $opts = array();
+
+  if ( $_SERVER["argc"] == 1 )
+    return $opts;
+
+  $i = 1;
+  while ($i < $_SERVER["argc"]) {
+
+    switch ($_SERVER["argv"][$i]) {
+
+    case "--help":
+    case "-h":
+      $opts["h"] = true;
+      $i++;
+      break;
+
+    case "-l":
+      $opts["l"] = true;
+      $i++;
+      break;
+
+    case "-p":
+      if ( !isset($_SERVER["argv"][$i+1]) )
+        die("-p switch requires a size parameter\n");
+      $opts["p"] = $_SERVER["argv"][$i+1];
+      $i += 2;
+      break;
+
+    case "-o":
+      if ( !isset($_SERVER["argv"][$i+1]) )
+        die("-o switch requires an orientation parameter\n");
+      $opts["o"] = $_SERVER["argv"][$i+1];
+      $i += 2;
+      break;
+
+    case "-b":
+      if ( !isset($_SERVER["argv"][$i+1]) )
+        die("-b switch requires a path parameter\n");
+      $opts["b"] = $_SERVER["argv"][$i+1];
+      $i += 2;
+      break;
+
+    case "-f":
+      if ( !isset($_SERVER["argv"][$i+1]) )
+        die("-f switch requires a filename parameter\n");
+      $opts["f"] = $_SERVER["argv"][$i+1];
+      $i += 2;
+      break;
+
+    case "-v":
+      $opts["v"] = true;
+      $i++;
+      break;
+
+    case "-d":
+      $opts["d"] = true;
+      $i++;
+      break;
+
+    case "-t":
+      if ( !isset($_SERVER['argv'][$i + 1]) )
+        die("-t switch requires a comma separated list of types\n");
+      $opts["t"] = $_SERVER['argv'][$i+1];
+      $i += 2;
+      break;
+
+   default:
+      $opts["filename"] = $_SERVER["argv"][$i];
+      $i++;
+      break;
+    }
+
+  }
+  return $opts;
+}
+
+require_once("dompdf_config.inc.php");
+global $_dompdf_show_warnings, $_dompdf_debug, $_DOMPDF_DEBUG_TYPES;
+
+$sapi = php_sapi_name();
+$options = array();
+
+$dompdf = new DOMPDF();
+
+switch ( $sapi ) {
+
+ case "cli":
+
+  $opts = getoptions();
+
+  if ( isset($opts["h"]) || (!isset($opts["filename"]) && !isset($opts["l"])) ) {
+    dompdf_usage();
+    exit;
+  }
+
+  if ( isset($opts["l"]) ) {
+    echo "\nUnderstood paper sizes:\n";
+
+    foreach (array_keys(CPDF_Adapter::$PAPER_SIZES) as $size)
+      echo "  " . mb_strtoupper($size) . "\n";
+    exit;
+  }
+  $file = $opts["filename"];
+
+  if ( isset($opts["p"]) )
+    $paper = $opts["p"];
+  else
+    $paper = DOMPDF_DEFAULT_PAPER_SIZE;
+
+  if ( isset($opts["o"]) )
+    $orientation = $opts["o"];
+  else
+    $orientation = "portrait";
+
+  if ( isset($opts["b"]) )
+    $base_path = $opts["b"];
+
+  if ( isset($opts["f"]) )
+    $outfile = $opts["f"];
+  else {
+    if ( $file === "-" )
+      $outfile = "dompdf_out.pdf";
+    else
+      $outfile = str_ireplace(array(".html", ".htm"), "", $file) . ".pdf";
+  }
+
+  if ( isset($opts["v"]) )
+    $_dompdf_show_warnings = true;
+
+  if ( isset($opts["d"]) ) {
+    $_dompdf_show_warnings = true;
+    $_dompdf_debug = true;
+  }
+
+  if ( isset($opts['t']) ) {
+    $arr = split(',',$opts['t']);
+    $types = array();
+    foreach ($arr as $type)
+      $types[ trim($type) ] = 1;
+    $_DOMPDF_DEBUG_TYPES = $types;
+  }
+  
+  $save_file = true;
+
+  break;
+
+ default:
+
+  $dompdf->set_option('enable_php', false);
+  
+  if ( isset($_GET["input_file"]) )
+    $file = rawurldecode($_GET["input_file"]);
+  else
+    throw new DOMPDF_Exception("An input file is required (i.e. input_file _GET variable).");
+  
+  if ( isset($_GET["paper"]) )
+    $paper = rawurldecode($_GET["paper"]);
+  else
+    $paper = DOMPDF_DEFAULT_PAPER_SIZE;
+  
+  if ( isset($_GET["orientation"]) )
+    $orientation = rawurldecode($_GET["orientation"]);
+  else
+    $orientation = "portrait";
+  
+  if ( isset($_GET["base_path"]) ) {
+    $base_path = rawurldecode($_GET["base_path"]);
+    $file = $base_path . $file; # Set the input file
+  }  
+  
+  if ( isset($_GET["options"]) ) {
+    $options = $_GET["options"];
+  }
+  
+  $file_parts = explode_url($file);
+  
+  $outfile = "dompdf_out.pdf"; # Don't allow them to set the output file
+  $save_file = false; # Don't save the file
+  
+  break;
+}
+
+if ( $file === "-" ) {
+  $str = "";
+  while ( !feof(STDIN) )
+    $str .= fread(STDIN, 4096);
+
+  $dompdf->load_html($str);
+
+} else
+  $dompdf->load_html_file($file);
+
+if ( isset($base_path) ) {
+  $dompdf->set_base_path($base_path);
+}
+
+$dompdf->set_paper($paper, $orientation);
+
+$dompdf->render();
+
+if ( $_dompdf_show_warnings ) {
+  global $_dompdf_warnings;
+  foreach ($_dompdf_warnings as $msg)
+    echo $msg . "\n";
+  echo $dompdf->get_canvas()->get_cpdf()->messages;
+  flush();
+}
+
+if ( $save_file ) {
+//   if ( !is_writable($outfile) )
+//     throw new DOMPDF_Exception("'$outfile' is not writable.");
+  if ( strtolower(DOMPDF_PDF_BACKEND) === "gd" )
+    $outfile = str_replace(".pdf", ".png", $outfile);
+
+  list($proto, $host, $path, $file) = explode_url($outfile);
+  if ( $proto != "" ) // i.e. not file://
+    $outfile = $file; // just save it locally, FIXME? could save it like wget: ./host/basepath/file
+
+  $outfile = realpath(dirname($outfile)) . DIRECTORY_SEPARATOR . basename($outfile);
+
+  if ( strpos($outfile, DOMPDF_CHROOT) !== 0 )
+    throw new DOMPDF_Exception("Permission denied.");
+
+  file_put_contents($outfile, $dompdf->output( array("compress" => 0) ));
+  exit(0);
+}
+
+if ( !headers_sent() ) {
+  $dompdf->stream($outfile, $options);
+}

vendor/dompdf/dompdf/dompdf_config.custom.inc.php

@@ -0,0 +1,41 @@
+<?php
+// Please refer to dompdf_config.inc.php for details on each configuration option.
+
+//define("DOMPDF_TEMP_DIR", "/tmp");
+//define("DOMPDF_FONT_DIR", DOMPDF_DIR."/lib/fonts/");
+//define("DOMPDF_FONT_CACHE", DOMPDF_DIR."/lib/fonts/");
+//define("DOMPDF_UNICODE_ENABLED", true);
+//define("DOMPDF_PDF_BACKEND", "PDFLib");
+//define("DOMPDF_DEFAULT_MEDIA_TYPE", "print");
+//define("DOMPDF_DEFAULT_PAPER_SIZE", "letter");
+//define("DOMPDF_DEFAULT_FONT", "serif");
+//define("DOMPDF_DPI", 72);
+//define("DOMPDF_ENABLE_CSS_FLOAT", true);
+//define("DOMPDF_ENABLE_JAVASCRIPT", false);
+//define("DEBUGPNG", true);
+//define("DEBUGKEEPTEMP", true);
+//define("DEBUGCSS", true);
+//define("DEBUG_LAYOUT", true);
+//define("DEBUG_LAYOUT_LINES", false);
+//define("DEBUG_LAYOUT_BLOCKS", false);
+//define("DEBUG_LAYOUT_INLINE", false);
+//define("DOMPDF_FONT_HEIGHT_RATIO", 1.0);
+//define("DEBUG_LAYOUT_PADDINGBOX", false);
+//define("DOMPDF_LOG_OUTPUT_FILE", DOMPDF_FONT_DIR."log.htm");
+//define("DOMPDF_ENABLE_HTML5PARSER", true);
+//define("DOMPDF_ENABLE_FONTSUBSETTING", true);
+
+// Authentication for the dompdf/www
+//define("DOMPDF_ADMIN_USERNAME", "user");
+//define("DOMPDF_ADMIN_PASSWORD", "password");
+
+/**
+ * Attention!
+ * The following settings may increase the risk of system exploit.
+ * Do not change these settings without understanding the consequences.
+ * Additional documentation is available on the dompdf wiki at:
+ * https://github.com/dompdf/dompdf/wiki
+ */
+//define("DOMPDF_CHROOT", DOMPDF_DIR);
+//define("DOMPDF_ENABLE_PHP", false);
+//define("DOMPDF_ENABLE_REMOTE", false);

vendor/dompdf/dompdf/dompdf_config.inc.php

@@ -0,0 +1,398 @@
+<?php
+
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @author   Brian Sweeney <eclecticgeek@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+if (class_exists('DOMPDF', false)) {
+  return;
+}
+
+PHP_VERSION >= 5.0 or die("DOMPDF requires PHP 5.0+");
+
+/**
+ * The root of your DOMPDF installation
+ */
+define("DOMPDF_DIR", str_replace(DIRECTORY_SEPARATOR, '/', realpath(dirname(__FILE__))));
+
+/**
+ * The location of the DOMPDF include directory
+ */
+define("DOMPDF_INC_DIR", DOMPDF_DIR . "/include");
+
+/**
+ * The location of the DOMPDF lib directory
+ */
+define("DOMPDF_LIB_DIR", DOMPDF_DIR . "/lib");
+
+/**
+ * Some installations don't have $_SERVER['DOCUMENT_ROOT']
+ * http://fyneworks.blogspot.com/2007/08/php-documentroot-in-iis-windows-servers.html
+ */
+if (!isset($_SERVER['DOCUMENT_ROOT'])) {
+  $path = "";
+
+  if (isset($_SERVER['SCRIPT_FILENAME']))
+    $path = $_SERVER['SCRIPT_FILENAME'];
+  elseif (isset($_SERVER['PATH_TRANSLATED']))
+    $path = str_replace('\\\\', '\\', $_SERVER['PATH_TRANSLATED']);
+
+  $_SERVER['DOCUMENT_ROOT'] = str_replace('\\', '/', substr($path, 0, 0 - strlen($_SERVER['PHP_SELF'])));
+}
+
+/** Include the custom config file if it exists */
+if (file_exists(DOMPDF_DIR . "/dompdf_config.custom.inc.php")) {
+  require_once(DOMPDF_DIR . "/dompdf_config.custom.inc.php");
+}
+
+//FIXME: Some function definitions rely on the constants defined by DOMPDF. However, might this location prove problematic?
+require_once(DOMPDF_INC_DIR . "/functions.inc.php");
+
+/**
+ * Username and password used by the configuration utility in www/
+ */
+def("DOMPDF_ADMIN_USERNAME", "user");
+def("DOMPDF_ADMIN_PASSWORD", "password");
+
+/**
+ * The location of the DOMPDF font directory
+ *
+ * The location of the directory where DOMPDF will store fonts and font metrics
+ * Note: This directory must exist and be writable by the webserver process.
+ * *Please note the trailing slash.*
+ *
+ * Notes regarding fonts:
+ * Additional .afm font metrics can be added by executing load_font.php from command line.
+ *
+ * Only the original "Base 14 fonts" are present on all pdf viewers. Additional fonts must
+ * be embedded in the pdf file or the PDF may not display correctly. This can significantly
+ * increase file size unless font subsetting is enabled. Before embedding a font please
+ * review your rights under the font license.
+ *
+ * Any font specification in the source HTML is translated to the closest font available
+ * in the font directory.
+ *
+ * The pdf standard "Base 14 fonts" are:
+ * Courier, Courier-Bold, Courier-BoldOblique, Courier-Oblique,
+ * Helvetica, Helvetica-Bold, Helvetica-BoldOblique, Helvetica-Oblique,
+ * Times-Roman, Times-Bold, Times-BoldItalic, Times-Italic,
+ * Symbol, ZapfDingbats.
+ */
+def("DOMPDF_FONT_DIR", DOMPDF_DIR . "/lib/fonts/");
+
+/**
+ * The location of the DOMPDF font cache directory
+ *
+ * This directory contains the cached font metrics for the fonts used by DOMPDF.
+ * This directory can be the same as DOMPDF_FONT_DIR
+ * 
+ * Note: This directory must exist and be writable by the webserver process.
+ */
+def("DOMPDF_FONT_CACHE", DOMPDF_FONT_DIR);
+
+/**
+ * The location of a temporary directory.
+ *
+ * The directory specified must be writeable by the webserver process.
+ * The temporary directory is required to download remote images and when
+ * using the PFDLib back end.
+ */
+def("DOMPDF_TEMP_DIR", sys_get_temp_dir());
+
+/**
+ * ==== IMPORTANT ====
+ *
+ * dompdf's "chroot": Prevents dompdf from accessing system files or other
+ * files on the webserver.  All local files opened by dompdf must be in a
+ * subdirectory of this directory.  DO NOT set it to '/' since this could
+ * allow an attacker to use dompdf to read any files on the server.  This
+ * should be an absolute path.
+ * This is only checked on command line call by dompdf.php, but not by
+ * direct class use like:
+ * $dompdf = new DOMPDF();	$dompdf->load_html($htmldata); $dompdf->render(); $pdfdata = $dompdf->output();
+ */
+def("DOMPDF_CHROOT", realpath(DOMPDF_DIR));
+
+/**
+ * Whether to use Unicode fonts or not.
+ *
+ * When set to true the PDF backend must be set to "CPDF" and fonts must be
+ * loaded via load_font.php.
+ *
+ * When enabled, dompdf can support all Unicode glyphs. Any glyphs used in a
+ * document must be present in your fonts, however.
+ */
+def("DOMPDF_UNICODE_ENABLED", true);
+
+/**
+ * Whether to enable font subsetting or not.
+ */
+def("DOMPDF_ENABLE_FONTSUBSETTING", false);
+
+/**
+ * The PDF rendering backend to use
+ *
+ * Valid settings are 'PDFLib', 'CPDF' (the bundled R&OS PDF class), 'GD' and
+ * 'auto'. 'auto' will look for PDFLib and use it if found, or if not it will
+ * fall back on CPDF. 'GD' renders PDFs to graphic files. {@link
+ * Canvas_Factory} ultimately determines which rendering class to instantiate
+ * based on this setting.
+ *
+ * Both PDFLib & CPDF rendering backends provide sufficient rendering
+ * capabilities for dompdf, however additional features (e.g. object,
+ * image and font support, etc.) differ between backends.  Please see
+ * {@link PDFLib_Adapter} for more information on the PDFLib backend
+ * and {@link CPDF_Adapter} and lib/class.pdf.php for more information
+ * on CPDF. Also see the documentation for each backend at the links
+ * below.
+ *
+ * The GD rendering backend is a little different than PDFLib and
+ * CPDF. Several features of CPDF and PDFLib are not supported or do
+ * not make any sense when creating image files.  For example,
+ * multiple pages are not supported, nor are PDF 'objects'.  Have a
+ * look at {@link GD_Adapter} for more information.  GD support is
+ * experimental, so use it at your own risk.
+ *
+ * @link http://www.pdflib.com
+ * @link http://www.ros.co.nz/pdf
+ * @link http://www.php.net/image
+ */
+def("DOMPDF_PDF_BACKEND", "CPDF");
+
+/**
+ * PDFlib license key
+ *
+ * If you are using a licensed, commercial version of PDFlib, specify
+ * your license key here.  If you are using PDFlib-Lite or are evaluating
+ * the commercial version of PDFlib, comment out this setting.
+ *
+ * @link http://www.pdflib.com
+ *
+ * If pdflib present in web server and auto or selected explicitely above,
+ * a real license code must exist!
+ */
+//def("DOMPDF_PDFLIB_LICENSE", "your license key here");
+
+/**
+ * html target media view which should be rendered into pdf.
+ * List of types and parsing rules for future extensions:
+ * http://www.w3.org/TR/REC-html40/types.html
+ *   screen, tty, tv, projection, handheld, print, braille, aural, all
+ * Note: aural is deprecated in CSS 2.1 because it is replaced by speech in CSS 3.
+ * Note, even though the generated pdf file is intended for print output,
+ * the desired content might be different (e.g. screen or projection view of html file).
+ * Therefore allow specification of content here.
+ */
+def("DOMPDF_DEFAULT_MEDIA_TYPE", "screen");
+
+/**
+ * The default paper size.
+ *
+ * North America standard is "letter"; other countries generally "a4"
+ *
+ * @see CPDF_Adapter::PAPER_SIZES for valid sizes
+ */
+def("DOMPDF_DEFAULT_PAPER_SIZE", "letter");
+
+/**
+ * The default font family
+ *
+ * Used if no suitable fonts can be found. This must exist in the font folder.
+ * @var string
+ */
+def("DOMPDF_DEFAULT_FONT", "serif");
+
+/**
+ * Image DPI setting
+ *
+ * This setting determines the default DPI setting for images and fonts.  The
+ * DPI may be overridden for inline images by explictly setting the
+ * image's width & height style attributes (i.e. if the image's native
+ * width is 600 pixels and you specify the image's width as 72 points,
+ * the image will have a DPI of 600 in the rendered PDF.  The DPI of
+ * background images can not be overridden and is controlled entirely
+ * via this parameter.
+ *
+ * For the purposes of DOMPDF, pixels per inch (PPI) = dots per inch (DPI).
+ * If a size in html is given as px (or without unit as image size),
+ * this tells the corresponding size in pt at 72 DPI.
+ * This adjusts the relative sizes to be similar to the rendering of the
+ * html page in a reference browser.
+ *
+ * In pdf, always 1 pt = 1/72 inch
+ *
+ * Rendering resolution of various browsers in px per inch:
+ * Windows Firefox and Internet Explorer:
+ *   SystemControl->Display properties->FontResolution: Default:96, largefonts:120, custom:?
+ * Linux Firefox:
+ *   about:config *resolution: Default:96
+ *   (xorg screen dimension in mm and Desktop font dpi settings are ignored)
+ *
+ * Take care about extra font/image zoom factor of browser.
+ *
+ * In images, <img> size in pixel attribute, img css style, are overriding
+ * the real image dimension in px for rendering.
+ *
+ * @var int
+ */
+def("DOMPDF_DPI", 96);
+
+/**
+ * Enable inline PHP
+ *
+ * If this setting is set to true then DOMPDF will automatically evaluate
+ * inline PHP contained within <script type="text/php"> ... </script> tags.
+ *
+ * Attention!
+ * Enabling this for documents you do not trust (e.g. arbitrary remote html
+ * pages) is a security risk. Inline scripts are run with the same level of
+ * system access available to dompdf. Set this option to false (recommended)
+ * if you wish to process untrusted documents.
+ *
+ * @var bool
+ */
+def("DOMPDF_ENABLE_PHP", false);
+
+/**
+ * Enable inline Javascript
+ *
+ * If this setting is set to true then DOMPDF will automatically insert
+ * JavaScript code contained within <script type="text/javascript"> ... </script> tags.
+ *
+ * @var bool
+ */
+def("DOMPDF_ENABLE_JAVASCRIPT", true);
+
+/**
+ * Enable remote file access
+ *
+ * If this setting is set to true, DOMPDF will access remote sites for
+ * images and CSS files as required.
+ * This is required for part of test case www/test/image_variants.html through www/examples.php
+ *
+ * Attention!
+ * This can be a security risk, in particular in combination with DOMPDF_ENABLE_PHP and
+ * allowing remote access to dompdf.php or on allowing remote html code to be passed to
+ * $dompdf = new DOMPDF(); $dompdf->load_html(...);
+ * This allows anonymous users to download legally doubtful internet content which on
+ * tracing back appears to being downloaded by your server, or allows malicious php code
+ * in remote html pages to be executed by your server with your account privileges.
+ *
+ * @var bool
+ */
+def("DOMPDF_ENABLE_REMOTE", false);
+
+/**
+ * The debug output log
+ * @var string
+ */
+def("DOMPDF_LOG_OUTPUT_FILE", DOMPDF_FONT_DIR . "log.htm");
+
+/**
+ * A ratio applied to the fonts height to be more like browsers' line height
+ */
+def("DOMPDF_FONT_HEIGHT_RATIO", 1.1);
+
+/**
+ * Enable CSS float
+ *
+ * Allows people to disabled CSS float support
+ * @var bool
+ */
+def("DOMPDF_ENABLE_CSS_FLOAT", false);
+
+/**
+ * Enable the built in DOMPDF autoloader
+ *
+ * @var bool
+ */
+def("DOMPDF_ENABLE_AUTOLOAD", false);
+
+/**
+ * Prepend the DOMPDF autoload function to the spl_autoload stack
+ *
+ * @var bool
+ */
+def("DOMPDF_AUTOLOAD_PREPEND", false);
+
+/**
+ * Use the more-than-experimental HTML5 Lib parser
+ */
+def("DOMPDF_ENABLE_HTML5PARSER", false);
+require_once(DOMPDF_LIB_DIR . "/html5lib/Parser.php");
+
+// ### End of user-configurable options ###
+
+/**
+ * Load autoloader
+ */
+if (DOMPDF_ENABLE_AUTOLOAD) {
+  require_once(DOMPDF_INC_DIR . "/autoload.inc.php");
+  require_once(DOMPDF_LIB_DIR . "/php-font-lib/classes/Font.php");
+}
+
+/**
+ * Ensure that PHP is working with text internally using UTF8 character encoding.
+ */
+mb_internal_encoding('UTF-8');
+
+/**
+ * Global array of warnings generated by DomDocument parser and
+ * stylesheet class
+ *
+ * @var array
+ */
+global $_dompdf_warnings;
+$_dompdf_warnings = array();
+
+/**
+ * If true, $_dompdf_warnings is dumped on script termination when using
+ * dompdf/dompdf.php or after rendering when using the DOMPDF class.
+ * When using the class, setting this value to true will prevent you from
+ * streaming the PDF.
+ *
+ * @var bool
+ */
+global $_dompdf_show_warnings;
+$_dompdf_show_warnings = false;
+
+/**
+ * If true, the entire tree is dumped to stdout in dompdf.cls.php.
+ * Setting this value to true will prevent you from streaming the PDF.
+ *
+ * @var bool
+ */
+global $_dompdf_debug;
+$_dompdf_debug = false;
+
+/**
+ * Array of enabled debug message types
+ *
+ * @var array
+ */
+global $_DOMPDF_DEBUG_TYPES;
+$_DOMPDF_DEBUG_TYPES = array(); //array("page-break" => 1);
+
+/* Optionally enable different classes of debug output before the pdf content.
+ * Visible if displaying pdf as text,
+ * E.g. on repeated display of same pdf in browser when pdf is not taken out of
+ * the browser cache and the premature output prevents setting of the mime type.
+ */
+def('DEBUGPNG', false);
+def('DEBUGKEEPTEMP', false);
+def('DEBUGCSS', false);
+
+/* Layout debugging. Will display rectangles around different block levels.
+ * Visible in the PDF itself.
+ */
+def('DEBUG_LAYOUT', false);
+def('DEBUG_LAYOUT_LINES', true);
+def('DEBUG_LAYOUT_BLOCKS', true);
+def('DEBUG_LAYOUT_INLINE', true);
+def('DEBUG_LAYOUT_PADDINGBOX', true);

vendor/dompdf/dompdf/include/absolute_positioner.cls.php

@@ -0,0 +1,125 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions absolutely positioned frames
+ */
+class Absolute_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+
+  function position() {
+
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    
+    $p = $frame->find_positionned_parent();
+    
+    list($x, $y, $w, $h) = $frame->get_containing_block();
+
+    $top    = $style->length_in_pt($style->top,    $h);
+    $right  = $style->length_in_pt($style->right,  $w);
+    $bottom = $style->length_in_pt($style->bottom, $h);
+    $left   = $style->length_in_pt($style->left,   $w);
+    
+    if ( $p && !($left === "auto" && $right === "auto") ) {
+      // Get the parent's padding box (see http://www.w3.org/TR/CSS21/visuren.html#propdef-top)
+      list($x, $y, $w, $h) = $p->get_padding_box();
+    }
+    
+    list($width, $height) = array($frame->get_margin_width(), $frame->get_margin_height());
+    
+    $orig_style = $this->_frame->get_original_style();
+    $orig_width = $orig_style->width;
+    $orig_height = $orig_style->height;
+    
+    /****************************
+    
+    Width auto: 
+    ____________| left=auto | left=fixed |
+    right=auto  |     A     |     B      |
+    right=fixed |     C     |     D      |
+    
+    Width fixed: 
+    ____________| left=auto | left=fixed |
+    right=auto  |     E     |     F      |
+    right=fixed |     G     |     H      |
+    
+    *****************************/
+    
+    if ( $left === "auto" ) {
+      if ( $right === "auto" ) {
+        // A or E - Keep the frame at the same position
+        $x = $x + $frame->find_block_parent()->get_current_line_box()->w;
+      }
+      else {
+        if ( $orig_width === "auto" ) {
+          // C
+          $x += $w - $width - $right;
+        }
+        else {
+          // G
+          $x += $w - $width - $right;
+        }
+      }
+    }
+    else {
+      if ( $right === "auto" ) {
+        // B or F
+        $x += $left;
+      }
+      else {
+        if ( $orig_width === "auto" ) {
+          // D - TODO change width
+          $x += $left;
+        }
+        else {
+          // H - Everything is fixed: left + width win
+          $x += $left;
+        }
+      }
+    }
+    
+    // The same vertically
+    if ( $top === "auto" ) {
+      if ( $bottom === "auto" ) {
+        // A or E - Keep the frame at the same position
+        $y = $frame->find_block_parent()->get_current_line_box()->y;
+      }
+      else {
+        if ( $orig_height === "auto" ) {
+          // C
+          $y += $h - $height - $bottom;
+        }
+        else {
+          // G
+          $y += $h - $height - $bottom;
+        }
+      }
+    }
+    else {
+      if ( $bottom === "auto" ) {
+        // B or F
+        $y += $top;
+      }
+      else {
+        if ( $orig_height === "auto" ) {
+          // D - TODO change height
+          $y += $top;
+        }
+        else {
+          // H - Everything is fixed: top + height win
+          $y += $top;
+        }
+      }
+    }
+    
+    $frame->set_position($x, $y);
+
+  }
+}

vendor/dompdf/dompdf/include/abstract_renderer.cls.php

@@ -0,0 +1,759 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Base renderer class
+ *
+ * @access private
+ * @package dompdf
+ */
+abstract class Abstract_Renderer {
+
+  /**
+   * Rendering backend
+   *
+   * @var Canvas
+   */
+  protected $_canvas;
+
+  /**
+   * Current dompdf instance
+   *
+   * @var DOMPDF
+   */
+  protected $_dompdf;
+  
+  /**
+   * Class constructor
+   *
+   * @param DOMPDF $dompdf The current dompdf instance
+   */
+  function __construct(DOMPDF $dompdf) {
+    $this->_dompdf = $dompdf;
+    $this->_canvas = $dompdf->get_canvas();
+  }
+  
+  /**
+   * Render a frame.
+   *
+   * Specialized in child classes
+   *
+   * @param Frame $frame The frame to render
+   */
+  abstract function render(Frame $frame);
+
+  //........................................................................
+
+  /**
+   * Render a background image over a rectangular area
+   *
+   * @param string $url      The background image to load
+   * @param float  $x        The left edge of the rectangular area
+   * @param float  $y        The top edge of the rectangular area
+   * @param float  $width    The width of the rectangular area
+   * @param float  $height   The height of the rectangular area
+   * @param Style  $style    The associated Style object
+   *
+   * @throws Exception
+   */
+  protected function _background_image($url, $x, $y, $width, $height, $style) {
+    if ( !function_exists("imagecreatetruecolor") ) {
+      throw new Exception("The PHP GD extension is required, but is not installed.");
+    }
+
+    $sheet = $style->get_stylesheet();
+
+    // Skip degenerate cases
+    if ( $width == 0 || $height == 0 ) {
+      return;
+    }
+    
+    $box_width = $width;
+    $box_height = $height;
+
+    //debugpng
+    if (DEBUGPNG) print '[_background_image '.$url.']';
+
+    list($img, $type, /*$msg*/) = Image_Cache::resolve_url(
+      $url,
+      $sheet->get_protocol(),
+      $sheet->get_host(),
+      $sheet->get_base_path(),
+      $this->_dompdf
+    );
+
+    // Bail if the image is no good
+    if ( Image_Cache::is_broken($img) ) {
+      return;
+    }
+
+    //Try to optimize away reading and composing of same background multiple times
+    //Postponing read with imagecreatefrom   ...()
+    //final composition parameters and name not known yet
+    //Therefore read dimension directly from file, instead of creating gd object first.
+    //$img_w = imagesx($src); $img_h = imagesy($src);
+
+    list($img_w, $img_h) = dompdf_getimagesize($img, $this->_dompdf->get_http_context());
+    if (!isset($img_w) || $img_w == 0 || !isset($img_h) || $img_h == 0) {
+      return;
+    }
+
+    $repeat = $style->background_repeat;
+    $dpi = $this->_dompdf->get_option("dpi");
+
+    //Increase background resolution and dependent box size according to image resolution to be placed in
+    //Then image can be copied in without resize
+    $bg_width = round((float)($width * $dpi) / 72);
+    $bg_height = round((float)($height * $dpi) / 72);
+
+    //Need %bg_x, $bg_y as background pos, where img starts, converted to pixel
+
+    list($bg_x, $bg_y) = $style->background_position;
+
+    if ( is_percent($bg_x) ) {
+      // The point $bg_x % from the left edge of the image is placed
+      // $bg_x % from the left edge of the background rectangle
+      $p = ((float)$bg_x)/100.0;
+      $x1 = $p * $img_w;
+      $x2 = $p * $bg_width;
+
+      $bg_x = $x2 - $x1;
+    }
+    else {
+      $bg_x = (float)($style->length_in_pt($bg_x)*$dpi) / 72;
+    }
+    
+    $bg_x = round($bg_x + $style->length_in_pt($style->border_left_width)*$dpi / 72);
+
+    if ( is_percent($bg_y) ) {
+      // The point $bg_y % from the left edge of the image is placed
+      // $bg_y % from the left edge of the background rectangle
+      $p = ((float)$bg_y)/100.0;
+      $y1 = $p * $img_h;
+      $y2 = $p * $bg_height;
+
+      $bg_y = $y2 - $y1;
+    }
+    else {
+      $bg_y = (float)($style->length_in_pt($bg_y)*$dpi) / 72;
+    }
+    
+    $bg_y = round($bg_y + $style->length_in_pt($style->border_top_width)*$dpi / 72);
+
+    //clip background to the image area on partial repeat. Nothing to do if img off area
+    //On repeat, normalize start position to the tile at immediate left/top or 0/0 of area
+    //On no repeat with positive offset: move size/start to have offset==0
+    //Handle x/y Dimensions separately
+
+    if ( $repeat !== "repeat" && $repeat !== "repeat-x" ) {
+      //No repeat x
+      if ($bg_x < 0) {
+        $bg_width = $img_w + $bg_x;
+      }
+      else {
+        $x += ($bg_x * 72)/$dpi;
+        $bg_width = $bg_width - $bg_x;
+        if ($bg_width > $img_w) {
+          $bg_width = $img_w;
+        }
+        $bg_x = 0;
+      }
+      
+      if ($bg_width <= 0) {
+        return;
+      }
+      
+      $width = (float)($bg_width * 72)/$dpi;
+    }
+    else {
+      //repeat x
+      if ($bg_x < 0) {
+        $bg_x = - ((-$bg_x) % $img_w);
+      }
+      else {
+        $bg_x = $bg_x % $img_w;
+        if ($bg_x > 0) {
+          $bg_x -= $img_w;
+        }
+      }
+    }
+
+    if ( $repeat !== "repeat" && $repeat !== "repeat-y" ) {
+      //no repeat y
+      if ($bg_y < 0) {
+        $bg_height = $img_h + $bg_y;
+      }
+      else {
+        $y += ($bg_y * 72)/$dpi;
+        $bg_height = $bg_height - $bg_y;
+        if ($bg_height > $img_h) {
+          $bg_height = $img_h;
+        }
+        $bg_y = 0;
+      }
+      if ($bg_height <= 0) {
+        return;
+      }
+      $height = (float)($bg_height * 72)/$dpi;
+    }
+    else {
+      //repeat y
+      if ($bg_y < 0) {
+        $bg_y = - ((-$bg_y) % $img_h);
+      }
+      else {
+        $bg_y = $bg_y % $img_h;
+        if ($bg_y > 0) {
+          $bg_y -= $img_h;
+        }
+      }
+    }
+
+    //Optimization, if repeat has no effect
+    if ( $repeat === "repeat" && $bg_y <= 0 && $img_h+$bg_y >= $bg_height ) {
+      $repeat = "repeat-x";
+    }
+    
+    if ( $repeat === "repeat" && $bg_x <= 0 && $img_w+$bg_x >= $bg_width ) {
+      $repeat = "repeat-y";
+    }
+    
+    if ( ($repeat === "repeat-x" && $bg_x <= 0 && $img_w+$bg_x >= $bg_width) ||
+         ($repeat === "repeat-y" && $bg_y <= 0 && $img_h+$bg_y >= $bg_height) ) {
+      $repeat = "no-repeat";
+    }
+
+    //Use filename as indicator only
+    //different names for different variants to have different copies in the pdf
+    //This is not dependent of background color of box! .'_'.(is_array($bg_color) ? $bg_color["hex"] : $bg_color)
+    //Note: Here, bg_* are the start values, not end values after going through the tile loops!
+
+    $filedummy = $img;
+    
+    $is_png = false;
+    $filedummy .= '_'.$bg_width.'_'.$bg_height.'_'.$bg_x.'_'.$bg_y.'_'.$repeat;
+
+    //Optimization to avoid multiple times rendering the same image.
+    //If check functions are existing and identical image already cached,
+    //then skip creation of duplicate, because it is not needed by addImagePng
+    if ( $this->_canvas instanceof CPDF_Adapter &&
+         $this->_canvas->get_cpdf()->image_iscached($filedummy) ) {
+      $bg = null;
+    }
+    
+    else {
+  
+      // Create a new image to fit over the background rectangle
+      $bg = imagecreatetruecolor($bg_width, $bg_height);
+      
+      switch (strtolower($type)) {
+        case IMAGETYPE_PNG:
+          $is_png = true;
+          imagesavealpha($bg, true);
+          imagealphablending($bg, false);
+          $src = imagecreatefrompng($img);
+          break;
+    
+        case IMAGETYPE_JPEG:
+          $src = imagecreatefromjpeg($img);
+          break;
+    
+        case IMAGETYPE_GIF:
+          $src = imagecreatefromgif($img);
+          break;
+          
+        case IMAGETYPE_BMP:
+          $src = imagecreatefrombmp($img);
+          break;
+    
+        default:
+          return; // Unsupported image type
+      }
+  
+      if ( $src == null ) {
+        return;
+      }
+  
+      //Background color if box is not relevant here
+      //Non transparent image: box clipped to real size. Background non relevant.
+      //Transparent image: The image controls the transparency and lets shine through whatever background.
+      //However on transparent image preset the composed image with the transparency color,
+      //to keep the transparency when copying over the non transparent parts of the tiles.
+      $ti = imagecolortransparent($src);
+      
+      if ( $ti >= 0 ) {
+        $tc = imagecolorsforindex($src, $ti);
+        $ti = imagecolorallocate($bg, $tc['red'], $tc['green'], $tc['blue']);
+        imagefill($bg, 0, 0, $ti);
+        imagecolortransparent($bg, $ti);
+      }
+  
+      //This has only an effect for the non repeatable dimension.
+      //compute start of src and dest coordinates of the single copy
+      if ( $bg_x < 0 ) {
+        $dst_x = 0;
+        $src_x = -$bg_x;
+      }
+      else {
+        $src_x = 0;
+        $dst_x = $bg_x;
+      }
+  
+      if ( $bg_y < 0 ) {
+        $dst_y = 0;
+        $src_y = -$bg_y;
+      }
+      else {
+        $src_y = 0;
+        $dst_y = $bg_y;
+      }
+  
+      //For historical reasons exchange meanings of variables:
+      //start_* will be the start values, while bg_* will be the temporary start values in the loops
+      $start_x = $bg_x;
+      $start_y = $bg_y;
+  
+      // Copy regions from the source image to the background
+      if ( $repeat === "no-repeat" ) {
+  
+        // Simply place the image on the background
+        imagecopy($bg, $src, $dst_x, $dst_y, $src_x, $src_y, $img_w, $img_h);
+  
+      }
+      else if ( $repeat === "repeat-x" ) {
+  
+        for ( $bg_x = $start_x; $bg_x < $bg_width; $bg_x += $img_w ) {
+          if ( $bg_x < 0 ) {
+            $dst_x = 0;
+            $src_x = -$bg_x;
+            $w = $img_w + $bg_x;
+          }
+          else {
+            $dst_x = $bg_x;
+            $src_x = 0;
+            $w = $img_w;
+          }
+          imagecopy($bg, $src, $dst_x, $dst_y, $src_x, $src_y, $w, $img_h);
+        }
+  
+      }
+      else if ( $repeat === "repeat-y" ) {
+  
+        for ( $bg_y = $start_y; $bg_y < $bg_height; $bg_y += $img_h ) {
+          if ( $bg_y < 0 ) {
+            $dst_y = 0;
+            $src_y = -$bg_y;
+            $h = $img_h + $bg_y;
+          }
+          else {
+            $dst_y = $bg_y;
+            $src_y = 0;
+            $h = $img_h;
+          }
+          imagecopy($bg, $src, $dst_x, $dst_y, $src_x, $src_y, $img_w, $h);
+  
+        }
+  
+      }
+      else if ( $repeat === "repeat" ) {
+  
+        for ( $bg_y = $start_y; $bg_y < $bg_height; $bg_y += $img_h ) {
+          for ( $bg_x = $start_x; $bg_x < $bg_width; $bg_x += $img_w ) {
+  
+            if ( $bg_x < 0 ) {
+              $dst_x = 0;
+              $src_x = -$bg_x;
+              $w = $img_w + $bg_x;
+            }
+            else {
+              $dst_x = $bg_x;
+              $src_x = 0;
+              $w = $img_w;
+            }
+  
+            if ( $bg_y < 0 ) {
+              $dst_y = 0;
+              $src_y = -$bg_y;
+              $h = $img_h + $bg_y;
+            }
+            else {
+              $dst_y = $bg_y;
+              $src_y = 0;
+              $h = $img_h;
+            }
+            imagecopy($bg, $src, $dst_x, $dst_y, $src_x, $src_y, $w, $h);
+          }
+        }
+      }
+      
+      else {
+        print 'Unknown repeat!';
+      }
+      
+      imagedestroy($src);
+
+    } /* End optimize away creation of duplicates */
+
+    $this->_canvas->clipping_rectangle($x, $y, $box_width, $box_height);
+    
+    //img: image url string
+    //img_w, img_h: original image size in px
+    //width, height: box size in pt
+    //bg_width, bg_height: box size in px
+    //x, y: left/top edge of box on page in pt
+    //start_x, start_y: placement of image relative to pattern
+    //$repeat: repeat mode
+    //$bg: GD object of result image
+    //$src: GD object of original image
+    //When using cpdf and optimization to direct png creation from gd object is available,
+    //don't create temp file, but place gd object directly into the pdf
+    if ( !$is_png && $this->_canvas instanceof CPDF_Adapter ) {
+      // Note: CPDF_Adapter image converts y position
+      $this->_canvas->get_cpdf()->addImagePng($filedummy, $x, $this->_canvas->get_height() - $y - $height, $width, $height, $bg);
+    } 
+    
+    else {
+      $tmp_dir = $this->_dompdf->get_option("temp_dir");
+      $tmp_name = tempnam($tmp_dir, "bg_dompdf_img_");
+      @unlink($tmp_name);
+      $tmp_file = "$tmp_name.png";
+      
+      //debugpng
+      if (DEBUGPNG) print '[_background_image '.$tmp_file.']';
+
+      imagepng($bg, $tmp_file);
+      $this->_canvas->image($tmp_file, $x, $y, $width, $height);
+      imagedestroy($bg);
+
+      //debugpng
+      if (DEBUGPNG) print '[_background_image unlink '.$tmp_file.']';
+
+      if (!DEBUGKEEPTEMP) {
+        unlink($tmp_file);
+      }
+    }
+    
+    $this->_canvas->clipping_end();
+  }
+  
+  protected function _get_dash_pattern($style, $width) {
+    $pattern = array();
+    
+    switch ($style) {
+      default:
+      /*case "solid":
+      case "double":
+      case "groove":
+      case "inset":
+      case "outset":
+      case "ridge":*/
+      case "none": break;
+      
+      case "dotted": 
+        if ( $width <= 1 )
+          $pattern = array($width, $width*2);
+        else
+          $pattern = array($width);
+      break;
+      
+      case "dashed": 
+        $pattern = array(3 * $width);
+      break;
+    }
+    
+    return $pattern;
+  }
+
+  protected function _border_none($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    return;
+  }
+  
+  protected function _border_hidden($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    return;
+  }
+  
+  // Border rendering functions
+
+  protected function _border_dotted($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    $this->_border_line($x, $y, $length, $color, $widths, $side, $corner_style, "dotted", $r1, $r2);
+  }
+
+
+  protected function _border_dashed($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    $this->_border_line($x, $y, $length, $color, $widths, $side, $corner_style, "dashed", $r1, $r2);
+  }
+
+
+  protected function _border_solid($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    // TODO: Solve rendering where one corner is beveled (radius == 0), one corner isn't.
+    if ( $corner_style !== "bevel" || $r1 > 0 || $r2 > 0 ) {
+      // do it the simple way
+      $this->_border_line($x, $y, $length, $color, $widths, $side, $corner_style, "solid", $r1, $r2);
+      return;
+    }
+
+    list($top, $right, $bottom, $left) = $widths;
+
+    // All this polygon business is for beveled corners...
+    switch ($side) {
+      case "top":
+        $points = array($x, $y,
+                        $x + $length, $y,
+                        $x + $length - $right, $y + $top,
+                        $x + $left, $y + $top);
+        $this->_canvas->polygon($points, $color, null, null, true);
+        break;
+  
+      case "bottom":
+        $points = array($x, $y,
+                        $x + $length, $y,
+                        $x + $length - $right, $y - $bottom,
+                        $x + $left, $y - $bottom);
+        $this->_canvas->polygon($points, $color, null, null, true);
+        break;
+  
+      case "left":
+        $points = array($x, $y,
+                        $x, $y + $length,
+                        $x + $left, $y + $length - $bottom,
+                        $x + $left, $y + $top);
+        $this->_canvas->polygon($points, $color, null, null, true);
+        break;
+  
+      case "right":
+        $points = array($x, $y,
+                        $x, $y + $length,
+                        $x - $right, $y + $length - $bottom,
+                        $x - $right, $y + $top);
+        $this->_canvas->polygon($points, $color, null, null, true);
+        break;
+  
+      default:
+        return;
+    }
+  }
+
+  protected function _apply_ratio($side, $ratio, $top, $right, $bottom, $left, &$x, &$y, &$length, &$r1, &$r2) {
+    switch ($side) {
+
+    case "top":
+      $r1 -= $left * $ratio;
+      $r2 -= $right * $ratio;
+      $x += $left * $ratio;
+      $y += $top * $ratio;
+      $length -= $left * $ratio + $right * $ratio;
+      break;
+
+    case "bottom":
+      $r1 -= $right * $ratio;
+      $r2 -= $left * $ratio;
+      $x += $left * $ratio;
+      $y -= $bottom * $ratio;
+      $length -= $left * $ratio + $right * $ratio;
+      break;
+
+    case "left":
+      $r1 -= $top * $ratio;
+      $r2 -= $bottom * $ratio;
+      $x += $left * $ratio;
+      $y += $top * $ratio;
+      $length -= $top * $ratio + $bottom * $ratio;
+      break;
+
+    case "right":
+      $r1 -= $bottom * $ratio;
+      $r2 -= $top * $ratio;
+      $x -= $right * $ratio;
+      $y += $top * $ratio;
+      $length -= $top * $ratio + $bottom * $ratio;
+      break;
+
+    default:
+      return;
+
+    }
+  }
+
+  protected function _border_double($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    list($top, $right, $bottom, $left) = $widths;
+
+    $third_widths = array($top / 3, $right / 3, $bottom / 3, $left / 3);
+
+    // draw the outer border
+    $this->_border_solid($x, $y, $length, $color, $third_widths, $side, $corner_style, $r1, $r2);
+
+    $this->_apply_ratio($side, 2/3, $top, $right, $bottom, $left, $x, $y, $length, $r1, $r2);
+
+    $this->_border_solid($x, $y, $length, $color, $third_widths, $side, $corner_style, $r1, $r2);
+  }
+
+  protected function _border_groove($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    list($top, $right, $bottom, $left) = $widths;
+
+    $half_widths = array($top / 2, $right / 2, $bottom / 2, $left / 2);
+
+    $this->_border_inset($x, $y, $length, $color, $half_widths, $side, $corner_style, $r1, $r2);
+    
+    $this->_apply_ratio($side, 0.5, $top, $right, $bottom, $left, $x, $y, $length, $r1, $r2);
+
+    $this->_border_outset($x, $y, $length, $color, $half_widths, $side, $corner_style, $r1, $r2);
+
+  }
+
+  protected function _border_ridge($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    list($top, $right, $bottom, $left) = $widths;
+
+    $half_widths = array($top / 2, $right / 2, $bottom / 2, $left / 2);
+
+    $this->_border_outset($x, $y, $length, $color, $half_widths, $side, $corner_style, $r1, $r2);
+    
+    $this->_apply_ratio($side, 0.5, $top, $right, $bottom, $left, $x, $y, $length, $r1, $r2);
+
+    $this->_border_inset($x, $y, $length, $color, $half_widths, $side, $corner_style, $r1, $r2);
+
+  }
+
+  protected function _tint($c) {
+    if ( !is_numeric($c) )
+      return $c;
+
+    return min(1, $c + 0.16);
+  }
+
+  protected function _shade($c) {
+    if ( !is_numeric($c) )
+      return $c;
+
+    return max(0, $c - 0.33);
+  }
+
+  protected function _border_inset($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    switch ($side) {
+      case "top":
+      case "left":
+        $shade = array_map(array($this, "_shade"), $color);
+        $this->_border_solid($x, $y, $length, $shade, $widths, $side, $corner_style, $r1, $r2);
+        break;
+  
+      case "bottom":
+      case "right":
+        $tint = array_map(array($this, "_tint"), $color);
+        $this->_border_solid($x, $y, $length, $tint, $widths, $side, $corner_style, $r1, $r2);
+        break;
+  
+      default:
+        return;
+    }
+  }
+
+  protected function _border_outset($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $r1 = 0, $r2 = 0) {
+    switch ($side) {
+      case "top":
+      case "left":
+        $tint = array_map(array($this, "_tint"), $color);
+        $this->_border_solid($x, $y, $length, $tint, $widths, $side, $corner_style, $r1, $r2);
+        break;
+  
+      case "bottom":
+      case "right":
+        $shade = array_map(array($this, "_shade"), $color);
+        $this->_border_solid($x, $y, $length, $shade, $widths, $side, $corner_style, $r1, $r2);
+        break;
+  
+      default:
+        return;
+    }
+  }
+  // Draws a solid, dotted, or dashed line, observing the border radius
+  protected function _border_line($x, $y, $length, $color, $widths, $side, $corner_style = "bevel", $pattern_name, $r1 = 0, $r2 = 0) {
+    list($top, $right, $bottom, $left) = $widths;
+    
+    $width = $$side;
+    $pattern = $this->_get_dash_pattern($pattern_name, $width);
+
+    $half_width = $width/2;
+    $r1 -= $half_width;
+    $r2 -= $half_width;
+    $adjust = $r1/80;
+    $length -= $width; 
+    
+    switch ($side) {
+      case "top":
+        $x += $half_width; 
+        $y += $half_width;
+  
+        if ( $r1 > 0 ) {
+          $this->_canvas->arc($x + $r1, $y + $r1, $r1, $r1, 90-$adjust, 135+$adjust, $color, $width, $pattern);
+        }
+  
+        $this->_canvas->line($x + $r1, $y, $x + $length - $r2, $y, $color, $width, $pattern);
+  
+        if ( $r2 > 0 ) {
+          $this->_canvas->arc($x + $length - $r2, $y + $r2, $r2, $r2, 45-$adjust, 90+$adjust, $color, $width, $pattern);
+        }
+        break;
+        
+      case "bottom":
+        $x += $half_width; 
+        $y -= $half_width;
+        
+        if ( $r1 > 0 ) {
+          $this->_canvas->arc($x + $r1, $y - $r1, $r1, $r1, 225-$adjust, 270+$adjust, $color, $width, $pattern);
+        }
+        
+        $this->_canvas->line($x + $r1, $y, $x + $length - $r2, $y, $color, $width, $pattern);
+        
+        if ( $r2 > 0 ) {
+          $this->_canvas->arc($x + $length - $r2, $y - $r2, $r2, $r2, 270-$adjust, 315+$adjust, $color, $width, $pattern);
+        }
+        break;
+        
+      case "left":
+        $y += $half_width; 
+        $x += $half_width;
+        
+        if ( $r1 > 0 ) {
+          $this->_canvas->arc($x + $r1, $y + $r1, $r1, $r1, 135-$adjust, 180+$adjust, $color, $width, $pattern);
+        }
+        
+        $this->_canvas->line($x, $y + $r1, $x, $y + $length - $r2, $color, $width, $pattern);
+        
+        if ( $r2 > 0 ) {
+          $this->_canvas->arc($x + $r2, $y + $length - $r2, $r2, $r2, 180-$adjust, 225+$adjust, $color, $width, $pattern);
+        }
+        break;
+        
+      case "right":
+        $y += $half_width; 
+        $x -= $half_width;
+        
+        if ( $r1 > 0 ) {
+          $this->_canvas->arc($x - $r1, $y + $r1, $r1, $r1, 0-$adjust, 45+$adjust, $color, $width, $pattern);
+        }
+        
+        $this->_canvas->line($x, $y + $r1, $x, $y + $length - $r2, $color, $width, $pattern);
+        
+        if ( $r2 > 0 ) {
+          $this->_canvas->arc($x - $r2, $y + $length - $r2, $r2, $r2, 315-$adjust, 360+$adjust, $color, $width, $pattern);
+        }
+        break;
+    }
+  }
+
+  protected function _set_opacity($opacity) {
+    if ( is_numeric($opacity) && $opacity <= 1.0 && $opacity >= 0.0 ) {
+      $this->_canvas->set_opacity( $opacity );
+    }
+  }
+
+  protected function _debug_layout($box, $color = "red", $style = array()) {
+    $this->_canvas->rectangle($box[0], $box[1], $box[2], $box[3], CSS_Color::parse($color), 0.1, $style);
+  }
+}

vendor/dompdf/dompdf/include/attribute_translator.cls.php

@@ -0,0 +1,592 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Translates HTML 4.0 attributes into CSS rules
+ *
+ * @package dompdf
+ */
+class Attribute_Translator {
+  static $_style_attr = "_html_style_attribute";
+  
+  // Munged data originally from
+  // http://www.w3.org/TR/REC-html40/index/attributes.html
+  // http://www.cs.tut.fi/~jkorpela/html2css.html
+  static private $__ATTRIBUTE_LOOKUP = array(
+    //'caption' => array ( 'align' => '', ),
+    'img' => array(
+      'align' => array(
+        'bottom' => 'vertical-align: baseline;',
+        'middle' => 'vertical-align: middle;',
+        'top'    => 'vertical-align: top;',
+        'left'   => 'float: left;',
+        'right'  => 'float: right;'
+      ),
+      'border' => 'border: %0.2F px solid;',
+      'height' => 'height: %s px;',
+      'hspace' => 'padding-left: %1$0.2F px; padding-right: %1$0.2F px;',
+      'vspace' => 'padding-top: %1$0.2F px; padding-bottom: %1$0.2F px;',
+      'width'  => 'width: %s px;',
+    ),
+    'table' => array(
+      'align' => array(
+        'left'   => 'margin-left: 0; margin-right: auto;',
+        'center' => 'margin-left: auto; margin-right: auto;',
+        'right'  => 'margin-left: auto; margin-right: 0;'
+      ),
+      'bgcolor' => 'background-color: %s;',
+      'border' => '!set_table_border',
+      'cellpadding' => '!set_table_cellpadding',//'border-spacing: %0.2F; border-collapse: separate;',
+      'cellspacing' => '!set_table_cellspacing',
+      'frame' => array(
+        'void'   => 'border-style: none;',
+        'above'  => 'border-top-style: solid;',
+        'below'  => 'border-bottom-style: solid;',
+        'hsides' => 'border-left-style: solid; border-right-style: solid;',
+        'vsides' => 'border-top-style: solid; border-bottom-style: solid;',
+        'lhs'    => 'border-left-style: solid;',
+        'rhs'    => 'border-right-style: solid;',
+        'box'    => 'border-style: solid;',
+        'border' => 'border-style: solid;'
+      ),
+      'rules' => '!set_table_rules',
+      'width' => 'width: %s;',
+    ),
+    'hr' => array(
+      'align'   => '!set_hr_align', // Need to grab width to set 'left' & 'right' correctly
+      'noshade' => 'border-style: solid;',
+      'size'    => '!set_hr_size', //'border-width: %0.2F px;',
+      'width'   => 'width: %s;',
+    ),
+    'div' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h1' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h2' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h3' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h4' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h5' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'h6' => array(
+      'align' => 'text-align: %s;',
+    ),
+    'p' => array(
+      'align' => 'text-align: %s;',
+    ),
+//    'col' => array(
+//      'align'  => '',
+//      'valign' => '',
+//    ),
+//    'colgroup' => array(
+//      'align'  => '',
+//      'valign' => '',
+//    ),
+    'tbody' => array(
+      'align'  => '!set_table_row_align',
+      'valign' => '!set_table_row_valign',
+    ),
+    'td' => array(
+      'align'   => 'text-align: %s;',
+      'bgcolor' => '!set_background_color',
+      'height'  => 'height: %s;',
+      'nowrap'  => 'white-space: nowrap;',
+      'valign'  => 'vertical-align: %s;',
+      'width'   => 'width: %s;',
+    ),
+    'tfoot' => array(
+      'align'   => '!set_table_row_align',
+      'valign'  => '!set_table_row_valign',
+    ),
+    'th' => array(
+      'align'   => 'text-align: %s;',
+      'bgcolor' => '!set_background_color',
+      'height'  => 'height: %s;',
+      'nowrap'  => 'white-space: nowrap;',
+      'valign'  => 'vertical-align: %s;',
+      'width'   => 'width: %s;',
+    ),
+    'thead' => array(
+      'align'   => '!set_table_row_align',
+      'valign'  => '!set_table_row_valign',
+    ),
+    'tr' => array(
+      'align'   => '!set_table_row_align',
+      'bgcolor' => '!set_table_row_bgcolor',
+      'valign'  => '!set_table_row_valign',
+    ),
+    'body' => array(
+      'background' => 'background-image: url(%s);',
+      'bgcolor'    => '!set_background_color',
+      'link'       => '!set_body_link',
+      'text'       => '!set_color',
+    ),
+    'br' => array(
+      'clear' => 'clear: %s;',
+    ),
+    'basefont' => array(
+      'color' => '!set_color',
+      'face'  => 'font-family: %s;',
+      'size'  => '!set_basefont_size',
+    ),
+    'font' => array(
+      'color' => '!set_color',
+      'face'  => 'font-family: %s;',
+      'size'  => '!set_font_size',
+    ),
+    'dir' => array(
+      'compact' => 'margin: 0.5em 0;',
+    ),
+    'dl' => array(
+      'compact' => 'margin: 0.5em 0;',
+    ),
+    'menu' => array(
+      'compact' => 'margin: 0.5em 0;',
+    ),
+    'ol' => array(
+      'compact' => 'margin: 0.5em 0;',
+      'start'   => 'counter-reset: -dompdf-default-counter %d;',
+      'type'    => 'list-style-type: %s;',
+    ),
+    'ul' => array(
+      'compact' => 'margin: 0.5em 0;',
+      'type'    => 'list-style-type: %s;',
+    ),
+    'li' => array(
+      'type'    => 'list-style-type: %s;',
+      'value'   => 'counter-reset: -dompdf-default-counter %d;',
+    ),
+    'pre' => array(
+      'width' => 'width: %s;',
+    ),
+  );
+  
+  static protected $_last_basefont_size = 3;
+  static protected $_font_size_lookup = array(
+    // For basefont support
+    -3 => "4pt", 
+    -2 => "5pt", 
+    -1 => "6pt", 
+     0 => "7pt", 
+    
+     1 => "8pt",
+     2 => "10pt",
+     3 => "12pt",
+     4 => "14pt",
+     5 => "18pt",
+     6 => "24pt",
+     7 => "34pt",
+     
+    // For basefont support
+     8 => "48pt", 
+     9 => "44pt", 
+    10 => "52pt", 
+    11 => "60pt", 
+  );
+
+  /**
+   * @param Frame $frame
+   */
+  static function translate_attributes(Frame $frame) {
+    $node = $frame->get_node();
+    $tag = $node->nodeName;
+
+    if ( !isset(self::$__ATTRIBUTE_LOOKUP[$tag]) ) {
+      return;
+    }
+
+    $valid_attrs = self::$__ATTRIBUTE_LOOKUP[$tag];
+    $attrs = $node->attributes;
+    $style = rtrim($node->getAttribute(self::$_style_attr), "; ");
+    if ( $style != "" ) {
+      $style .= ";";
+    }
+
+    foreach ($attrs as $attr => $attr_node ) {
+      if ( !isset($valid_attrs[$attr]) ) {
+        continue;
+      }
+
+      $value = $attr_node->value;
+
+      $target = $valid_attrs[$attr];
+      
+      // Look up $value in $target, if $target is an array:
+      if ( is_array($target) ) {
+        if ( isset($target[$value]) ) {
+          $style .= " " . self::_resolve_target($node, $target[$value], $value);
+        }
+      }
+      else {
+        // otherwise use target directly
+        $style .= " " . self::_resolve_target($node, $target, $value);
+      }
+    }
+    
+    if ( !is_null($style) ) {
+      $style = ltrim($style);
+      $node->setAttribute(self::$_style_attr, $style);
+    }
+    
+  }
+
+  /**
+   * @param DOMNode $node
+   * @param string  $target
+   * @param string      $value
+   *
+   * @return string
+   */
+  static protected function _resolve_target(DOMNode $node, $target, $value) {
+    if ( $target[0] === "!" ) {
+      // Function call
+      $func = "_" . mb_substr($target, 1);
+      return self::$func($node, $value);
+    }
+    
+    return $value ? sprintf($target, $value) : "";
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $new_style
+   */
+  static function append_style(DOMElement $node, $new_style) {
+    $style = rtrim($node->getAttribute(self::$_style_attr), ";");
+    $style .= $new_style;
+    $style = ltrim($style, ";");
+    $node->setAttribute(self::$_style_attr, $style);
+  }
+
+  /**
+   * @param DOMNode $node
+   *
+   * @return DOMNodeList|DOMElement[]
+   */
+  static protected function get_cell_list(DOMNode $node) {
+    $xpath = new DOMXpath($node->ownerDocument);
+    
+    switch($node->nodeName) {
+      default:
+      case "table":
+        $query = "tr/td | thead/tr/td | tbody/tr/td | tfoot/tr/td | tr/th | thead/tr/th | tbody/tr/th | tfoot/tr/th";
+        break;
+        
+      case "tbody":
+      case "tfoot":
+      case "thead":
+        $query = "tr/td | tr/th";
+        break;
+        
+      case "tr":
+        $query = "td | th";
+        break;
+    }
+    
+    return $xpath->query($query, $node);
+  }
+
+  /**
+   * @param string $value
+   *
+   * @return string
+   */
+  static protected function _get_valid_color($value) {
+    if ( preg_match('/^#?([0-9A-F]{6})$/i', $value, $matches) ) {
+      $value = "#$matches[1]";
+    }
+    
+    return $value;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_color(DOMElement $node, $value) {
+    $value = self::_get_valid_color($value);
+    return "color: $value;";
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_background_color(DOMElement $node, $value) {
+    $value = self::_get_valid_color($value);
+    return "background-color: $value;";
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_table_cellpadding(DOMElement $node, $value) {
+    $cell_list = self::get_cell_list($node);
+    
+    foreach ($cell_list as $cell) {
+      self::append_style($cell, "; padding: {$value}px;");
+    }
+    
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_table_border(DOMElement $node, $value) {
+    $cell_list = self::get_cell_list($node);
+
+    foreach ($cell_list as $cell) {
+      $style = rtrim($cell->getAttribute(self::$_style_attr));
+      $style .= "; border-width: " . ($value > 0 ? 1 : 0) . "pt; border-style: inset;";
+      $style = ltrim($style, ";");
+      $cell->setAttribute(self::$_style_attr, $style);
+    }
+    
+    $style = rtrim($node->getAttribute(self::$_style_attr), ";");
+    $style .= "; border-width: $value" . "px; ";
+    return ltrim($style, "; ");
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_table_cellspacing(DOMElement $node, $value) {
+    $style = rtrim($node->getAttribute(self::$_style_attr), ";");
+
+    if ( $value == 0 ) {
+      $style .= "; border-collapse: collapse;";
+    }
+    else {
+      $style .= "; border-spacing: {$value}px; border-collapse: separate;";
+    }
+    
+    return ltrim($style, ";");
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null|string
+   */
+  static protected function _set_table_rules(DOMElement $node, $value) {
+    $new_style = "; border-collapse: collapse;";
+    
+    switch ($value) {
+    case "none":
+      $new_style .= "border-style: none;";
+      break;
+
+    case "groups":
+      // FIXME: unsupported
+      return null;
+
+    case "rows":
+      $new_style .= "border-style: solid none solid none; border-width: 1px; ";
+      break;
+
+    case "cols":
+      $new_style .= "border-style: none solid none solid; border-width: 1px; ";
+      break;
+
+    case "all":
+      $new_style .= "border-style: solid; border-width: 1px; ";
+      break;
+      
+    default:
+      // Invalid value
+      return null;
+    }
+
+    $cell_list = self::get_cell_list($node);
+    
+    foreach ($cell_list as $cell) {
+      $style = $cell->getAttribute(self::$_style_attr);
+      $style .= $new_style;
+      $cell->setAttribute(self::$_style_attr, $style);
+    }
+    
+    $style = rtrim($node->getAttribute(self::$_style_attr), ";");
+    $style .= "; border-collapse: collapse; ";
+    
+    return ltrim($style, "; ");
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_hr_size(DOMElement $node, $value) {
+    $style = rtrim($node->getAttribute(self::$_style_attr), ";");
+    $style .= "; border-width: ".max(0, $value-2)."; ";
+    return ltrim($style, "; ");
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null|string
+   */
+  static protected function _set_hr_align(DOMElement $node, $value) {
+    $style = rtrim($node->getAttribute(self::$_style_attr),";");
+    $width = $node->getAttribute("width");
+    
+    if ( $width == "" ) {
+      $width = "100%";
+    }
+
+    $remainder = 100 - (double)rtrim($width, "% ");
+    
+    switch ($value) {
+      case "left":
+        $style .= "; margin-right: $remainder %;";
+        break;
+  
+      case "right":
+        $style .= "; margin-left: $remainder %;";
+        break;
+  
+      case "center":
+        $style .= "; margin-left: auto; margin-right: auto;";
+        break;
+  
+      default:
+        return null;
+    }
+    
+    return ltrim($style, "; ");
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_table_row_align(DOMElement $node, $value) {
+    $cell_list = self::get_cell_list($node);
+
+    foreach ($cell_list as $cell) {
+      self::append_style($cell, "; text-align: $value;");
+    }
+
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_table_row_valign(DOMElement $node, $value) {
+    $cell_list = self::get_cell_list($node);
+
+    foreach ($cell_list as $cell) {
+      self::append_style($cell, "; vertical-align: $value;");
+    }
+
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_table_row_bgcolor(DOMElement $node, $value) {
+    $cell_list = self::get_cell_list($node);
+    $value = self::_get_valid_color($value);
+    
+    foreach ($cell_list as $cell) {
+      self::append_style($cell, "; background-color: $value;");
+    }
+
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_body_link(DOMElement $node, $value) {
+    $a_list = $node->getElementsByTagName("a");
+    $value = self::_get_valid_color($value);
+    
+    foreach ($a_list as $a) {
+      self::append_style($a, "; color: $value;");
+    }
+
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return null
+   */
+  static protected function _set_basefont_size(DOMElement $node, $value) {
+    // FIXME: ? we don't actually set the font size of anything here, just
+    // the base size for later modification by <font> tags.
+    self::$_last_basefont_size = $value;
+    return null;
+  }
+
+  /**
+   * @param DOMElement $node
+   * @param string     $value
+   *
+   * @return string
+   */
+  static protected function _set_font_size(DOMElement $node, $value) {
+    $style = $node->getAttribute(self::$_style_attr);
+
+    if ( $value[0] === "-" || $value[0] === "+" ) {
+      $value = self::$_last_basefont_size + (int)$value;
+    }
+    
+    if ( isset(self::$_font_size_lookup[$value]) ) {
+      $style .= "; font-size: " . self::$_font_size_lookup[$value] . ";";
+    }
+    else {
+      $style .= "; font-size: $value;";
+    }
+    
+    return ltrim($style, "; ");
+  }
+}

vendor/dompdf/dompdf/include/autoload.inc.php

@@ -0,0 +1,86 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+ 
+/**
+ * DOMPDF autoload function
+ *
+ * If you have an existing autoload function, add a call to this function
+ * from your existing __autoload() implementation.
+ *
+ * @param string $class
+ */
+function DOMPDF_autoload($class) {
+  $filename = DOMPDF_INC_DIR . "/" . mb_strtolower($class) . ".cls.php";
+  
+  if ( is_file($filename) ) {
+    include_once $filename;
+  }
+}
+
+// If SPL autoload functions are available (PHP >= 5.1.2)
+if ( function_exists("spl_autoload_register") ) {
+  $autoload = "DOMPDF_autoload";
+  $funcs = spl_autoload_functions();
+  
+  // No functions currently in the stack. 
+  if ( !DOMPDF_AUTOLOAD_PREPEND || $funcs === false ) {
+    spl_autoload_register($autoload); 
+  }
+  
+  // If PHP >= 5.3 the $prepend argument is available
+  else if ( PHP_VERSION_ID >= 50300 ) {
+    spl_autoload_register($autoload, true, true); 
+  }
+  
+  else {
+    // Unregister existing autoloaders... 
+    $compat = (PHP_VERSION_ID <= 50102 && PHP_VERSION_ID >= 50100);
+              
+    foreach ($funcs as $func) { 
+      if (is_array($func)) { 
+        // :TRICKY: There are some compatibility issues and some 
+        // places where we need to error out 
+        $reflector = new ReflectionMethod($func[0], $func[1]); 
+        if (!$reflector->isStatic()) { 
+          throw new Exception('This function is not compatible with non-static object methods due to PHP Bug #44144.'); 
+        }
+        
+        // Suprisingly, spl_autoload_register supports the 
+        // Class::staticMethod callback format, although call_user_func doesn't 
+        if ($compat) $func = implode('::', $func); 
+      }
+      
+      spl_autoload_unregister($func); 
+    }
+    
+    // Register the new one, thus putting it at the front of the stack... 
+    spl_autoload_register($autoload); 
+    
+    // Now, go back and re-register all of our old ones. 
+    foreach ($funcs as $func) { 
+      spl_autoload_register($func); 
+    }
+    
+    // Be polite and ensure that userland autoload gets retained
+    if ( function_exists("__autoload") ) {
+      spl_autoload_register("__autoload");
+    }
+  }
+}
+
+else if ( !function_exists("__autoload") ) {
+  /**
+   * Default __autoload() function
+   *
+   * @param string $class
+   */
+  function __autoload($class) {
+    DOMPDF_autoload($class);
+  }
+}

vendor/dompdf/dompdf/include/block_frame_decorator.cls.php

@@ -0,0 +1,234 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for block layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Block_Frame_Decorator extends Frame_Decorator {
+  /**
+   * Current line index
+   *
+   * @var int
+   */
+  protected $_cl;
+  
+  /**
+   * The block's line boxes
+   * 
+   * @var Line_Box[]
+   */
+  protected $_line_boxes;
+
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    
+    $this->_line_boxes = array(new Line_Box($this));
+    $this->_cl = 0;
+  }
+
+  function reset() {
+    parent::reset();
+    
+    $this->_line_boxes = array(new Line_Box($this));
+    $this->_cl = 0;
+  }
+
+  /**
+   * @return Line_Box
+   */
+  function get_current_line_box() {
+    return $this->_line_boxes[$this->_cl];
+  }
+
+  /**
+   * @return integer
+   */
+  function get_current_line_number() {
+    return $this->_cl;
+  }
+
+  /**
+   * @return Line_Box[]
+   */
+  function get_line_boxes() { 
+    return $this->_line_boxes; 
+  }
+
+  /**
+   * @param integer $i
+   */
+  function clear_line($i) {
+    if ( isset($this->_line_boxes[$i]) ) {
+      unset($this->_line_boxes[$i]);
+    }
+  }
+
+  /**
+   * @param Frame $frame
+   */
+  function add_frame_to_line(Frame $frame) {
+    if ( !$frame->is_in_flow() ) {
+      return;
+    }
+    
+    $style = $frame->get_style();
+    
+    $frame->set_containing_line($this->_line_boxes[$this->_cl]);
+    
+    /*
+    // Adds a new line after a block, only if certain conditions are met
+    if ((($frame instanceof Inline_Frame_Decorator && $frame->get_node()->nodeName !== "br") || 
+          $frame instanceof Text_Frame_Decorator && trim($frame->get_text())) && 
+        ($frame->get_prev_sibling() && $frame->get_prev_sibling()->get_style()->display === "block" && 
+         $this->_line_boxes[$this->_cl]->w > 0 )) {
+           
+           $this->maximize_line_height( $style->length_in_pt($style->line_height), $frame );
+           $this->add_line();
+         
+           // Add each child of the inline frame to the line individually
+           foreach ($frame->get_children() as $child)
+             $this->add_frame_to_line( $child );     
+    }
+    else*/
+
+    // Handle inline frames (which are effectively wrappers)
+    if ( $frame instanceof Inline_Frame_Decorator ) {
+
+      // Handle line breaks
+      if ( $frame->get_node()->nodeName === "br" ) {
+        $this->maximize_line_height( $style->length_in_pt($style->line_height), $frame );
+        $this->add_line(true);
+      }
+
+      return;
+    }
+
+    // Trim leading text if this is an empty line.  Kinda a hack to put it here,
+    // but what can you do...
+    if ( $this->get_current_line_box()->w == 0 &&
+         $frame->is_text_node() &&
+        !$frame->is_pre() ) {
+
+      $frame->set_text( ltrim($frame->get_text()) );
+      $frame->recalculate_width();
+    }
+
+    $w = $frame->get_margin_width();
+
+    if ( $w == 0 ) {
+      return;
+    }
+
+    // Debugging code:
+    /*
+    pre_r("\n<h3>Adding frame to line:</h3>");
+
+    //    pre_r("Me: " . $this->get_node()->nodeName . " (" . spl_object_hash($this->get_node()) . ")");
+    //    pre_r("Node: " . $frame->get_node()->nodeName . " (" . spl_object_hash($frame->get_node()) . ")");
+    if ( $frame->is_text_node() )
+      pre_r('"'.$frame->get_node()->nodeValue.'"');
+
+    pre_r("Line width: " . $this->_line_boxes[$this->_cl]->w);
+    pre_r("Frame: " . get_class($frame));
+    pre_r("Frame width: "  . $w);
+    pre_r("Frame height: " . $frame->get_margin_height());
+    pre_r("Containing block width: " . $this->get_containing_block("w"));
+    */
+    // End debugging
+
+    $line = $this->_line_boxes[$this->_cl];
+    if ( $line->left + $line->w + $line->right + $w > $this->get_containing_block("w")) {
+      $this->add_line();
+    }
+
+    $frame->position();
+
+    $current_line = $this->_line_boxes[$this->_cl];
+    $current_line->add_frame($frame);
+
+    if ( $frame->is_text_node() ) {
+      $current_line->wc += count(preg_split("/\s+/", trim($frame->get_text())));
+    }
+
+    $this->increase_line_width($w);
+    
+    $this->maximize_line_height($frame->get_margin_height(), $frame);
+  }
+
+  function remove_frames_from_line(Frame $frame) {
+    // Search backwards through the lines for $frame
+    $i = $this->_cl;
+    $j = null;
+
+    while ($i >= 0) {
+      if ( ($j = in_array($frame, $this->_line_boxes[$i]->get_frames(), true)) !== false ) {
+        break;
+      }
+      
+      $i--;
+    }
+
+    if ( $j === false ) {
+      return;
+    }
+
+    // Remove $frame and all frames that follow
+    while ($j < count($this->_line_boxes[$i]->get_frames())) {
+      $frames = $this->_line_boxes[$i]->get_frames();
+      $f = $frames[$j];
+      $frames[$j] = null;
+      unset($frames[$j]);
+      $j++;
+      $this->_line_boxes[$i]->w -= $f->get_margin_width();
+    }
+
+    // Recalculate the height of the line
+    $h = 0;
+    foreach ($this->_line_boxes[$i]->get_frames() as $f) {
+      $h = max( $h, $f->get_margin_height() );
+    }
+
+    $this->_line_boxes[$i]->h = $h;
+
+    // Remove all lines that follow
+    while ($this->_cl > $i) {
+      $this->_line_boxes[ $this->_cl ] = null;
+      unset($this->_line_boxes[ $this->_cl ]);
+      $this->_cl--;
+    }
+  }
+
+  function increase_line_width($w) {
+    $this->_line_boxes[ $this->_cl ]->w += $w;
+  }
+
+  function maximize_line_height($val, Frame $frame) {
+    if ( $val > $this->_line_boxes[ $this->_cl ]->h ) {
+      $this->_line_boxes[ $this->_cl ]->tallest_frame = $frame;
+      $this->_line_boxes[ $this->_cl ]->h = $val;
+    }
+  }
+
+  function add_line($br = false) {
+
+//     if ( $this->_line_boxes[$this->_cl]["h"] == 0 ) //count($this->_line_boxes[$i]["frames"]) == 0 ||
+//       return;
+
+    $this->_line_boxes[$this->_cl]->br = $br;
+    $y = $this->_line_boxes[$this->_cl]->y + $this->_line_boxes[$this->_cl]->h;
+
+    $new_line = new Line_Box($this, $y);
+    
+    $this->_line_boxes[ ++$this->_cl ] = $new_line;
+  }
+
+  //........................................................................
+}

vendor/dompdf/dompdf/include/block_frame_reflower.cls.php

@@ -0,0 +1,805 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows block frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Block_Frame_Reflower extends Frame_Reflower {
+  // Minimum line width to justify, as fraction of available width
+  const MIN_JUSTIFY_WIDTH = 0.80;
+
+  /**
+   * @var Block_Frame_Decorator
+   */
+  protected $_frame;
+  
+  function __construct(Block_Frame_Decorator $frame) { parent::__construct($frame); }
+
+  /**
+   *  Calculate the ideal used value for the width property as per:
+   *  http://www.w3.org/TR/CSS21/visudet.html#Computing_widths_and_margins
+   *  
+   *  @param float $width
+   *  @return array
+   */
+  protected function _calculate_width($width) {
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    $w = $frame->get_containing_block("w");
+
+    if ( $style->position === "fixed" ) {
+      $w = $frame->get_parent()->get_containing_block("w");
+    }
+
+    $rm = $style->length_in_pt($style->margin_right, $w);
+    $lm = $style->length_in_pt($style->margin_left, $w);
+
+    $left = $style->length_in_pt($style->left, $w);
+    $right = $style->length_in_pt($style->right, $w);
+    
+    // Handle 'auto' values
+    $dims = array($style->border_left_width,
+                  $style->border_right_width,
+                  $style->padding_left,
+                  $style->padding_right,
+                  $width !== "auto" ? $width : 0,
+                  $rm !== "auto" ? $rm : 0,
+                  $lm !== "auto" ? $lm : 0);
+
+    // absolutely positioned boxes take the 'left' and 'right' properties into account
+    if ( $frame->is_absolute() ) {
+      $absolute = true;
+      $dims[] = $left !== "auto" ? $left : 0;
+      $dims[] = $right !== "auto" ? $right : 0;
+    }
+    else {
+      $absolute = false;
+    }
+
+    $sum = $style->length_in_pt($dims, $w);
+
+    // Compare to the containing block
+    $diff = $w - $sum;
+
+    if ( $diff > 0 ) {
+
+      if ( $absolute ) {
+
+        // resolve auto properties: see
+        // http://www.w3.org/TR/CSS21/visudet.html#abs-non-replaced-width
+
+        if ( $width === "auto" && $left === "auto" && $right === "auto" ) {
+
+          if ( $lm === "auto" ) $lm = 0;
+          if ( $rm === "auto" ) $rm = 0;
+
+          // Technically, the width should be "shrink-to-fit" i.e. based on the
+          // preferred width of the content...  a little too costly here as a
+          // special case.  Just get the width to take up the slack:
+          $left = 0;
+          $right = 0;
+          $width = $diff;
+        }
+        else if ( $width === "auto" ) {
+
+          if ( $lm    === "auto" ) $lm = 0;
+          if ( $rm    === "auto" ) $rm = 0;
+          if ( $left  === "auto" ) $left = 0;
+          if ( $right === "auto" ) $right = 0;
+
+          $width = $diff;
+        }
+        else if ( $left === "auto" ) {
+          
+          if ( $lm    === "auto" ) $lm = 0;
+          if ( $rm    === "auto" ) $rm = 0;
+          if ( $right === "auto" ) $right = 0;
+
+          $left = $diff;
+        }
+        else if ( $right === "auto" ) {
+
+          if ( $lm === "auto" ) $lm = 0;
+          if ( $rm === "auto" ) $rm = 0;
+
+          $right = $diff;
+        }
+
+      }
+      else {
+
+        // Find auto properties and get them to take up the slack
+        if ( $width === "auto" ) {
+          $width = $diff;
+        }
+        else if ( $lm === "auto" && $rm === "auto" ) {
+          $lm = $rm = round($diff / 2);
+        }
+        else if ( $lm === "auto" ) {
+          $lm = $diff;
+        }
+        else if ( $rm === "auto" ) {
+          $rm = $diff;
+        }
+      }
+
+    }
+    else if ($diff < 0) {
+
+      // We are over constrained--set margin-right to the difference
+      $rm = $diff;
+
+    }
+
+    return array(
+      "width"        => $width,
+      "margin_left"  => $lm,
+      "margin_right" => $rm,
+      "left"         => $left,
+      "right"        => $right,
+    );
+  }
+
+  /**
+   * Call the above function, but resolve max/min widths
+   *
+   * @throws DOMPDF_Exception
+   * @return array
+   */
+  protected function _calculate_restricted_width() {
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    $cb = $frame->get_containing_block();
+    
+    if ( $style->position === "fixed" ) {
+      $cb = $frame->get_root()->get_containing_block();
+    }
+    
+    //if ( $style->position === "absolute" )
+    //  $cb = $frame->find_positionned_parent()->get_containing_block();
+
+    if ( !isset($cb["w"]) ) {
+      throw new DOMPDF_Exception("Box property calculation requires containing block width");
+    }
+    
+    // Treat width 100% as auto
+    if ( $style->width === "100%" ) {
+      $width = "auto";
+    }
+    else {
+      $width = $style->length_in_pt($style->width, $cb["w"]);
+    }
+    
+    extract($this->_calculate_width($width));
+
+    // Handle min/max width
+    $min_width = $style->length_in_pt($style->min_width, $cb["w"]);
+    $max_width = $style->length_in_pt($style->max_width, $cb["w"]);
+
+    if ( $max_width !== "none" && $min_width > $max_width ) {
+      list($max_width, $min_width) = array($min_width, $max_width);
+    }
+    
+    if ( $max_width !== "none" && $width > $max_width ) {
+      extract($this->_calculate_width($max_width));
+    }
+
+    if ( $width < $min_width ) {
+      extract($this->_calculate_width($min_width));
+    }
+
+    return array($width, $margin_left, $margin_right, $left, $right);
+  }
+  
+  /** 
+   * Determine the unrestricted height of content within the block
+   * not by adding each line's height, but by getting the last line's position. 
+   * This because lines could have been pushed lower by a clearing element.
+   *
+   * @return float
+   */
+  protected function _calculate_content_height() {
+    $lines = $this->_frame->get_line_boxes();
+    $height = 0;
+
+    foreach ($lines as $line) {
+      $height += $line->h;
+    }
+    
+    /*
+    $first_line = reset($lines);
+    $last_line  = end($lines);
+    $height2 = $last_line->y + $last_line->h - $first_line->y;
+    */
+    
+    return $height;
+  }
+
+  /** 
+   * Determine the frame's restricted height
+   *
+   * @return array
+   */
+  protected function _calculate_restricted_height() {
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    $content_height = $this->_calculate_content_height();
+    $cb = $frame->get_containing_block();
+    
+    $height = $style->length_in_pt($style->height, $cb["h"]);
+
+    $top    = $style->length_in_pt($style->top, $cb["h"]);
+    $bottom = $style->length_in_pt($style->bottom, $cb["h"]);
+
+    $margin_top    = $style->length_in_pt($style->margin_top, $cb["h"]);
+    $margin_bottom = $style->length_in_pt($style->margin_bottom, $cb["h"]);
+
+    if ( $frame->is_absolute() ) {
+
+      // see http://www.w3.org/TR/CSS21/visudet.html#abs-non-replaced-height
+
+      $dims = array($top !== "auto" ? $top : 0,
+                    $style->margin_top !== "auto" ? $style->margin_top : 0,
+                    $style->padding_top,
+                    $style->border_top_width,
+                    $height !== "auto" ? $height : 0,
+                    $style->border_bottom_width,
+                    $style->padding_bottom,
+                    $style->margin_bottom !== "auto" ? $style->margin_bottom : 0,
+                    $bottom !== "auto" ? $bottom : 0);
+
+      $sum = $style->length_in_pt($dims, $cb["h"]);
+
+      $diff = $cb["h"] - $sum; 
+
+      if ( $diff > 0 ) {
+
+        if ( $height === "auto" && $top === "auto" && $bottom === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $height = $diff;
+        }
+        else if ( $height === "auto" && $top === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $height = $content_height;
+          $top = $diff - $content_height;
+        }
+        else if ( $height === "auto" && $bottom === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $height = $content_height;
+          $bottom = $diff - $content_height;
+        }
+        else if ( $top === "auto" && $bottom === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $bottom = $diff;
+        }
+        else if ( $top === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $top = $diff;
+        }
+        else if ( $height === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $height = $diff;
+        }
+        else if ( $bottom === "auto" ) {
+
+          if ( $margin_top    === "auto" ) $margin_top = 0;
+          if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+
+          $bottom = $diff;
+        }
+        else {
+
+          if ( $style->overflow === "visible" ) {
+            // set all autos to zero
+            if ( $margin_top    === "auto" ) $margin_top = 0;
+            if ( $margin_bottom === "auto" ) $margin_bottom = 0;
+            if ( $top           === "auto" ) $top = 0;
+            if ( $bottom        === "auto" ) $bottom = 0;
+            if ( $height        === "auto" ) $height = $content_height;
+          }
+
+          // FIXME: overflow hidden
+        }
+
+      }
+
+    }
+    else {
+
+      // Expand the height if overflow is visible 
+      if ( $height === "auto" && $content_height > $height /* && $style->overflow === "visible" */) {
+        $height = $content_height;
+      }
+
+      // FIXME: this should probably be moved to a seperate function as per
+      // _calculate_restricted_width
+      
+      // Only handle min/max height if the height is independent of the frame's content
+      if ( !($style->overflow === "visible" ||
+             ($style->overflow === "hidden" && $height === "auto")) ) {
+
+        $min_height = $style->min_height;
+        $max_height = $style->max_height;
+
+        if ( isset($cb["h"]) ) {
+          $min_height = $style->length_in_pt($min_height, $cb["h"]);
+          $max_height = $style->length_in_pt($max_height, $cb["h"]);
+
+        }
+        else if ( isset($cb["w"]) ) {
+
+          if ( mb_strpos($min_height, "%") !== false ) {
+            $min_height = 0;
+          }
+          else {
+            $min_height = $style->length_in_pt($min_height, $cb["w"]);
+          }
+
+          if ( mb_strpos($max_height, "%") !== false ) {
+            $max_height = "none";
+          }
+          else {
+            $max_height = $style->length_in_pt($max_height, $cb["w"]);
+          }
+        }
+
+        if ( $max_height !== "none" && $min_height > $max_height ) {
+          // Swap 'em
+          list($max_height, $min_height) = array($min_height, $max_height);
+        }
+        
+        if ( $max_height !== "none" && $height > $max_height ) {
+          $height = $max_height;
+        }
+
+        if ( $height < $min_height ) {
+          $height = $min_height;
+        }
+      }
+
+    }
+
+    return array($height, $margin_top, $margin_bottom, $top, $bottom);
+
+  }
+
+  /**
+   * Adjust the justification of each of our lines.
+   * http://www.w3.org/TR/CSS21/text.html#propdef-text-align
+   */
+  protected function _text_align() {
+    $style = $this->_frame->get_style();
+    $w = $this->_frame->get_containing_block("w");
+    $width = $style->length_in_pt($style->width, $w);
+    
+    switch ($style->text_align) {
+      default:
+      case "left":
+        foreach ($this->_frame->get_line_boxes() as $line) {
+          if ( !$line->left ) {
+            continue;
+          }
+          
+          foreach($line->get_frames() as $frame) {
+            if ( $frame instanceof Block_Frame_Decorator) {
+              continue;
+            }
+            $frame->set_position( $frame->get_position("x") + $line->left );
+          }
+        }
+        return;
+  
+      case "right":
+        foreach ($this->_frame->get_line_boxes() as $line) {
+          // Move each child over by $dx
+          $dx = $width - $line->w - $line->right;
+          
+          foreach($line->get_frames() as $frame) {
+            // Block frames are not aligned by text-align
+            if ($frame instanceof Block_Frame_Decorator) {
+              continue;
+            }
+            
+            $frame->set_position( $frame->get_position("x") + $dx );
+          }
+        }
+        break;
+  
+  
+      case "justify":
+        // We justify all lines except the last one
+        $lines = $this->_frame->get_line_boxes(); // needs to be a variable (strict standards)
+        array_pop($lines);
+        
+        foreach($lines as $i => $line) {
+          if ( $line->br ) {
+            unset($lines[$i]);
+          }
+        }
+        
+        // One space character's width. Will be used to get a more accurate spacing
+        $space_width = Font_Metrics::get_text_width(" ", $style->font_family, $style->font_size);
+        
+        foreach ($lines as $line) {
+          if ( $line->left ) {
+            foreach ( $line->get_frames() as $frame ) {
+              if ( !$frame instanceof Text_Frame_Decorator ) {
+                continue;
+              }
+    
+              $frame->set_position( $frame->get_position("x") + $line->left );
+            }
+          }
+            
+          // Only set the spacing if the line is long enough.  This is really
+          // just an aesthetic choice ;)
+          //if ( $line["left"] + $line["w"] + $line["right"] > self::MIN_JUSTIFY_WIDTH * $width ) {
+            
+            // Set the spacing for each child
+            if ( $line->wc > 1 ) {
+              $spacing = ($width - ($line->left + $line->w + $line->right) + $space_width) / ($line->wc - 1);
+            }
+            else {
+              $spacing = 0;
+            }
+  
+            $dx = 0;
+            foreach($line->get_frames() as $frame) {
+              if ( !$frame instanceof Text_Frame_Decorator ) {
+                continue;
+              }
+                
+              $text = $frame->get_text();
+              $spaces = mb_substr_count($text, " ");
+              
+              $char_spacing = $style->length_in_pt($style->letter_spacing);
+              $_spacing = $spacing + $char_spacing;
+              
+              $frame->set_position( $frame->get_position("x") + $dx );
+              $frame->set_text_spacing($_spacing);
+              
+              $dx += $spaces * $_spacing;
+            }
+  
+            // The line (should) now occupy the entire width
+            $line->w = $width;
+  
+          //}
+        }
+        break;
+  
+      case "center":
+      case "centre":
+        foreach ($this->_frame->get_line_boxes() as $line) {
+          // Centre each line by moving each frame in the line by:
+          $dx = ($width + $line->left - $line->w - $line->right ) / 2;
+          
+          foreach ($line->get_frames() as $frame) {
+            // Block frames are not aligned by text-align
+            if ($frame instanceof Block_Frame_Decorator) {
+              continue;
+            }
+            
+            $frame->set_position( $frame->get_position("x") + $dx );
+          }
+        }
+        break;
+    }
+  }
+  
+  /**
+   * Align inline children vertically.
+   * Aligns each child vertically after each line is reflowed
+   */
+  function vertical_align() {
+    
+    $canvas = null;
+    
+    foreach ( $this->_frame->get_line_boxes() as $line ) {
+
+      $height = $line->h;
+    
+      foreach ( $line->get_frames() as $frame ) {
+        $style = $frame->get_style();
+
+        if ( $style->display !== "inline" ) {
+          continue;
+        }
+
+        $align = $frame->get_parent()->get_style()->vertical_align;
+        
+        if ( !isset($canvas) ) {
+          $canvas = $frame->get_root()->get_dompdf()->get_canvas();
+        }
+        
+        $baseline = $canvas->get_font_baseline($style->font_family, $style->font_size);
+        $y_offset = 0;
+        
+        switch ($align) {
+          case "baseline":
+            $y_offset = $height*0.8 - $baseline; // The 0.8 ratio is arbitrary until we find it's meaning
+            break;
+    
+          case "middle":
+            $y_offset = ($height*0.8 - $baseline) / 2;
+            break;
+    
+          case "sub":
+            $y_offset = 0.3 * $height;
+            break;
+    
+          case "super":
+            $y_offset = -0.2 * $height;
+            break;
+    
+          case "text-top":
+          case "top": // Not strictly accurate, but good enough for now
+            break;
+    
+          case "text-bottom":
+          case "bottom":
+            $y_offset = $height*0.8 - $baseline;
+            break;
+        }
+         
+        if ( $y_offset ) {
+          $frame->move(0, $y_offset);
+        }
+      }
+    }
+  }
+
+  /**
+   * @param Frame $child
+   */
+  function process_clear(Frame $child){
+    $enable_css_float = $this->get_dompdf()->get_option("enable_css_float");
+    if ( !$enable_css_float ) {
+      return;
+    }
+    
+    $child_style = $child->get_style();
+    $root = $this->_frame->get_root();
+    
+    // Handle "clear"
+    if ( $child_style->clear !== "none" ) {
+      $lowest_y = $root->get_lowest_float_offset($child);
+      
+      // If a float is still applying, we handle it
+      if ( $lowest_y ) {
+        if ( $child->is_in_flow() ) {
+          $line_box = $this->_frame->get_current_line_box();
+          $line_box->y = $lowest_y + $child->get_margin_height();
+          $line_box->left = 0;
+          $line_box->right = 0;
+        }
+        
+        $child->move(0, $lowest_y - $child->get_position("y"));
+      }
+    }
+  }
+
+  /**
+   * @param Frame $child
+   * @param float $cb_x
+   * @param float $cb_w
+   */
+  function process_float(Frame $child, $cb_x, $cb_w){
+    $enable_css_float = $this->_frame->get_dompdf()->get_option("enable_css_float");
+    if ( !$enable_css_float ) {
+      return;
+    }
+    
+    $child_style = $child->get_style();
+    $root = $this->_frame->get_root();
+    
+    // Handle "float"
+    if ( $child_style->float !== "none" ) {
+      $root->add_floating_frame($child);
+      
+      // Remove next frame's beginning whitespace
+      $next = $child->get_next_sibling();
+      if ( $next && $next instanceof Text_Frame_Decorator) {
+        $next->set_text(ltrim($next->get_text()));
+      }
+      
+      $line_box = $this->_frame->get_current_line_box();
+      list($old_x, $old_y) = $child->get_position();
+      
+      $float_x = $cb_x;
+      $float_y = $old_y;
+      $float_w = $child->get_margin_width();
+      
+      if ( $child_style->clear === "none" ) {
+        switch( $child_style->float ) {
+          case "left": 
+            $float_x += $line_box->left;
+            break;
+          case "right": 
+            $float_x += ($cb_w - $line_box->right - $float_w);
+            break;
+        }
+      }
+      else {
+        if ( $child_style->float === "right" ) {
+          $float_x += ($cb_w - $float_w);
+        }
+      }
+      
+      if ( $cb_w < $float_x + $float_w - $old_x ) {
+        // TODO handle when floating elements don't fit
+      }
+      
+      $line_box->get_float_offsets();
+      
+      if ( $child->_float_next_line ) {
+        $float_y += $line_box->h;
+      }
+      
+      $child->set_position($float_x, $float_y);
+      $child->move($float_x - $old_x, $float_y - $old_y, true);
+    }
+  }
+
+  /**
+   * @param Frame_Decorator $block
+   */
+  function reflow(Block_Frame_Decorator $block = null) {
+
+    // Check if a page break is forced
+    $page = $this->_frame->get_root();
+    $page->check_forced_page_break($this->_frame);
+
+    // Bail if the page is full
+    if ( $page->is_full() ) {
+      return;
+    }
+      
+    // Generated content
+    $this->_set_content();
+
+    // Collapse margins if required
+    $this->_collapse_margins();
+
+    $style = $this->_frame->get_style();
+    $cb = $this->_frame->get_containing_block();
+    
+    if ( $style->position === "fixed" ) {
+      $cb = $this->_frame->get_root()->get_containing_block();
+    }
+    
+    // Determine the constraints imposed by this frame: calculate the width
+    // of the content area:
+    list($w, $left_margin, $right_margin, $left, $right) = $this->_calculate_restricted_width();
+
+    // Store the calculated properties
+    $style->width = $w . "pt";
+    $style->margin_left = $left_margin."pt";
+    $style->margin_right = $right_margin."pt";
+    $style->left = $left ."pt";
+    $style->right = $right . "pt";
+    
+    // Update the position
+    $this->_frame->position();
+    list($x, $y) = $this->_frame->get_position();
+
+    // Adjust the first line based on the text-indent property
+    $indent = $style->length_in_pt($style->text_indent, $cb["w"]);
+    $this->_frame->increase_line_width($indent);
+
+    // Determine the content edge
+    $top = $style->length_in_pt(array($style->margin_top,
+                                      $style->padding_top,
+                                      $style->border_top_width), $cb["h"]);
+
+    $bottom = $style->length_in_pt(array($style->border_bottom_width,
+                                         $style->margin_bottom,
+                                         $style->padding_bottom), $cb["h"]);
+
+    $cb_x = $x + $left_margin + $style->length_in_pt(array($style->border_left_width, 
+                                                           $style->padding_left), $cb["w"]);
+
+    $cb_y = $y + $top;
+
+    $cb_h = ($cb["h"] + $cb["y"]) - $bottom - $cb_y;
+
+    // Set the y position of the first line in this block
+    $line_box = $this->_frame->get_current_line_box();
+    $line_box->y = $cb_y;
+    $line_box->get_float_offsets();
+    
+    // Set the containing blocks and reflow each child
+    foreach ( $this->_frame->get_children() as $child ) {
+      
+      // Bail out if the page is full
+      if ( $page->is_full() ) {
+        break;
+      }
+      
+      $child->set_containing_block($cb_x, $cb_y, $w, $cb_h);
+      
+      $this->process_clear($child);
+      
+      $child->reflow($this->_frame);
+      
+      // Don't add the child to the line if a page break has occurred
+      if ( $page->check_page_break($child) ) {
+        break;
+      }
+      
+      $this->process_float($child, $cb_x, $w);
+    }
+
+    // Determine our height
+    list($height, $margin_top, $margin_bottom, $top, $bottom) = $this->_calculate_restricted_height();
+    $style->height = $height;
+    $style->margin_top = $margin_top;
+    $style->margin_bottom = $margin_bottom;
+    $style->top = $top;
+    $style->bottom = $bottom;
+    
+    $needs_reposition = ($style->position === "absolute" && ($style->right !== "auto" || $style->bottom !== "auto"));
+    
+    // Absolute positioning measurement
+    if ( $needs_reposition ) {
+      $orig_style = $this->_frame->get_original_style();
+      if ( $orig_style->width === "auto" && ($orig_style->left === "auto" || $orig_style->right === "auto") ) {
+        $width = 0;
+        foreach ($this->_frame->get_line_boxes() as $line) {
+          $width = max($line->w, $width);
+        }
+        $style->width = $width;
+      }
+      
+      $style->left = $orig_style->left;
+      $style->right = $orig_style->right;
+    }
+
+    $this->_text_align();
+    $this->vertical_align();
+    
+    // Absolute positioning
+    if ( $needs_reposition ) {
+      list($x, $y) = $this->_frame->get_position();
+      $this->_frame->position();
+      list($new_x, $new_y) = $this->_frame->get_position();
+      $this->_frame->move($new_x-$x, $new_y-$y, true);
+    }
+    
+    if ( $block && $this->_frame->is_in_flow() ) {
+      $block->add_frame_to_line($this->_frame);
+      
+      // May be inline-block
+      if ( $style->display === "block" ) {
+        $block->add_line();
+      }
+    }
+  }
+}

vendor/dompdf/dompdf/include/block_positioner.cls.php

@@ -0,0 +1,57 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions block frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Block_Positioner extends Positioner {
+
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+  
+  //........................................................................
+
+  function position() {
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    $cb = $frame->get_containing_block();
+    $p = $frame->find_block_parent();
+    
+    if ( $p ) {
+      $float = $style->float;
+
+      $enable_css_float = $frame->get_dompdf()->get_option("enable_css_float");
+      if ( !$enable_css_float || !$float || $float === "none" ) {
+        $p->add_line(true);
+      }
+      $y = $p->get_current_line_box()->y;
+      
+    }
+    else {
+      $y = $cb["y"];
+    }
+
+    $x = $cb["x"];
+
+    // Relative positionning
+    if ( $style->position === "relative" ) {
+      $top =    $style->length_in_pt($style->top,    $cb["h"]);
+      //$right =  $style->length_in_pt($style->right,  $cb["w"]);
+      //$bottom = $style->length_in_pt($style->bottom, $cb["h"]);
+      $left =   $style->length_in_pt($style->left,   $cb["w"]);
+      
+      $x += $left;
+      $y += $top;
+    }
+    
+    $frame->set_position($x, $y);
+  }
+}

vendor/dompdf/dompdf/include/block_renderer.cls.php

@@ -0,0 +1,230 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Renders block frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Block_Renderer extends Abstract_Renderer {
+
+  //........................................................................
+
+  function render(Frame $frame) {
+    $style = $frame->get_style();
+    $node = $frame->get_node();
+
+    list($x, $y, $w, $h) = $frame->get_border_box();
+    
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+
+    if ( $node->nodeName === "body" ) {
+      $h = $frame->get_containing_block("h") - $style->length_in_pt(array(
+        $style->margin_top,
+        $style->border_top_width,
+        $style->border_bottom_width,
+        $style->margin_bottom),
+      $style->width);
+    }
+
+    // Handle anchors & links
+    if ( $node->nodeName === "a" && $href = $node->getAttribute("href") ) {
+      $this->_canvas->add_link($href, $x, $y, $w, $h);
+    }
+    
+    // Draw our background, border and content
+    list($tl, $tr, $br, $bl) = $style->get_computed_border_radius($w, $h);
+    
+    if ( $tl + $tr + $br + $bl > 0 ) {
+      $this->_canvas->clipping_roundrectangle( $x, $y, $w, $h, $tl, $tr, $br, $bl );
+    }
+      
+    if ( ($bg = $style->background_color) !== "transparent" ) {
+      $this->_canvas->filled_rectangle( $x, $y, $w, $h, $bg );
+    }
+
+    if ( ($url = $style->background_image) && $url !== "none" ) {
+      $this->_background_image($url, $x, $y, $w, $h, $style);
+    }
+    
+    if ( $tl + $tr + $br + $bl > 0 ) {
+      $this->_canvas->clipping_end();
+    }
+
+    $border_box = array($x, $y, $w, $h);
+    $this->_render_border($frame, $border_box);
+    $this->_render_outline($frame, $border_box);
+    
+    if (DEBUG_LAYOUT && DEBUG_LAYOUT_BLOCKS) {
+      $this->_debug_layout($frame->get_border_box(), "red");
+      if (DEBUG_LAYOUT_PADDINGBOX) {
+        $this->_debug_layout($frame->get_padding_box(), "red", array(0.5, 0.5));
+      }
+    }
+    
+    if (DEBUG_LAYOUT && DEBUG_LAYOUT_LINES && $frame->get_decorator()) {
+      foreach ($frame->get_decorator()->get_line_boxes() as $line) {
+        $frame->_debug_layout(array($line->x, $line->y, $line->w, $line->h), "orange");
+      }
+    }
+  }
+
+  protected function _render_border(Frame_Decorator $frame, $border_box = null, $corner_style = "bevel") {
+    $style = $frame->get_style();
+    $bp = $style->get_border_properties();
+
+    if ( empty($border_box) ) {
+      $border_box = $frame->get_border_box();
+    }
+    
+    // find the radius
+    $radius = $style->get_computed_border_radius($border_box[2], $border_box[3]); // w, h
+
+    // Short-cut: If all the borders are "solid" with the same color and style, and no radius, we'd better draw a rectangle
+    if (
+        in_array($bp["top"]["style"], array("solid", "dashed", "dotted")) && 
+        $bp["top"]    == $bp["right"] &&
+        $bp["right"]  == $bp["bottom"] &&
+        $bp["bottom"] == $bp["left"] &&
+        array_sum($radius) == 0
+    ) {
+      $props = $bp["top"];
+      if ( $props["color"] === "transparent" || $props["width"] <= 0 ) return;
+      
+      list($x, $y, $w, $h) = $border_box;
+      $width = $style->length_in_pt($props["width"]);
+      $pattern = $this->_get_dash_pattern($props["style"], $width);
+      $this->_canvas->rectangle($x + $width / 2, $y + $width / 2, $w - $width, $h - $width, $props["color"], $width, $pattern);
+      return;
+    }
+
+    // Do it the long way
+    $widths = array($style->length_in_pt($bp["top"]["width"]),
+                    $style->length_in_pt($bp["right"]["width"]),
+                    $style->length_in_pt($bp["bottom"]["width"]),
+                    $style->length_in_pt($bp["left"]["width"]));
+    
+    foreach ($bp as $side => $props) {
+      list($x, $y, $w, $h) = $border_box;
+      $length = 0;
+      $r1 = 0;
+      $r2 = 0;
+
+      if ( !$props["style"] || 
+            $props["style"] === "none" || 
+            $props["width"] <= 0 || 
+            $props["color"] == "transparent" )
+        continue;
+
+      switch($side) {
+      case "top":
+        $length = $w;
+        $r1 = $radius["top-left"];
+        $r2 = $radius["top-right"];
+        break;
+
+      case "bottom":
+        $length = $w;
+        $y += $h;
+        $r1 = $radius["bottom-left"];
+        $r2 = $radius["bottom-right"];
+        break;
+
+      case "left":
+        $length = $h;
+        $r1 = $radius["top-left"];
+        $r2 = $radius["bottom-left"];
+        break;
+
+      case "right":
+        $length = $h;
+        $x += $w;
+        $r1 = $radius["top-right"];
+        $r2 = $radius["bottom-right"];
+        break;
+      default:
+        break;
+      }
+      $method = "_border_" . $props["style"];
+    
+      // draw rounded corners
+      $this->$method($x, $y, $length, $props["color"], $widths, $side, $corner_style, $r1, $r2);
+    }
+  }
+
+  protected function _render_outline(Frame_Decorator $frame, $border_box = null, $corner_style = "bevel") {
+    $style = $frame->get_style();
+    
+    $props = array(
+      "width" => $style->outline_width,
+      "style" => $style->outline_style,
+      "color" => $style->outline_color,
+    );
+    
+    if ( !$props["style"] || $props["style"] === "none" || $props["width"] <= 0 )
+      return;
+
+    if ( empty($border_box) ) {
+      $border_box = $frame->get_border_box();
+    }
+
+    $offset = $style->length_in_pt($props["width"]);
+    $pattern = $this->_get_dash_pattern($props["style"], $offset);
+
+    // If the outline style is "solid" we'd better draw a rectangle
+    if ( in_array($props["style"], array("solid", "dashed", "dotted")) ) {
+      $border_box[0] -= $offset / 2;
+      $border_box[1] -= $offset / 2;
+      $border_box[2] += $offset;
+      $border_box[3] += $offset;
+    
+      list($x, $y, $w, $h) = $border_box;
+      $this->_canvas->rectangle($x, $y, $w, $h, $props["color"], $offset, $pattern);
+      return;
+    }
+
+    $border_box[0] -= $offset;
+    $border_box[1] -= $offset;
+    $border_box[2] += $offset * 2;
+    $border_box[3] += $offset * 2;
+    
+    $method = "_border_" . $props["style"];
+    $widths = array_fill(0, 4, $props["width"]);
+    $sides = array("top", "right", "left", "bottom");
+    $length = 0;
+    
+    foreach ($sides as $side) {
+      list($x, $y, $w, $h) = $border_box;
+
+      switch($side) {
+      case "top":
+        $length = $w;
+        break;
+
+      case "bottom":
+        $length = $w;
+        $y += $h;
+        break;
+
+      case "left":
+        $length = $h;
+        break;
+
+      case "right":
+        $length = $h;
+        $x += $w;
+        break;
+      default:
+        break;
+      }
+
+      $this->$method($x, $y, $length, $props["color"], $widths, $side, $corner_style);
+    }
+  }
+}

vendor/dompdf/dompdf/include/cached_pdf_decorator.cls.php

@@ -0,0 +1,164 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Caching canvas implementation
+ *
+ * Each rendered page is serialized and stored in the {@link Page_Cache}.
+ * This is useful for static forms/pages that do not need to be re-rendered
+ * all the time.
+ *
+ * This class decorates normal CPDF_Adapters.  It is currently completely
+ * experimental.
+ *
+ * @access private
+ * @package dompdf
+ */
+class Cached_PDF_Decorator extends CPDF_Adapter implements Canvas {
+  /**
+   * @var CPDF_Adapter
+   */
+  protected $_pdf;
+  protected $_cache_id;
+  protected $_current_page_id;
+  protected $_fonts;  // fonts used in this document
+  
+  function __construct($paper = "letter", $orientation = "portrait", DOMPDF $dompdf) {
+    $this->_fonts = array();
+  }
+
+  /**
+   * Must be called after constructor
+   *
+   * @param int          $cache_id
+   * @param CPDF_Adapter $pdf
+   */
+  function init($cache_id, CPDF_Adapter $pdf) {
+    $this->_cache_id = $cache_id;
+    $this->_pdf = $pdf;
+    $this->_current_page_id = $this->_pdf->open_object();
+  }
+
+  //........................................................................
+
+  function get_cpdf() { return $this->_pdf->get_cpdf(); }
+
+  function open_object() { $this->_pdf->open_object(); }
+  function reopen_object($object) { $this->_pdf->reopen_object($object); }
+  
+  function close_object() { $this->_pdf->close_object(); }
+
+  function add_object($object, $where = 'all') { $this->_pdf->add_object($object, $where); }
+
+  function serialize_object($id) { $this->_pdf->serialize_object($id); }
+
+  function reopen_serialized_object($obj) { $this->_pdf->reopen_serialized_object($obj); }
+    
+  //........................................................................
+
+  function get_width() { return $this->_pdf->get_width(); }
+  function get_height() {  return $this->_pdf->get_height(); }
+  function get_page_number() { return $this->_pdf->get_page_number(); }
+  function get_page_count() { return $this->_pdf->get_page_count(); }
+
+  function set_page_number($num) { $this->_pdf->set_page_number($num); }
+  function set_page_count($count) { $this->_pdf->set_page_count($count); }
+
+  function line($x1, $y1, $x2, $y2, $color, $width, $style = array()) {
+    $this->_pdf->line($x1, $y1, $x2, $y2, $color, $width, $style);
+  }
+                              
+  function rectangle($x1, $y1, $w, $h, $color, $width, $style = array()) {
+    $this->_pdf->rectangle($x1, $y1, $w, $h, $color, $width, $style);
+  }
+ 
+  function filled_rectangle($x1, $y1, $w, $h, $color) {
+    $this->_pdf->filled_rectangle($x1, $y1, $w, $h, $color);
+  }
+    
+  function polygon($points, $color, $width = null, $style = array(), $fill = false) {
+    $this->_pdf->polygon($points, $color, $width, $style, $fill);
+  }
+
+  function circle($x, $y, $r1, $color, $width = null, $style = null, $fill = false) {
+    $this->_pdf->circle($x, $y, $r1, $color, $width, $style, $fill);
+  }
+
+  function image($img_url, $x, $y, $w, $h, $resolution = "normal") {
+    $this->_pdf->image($img_url, $x, $y, $w, $h, $resolution);
+  }
+  
+  function text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_space = 0.0, $char_space = 0.0, $angle = 0.0) {
+    $this->_fonts[$font] = true;
+    $this->_pdf->text($x, $y, $text, $font, $size, $color, $word_space, $char_space, $angle);
+  }
+
+  function page_text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_space = 0.0, $char_space = 0.0, $angle = 0.0) {
+    
+    // We want to remove this from cached pages since it may not be correct
+    $this->_pdf->close_object();
+    $this->_pdf->page_text($x, $y, $text, $font, $size, $color, $word_space, $char_space, $angle);
+    $this->_pdf->reopen_object($this->_current_page_id);
+  }
+  
+  function page_script($script, $type = 'text/php') {
+    
+    // We want to remove this from cached pages since it may not be correct
+    $this->_pdf->close_object();
+    $this->_pdf->page_script($script, $type);
+    $this->_pdf->reopen_object($this->_current_page_id);
+  }
+  
+  function new_page() {
+    $this->_pdf->close_object();
+
+    // Add the object to the current page
+    $this->_pdf->add_object($this->_current_page_id, "add");
+    $this->_pdf->new_page();    
+
+    Page_Cache::store_page($this->_cache_id,
+                           $this->_pdf->get_page_number() - 1,
+                           $this->_pdf->serialize_object($this->_current_page_id));
+
+    $this->_current_page_id = $this->_pdf->open_object();
+    return $this->_current_page_id;
+  }
+  
+  function stream($filename, $options = null) {
+    // Store the last page in the page cache
+    if ( !is_null($this->_current_page_id) ) {
+      $this->_pdf->close_object();
+      $this->_pdf->add_object($this->_current_page_id, "add");
+      Page_Cache::store_page($this->_cache_id,
+                             $this->_pdf->get_page_number(),
+                             $this->_pdf->serialize_object($this->_current_page_id));
+      Page_Cache::store_fonts($this->_cache_id, $this->_fonts);
+      $this->_current_page_id = null;
+    }
+    
+    $this->_pdf->stream($filename);
+    
+  }
+  
+  function output($options = null) {
+    // Store the last page in the page cache
+    if ( !is_null($this->_current_page_id) ) {
+      $this->_pdf->close_object();
+      $this->_pdf->add_object($this->_current_page_id, "add");
+      Page_Cache::store_page($this->_cache_id,
+                             $this->_pdf->get_page_number(),
+                             $this->_pdf->serialize_object($this->_current_page_id));
+      $this->_current_page_id = null;
+    }
+    
+    return $this->_pdf->output();
+  }
+  
+  function get_messages() { return $this->_pdf->get_messages(); }
+  
+}

vendor/dompdf/dompdf/include/canvas.cls.php

@@ -0,0 +1,385 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Main rendering interface
+ *
+ * Currently {@link CPDF_Adapter}, {@link PDFLib_Adapter}, {@link TCPDF_Adapter}, and {@link GD_Adapter}
+ * implement this interface.
+ *
+ * Implementations should measure x and y increasing to the left and down,
+ * respectively, with the origin in the top left corner.  Implementations
+ * are free to use a unit other than points for length, but I can't
+ * guarantee that the results will look any good.
+ *
+ * @package dompdf
+ */
+interface Canvas {
+  function __construct($paper = "letter", $orientation = "portrait", DOMPDF $dompdf);
+
+  /**
+   * @return DOMPDF
+   */
+  function get_dompdf();
+
+  /**
+   * Returns the current page number
+   *
+   * @return int
+   */
+  function get_page_number();
+
+  /**
+   * Returns the total number of pages
+   *
+   * @return int
+   */
+  function get_page_count();
+
+  /**
+   * Sets the total number of pages
+   *
+   * @param int $count
+   */
+  function set_page_count($count);
+
+  /**
+   * Draws a line from x1,y1 to x2,y2
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the format of the
+   * $style parameter (aka dash).
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $x2
+   * @param float $y2
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   */
+  function line($x1, $y1, $x2, $y2, $color, $width, $style = null);
+
+  /**
+   * Draws a rectangle at x1,y1 with width w and height h
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   */   
+  function rectangle($x1, $y1, $w, $h, $color, $width, $style = null);
+
+  /**
+   * Draws a filled rectangle at x1,y1 with width w and height h
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   * @param array $color
+   */   
+  function filled_rectangle($x1, $y1, $w, $h, $color);
+
+  /**
+   * Starts a clipping rectangle at x1,y1 with width w and height h
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   */   
+  function clipping_rectangle($x1, $y1, $w, $h);
+
+  /**
+   * Starts a rounded clipping rectangle at x1,y1 with width w and height h
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   * @param float $tl
+   * @param float $tr
+   * @param float $br
+   * @param float $bl
+   *
+   * @return
+   */
+  function clipping_roundrectangle($x1, $y1, $w, $h, $tl, $tr, $br, $bl);
+  
+  /**
+   * Ends the last clipping shape
+   */  
+  function clipping_end();
+  
+  /**
+   * Save current state
+   */
+  function save();
+  
+  /**
+   * Restore last state
+   */
+  function restore();
+  
+  /**
+   * Rotate
+   */
+  function rotate($angle, $x, $y);
+  
+  /**
+   * Skew
+   */
+  function skew($angle_x, $angle_y, $x, $y);
+  
+  /**
+   * Scale
+   */
+  function scale($s_x, $s_y, $x, $y);
+  
+  /**
+   * Translate
+   */
+  function translate($t_x, $t_y);
+  
+  /**
+   * Transform
+   */
+  function transform($a, $b, $c, $d, $e, $f);
+  
+  /**
+   * Draws a polygon
+   *
+   * The polygon is formed by joining all the points stored in the $points
+   * array.  $points has the following structure:
+   * <code>
+   * array(0 => x1,
+   *       1 => y1,
+   *       2 => x2,
+   *       3 => y2,
+   *       ...
+   *       );
+   * </code>
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)   
+   *
+   * @param array $points
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   * @param bool  $fill  Fills the polygon if true
+   */
+  function polygon($points, $color, $width = null, $style = null, $fill = false);
+
+  /**
+   * Draws a circle at $x,$y with radius $r
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)
+   *
+   * @param float $x
+   * @param float $y
+   * @param float $r
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   * @param bool $fill Fills the circle if true   
+   */   
+  function circle($x, $y, $r, $color, $width = null, $style = null, $fill = false);
+
+  /**
+   * Add an image to the pdf.
+   *
+   * The image is placed at the specified x and y coordinates with the
+   * given width and height.
+   *
+   * @param string $img_url the path to the image
+   * @param float $x x position
+   * @param float $y y position
+   * @param int $w width (in pixels)
+   * @param int $h height (in pixels)
+   * @param string $resolution The resolution of the image
+   */
+  function image($img_url, $x, $y, $w, $h, $resolution = "normal");
+
+  /**
+   * Add an arc to the PDF
+   * See {@link Style::munge_color()} for the format of the color array.
+   *
+   * @param float $x      X coordinate of the arc
+   * @param float $y      Y coordinate of the arc
+   * @param float $r1     Radius 1
+   * @param float $r2     Radius 2
+   * @param float $astart Start angle in degrees
+   * @param float $aend   End angle in degrees
+   * @param array $color  Color
+   * @param float $width
+   * @param array $style
+   *
+   * @return void
+   */
+  function arc($x, $y, $r1, $r2, $astart, $aend, $color, $width, $style = array());
+
+  /**
+   * Writes text at the specified x and y coordinates
+   * See {@link Style::munge_color()} for the format of the color array.
+   *
+   * @param float  $x
+   * @param float  $y
+   * @param string $text       the text to write
+   * @param string $font       the font file to use
+   * @param float  $size       the font size, in points
+   * @param array  $color
+   * @param float  $word_space word spacing adjustment
+   * @param float  $char_space char spacing adjustment
+   * @param float  $angle      angle
+   *
+   * @return void
+   */
+  function text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_space = 0.0, $char_space = 0.0, $angle = 0.0);
+
+  /**
+   * Add a named destination (similar to <a name="foo">...</a> in html)
+   *
+   * @param string $anchorname The name of the named destination
+   */
+  function add_named_dest($anchorname);
+
+  /**
+   * Add a link to the pdf
+   *
+   * @param string $url    The url to link to
+   * @param float  $x      The x position of the link
+   * @param float  $y      The y position of the link
+   * @param float  $width  The width of the link
+   * @param float  $height The height of the link
+   *
+   * @return void
+   */
+  function add_link($url, $x, $y, $width, $height);
+
+  /**
+   * Add meta information to the pdf
+   *
+   * @param string $name  Label of the value (Creator, Producer, etc.)
+   * @param string $value The text to set
+   */
+  function add_info($name, $value);
+  
+  /**
+   * Calculates text size, in points
+   *
+   * @param string $text the text to be sized
+   * @param string $font the desired font
+   * @param float  $size the desired font size
+   * @param float  $word_spacing word spacing, if any
+   * @param float  $char_spacing
+   *
+   * @return float
+   */
+  function get_text_width($text, $font, $size, $word_spacing = 0.0, $char_spacing = 0.0);
+
+  /**
+   * Calculates font height, in points
+   *
+   * @param string $font
+   * @param float  $size
+   *
+   * @return float
+   */
+  function get_font_height($font, $size);
+
+  /**
+   * Calculates font baseline, in points
+   *
+   * @param string $font
+   * @param float  $size
+   *
+   * @return float
+   */
+  function get_font_baseline($font, $size);
+  
+  /**
+   * Returns the font x-height, in points
+   *
+   * @param string $font
+   * @param float  $size
+   *
+   * @return float
+   */
+  //function get_font_x_height($font, $size);
+  
+  /**
+   * Sets the opacity
+   *
+   * @param float  $opacity
+   * @param string $mode
+   */
+  function set_opacity($opacity, $mode = "Normal");
+
+  /**
+   * Sets the default view
+   *
+   * @param string $view
+   * 'XYZ'  left, top, zoom
+   * 'Fit'
+   * 'FitH' top
+   * 'FitV' left
+   * 'FitR' left,bottom,right
+   * 'FitB'
+   * 'FitBH' top
+   * 'FitBV' left
+   * @param array  $options
+   *
+   * @return void
+   */
+  function set_default_view($view, $options = array());
+
+  /**
+   * @param string $script
+   *
+   * @return void
+   */
+  function javascript($script);
+
+  /**
+   * Starts a new page
+   *
+   * Subsequent drawing operations will appear on the new page.
+   */
+  function new_page();
+
+  /**
+   * Streams the PDF directly to the browser
+   *
+   * @param string $filename the name of the PDF file
+   * @param array  $options associative array, 'Attachment' => 0 or 1, 'compress' => 1 or 0
+   */
+  function stream($filename, $options = null);
+
+  /**
+   * Returns the PDF as a string
+   *
+   * @param array  $options associative array: 'compress' => 1 or 0
+   * @return string
+   */
+  function output($options = null);
+}

vendor/dompdf/dompdf/include/canvas_factory.cls.php

@@ -0,0 +1,63 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Create canvas instances
+ *
+ * The canvas factory creates canvas instances based on the
+ * availability of rendering backends and config options.
+ *
+ * @package dompdf
+ */
+class Canvas_Factory {
+
+  /**
+   * Constructor is private: this is a static class
+   */
+  private function __construct() { }
+
+  /**
+   * @param DOMPDF       $dompdf
+   * @param string|array $paper
+   * @param string       $orientation
+   * @param string       $class
+   *
+   * @return Canvas
+   */
+  static function get_instance(DOMPDF $dompdf, $paper = null, $orientation = null, $class = null) {
+
+    $backend = strtolower(DOMPDF_PDF_BACKEND);
+    
+    if ( isset($class) && class_exists($class, false) ) {
+      $class .= "_Adapter";
+    }
+    
+    else if ( (DOMPDF_PDF_BACKEND === "auto" || $backend === "pdflib" ) &&
+              class_exists("PDFLib", false) ) {
+      $class = "PDFLib_Adapter";
+    }
+
+    // FIXME The TCPDF adapter is not ready yet
+    //else if ( (DOMPDF_PDF_BACKEND === "auto" || $backend === "cpdf") )
+    //  $class = "CPDF_Adapter";
+
+    else if ( $backend === "tcpdf" ) {
+      $class = "TCPDF_Adapter";
+    }
+      
+    else if ( $backend === "gd" ) {
+      $class = "GD_Adapter";
+    }
+    
+    else {
+      $class = "CPDF_Adapter";
+    }
+
+    return new $class($paper, $orientation, $dompdf);
+  }
+}

vendor/dompdf/dompdf/include/cellmap.cls.php

@@ -0,0 +1,790 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Maps table cells to the table grid.
+ *
+ * This class resolves borders in tables with collapsed borders and helps
+ * place row & column spanned table cells.
+ *
+ * @access private
+ * @package dompdf
+ */
+class Cellmap {
+
+  /**
+   * Border style weight lookup for collapsed border resolution.
+   *
+   * @var array
+   */
+  static protected $_BORDER_STYLE_SCORE = array(
+    "inset"  => 1,
+    "groove" => 2,
+    "outset" => 3,
+    "ridge"  => 4,
+    "dotted" => 5,
+    "dashed" => 6,
+    "solid"  => 7,
+    "double" => 8,
+    "hidden" => 9,
+    "none"   => 0,
+   );
+
+  /**
+   * The table object this cellmap is attached to.
+   *
+   * @var Table_Frame_Decorator
+   */
+  protected $_table;
+
+  /**
+   * The total number of rows in the table
+   *
+   * @var int
+   */
+  protected $_num_rows;
+
+  /**
+   * The total number of columns in the table
+   *
+   * @var int
+   */
+  protected $_num_cols;
+
+  /**
+   * 2D array mapping <row,column> to frames
+   *
+   * @var Frame[][]
+   */
+  protected $_cells;
+
+  /**
+   * 1D array of column dimensions
+   *
+   * @var array
+   */
+  protected $_columns;
+
+  /**
+   * 1D array of row dimensions
+   *
+   * @var array
+   */
+  protected $_rows;
+
+  /**
+   * 2D array of border specs
+   *
+   * @var array
+   */
+  protected $_borders;
+
+  /**
+   * 1D Array mapping frames to (multiple) <row, col> pairs, keyed on frame_id.
+   *
+   * @var Frame[]
+   */
+  protected $_frames;
+
+  /**
+   * Current column when adding cells, 0-based
+   *
+   * @var int
+   */
+  private $__col;
+
+  /**
+   * Current row when adding cells, 0-based
+   *
+   * @var int
+   */
+  private $__row;
+  
+  /**
+   * Tells wether the columns' width can be modified
+   *
+   * @var bool
+   */
+  private $_columns_locked = false;
+  
+  /**
+   * Tells wether the table has table-layout:fixed
+   *
+   * @var bool
+   */
+  private $_fixed_layout = false;
+
+  //........................................................................
+
+  function __construct(Table_Frame_Decorator $table) {
+    $this->_table = $table;
+    $this->reset();
+  }
+  
+  function __destruct() {
+    clear_object($this);
+  }
+  //........................................................................
+
+  function reset() {
+    $this->_num_rows = 0;
+    $this->_num_cols = 0;
+
+    $this->_cells  = array();
+    $this->_frames = array();
+
+    if ( !$this->_columns_locked ) {
+      $this->_columns = array();
+    }
+    
+    $this->_rows = array();
+
+    $this->_borders = array();
+
+    $this->__col = $this->__row = 0;
+  }
+
+  //........................................................................
+
+  function lock_columns() { 
+    $this->_columns_locked = true; 
+  }
+
+  function is_columns_locked() {
+    return $this->_columns_locked;
+  }
+  
+  function set_layout_fixed($fixed) { 
+    $this->_fixed_layout = $fixed; 
+  }
+
+  function is_layout_fixed() {
+    return $this->_fixed_layout;
+  }
+  
+  function get_num_rows() { return $this->_num_rows; }
+  function get_num_cols() { return $this->_num_cols; }
+
+  function &get_columns() {
+    return $this->_columns;
+  }
+
+  function set_columns($columns) {
+    $this->_columns = $columns;
+  }
+
+  function &get_column($i) {
+    if ( !isset($this->_columns[$i]) ) {
+      $this->_columns[$i] = array(
+        "x" => 0,
+        "min-width" => 0,
+        "max-width" => 0,
+        "used-width" => null,
+        "absolute" => 0,
+        "percent" => 0,
+        "auto" => true,
+      );
+    }
+    
+    return $this->_columns[$i];
+  }
+
+  function &get_rows() {
+    return $this->_rows;
+  }
+
+  function &get_row($j) {
+    if ( !isset($this->_rows[$j]) ) {
+      $this->_rows[$j] = array(
+        "y" => 0,
+        "first-column" => 0,
+        "height" => null,
+      );
+    }
+    
+    return $this->_rows[$j];
+  }
+
+  function get_border($i, $j, $h_v, $prop = null) {
+    if ( !isset($this->_borders[$i][$j][$h_v]) ) {
+      $this->_borders[$i][$j][$h_v] = array(
+        "width" => 0,
+        "style" => "solid",
+        "color" => "black",
+      );
+    }
+    
+    if ( isset($prop) ) {
+      return $this->_borders[$i][$j][$h_v][$prop];
+    }
+    
+    return $this->_borders[$i][$j][$h_v];
+  }
+
+  function get_border_properties($i, $j) {
+    return array(
+      "top"    => $this->get_border($i,   $j,   "horizontal"), 
+      "right"  => $this->get_border($i,   $j+1, "vertical"),
+      "bottom" => $this->get_border($i+1, $j,   "horizontal"), 
+      "left"   => $this->get_border($i,   $j,   "vertical"),
+    );
+  }
+
+  //........................................................................
+
+  function get_spanned_cells(Frame $frame) {
+    $key = $frame->get_id();
+
+    if ( !isset($this->_frames[$key]) ) {
+      throw new DOMPDF_Exception("Frame not found in cellmap");
+    }
+
+    return $this->_frames[$key];
+
+  }
+
+  function frame_exists_in_cellmap(Frame $frame) {
+    $key = $frame->get_id();
+    return isset($this->_frames[$key]);
+  }
+  
+  function get_frame_position(Frame $frame) {
+    global $_dompdf_warnings;
+
+    $key = $frame->get_id();
+
+    if ( !isset($this->_frames[$key]) ) {
+      throw new DOMPDF_Exception("Frame not found in cellmap");
+    }
+
+    $col = $this->_frames[$key]["columns"][0];
+    $row = $this->_frames[$key]["rows"][0];
+
+    if ( !isset($this->_columns[$col])) {
+      $_dompdf_warnings[] = "Frame not found in columns array.  Check your table layout for missing or extra TDs.";
+      $x = 0;
+    }
+    else {
+      $x = $this->_columns[$col]["x"];
+    }
+
+    if ( !isset($this->_rows[$row])) {
+      $_dompdf_warnings[] = "Frame not found in row array.  Check your table layout for missing or extra TDs.";
+      $y = 0;
+    }
+    else {
+      $y = $this->_rows[$row]["y"];
+    }
+
+    return array($x, $y, "x" => $x, "y" => $y);
+  }
+
+  function get_frame_width(Frame $frame) {
+    $key = $frame->get_id();
+
+    if ( !isset($this->_frames[$key]) ) {
+      throw new DOMPDF_Exception("Frame not found in cellmap");
+    }
+
+    $cols = $this->_frames[$key]["columns"];
+    $w = 0;
+    foreach ($cols as $i) {
+      $w += $this->_columns[$i]["used-width"];
+    }
+    
+    return $w;
+  }
+
+  function get_frame_height(Frame $frame) {
+    $key = $frame->get_id();
+
+    if ( !isset($this->_frames[$key]) ) {
+      throw new DOMPDF_Exception("Frame not found in cellmap");
+    }
+
+    $rows = $this->_frames[$key]["rows"];
+    $h = 0;
+    foreach ($rows as $i) {
+      if ( !isset($this->_rows[$i]) )  {
+        throw new Exception("The row #$i could not be found, please file an issue in the tracker with the HTML code");
+      }
+      
+      $h += $this->_rows[$i]["height"];
+    }
+    
+    return $h;
+  }
+
+
+  //........................................................................
+
+  function set_column_width($j, $width) {
+    if ( $this->_columns_locked ) {
+      return;
+    }
+    
+    $col =& $this->get_column($j);
+    $col["used-width"] = $width;
+    $next_col =& $this->get_column($j+1);
+    $next_col["x"] = $next_col["x"] + $width;
+  }
+
+  function set_row_height($i, $height) {
+    $row =& $this->get_row($i);
+    
+    if ( $row["height"] !== null && $height <= $row["height"] ) {
+      return;
+    }
+
+    $row["height"] = $height;
+    $next_row =& $this->get_row($i+1);
+    $next_row["y"] = $row["y"] + $height;
+
+  }
+
+  //........................................................................
+
+
+  protected function _resolve_border($i, $j, $h_v, $border_spec) {
+    $n_width = $border_spec["width"];
+    $n_style = $border_spec["style"];
+
+    if ( !isset($this->_borders[$i][$j][$h_v]) ) {
+      $this->_borders[$i][$j][$h_v] = $border_spec;
+      return $this->_borders[$i][$j][$h_v]["width"];
+    }
+    
+    $border = &$this->_borders[$i][$j][$h_v];
+    
+    $o_width = $border["width"];
+    $o_style = $border["style"];
+
+    if ( ($n_style === "hidden" ||
+          $n_width  >  $o_width ||
+          $o_style === "none")
+
+         or
+
+         ($o_width == $n_width &&
+          in_array($n_style, self::$_BORDER_STYLE_SCORE) &&
+          self::$_BORDER_STYLE_SCORE[ $n_style ] > self::$_BORDER_STYLE_SCORE[ $o_style ]) ) {
+      $border = $border_spec;
+    }
+
+    return $border["width"];
+  }
+
+  //........................................................................
+
+  function add_frame(Frame $frame) {
+    
+    $style = $frame->get_style();
+    $display = $style->display;
+
+    $collapse = $this->_table->get_style()->border_collapse == "collapse";
+
+    // Recursively add the frames within tables, table-row-groups and table-rows
+    if ( $display === "table-row" ||
+         $display === "table" ||
+         $display === "inline-table" ||
+         in_array($display, Table_Frame_Decorator::$ROW_GROUPS) ) {
+
+      $start_row = $this->__row;
+      foreach ( $frame->get_children() as $child ) {
+        $this->add_frame( $child );
+      }
+
+      if ( $display === "table-row" ) {
+        $this->add_row();
+      }
+
+      $num_rows = $this->__row - $start_row - 1;
+      $key = $frame->get_id();
+
+      // Row groups always span across the entire table
+      $this->_frames[$key]["columns"] = range(0,max(0,$this->_num_cols-1));
+      $this->_frames[$key]["rows"] = range($start_row, max(0, $this->__row - 1));
+      $this->_frames[$key]["frame"] = $frame;
+
+      if ( $display !== "table-row" && $collapse ) {
+
+        $bp = $style->get_border_properties();
+
+        // Resolve the borders
+        for ( $i = 0; $i < $num_rows+1; $i++) {
+          $this->_resolve_border($start_row + $i, 0, "vertical", $bp["left"]);
+          $this->_resolve_border($start_row + $i, $this->_num_cols, "vertical", $bp["right"]);
+        }
+
+        for ( $j = 0; $j < $this->_num_cols; $j++) {
+          $this->_resolve_border($start_row, $j, "horizontal", $bp["top"]);
+          $this->_resolve_border($this->__row, $j, "horizontal", $bp["bottom"]);
+        }
+      }
+
+
+      return;
+    }
+    
+    $node = $frame->get_node();
+    
+    // Determine where this cell is going
+    $colspan = $node->getAttribute("colspan");
+    $rowspan = $node->getAttribute("rowspan");
+
+    if ( !$colspan ) {
+      $colspan = 1;
+      $node->setAttribute("colspan",1);
+    }
+
+    if ( !$rowspan ) {
+      $rowspan = 1;
+      $node->setAttribute("rowspan",1);
+    }
+    $key = $frame->get_id();
+
+    $bp = $style->get_border_properties();
+
+
+    // Add the frame to the cellmap
+    $max_left = $max_right = 0;
+
+    // Find the next available column (fix by Ciro Mondueri)
+    $ac = $this->__col;
+    while ( isset($this->_cells[$this->__row][$ac]) ) {
+       $ac++;
+    }
+    
+    $this->__col = $ac;
+
+    // Rows:
+    for ( $i = 0; $i < $rowspan; $i++ ) {
+      $row = $this->__row + $i;
+
+      $this->_frames[$key]["rows"][] = $row;
+
+      for ( $j = 0; $j < $colspan; $j++) {
+        $this->_cells[$row][$this->__col + $j] = $frame;
+      }
+
+      if ( $collapse ) {
+        // Resolve vertical borders
+        $max_left = max($max_left, $this->_resolve_border($row, $this->__col, "vertical", $bp["left"]));
+        $max_right = max($max_right, $this->_resolve_border($row, $this->__col + $colspan, "vertical", $bp["right"]));
+      }
+    }
+
+    $max_top = $max_bottom = 0;
+
+    // Columns:
+    for ( $j = 0; $j < $colspan; $j++ ) {
+      $col = $this->__col + $j;
+      $this->_frames[$key]["columns"][] = $col;
+
+      if ( $collapse ) {
+        // Resolve horizontal borders
+        $max_top = max($max_top, $this->_resolve_border($this->__row, $col, "horizontal", $bp["top"]));
+        $max_bottom = max($max_bottom, $this->_resolve_border($this->__row + $rowspan, $col, "horizontal", $bp["bottom"]));
+      }
+    }
+
+    $this->_frames[$key]["frame"] = $frame;
+
+    // Handle seperated border model
+    if ( !$collapse ) {
+      list($h, $v) = $this->_table->get_style()->border_spacing;
+
+      // Border spacing is effectively a margin between cells
+      $v = $style->length_in_pt($v) / 2;
+      $h = $style->length_in_pt($h) / 2;
+      $style->margin = "$v $h";
+
+      // The additional 1/2 width gets added to the table proper
+    }
+    else {
+      // Drop the frame's actual border
+      $style->border_left_width = $max_left / 2;
+      $style->border_right_width = $max_right / 2;
+      $style->border_top_width = $max_top / 2;
+      $style->border_bottom_width = $max_bottom / 2;
+      $style->margin = "none";
+    }
+
+    if ( !$this->_columns_locked ) {
+      // Resolve the frame's width
+      if ( $this->_fixed_layout ) {
+        list($frame_min, $frame_max) = array(0, 10e-10);
+      }
+      else {
+        list($frame_min, $frame_max) = $frame->get_min_max_width();
+      }
+  
+      $width = $style->width;
+
+      $val = null;
+      if ( is_percent($width) ) {
+        $var = "percent";
+        $val = (float)rtrim($width, "% ") / $colspan;
+      }
+      else if ( $width !== "auto" ) {
+        $var = "absolute";
+        $val = $style->length_in_pt($frame_min) / $colspan;
+      }
+      
+      $min = 0;
+      $max = 0;
+      for ( $cs = 0; $cs < $colspan; $cs++ ) {
+  
+        // Resolve the frame's width(s) with other cells
+        $col =& $this->get_column( $this->__col + $cs );
+  
+        // Note: $var is either 'percent' or 'absolute'.  We compare the
+        // requested percentage or absolute values with the existing widths
+        // and adjust accordingly.
+        if ( isset($var) && $val > $col[$var] ) {
+          $col[$var] = $val;
+          $col["auto"] = false;
+        }
+  
+        $min += $col["min-width"];
+        $max += $col["max-width"];
+      }
+  
+      if ( $frame_min > $min ) {
+        // The frame needs more space.  Expand each sub-column
+        // FIXME try to avoid putting this dummy value when table-layout:fixed
+        $inc = ($this->is_layout_fixed() ? 10e-10 : ($frame_min - $min) / $colspan);
+        for ($c = 0; $c < $colspan; $c++) {
+          $col =& $this->get_column($this->__col + $c);
+          $col["min-width"] += $inc;
+        }
+      }
+  
+      if ( $frame_max > $max ) {
+        // FIXME try to avoid putting this dummy value when table-layout:fixed
+        $inc = ($this->is_layout_fixed() ? 10e-10 : ($frame_max - $max) / $colspan);
+        for ($c = 0; $c < $colspan; $c++) {
+          $col =& $this->get_column($this->__col + $c);
+          $col["max-width"] += $inc;
+        }
+      }
+    }
+
+    $this->__col += $colspan;
+    if ( $this->__col > $this->_num_cols )
+      $this->_num_cols = $this->__col;
+
+  }
+
+  //........................................................................
+
+  function add_row() {
+
+    $this->__row++;
+    $this->_num_rows++;
+
+    // Find the next available column
+    $i = 0;
+    while ( isset($this->_cells[$this->__row][$i]) ) {
+      $i++;
+    }
+
+    $this->__col = $i;
+
+  }
+
+  //........................................................................
+
+  /**
+   * Remove a row from the cellmap.
+   *
+   * @param Frame
+   */
+  function remove_row(Frame $row) {
+
+    $key = $row->get_id();
+    if ( !isset($this->_frames[$key]) ) {
+      return;  // Presumably this row has alredy been removed
+    }
+
+    $this->_row = $this->_num_rows--;
+
+    $rows = $this->_frames[$key]["rows"];
+    $columns = $this->_frames[$key]["columns"];
+
+    // Remove all frames from this row
+    foreach ( $rows as $r ) {
+      foreach ( $columns as $c ) {
+        if ( isset($this->_cells[$r][$c]) ) {
+          $id = $this->_cells[$r][$c]->get_id();
+          
+          $this->_frames[$id] = null;
+          unset($this->_frames[$id]);
+          
+          $this->_cells[$r][$c] = null;
+          unset($this->_cells[$r][$c]);
+        }
+      }
+      
+      $this->_rows[$r] = null;
+      unset($this->_rows[$r]);
+    }
+
+    $this->_frames[$key] = null;
+    unset($this->_frames[$key]);
+
+  }
+
+  /**
+   * Remove a row group from the cellmap.
+   *
+   * @param Frame $group  The group to remove
+   */
+  function remove_row_group(Frame $group) {
+
+    $key = $group->get_id();
+    if ( !isset($this->_frames[$key]) ) {
+      return;  // Presumably this row has alredy been removed
+    }
+    
+    $iter = $group->get_first_child();
+    while ($iter) {
+      $this->remove_row($iter);
+      $iter = $iter->get_next_sibling();
+    }
+
+    $this->_frames[$key] = null;
+    unset($this->_frames[$key]);
+  }
+
+  /**
+   * Update a row group after rows have been removed
+   *
+   * @param Frame $group    The group to update
+   * @param Frame $last_row The last row in the row group
+   */
+  function update_row_group(Frame $group, Frame $last_row) {
+
+    $g_key = $group->get_id();
+    $r_key = $last_row->get_id();
+
+    $r_rows = $this->_frames[$r_key]["rows"];
+    $this->_frames[$g_key]["rows"] = range( $this->_frames[$g_key]["rows"][0], end($r_rows) );
+
+  }
+
+  //........................................................................
+
+  function assign_x_positions() {
+    // Pre-condition: widths must be resolved and assigned to columns and
+    // column[0]["x"] must be set.
+
+    if ( $this->_columns_locked ) {
+      return;
+    }
+    
+    $x = $this->_columns[0]["x"];
+    foreach ( array_keys($this->_columns) as $j ) {
+      $this->_columns[$j]["x"] = $x;
+      $x += $this->_columns[$j]["used-width"];
+    }
+
+  }
+
+  function assign_frame_heights() {
+    // Pre-condition: widths and heights of each column & row must be
+    // calcluated
+
+    foreach ( $this->_frames as $arr ) {
+      $frame = $arr["frame"];
+
+      $h = 0;
+      foreach( $arr["rows"] as $row ) {
+        if ( !isset($this->_rows[$row]) ) {
+          // The row has been removed because of a page split, so skip it.
+          continue;
+        }
+        
+        $h += $this->_rows[$row]["height"];
+      }
+
+      if ( $frame instanceof Table_Cell_Frame_Decorator ) {
+        $frame->set_cell_height($h);
+      }
+      else {
+        $frame->get_style()->height = $h;
+      }
+    }
+
+  }
+
+  //........................................................................
+
+  /**
+   * Re-adjust frame height if the table height is larger than its content
+   */
+  function set_frame_heights($table_height, $content_height) {
+
+
+    // Distribute the increased height proportionally amongst each row
+    foreach ( $this->_frames as $arr ) {
+      $frame = $arr["frame"];
+
+      $h = 0;
+      foreach ($arr["rows"] as $row ) {
+        if ( !isset($this->_rows[$row]) ) {
+          continue;
+        }
+
+        $h += $this->_rows[$row]["height"];
+      }
+      
+      if ( $content_height > 0 ) {
+        $new_height = ($h / $content_height) * $table_height;
+      }
+      else {
+        $new_height = 0;
+      }
+
+      if ( $frame instanceof Table_Cell_Frame_Decorator ) {
+        $frame->set_cell_height($new_height);
+      }
+      else {
+        $frame->get_style()->height = $new_height;
+      }
+    }
+
+  }
+
+  //........................................................................
+
+  // Used for debugging:
+  function __toString() {
+    $str = "";
+    $str .= "Columns:<br/>";
+    $str .= pre_r($this->_columns, true);
+    $str .=  "Rows:<br/>";
+    $str .= pre_r($this->_rows, true);
+
+    $str .=  "Frames:<br/>";
+    $arr = array();
+    foreach ( $this->_frames as $key => $val ) {
+      $arr[$key] = array("columns" => $val["columns"], "rows" => $val["rows"]);
+    }
+    
+    $str .= pre_r($arr, true);
+
+    if ( php_sapi_name() == "cli" ) {
+      $str = strip_tags(str_replace(array("<br/>","<b>","</b>"),
+                                    array("\n",chr(27)."[01;33m", chr(27)."[0m"),
+                                    $str));
+    }
+    
+    return $str;
+  }
+}

vendor/dompdf/dompdf/include/cpdf_adapter.cls.php

@@ -0,0 +1,877 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Orion Richardson <orionr@yahoo.com>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+// FIXME: Need to sanity check inputs to this class
+require_once(DOMPDF_LIB_DIR . "/class.pdf.php");
+
+/**
+ * PDF rendering interface
+ *
+ * CPDF_Adapter provides a simple stateless interface to the stateful one
+ * provided by the Cpdf class.
+ *
+ * Unless otherwise mentioned, all dimensions are in points (1/72 in).  The
+ * coordinate origin is in the top left corner, and y values increase
+ * downwards.
+ *
+ * See {@link http://www.ros.co.nz/pdf/} for more complete documentation
+ * on the underlying {@link Cpdf} class.
+ *
+ * @package dompdf
+ */
+class CPDF_Adapter implements Canvas {
+
+  /**
+   * Dimensions of paper sizes in points
+   *
+   * @var array;
+   */
+  static $PAPER_SIZES = array(
+    "4a0" => array(0,0,4767.87,6740.79),
+    "2a0" => array(0,0,3370.39,4767.87),
+    "a0" => array(0,0,2383.94,3370.39),
+    "a1" => array(0,0,1683.78,2383.94),
+    "a2" => array(0,0,1190.55,1683.78),
+    "a3" => array(0,0,841.89,1190.55),
+    "a4" => array(0,0,595.28,841.89),
+    "a5" => array(0,0,419.53,595.28),
+    "a6" => array(0,0,297.64,419.53),
+    "a7" => array(0,0,209.76,297.64),
+    "a8" => array(0,0,147.40,209.76),
+    "a9" => array(0,0,104.88,147.40),
+    "a10" => array(0,0,73.70,104.88),
+    "b0" => array(0,0,2834.65,4008.19),
+    "b1" => array(0,0,2004.09,2834.65),
+    "b2" => array(0,0,1417.32,2004.09),
+    "b3" => array(0,0,1000.63,1417.32),
+    "b4" => array(0,0,708.66,1000.63),
+    "b5" => array(0,0,498.90,708.66),
+    "b6" => array(0,0,354.33,498.90),
+    "b7" => array(0,0,249.45,354.33),
+    "b8" => array(0,0,175.75,249.45),
+    "b9" => array(0,0,124.72,175.75),
+    "b10" => array(0,0,87.87,124.72),
+    "c0" => array(0,0,2599.37,3676.54),
+    "c1" => array(0,0,1836.85,2599.37),
+    "c2" => array(0,0,1298.27,1836.85),
+    "c3" => array(0,0,918.43,1298.27),
+    "c4" => array(0,0,649.13,918.43),
+    "c5" => array(0,0,459.21,649.13),
+    "c6" => array(0,0,323.15,459.21),
+    "c7" => array(0,0,229.61,323.15),
+    "c8" => array(0,0,161.57,229.61),
+    "c9" => array(0,0,113.39,161.57),
+    "c10" => array(0,0,79.37,113.39),
+    "ra0" => array(0,0,2437.80,3458.27),
+    "ra1" => array(0,0,1729.13,2437.80),
+    "ra2" => array(0,0,1218.90,1729.13),
+    "ra3" => array(0,0,864.57,1218.90),
+    "ra4" => array(0,0,609.45,864.57),
+    "sra0" => array(0,0,2551.18,3628.35),
+    "sra1" => array(0,0,1814.17,2551.18),
+    "sra2" => array(0,0,1275.59,1814.17),
+    "sra3" => array(0,0,907.09,1275.59),
+    "sra4" => array(0,0,637.80,907.09),
+    "letter" => array(0,0,612.00,792.00),
+    "legal" => array(0,0,612.00,1008.00),
+    "ledger" => array(0,0,1224.00, 792.00),
+    "tabloid" => array(0,0,792.00, 1224.00),
+    "executive" => array(0,0,521.86,756.00),
+    "folio" => array(0,0,612.00,936.00),
+    "commercial #10 envelope" => array(0,0,684,297),
+    "catalog #10 1/2 envelope" => array(0,0,648,864),
+    "8.5x11" => array(0,0,612.00,792.00),
+    "8.5x14" => array(0,0,612.00,1008.0),
+    "11x17"  => array(0,0,792.00, 1224.00),
+  );
+
+  /**
+   * The DOMPDF object
+   *
+   * @var DOMPDF
+   */
+  private $_dompdf;
+
+  /**
+   * Instance of Cpdf class
+   *
+   * @var Cpdf
+   */
+  private $_pdf;
+
+  /**
+   * PDF width, in points
+   *
+   * @var float
+   */
+  private $_width;
+
+  /**
+   * PDF height, in points
+   *
+   * @var float;
+   */
+  private $_height;
+
+  /**
+   * Current page number
+   *
+   * @var int
+   */
+  private $_page_number;
+
+  /**
+   * Total number of pages
+   *
+   * @var int
+   */
+  private $_page_count;
+
+  /**
+   * Text to display on every page
+   *
+   * @var array
+   */
+  private $_page_text;
+
+  /**
+   * Array of pages for accesing after rendering is initially complete
+   *
+   * @var array
+   */
+  private $_pages;
+
+  /**
+   * Array of temporary cached images to be deleted when processing is complete
+   *
+   * @var array
+   */
+  private $_image_cache;
+
+  /**
+   * Class constructor
+   *
+   * @param mixed  $paper       The size of paper to use in this PDF ({@link CPDF_Adapter::$PAPER_SIZES})
+   * @param string $orientation The orientation of the document (either 'landscape' or 'portrait')
+   * @param DOMPDF $dompdf      The DOMPDF instance
+   */
+  function __construct($paper = "letter", $orientation = "portrait", DOMPDF $dompdf) {
+    if ( is_array($paper) ) {
+      $size = $paper;
+    }
+    else if ( isset(self::$PAPER_SIZES[mb_strtolower($paper)]) ) {
+      $size = self::$PAPER_SIZES[mb_strtolower($paper)];
+    }
+    else {
+      $size = self::$PAPER_SIZES["letter"];
+    }
+
+    if ( mb_strtolower($orientation) === "landscape" ) {
+      list($size[2], $size[3]) = array($size[3], $size[2]);
+    }
+
+    $this->_dompdf = $dompdf;
+    
+    $this->_pdf = new Cpdf(
+      $size,
+      $dompdf->get_option("enable_unicode"),
+      $dompdf->get_option("font_cache"),
+      $dompdf->get_option("temp_dir")
+    );
+
+    $this->_pdf->addInfo("Creator", "DOMPDF");
+    $time = substr_replace(date('YmdHisO'), '\'', -2, 0).'\'';
+    $this->_pdf->addInfo("CreationDate", "D:$time");
+    $this->_pdf->addInfo("ModDate", "D:$time");
+
+    $this->_width = $size[2] - $size[0];
+    $this->_height= $size[3] - $size[1];
+    
+    $this->_page_number = $this->_page_count = 1;
+    $this->_page_text = array();
+
+    $this->_pages = array($this->_pdf->getFirstPageId());
+
+    $this->_image_cache = array();
+  }
+
+  function get_dompdf(){
+    return $this->_dompdf;
+  }
+
+  /**
+   * Class destructor
+   *
+   * Deletes all temporary image files
+   */
+  function __destruct() {
+    foreach ($this->_image_cache as $img) {
+      // The file might be already deleted by 3rd party tmp cleaner,
+      // the file might not have been created at all
+      // (if image outputting commands failed)
+      // or because the destructor was called twice accidentally.
+      if (!file_exists($img)) {
+        continue;
+      }
+
+      if (DEBUGPNG) print '[__destruct unlink '.$img.']';
+      if (!DEBUGKEEPTEMP) unlink($img);
+    }
+  }
+  
+  /**
+   * Returns the Cpdf instance
+   *
+   * @return Cpdf
+   */
+  function get_cpdf() {
+    return $this->_pdf;
+  }
+
+  /**
+   * Add meta information to the PDF
+   *
+   * @param string $label  label of the value (Creator, Producer, etc.)
+   * @param string $value  the text to set
+   */
+  function add_info($label, $value) {
+    $this->_pdf->addInfo($label, $value);
+  }
+
+  /**
+   * Opens a new 'object'
+   *
+   * While an object is open, all drawing actions are recored in the object,
+   * as opposed to being drawn on the current page.  Objects can be added
+   * later to a specific page or to several pages.
+   *
+   * The return value is an integer ID for the new object.
+   *
+   * @see CPDF_Adapter::close_object()
+   * @see CPDF_Adapter::add_object()
+   *
+   * @return int
+   */
+  function open_object() {
+    $ret = $this->_pdf->openObject();
+    $this->_pdf->saveState();
+    return $ret;
+  }
+
+  /**
+   * Reopens an existing 'object'
+   *
+   * @see CPDF_Adapter::open_object()
+   * @param int $object  the ID of a previously opened object
+   */
+  function reopen_object($object) {
+    $this->_pdf->reopenObject($object);
+    $this->_pdf->saveState();
+  }
+
+  /**
+   * Closes the current 'object'
+   *
+   * @see CPDF_Adapter::open_object()
+   */
+  function close_object() {
+    $this->_pdf->restoreState();
+    $this->_pdf->closeObject();
+  }
+
+  /**
+   * Adds a specified 'object' to the document
+   *
+   * $object int specifying an object created with {@link
+   * CPDF_Adapter::open_object()}.  $where can be one of:
+   * - 'add' add to current page only
+   * - 'all' add to every page from the current one onwards
+   * - 'odd' add to all odd numbered pages from now on
+   * - 'even' add to all even numbered pages from now on
+   * - 'next' add the object to the next page only
+   * - 'nextodd' add to all odd numbered pages from the next one
+   * - 'nexteven' add to all even numbered pages from the next one
+   *
+   * @see Cpdf::addObject()
+   *
+   * @param int $object
+   * @param string $where
+   */
+  function add_object($object, $where = 'all') {
+    $this->_pdf->addObject($object, $where);
+  }
+
+  /**
+   * Stops the specified 'object' from appearing in the document.
+   *
+   * The object will stop being displayed on the page following the current
+   * one.
+   *
+   * @param int $object
+   */
+  function stop_object($object) {
+    $this->_pdf->stopObject($object);
+  }
+
+  /**
+   * @access private
+   */
+  function serialize_object($id) {
+    // Serialize the pdf object's current state for retrieval later
+    return $this->_pdf->serializeObject($id);
+  }
+
+  /**
+   * @access private
+   */
+  function reopen_serialized_object($obj) {
+    return $this->_pdf->restoreSerializedObject($obj);
+  }
+    
+  //........................................................................
+
+  /**
+   * Returns the PDF's width in points
+   * @return float
+   */
+  function get_width() { return $this->_width; }
+
+  /**
+   * Returns the PDF's height in points
+   * @return float
+   */
+  function get_height() { return $this->_height; }
+
+  /**
+   * Returns the current page number
+   * @return int
+   */
+  function get_page_number() { return $this->_page_number; }
+
+  /**
+   * Returns the total number of pages in the document
+   * @return int
+   */
+  function get_page_count() { return $this->_page_count; }
+
+  /**
+   * Sets the current page number
+   *
+   * @param int $num
+   */
+  function set_page_number($num) { $this->_page_number = $num; }
+
+  /**
+   * Sets the page count
+   *
+   * @param int $count
+   */
+  function set_page_count($count) {  $this->_page_count = $count; }
+    
+  /**
+   * Sets the stroke color
+   *
+   * See {@link Style::set_color()} for the format of the color array.
+   * @param array $color
+   */
+  protected function _set_stroke_color($color) {
+    $this->_pdf->setStrokeColor($color);
+  }
+  
+  /**
+   * Sets the fill colour
+   *
+   * See {@link Style::set_color()} for the format of the colour array.
+   * @param array $color
+   */
+  protected function _set_fill_color($color) {
+    $this->_pdf->setColor($color);
+  }
+
+  /**
+   * Sets line transparency
+   * @see Cpdf::setLineTransparency()
+   *
+   * Valid blend modes are (case-sensitive):
+   *
+   * Normal, Multiply, Screen, Overlay, Darken, Lighten,
+   * ColorDodge, ColorBurn, HardLight, SoftLight, Difference,
+   * Exclusion
+   *
+   * @param string $mode the blending mode to use
+   * @param float $opacity 0.0 fully transparent, 1.0 fully opaque
+   */
+  protected function _set_line_transparency($mode, $opacity) {
+    $this->_pdf->setLineTransparency($mode, $opacity);
+  }
+  
+  /**
+   * Sets fill transparency
+   * @see Cpdf::setFillTransparency()
+   *
+   * Valid blend modes are (case-sensitive):
+   *
+   * Normal, Multiply, Screen, Overlay, Darken, Lighten,
+   * ColorDogde, ColorBurn, HardLight, SoftLight, Difference,
+   * Exclusion
+   *
+   * @param string $mode the blending mode to use
+   * @param float $opacity 0.0 fully transparent, 1.0 fully opaque
+   */
+  protected function _set_fill_transparency($mode, $opacity) {
+    $this->_pdf->setFillTransparency($mode, $opacity);
+  }
+
+  /**
+   * Sets the line style
+   *
+   * @see Cpdf::setLineStyle()
+   *
+   * @param float  $width
+   * @param string $cap
+   * @param string $join
+   * @param array  $dash
+   */
+  protected function _set_line_style($width, $cap, $join, $dash) {
+    $this->_pdf->setLineStyle($width, $cap, $join, $dash);
+  }
+  
+  /**
+   * Sets the opacity 
+   * 
+   * @param $opacity
+   * @param $mode
+   */
+  function set_opacity($opacity, $mode = "Normal") {
+    $this->_set_line_transparency($mode, $opacity);
+    $this->_set_fill_transparency($mode, $opacity);
+  }
+  
+  function set_default_view($view, $options = array()) {
+    array_unshift($options, $view);
+    call_user_func_array(array($this->_pdf, "openHere"), $options);
+  }
+
+  /**
+   * Remaps y coords from 4th to 1st quadrant
+   *
+   * @param float $y
+   * @return float
+   */
+  protected function y($y) {
+    return $this->_height - $y;
+  }
+
+  // Canvas implementation
+  function line($x1, $y1, $x2, $y2, $color, $width, $style = array()) {
+    $this->_set_stroke_color($color);
+    $this->_set_line_style($width, "butt", "", $style);
+    
+    $this->_pdf->line($x1, $this->y($y1),
+                      $x2, $this->y($y2));
+  }
+  
+  function arc($x, $y, $r1, $r2, $astart, $aend, $color, $width, $style = array()) {
+    $this->_set_stroke_color($color);
+    $this->_set_line_style($width, "butt", "", $style);
+    
+    $this->_pdf->ellipse($x, $this->y($y), $r1, $r2, 0, 8, $astart, $aend, false, false, true, false);
+  }
+                              
+  //........................................................................
+
+  /**
+   * Convert a GIF or BMP image to a PNG image
+   *
+   * @param string  $image_url
+   * @param integer $type
+   *
+   * @throws DOMPDF_Exception
+   * @return string The url of the newly converted image
+   */
+  protected function _convert_gif_bmp_to_png($image_url, $type) {
+    $image_type = Image_Cache::type_to_ext($type);
+    $func_name = "imagecreatefrom$image_type";
+    
+    if ( !function_exists($func_name) ) {
+      throw new DOMPDF_Exception("Function $func_name() not found.  Cannot convert $image_type image: $image_url.  Please install the image PHP extension.");
+    }
+
+    set_error_handler("record_warnings");
+    $im = $func_name($image_url);
+
+    if ( $im ) {
+      imageinterlace($im, false);
+
+      $tmp_dir = $this->_dompdf->get_option("temp_dir");
+      $tmp_name = tempnam($tmp_dir, "{$image_type}dompdf_img_");
+      @unlink($tmp_name);
+      $filename = "$tmp_name.png";
+      $this->_image_cache[] = $filename;
+
+      imagepng($im, $filename);
+      imagedestroy($im);
+    } 
+    else {
+      $filename = Image_Cache::$broken_image;
+    }
+
+    restore_error_handler();
+    
+    return $filename;
+  }
+
+  function rectangle($x1, $y1, $w, $h, $color, $width, $style = array()) {
+    $this->_set_stroke_color($color);
+    $this->_set_line_style($width, "butt", "", $style);
+    $this->_pdf->rectangle($x1, $this->y($y1) - $h, $w, $h);
+  }
+  
+  function filled_rectangle($x1, $y1, $w, $h, $color) {
+    $this->_set_fill_color($color);
+    $this->_pdf->filledRectangle($x1, $this->y($y1) - $h, $w, $h);
+  }
+  
+  function clipping_rectangle($x1, $y1, $w, $h) {
+    $this->_pdf->clippingRectangle($x1, $this->y($y1) - $h, $w, $h);
+  }
+  
+  function clipping_roundrectangle($x1, $y1, $w, $h, $rTL, $rTR, $rBR, $rBL) {
+    $this->_pdf->clippingRectangleRounded($x1, $this->y($y1) - $h, $w, $h, $rTL, $rTR, $rBR, $rBL);
+  }
+  
+  function clipping_end() {
+    $this->_pdf->clippingEnd();
+  }
+  
+  function save() {
+    $this->_pdf->saveState();
+  }
+  
+  function restore() {
+    $this->_pdf->restoreState();
+  }
+  
+  function rotate($angle, $x, $y) {
+    $this->_pdf->rotate($angle, $x, $y);
+  }
+  
+  function skew($angle_x, $angle_y, $x, $y) {
+    $this->_pdf->skew($angle_x, $angle_y, $x, $y);
+  }
+  
+  function scale($s_x, $s_y, $x, $y) {
+    $this->_pdf->scale($s_x, $s_y, $x, $y);
+  }
+  
+  function translate($t_x, $t_y) {
+    $this->_pdf->translate($t_x, $t_y);
+  }
+  
+  function transform($a, $b, $c, $d, $e, $f) {
+    $this->_pdf->transform(array($a, $b, $c, $d, $e, $f));
+  }
+
+  function polygon($points, $color, $width = null, $style = array(), $fill = false) {
+    $this->_set_fill_color($color);
+    $this->_set_stroke_color($color);
+    
+    // Adjust y values
+    for ( $i = 1; $i < count($points); $i += 2) {
+      $points[$i] = $this->y($points[$i]);
+    }
+    
+    $this->_pdf->polygon($points, count($points) / 2, $fill);
+  }
+
+  function circle($x, $y, $r1, $color, $width = null, $style = null, $fill = false) {
+    $this->_set_fill_color($color);
+    $this->_set_stroke_color($color);
+
+    if ( !$fill && isset($width) ) {
+      $this->_set_line_style($width, "round", "round", $style);
+    }
+
+    $this->_pdf->ellipse($x, $this->y($y), $r1, 0, 0, 8, 0, 360, 1, $fill);
+  }
+
+  function image($img, $x, $y, $w, $h, $resolution = "normal") {
+    list($width, $height, $type) = dompdf_getimagesize($img, $this->_dompdf->get_http_context());
+    
+    $debug_png = $this->_dompdf->get_option("debug_png");
+
+    if ($debug_png) print "[image:$img|$width|$height|$type]";
+
+    switch ($type) {
+    case IMAGETYPE_JPEG:
+      if ($debug_png) print '!!!jpg!!!';
+      $this->_pdf->addJpegFromFile($img, $x, $this->y($y) - $h, $w, $h);
+      break;
+      
+    case IMAGETYPE_GIF:
+    case IMAGETYPE_BMP:
+      if ($debug_png) print '!!!bmp or gif!!!';
+      // @todo use cache for BMP and GIF
+      $img = $this->_convert_gif_bmp_to_png($img, $type);
+
+    case IMAGETYPE_PNG:
+      if ($debug_png) print '!!!png!!!';
+
+      $this->_pdf->addPngFromFile($img, $x, $this->y($y) - $h, $w, $h);
+      break;
+
+    default:
+      if ($debug_png) print '!!!unknown!!!';
+    }
+  }
+
+  function text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_space = 0.0, $char_space = 0.0, $angle = 0.0) {
+    $pdf = $this->_pdf;
+    
+    $pdf->setColor($color);
+    
+    $font .= ".afm";
+    $pdf->selectFont($font);
+    
+    //Font_Metrics::get_font_height($font, $size) ==
+    //$this->get_font_height($font, $size) ==
+    //$this->_pdf->selectFont($font),$this->_pdf->getFontHeight($size)
+    //- FontBBoxheight+FontHeightOffset, scaled to $size, in pt
+    //$this->_pdf->getFontDescender($size)
+    //- Descender scaled to size
+    //
+    //$this->_pdf->fonts[$this->_pdf->currentFont] sizes:
+    //['FontBBox'][0] left, ['FontBBox'][1] bottom, ['FontBBox'][2] right, ['FontBBox'][3] top
+    //Maximum extent of all glyphs of the font from the baseline point
+    //['Ascender'] maximum height above baseline except accents
+    //['Descender'] maximum depth below baseline, negative number means below baseline
+    //['FontHeightOffset'] manual enhancement of .afm files to trim windows fonts. currently not used.
+    //Values are in 1/1000 pt for a font size of 1 pt
+    //
+    //['FontBBox'][1] should be close to ['Descender']
+    //['FontBBox'][3] should be close to ['Ascender']+Accents
+    //in practice, FontBBox values are a little bigger
+    //
+    //The text position is referenced to the baseline, not to the lower corner of the FontBBox,
+    //for what the left,top corner is given.
+    //FontBBox spans also the background box for the text.
+    //If the lower corner would be used as reference point, the Descents of the glyphs would
+    //hang over the background box border.
+    //Therefore compensate only the extent above the Baseline.
+    //
+    //print '<pre>['.$font.','.$size.','.$pdf->getFontHeight($size).','.$pdf->getFontDescender($size).','.$pdf->fonts[$pdf->currentFont]['FontBBox'][3].','.$pdf->fonts[$pdf->currentFont]['FontBBox'][1].','.$pdf->fonts[$pdf->currentFont]['FontHeightOffset'].','.$pdf->fonts[$pdf->currentFont]['Ascender'].','.$pdf->fonts[$pdf->currentFont]['Descender'].']</pre>';
+    //
+    //$pdf->addText($x, $this->y($y) - ($pdf->fonts[$pdf->currentFont]['FontBBox'][3]*$size)/1000, $size, $text, $angle, $word_space, $char_space);
+    $pdf->addText($x, $this->y($y) - $pdf->getFontHeight($size), $size, $text, $angle, $word_space, $char_space);
+  }
+
+  //........................................................................
+
+  function javascript($code) {
+    $this->_pdf->addJavascript($code);
+  }
+
+  //........................................................................
+
+  /**
+   * Add a named destination (similar to <a name="foo">...</a> in html)
+   *
+   * @param string $anchorname The name of the named destination
+   */
+  function add_named_dest($anchorname) {
+    $this->_pdf->addDestination($anchorname, "Fit");
+  }
+
+  //........................................................................
+
+  /**
+   * Add a link to the pdf
+   *
+   * @param string $url The url to link to
+   * @param float  $x   The x position of the link
+   * @param float  $y   The y position of the link
+   * @param float  $width   The width of the link
+   * @param float  $height   The height of the link
+   */
+  function add_link($url, $x, $y, $width, $height) {
+
+    $y = $this->y($y) - $height;
+
+    if ( strpos($url, '#') === 0 ) {
+      // Local link
+      $name = substr($url,1);
+      if ( $name ) {
+        $this->_pdf->addInternalLink($name, $x, $y, $x + $width, $y + $height);
+      }
+      
+    }
+    else {
+      $this->_pdf->addLink(rawurldecode($url), $x, $y, $x + $width, $y + $height);
+    }
+  }
+
+  function get_text_width($text, $font, $size, $word_spacing = 0, $char_spacing = 0) {
+    $this->_pdf->selectFont($font);
+
+    $unicode = $this->_dompdf->get_option("enable_unicode");
+    if (!$unicode) {
+      $text = mb_convert_encoding($text, 'Windows-1252', 'UTF-8');
+    }
+
+    return $this->_pdf->getTextWidth($size, $text, $word_spacing, $char_spacing);
+  }
+  
+  function register_string_subset($font, $string) {
+    $this->_pdf->registerText($font, $string);
+  }
+
+  function get_font_height($font, $size) {
+    $this->_pdf->selectFont($font);
+
+    $ratio = $this->_dompdf->get_option("font_height_ratio");
+    return $this->_pdf->getFontHeight($size) * $ratio;
+  }
+  
+  /*function get_font_x_height($font, $size) {
+    $this->_pdf->selectFont($font);
+    $ratio = $this->_dompdf->get_option("font_height_ratio");
+    return $this->_pdf->getFontXHeight($size) * $ratio;
+  }*/
+  
+  function get_font_baseline($font, $size) {
+    $ratio = $this->_dompdf->get_option("font_height_ratio");
+    return $this->get_font_height($font, $size) / $ratio;
+  }
+  
+  /**
+   * Writes text at the specified x and y coordinates on every page
+   *
+   * The strings '{PAGE_NUM}' and '{PAGE_COUNT}' are automatically replaced
+   * with their current values.
+   *
+   * See {@link Style::munge_color()} for the format of the colour array.
+   *
+   * @param float $x
+   * @param float $y
+   * @param string $text the text to write
+   * @param string $font the font file to use
+   * @param float $size the font size, in points
+   * @param array $color
+   * @param float $word_space word spacing adjustment
+   * @param float $char_space char spacing adjustment
+   * @param float $angle angle to write the text at, measured CW starting from the x-axis
+   */
+  function page_text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_space = 0.0, $char_space = 0.0, $angle = 0.0) {
+    $_t = "text";
+    $this->_page_text[] = compact("_t", "x", "y", "text", "font", "size", "color", "word_space", "char_space", "angle");
+  }
+    
+  /**
+   * Processes a script on every page
+   *
+   * The variables $pdf, $PAGE_NUM, and $PAGE_COUNT are available.
+   *
+   * This function can be used to add page numbers to all pages
+   * after the first one, for example.
+   *
+   * @param string $code the script code
+   * @param string $type the language type for script
+   */
+  function page_script($code, $type = "text/php") {
+    $_t = "script";
+    $this->_page_text[] = compact("_t", "code", "type");
+  }
+
+  function new_page() {
+    $this->_page_number++;
+    $this->_page_count++;
+
+    $ret = $this->_pdf->newPage();
+    $this->_pages[] = $ret;
+    return $ret;
+  }
+
+  /**
+   * Add text to each page after rendering is complete
+   */
+  protected function _add_page_text() {
+    
+    if ( !count($this->_page_text) ) {
+      return;
+    }
+
+    $page_number = 1;
+    $eval = null;
+
+    foreach ($this->_pages as $pid) {
+      $this->reopen_object($pid);
+
+      foreach ($this->_page_text as $pt) {
+        extract($pt);
+
+        switch ($_t) {
+          case "text":
+            $text = str_replace(array("{PAGE_NUM}","{PAGE_COUNT}"),
+                                array($page_number, $this->_page_count), $text);
+            $this->text($x, $y, $text, $font, $size, $color, $word_space, $char_space, $angle);
+            break;
+            
+          case "script":
+            if ( !$eval ) {
+              $eval = new PHP_Evaluator($this);
+            }
+            $eval->evaluate($code, array('PAGE_NUM' => $page_number, 'PAGE_COUNT' => $this->_page_count));
+            break;
+        }
+      }
+
+      $this->close_object();
+      $page_number++;
+    }
+  }
+  
+  /**
+   * Streams the PDF directly to the browser
+   *
+   * @param string $filename the name of the PDF file
+   * @param array  $options associative array, 'Attachment' => 0 or 1, 'compress' => 1 or 0
+   */
+  function stream($filename, $options = null) {
+    // Add page text
+    $this->_add_page_text();
+    
+    $options["Content-Disposition"] = $filename;
+    $this->_pdf->stream($options);
+  }
+
+  /**
+   * Returns the PDF as a string
+   * 
+   * @param array $options Output options
+   * @return string
+   */
+  function output($options = null) {
+    $this->_add_page_text();
+
+    $debug = isset($options["compress"]) && $options["compress"] != 1;
+    
+    return $this->_pdf->output($debug);
+  }
+
+  /**
+   * Returns logging messages generated by the Cpdf class
+   *
+   * @return string
+   */
+  function get_messages() {
+    return $this->_pdf->messages;
+  }
+}

vendor/dompdf/dompdf/include/css_color.cls.php

@@ -0,0 +1,287 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+class CSS_Color {
+  static $cssColorNames = array(
+    "aliceblue" => "F0F8FF",
+    "antiquewhite" => "FAEBD7",
+    "aqua" => "00FFFF",
+    "aquamarine" => "7FFFD4",
+    "azure" => "F0FFFF",
+    "beige" => "F5F5DC",
+    "bisque" => "FFE4C4",
+    "black" => "000000",
+    "blanchedalmond" => "FFEBCD",
+    "blue" => "0000FF",
+    "blueviolet" => "8A2BE2",
+    "brown" => "A52A2A",
+    "burlywood" => "DEB887",
+    "cadetblue" => "5F9EA0",
+    "chartreuse" => "7FFF00",
+    "chocolate" => "D2691E",
+    "coral" => "FF7F50",
+    "cornflowerblue" => "6495ED",
+    "cornsilk" => "FFF8DC",
+    "crimson" => "DC143C",
+    "cyan" => "00FFFF",
+    "darkblue" => "00008B",
+    "darkcyan" => "008B8B",
+    "darkgoldenrod" => "B8860B",
+    "darkgray" => "A9A9A9",
+    "darkgreen" => "006400",
+    "darkgrey" => "A9A9A9",
+    "darkkhaki" => "BDB76B",
+    "darkmagenta" => "8B008B",
+    "darkolivegreen" => "556B2F",
+    "darkorange" => "FF8C00",
+    "darkorchid" => "9932CC",
+    "darkred" => "8B0000",
+    "darksalmon" => "E9967A",
+    "darkseagreen" => "8FBC8F",
+    "darkslateblue" => "483D8B",
+    "darkslategray" => "2F4F4F",
+    "darkslategrey" => "2F4F4F",
+    "darkturquoise" => "00CED1",
+    "darkviolet" => "9400D3",
+    "deeppink" => "FF1493",
+    "deepskyblue" => "00BFFF",
+    "dimgray" => "696969",
+    "dimgrey" => "696969",
+    "dodgerblue" => "1E90FF",
+    "firebrick" => "B22222",
+    "floralwhite" => "FFFAF0",
+    "forestgreen" => "228B22",
+    "fuchsia" => "FF00FF",
+    "gainsboro" => "DCDCDC",
+    "ghostwhite" => "F8F8FF",
+    "gold" => "FFD700",
+    "goldenrod" => "DAA520",
+    "gray" => "808080",
+    "green" => "008000",
+    "greenyellow" => "ADFF2F",
+    "grey" => "808080",
+    "honeydew" => "F0FFF0",
+    "hotpink" => "FF69B4",
+    "indianred" => "CD5C5C",
+    "indigo" => "4B0082",
+    "ivory" => "FFFFF0",
+    "khaki" => "F0E68C",
+    "lavender" => "E6E6FA",
+    "lavenderblush" => "FFF0F5",
+    "lawngreen" => "7CFC00",
+    "lemonchiffon" => "FFFACD",
+    "lightblue" => "ADD8E6",
+    "lightcoral" => "F08080",
+    "lightcyan" => "E0FFFF",
+    "lightgoldenrodyellow" => "FAFAD2",
+    "lightgray" => "D3D3D3",
+    "lightgreen" => "90EE90",
+    "lightgrey" => "D3D3D3",
+    "lightpink" => "FFB6C1",
+    "lightsalmon" => "FFA07A",
+    "lightseagreen" => "20B2AA",
+    "lightskyblue" => "87CEFA",
+    "lightslategray" => "778899",
+    "lightslategrey" => "778899",
+    "lightsteelblue" => "B0C4DE",
+    "lightyellow" => "FFFFE0",
+    "lime" => "00FF00",
+    "limegreen" => "32CD32",
+    "linen" => "FAF0E6",
+    "magenta" => "FF00FF",
+    "maroon" => "800000",
+    "mediumaquamarine" => "66CDAA",
+    "mediumblue" => "0000CD",
+    "mediumorchid" => "BA55D3",
+    "mediumpurple" => "9370DB",
+    "mediumseagreen" => "3CB371",
+    "mediumslateblue" => "7B68EE",
+    "mediumspringgreen" => "00FA9A",
+    "mediumturquoise" => "48D1CC",
+    "mediumvioletred" => "C71585",
+    "midnightblue" => "191970",
+    "mintcream" => "F5FFFA",
+    "mistyrose" => "FFE4E1",
+    "moccasin" => "FFE4B5",
+    "navajowhite" => "FFDEAD",
+    "navy" => "000080",
+    "oldlace" => "FDF5E6",
+    "olive" => "808000",
+    "olivedrab" => "6B8E23",
+    "orange" => "FFA500",
+    "orangered" => "FF4500",
+    "orchid" => "DA70D6",
+    "palegoldenrod" => "EEE8AA",
+    "palegreen" => "98FB98",
+    "paleturquoise" => "AFEEEE",
+    "palevioletred" => "DB7093",
+    "papayawhip" => "FFEFD5",
+    "peachpuff" => "FFDAB9",
+    "peru" => "CD853F",
+    "pink" => "FFC0CB",
+    "plum" => "DDA0DD",
+    "powderblue" => "B0E0E6",
+    "purple" => "800080",
+    "red" => "FF0000",
+    "rosybrown" => "BC8F8F",
+    "royalblue" => "4169E1",
+    "saddlebrown" => "8B4513",
+    "salmon" => "FA8072",
+    "sandybrown" => "F4A460",
+    "seagreen" => "2E8B57",
+    "seashell" => "FFF5EE",
+    "sienna" => "A0522D",
+    "silver" => "C0C0C0",
+    "skyblue" => "87CEEB",
+    "slateblue" => "6A5ACD",
+    "slategray" => "708090",
+    "slategrey" => "708090",
+    "snow" => "FFFAFA",
+    "springgreen" => "00FF7F",
+    "steelblue" => "4682B4",
+    "tan" => "D2B48C",
+    "teal" => "008080",
+    "thistle" => "D8BFD8",
+    "tomato" => "FF6347",
+    "turquoise" => "40E0D0",
+    "violet" => "EE82EE",
+    "wheat" => "F5DEB3",
+    "white" => "FFFFFF",
+    "whitesmoke" => "F5F5F5",
+    "yellow" => "FFFF00",
+    "yellowgreen" => "9ACD32",
+  );
+
+  static function parse($color) {
+    if ( is_array($color) ) {
+      // Assume the array has the right format...
+      // FIXME: should/could verify this.
+      return $color;
+    }
+    
+    static $cache = array();
+    
+    $color = strtolower($color);
+    
+    if ( isset($cache[$color]) ) {
+      return $cache[$color];
+    }
+      
+    if ( in_array($color, array("transparent", "inherit")) ) {
+      return $cache[$color] = $color;
+    }
+    
+    if ( isset(self::$cssColorNames[$color]) ) {
+      return $cache[$color] = self::getArray(self::$cssColorNames[$color]);
+    }
+    
+    $length = mb_strlen($color);
+    
+    // #rgb format
+    if ( $length == 4 && $color[0] === "#" ) {
+      return $cache[$color] = self::getArray($color[1].$color[1].$color[2].$color[2].$color[3].$color[3]);
+    }
+
+    // #rrggbb format
+    else if ( $length == 7 && $color[0] === "#" ) {
+      return $cache[$color] = self::getArray(mb_substr($color, 1, 6));
+    }
+    
+    // rgb( r,g,b ) / rgbaa( r,g,b,α ) format
+    else if ( mb_strpos($color, "rgb") !== false ) {
+      $i = mb_strpos($color, "(");
+      $j = mb_strpos($color, ")");
+      
+      // Bad color value
+      if ( $i === false || $j === false ) {
+        return null;
+      }
+      
+      $triplet = explode(",", mb_substr($color, $i+1, $j-$i-1));
+      
+      // alpha transparency
+      // FIXME: not currently using transparency
+      $alpha = 1;
+      if ( count( $triplet ) == 4 ) {
+        $alpha = (float) ( trim( array_pop( $triplet ) ) );
+        // bad value, set to fully opaque
+        if ( $alpha > 1 || $alpha < 0 ) {
+          $alpha = 1;
+        }
+      }
+      
+      if ( count($triplet) != 3 ) {
+        return null;
+      }
+      
+      foreach (array_keys($triplet) as $c) {
+        $triplet[$c] = trim($triplet[$c]);
+        
+        if ( $triplet[$c][mb_strlen($triplet[$c]) - 1] === "%" ) {
+          $triplet[$c] = round($triplet[$c] * 2.55);
+        }
+      }
+      
+      return $cache[$color] = self::getArray(vsprintf("%02X%02X%02X", $triplet));
+    
+    }
+    
+    // cmyk( c,m,y,k ) format
+    // http://www.w3.org/TR/css3-gcpm/#cmyk-colors
+    else if ( mb_strpos($color, "cmyk") !== false ) {
+      $i = mb_strpos($color, "(");
+      $j = mb_strpos($color, ")");
+      
+      // Bad color value
+      if ( $i === false || $j === false ) {
+        return null;
+      }
+
+      $values = explode(",", mb_substr($color, $i+1, $j-$i-1));
+
+      if ( count($values) != 4 ) {
+        return null;
+      }
+      
+      foreach ($values as &$c) {
+        $c = floatval(trim($c));
+        if ($c > 1.0) $c = 1.0;
+        if ($c < 0.0) $c = 0.0;
+      }
+      
+      return $cache[$color] = self::getArray($values);
+    }
+
+    return null;
+  }
+  
+  static function getArray($color) {
+    $c = array(null, null, null, null, "hex" => null);
+    
+    if (is_array($color)) {
+      $c = $color;
+      $c["c"] = $c[0];
+      $c["m"] = $c[1];
+      $c["y"] = $c[2];
+      $c["k"] = $c[3];
+      $c["hex"] = "cmyk($c[0],$c[1],$c[2],$c[3])";
+    }
+    else {
+      $c[0] = hexdec(mb_substr($color, 0, 2)) / 0xff;
+      $c[1] = hexdec(mb_substr($color, 2, 2)) / 0xff;
+      $c[2] = hexdec(mb_substr($color, 4, 2)) / 0xff;
+      $c["r"] = $c[0];
+      $c["g"] = $c[1];
+      $c["b"] = $c[2];
+      $c["hex"] = "#$color";
+    }
+    
+    return $c;
+  }
+}

vendor/dompdf/dompdf/include/dompdf_exception.cls.php

@@ -0,0 +1,26 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Standard exception thrown by DOMPDF classes
+ *
+ * @package dompdf
+ */
+class DOMPDF_Exception extends Exception {
+
+  /**
+   * Class constructor
+   *
+   * @param string $message Error message
+   * @param int $code Error code
+   */
+  function __construct($message = null, $code = 0) {
+    parent::__construct($message, $code);
+  }
+
+}

vendor/dompdf/dompdf/include/dompdf_image_exception.cls.php

@@ -0,0 +1,26 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Image exception thrown by DOMPDF
+ *
+ * @package dompdf
+ */
+class DOMPDF_Image_Exception extends DOMPDF_Exception {
+
+  /**
+   * Class constructor
+   *
+   * @param string $message Error message
+   * @param int $code Error code
+   */
+  function __construct($message = null, $code = 0) {
+    parent::__construct($message, $code);
+  }
+
+}

vendor/dompdf/dompdf/include/file.skel

@@ -0,0 +1,8 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  ...
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */

vendor/dompdf/dompdf/include/fixed_positioner.cls.php

@@ -0,0 +1,88 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions fixely positioned frames
+ */
+class Fixed_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+
+  function position() {
+
+    $frame = $this->_frame;
+    $style = $frame->get_original_style();
+    $root = $frame->get_root();
+    $initialcb = $root->get_containing_block();
+    $initialcb_style = $root->get_style();
+
+    $p = $frame->find_block_parent();
+    if ( $p ) {
+      $p->add_line();
+    }
+
+    // Compute the margins of the @page style
+    $margin_top    = $initialcb_style->length_in_pt($initialcb_style->margin_top,    $initialcb["h"]);
+    $margin_right  = $initialcb_style->length_in_pt($initialcb_style->margin_right,  $initialcb["w"]);
+    $margin_bottom = $initialcb_style->length_in_pt($initialcb_style->margin_bottom, $initialcb["h"]);
+    $margin_left   = $initialcb_style->length_in_pt($initialcb_style->margin_left,   $initialcb["w"]);
+    
+    // The needed computed style of the element
+    $height = $style->length_in_pt($style->height, $initialcb["h"]);
+    $width  = $style->length_in_pt($style->width,  $initialcb["w"]);
+    
+    $top    = $style->length_in_pt($style->top,    $initialcb["h"]);
+    $right  = $style->length_in_pt($style->right,  $initialcb["w"]);
+    $bottom = $style->length_in_pt($style->bottom, $initialcb["h"]);
+    $left   = $style->length_in_pt($style->left,   $initialcb["w"]);
+
+    $y = $margin_top;
+    if ( isset($top) ) {
+      $y = $top + $margin_top;
+      if ( $top === "auto" ) {
+        $y = $margin_top;
+        if ( isset($bottom) && $bottom !== "auto" ) {
+          $y = $initialcb["h"] - $bottom - $margin_bottom;
+          $margin_height = $this->_frame->get_margin_height();
+          if ( $margin_height !== "auto" ) {
+            $y -= $margin_height;
+          }
+          else {
+            $y -= $height;
+          }
+        }
+      }
+    }
+
+    $x = $margin_left;
+    if ( isset($left) ) {
+      $x = $left + $margin_left;
+      if ( $left === "auto" ) {
+        $x = $margin_left;
+        if ( isset($right) && $right !== "auto" ) {
+          $x = $initialcb["w"] - $right - $margin_right;
+          $margin_width = $this->_frame->get_margin_width();
+          if ( $margin_width !== "auto" ) {
+            $x -= $margin_width;
+          }
+          else {
+            $x -= $width;
+          }
+        }
+      }
+    }
+    
+    $frame->set_position($x, $y);
+
+    $children = $frame->get_children();
+    foreach($children as $child) {
+      $child->set_position($x, $y);
+    }
+  }
+}

vendor/dompdf/dompdf/include/font_metrics.cls.php

@@ -0,0 +1,382 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+require_once DOMPDF_LIB_DIR . "/class.pdf.php";
+
+/**
+ * Name of the font cache file
+ *
+ * This file must be writable by the webserver process only to update it
+ * with save_font_families() after adding the .afm file references of a new font family
+ * with Font_Metrics::save_font_families().
+ * This is typically done only from command line with load_font.php on converting
+ * ttf fonts to ufm with php-font-lib.
+ *
+ * Declared here because PHP5 prevents constants from being declared with expressions
+ */
+define('__DOMPDF_FONT_CACHE_FILE', DOMPDF_FONT_DIR . "dompdf_font_family_cache.php");
+
+/**
+ * The font metrics class
+ *
+ * This class provides information about fonts and text.  It can resolve
+ * font names into actual installed font files, as well as determine the
+ * size of text in a particular font and size.
+ *
+ * @static
+ * @package dompdf
+ */
+class Font_Metrics {
+
+  /**
+   * @see __DOMPDF_FONT_CACHE_FILE
+   */
+  const CACHE_FILE = __DOMPDF_FONT_CACHE_FILE;
+  
+  /**
+   * Underlying {@link Canvas} object to perform text size calculations
+   *
+   * @var Canvas
+   */
+  static protected $_pdf = null;
+
+  /**
+   * Array of font family names to font files
+   *
+   * Usually cached by the {@link load_font.php} script
+   *
+   * @var array
+   */
+  static protected $_font_lookup = array();
+  
+  
+  /**
+   * Class initialization
+   *
+   */
+  static function init(Canvas $canvas = null) {
+    if (!self::$_pdf) {
+      if (!$canvas) {
+        $canvas = Canvas_Factory::get_instance(new DOMPDF());
+      }
+      
+      self::$_pdf = $canvas;
+    }
+  }
+
+  /**
+   * Calculates text size, in points
+   *
+   * @param string $text the text to be sized
+   * @param string $font the desired font
+   * @param float  $size the desired font size
+   * @param float  $word_spacing
+   * @param float  $char_spacing
+   *
+   * @internal param float $spacing word spacing, if any
+   * @return float
+   */
+  static function get_text_width($text, $font, $size, $word_spacing = 0.0, $char_spacing = 0.0) {
+    //return self::$_pdf->get_text_width($text, $font, $size, $word_spacing, $char_spacing);
+    
+    // @todo Make sure this cache is efficient before enabling it
+    static $cache = array();
+    
+    if ( $text === "" ) {
+      return 0;
+    }
+    
+    // Don't cache long strings
+    $use_cache = !isset($text[50]); // Faster than strlen
+    
+    $key = "$font/$size/$word_spacing/$char_spacing";
+    
+    if ( $use_cache && isset($cache[$key][$text]) ) {
+      return $cache[$key]["$text"];
+    }
+    
+    $width = self::$_pdf->get_text_width($text, $font, $size, $word_spacing, $char_spacing);
+    
+    if ( $use_cache ) {
+      $cache[$key][$text] = $width;
+    }
+    
+    return $width;
+  }
+
+  /**
+   * Calculates font height
+   *
+   * @param string $font
+   * @param float $size
+   * @return float
+   */
+  static function get_font_height($font, $size) {
+    return self::$_pdf->get_font_height($font, $size);
+  }
+
+  /**
+   * Resolves a font family & subtype into an actual font file
+   * Subtype can be one of 'normal', 'bold', 'italic' or 'bold_italic'.  If
+   * the particular font family has no suitable font file, the default font
+   * ({@link DOMPDF_DEFAULT_FONT}) is used.  The font file returned
+   * is the absolute pathname to the font file on the system.
+   *
+   * @param string $family_raw
+   * @param string $subtype_raw
+   *
+   * @return string
+   */
+  static function get_font($family_raw, $subtype_raw = "normal") {
+    static $cache = array();
+    
+    if ( isset($cache[$family_raw][$subtype_raw]) ) {
+      return $cache[$family_raw][$subtype_raw];
+    }
+    
+    /* Allow calling for various fonts in search path. Therefore not immediately
+     * return replacement on non match.
+     * Only when called with NULL try replacement.
+     * When this is also missing there is really trouble.
+     * If only the subtype fails, nevertheless return failure.
+     * Only on checking the fallback font, check various subtypes on same font.
+     */
+    
+    $subtype = strtolower($subtype_raw);
+    
+    if ( $family_raw ) {
+      $family = str_replace( array("'", '"'), "", strtolower($family_raw));
+      
+      if ( isset(self::$_font_lookup[$family][$subtype]) ) {
+        return $cache[$family_raw][$subtype_raw] = self::$_font_lookup[$family][$subtype];
+      }
+      
+      return null;
+    }
+
+    $family = "serif";
+
+    if ( isset(self::$_font_lookup[$family][$subtype]) ) {
+      return $cache[$family_raw][$subtype_raw] = self::$_font_lookup[$family][$subtype];
+    }
+    
+    if ( !isset(self::$_font_lookup[$family]) ) {
+      return null;
+    }
+    
+    $family = self::$_font_lookup[$family];
+
+    foreach ( $family as $sub => $font ) {
+      if (strpos($subtype, $sub) !== false) {
+        return $cache[$family_raw][$subtype_raw] = $font;
+      }
+    }
+
+    if ($subtype !== "normal") {
+      foreach ( $family as $sub => $font ) {
+        if ($sub !== "normal") {
+          return $cache[$family_raw][$subtype_raw] = $font;
+        }
+      }
+    }
+
+    $subtype = "normal";
+
+    if ( isset($family[$subtype]) ) {
+      return $cache[$family_raw][$subtype_raw] = $family[$subtype];
+    }
+    
+    return null;
+  }
+  
+  static function get_family($family) {
+    $family = str_replace( array("'", '"'), "", mb_strtolower($family));
+    
+    if ( isset(self::$_font_lookup[$family]) ) {
+      return self::$_font_lookup[$family];
+    }
+    
+    return null;
+  }
+
+  /**
+   * Saves the stored font family cache
+   *
+   * The name and location of the cache file are determined by {@link
+   * Font_Metrics::CACHE_FILE}.  This file should be writable by the
+   * webserver process.
+   *
+   * @see Font_Metrics::load_font_families()
+   */
+  static function save_font_families() {
+    // replace the path to the DOMPDF font directories with the corresponding constants (allows for more portability)
+    $cache_data = sprintf("<?php return array (%s", PHP_EOL);
+    foreach (self::$_font_lookup as $family => $variants) {
+      $cache_data .= sprintf("  '%s' => array(%s", addslashes($family), PHP_EOL);
+      foreach ($variants as $variant => $path) {
+        $path = sprintf("'%s'", $path);
+        $path = str_replace('\'' . DOMPDF_FONT_DIR , 'DOMPDF_FONT_DIR . \'' , $path);
+        $path = str_replace('\'' . DOMPDF_DIR , 'DOMPDF_DIR . \'' , $path);
+        $cache_data .= sprintf("    '%s' => %s,%s", $variant, $path, PHP_EOL);
+      }
+      $cache_data .= sprintf("  ),%s", PHP_EOL);
+    }
+    $cache_data .= ") ?>";
+    file_put_contents(self::CACHE_FILE, $cache_data);
+  }
+
+  /**
+   * Loads the stored font family cache
+   *
+   * @see save_font_families()
+   */
+  static function load_font_families() {
+    $dist_fonts = require_once DOMPDF_DIR . "/lib/fonts/dompdf_font_family_cache.dist.php";
+    
+    // FIXME: temporary step for font cache created before the font cache fix
+    if ( is_readable( DOMPDF_FONT_DIR . "dompdf_font_family_cache" ) ) {
+      $old_fonts = require_once DOMPDF_FONT_DIR . "dompdf_font_family_cache";
+      // If the font family cache is still in the old format
+      if ( $old_fonts === 1 ) {
+        $cache_data = file_get_contents(DOMPDF_FONT_DIR . "dompdf_font_family_cache");
+        file_put_contents(DOMPDF_FONT_DIR . "dompdf_font_family_cache", "<"."?php return $cache_data ?".">");
+        $old_fonts = require_once DOMPDF_FONT_DIR . "dompdf_font_family_cache";
+      }
+      $dist_fonts += $old_fonts;
+    }
+    
+    if ( !is_readable(self::CACHE_FILE) ) {
+      self::$_font_lookup = $dist_fonts;
+      return;
+    }
+    
+    $cache_data = require_once self::CACHE_FILE;
+    
+    // If the font family cache is still in the old format
+    if ( self::$_font_lookup === 1 ) {
+      $cache_data = file_get_contents(self::CACHE_FILE);
+      file_put_contents(self::CACHE_FILE, "<"."?php return $cache_data ?".">");
+      $cache_data = require_once self::CACHE_FILE;
+    }
+    
+    self::$_font_lookup = array();
+    foreach ($cache_data as $key => $value) {
+      self::$_font_lookup[stripslashes($key)] = $value;
+    }
+    
+    // Merge provided fonts
+    self::$_font_lookup += $dist_fonts;
+  }
+  
+  static function get_type($type) {
+    if (preg_match("/bold/i", $type)) {
+      if (preg_match("/italic|oblique/i", $type)) {
+        $type = "bold_italic";
+      }
+      else {
+        $type = "bold";
+      }
+    }
+    elseif (preg_match("/italic|oblique/i", $type)) {
+      $type = "italic";
+    }
+    else {
+      $type = "normal";
+    }
+      
+    return $type;
+  }
+  
+  static function install_fonts($files) {
+    $names = array();
+    
+    foreach($files as $file) {
+      $font = Font::load($file);
+      $records = $font->getData("name", "records");
+      $type = self::get_type($records[2]);
+      $names[mb_strtolower($records[1])][$type] = $file;
+    }
+    
+    return $names;
+  }
+  
+  static function get_system_fonts() {
+    $files = glob("/usr/share/fonts/truetype/*.ttf") +
+             glob("/usr/share/fonts/truetype/*/*.ttf") +
+             glob("/usr/share/fonts/truetype/*/*/*.ttf") +
+             glob("C:\\Windows\\fonts\\*.ttf") + 
+             glob("C:\\WinNT\\fonts\\*.ttf") + 
+             glob("/mnt/c_drive/WINDOWS/Fonts/");
+    
+    return self::install_fonts($files);
+  }
+
+  /**
+   * Returns the current font lookup table
+   *
+   * @return array
+   */
+  static function get_font_families() {
+    return self::$_font_lookup;
+  }
+
+  static function set_font_family($fontname, $entry) {
+    self::$_font_lookup[mb_strtolower($fontname)] = $entry;
+  }
+  
+  static function register_font($style, $remote_file, $context = null) {
+    $fontname = mb_strtolower($style["family"]);
+    $families = Font_Metrics::get_font_families();
+    
+    $entry = array();
+    if ( isset($families[$fontname]) ) {
+      $entry = $families[$fontname];
+    }
+    
+    $local_file = DOMPDF_FONT_DIR . md5($remote_file);
+    $local_temp_file = DOMPDF_TEMP_DIR . "/" . md5($remote_file);
+    $cache_entry = $local_file;
+    $local_file .= ".ttf";
+    
+    $style_string = Font_Metrics::get_type("{$style['weight']} {$style['style']}");
+    
+    if ( !isset($entry[$style_string]) ) {
+      $entry[$style_string] = $cache_entry;
+      
+      // Download the remote file
+      file_put_contents($local_temp_file, file_get_contents($remote_file, null, $context));
+      
+      $font = Font::load($local_temp_file);
+      
+      if (!$font) {
+        unlink($local_temp_file);
+        return false;
+      }
+      
+      $font->parse();
+      $font->saveAdobeFontMetrics("$cache_entry.ufm");
+      
+      unlink($local_temp_file);
+      
+      if ( !file_exists("$cache_entry.ufm") ) {
+        return false;
+      }
+      
+      // Save the changes
+      file_put_contents($local_file, file_get_contents($remote_file, null, $context));
+      Font_Metrics::set_font_family($fontname, $entry);
+      Font_Metrics::save_font_families();
+    }
+    
+    return true;
+  }
+}
+
+Font_Metrics::load_font_families();

vendor/dompdf/dompdf/include/frame_decorator.cls.php

@@ -0,0 +1,717 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Base Frame_Decorator class
+ *
+ * @access private
+ * @package dompdf
+ */
+abstract class Frame_Decorator extends Frame {
+  const DEFAULT_COUNTER = "-dompdf-default-counter";
+  
+  public $_counters = array(); // array([id] => counter_value) (for generated content)
+  
+  /**
+   * The root node of the DOM tree
+   *
+   * @var Frame
+   */
+  protected $_root;
+
+  /**
+   * The decorated frame
+   *
+   * @var Frame
+   */
+  protected $_frame;
+
+  /**
+   * Positioner object used to position this frame (Strategy pattern)
+   *
+   * @var Positioner
+   */
+  protected $_positioner;
+
+  /**
+   * Reflower object used to calculate frame dimensions (Strategy pattern)
+   *
+   * @var Frame_Reflower
+   */
+  protected $_reflower;
+  
+  /**
+   * Reference to the current dompdf instance
+   *
+   * @var DOMPDF
+   */
+  protected $_dompdf;
+  
+  /**
+   * First block parent
+   * 
+   * @var Block_Frame_Decorator
+   */
+  private $_block_parent;
+  
+  /**
+   * First positionned parent (position: relative | absolute | fixed)
+   * 
+   * @var Frame_Decorator
+   */
+  private $_positionned_parent;
+
+  /**
+   * Class constructor
+   *
+   * @param Frame  $frame  The decoration target
+   * @param DOMPDF $dompdf The DOMPDF object
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    $this->_frame = $frame;
+    $this->_root = null;
+    $this->_dompdf = $dompdf;
+    $frame->set_decorator($this);
+  }
+
+  /**
+   * "Destructor": foribly free all references held by this object
+   *
+   * @param bool $recursive if true, call dispose on all children
+   */
+  function dispose($recursive = false) {
+    if ( $recursive ) {
+      while ( $child = $this->get_first_child() ) {
+        $child->dispose(true);
+      }
+    }
+    
+    $this->_root = null;
+    unset($this->_root);
+    
+    $this->_frame->dispose(true);
+    $this->_frame = null;
+    unset($this->_frame);
+    
+    $this->_positioner = null;
+    unset($this->_positioner);
+    
+    $this->_reflower = null;
+    unset($this->_reflower);
+  }
+
+  /**
+   * Return a copy of this frame with $node as its node
+   * 
+   * @param DOMNode $node
+   *
+   * @return Frame
+   */ 
+  function copy(DOMNode $node) {
+    $frame = new Frame($node);
+    $frame->set_style(clone $this->_frame->get_original_style());
+    
+    return Frame_Factory::decorate_frame($frame, $this->_dompdf, $this->_root);
+  }
+
+  /**
+   * Create a deep copy: copy this node and all children
+   *
+   * @return Frame
+   */
+  function deep_copy() {
+    $frame = new Frame($this->get_node()->cloneNode());
+    $frame->set_style(clone $this->_frame->get_original_style());
+    
+    $deco = Frame_Factory::decorate_frame($frame, $this->_dompdf, $this->_root);
+    
+    foreach ($this->get_children() as $child) {
+      $deco->append_child($child->deep_copy());
+    }
+    
+    return $deco;
+  }
+  
+  /**
+   * Delegate calls to decorated frame object
+   */
+  function reset() {
+    $this->_frame->reset();
+    
+    $this->_counters = array();
+    
+    // Reset all children
+    foreach ($this->get_children() as $child) {
+      $child->reset();
+    }
+  }
+  
+  // Getters -----------
+  function get_id() {
+    return $this->_frame->get_id();
+  }
+  
+  /**
+   * @return Frame
+   */
+  function get_frame() {
+    return $this->_frame;
+  }
+  
+  /**
+   * @return DOMElement|DOMText
+   */
+  function get_node() {
+    return $this->_frame->get_node();
+  }
+  
+  /**
+   * @return Style
+   */
+  function get_style() {
+    return $this->_frame->get_style();
+  }
+  
+  /**
+   * @return Style
+   */
+  function get_original_style() {
+    return $this->_frame->get_original_style();
+  }
+
+  /**
+   * @param integer $i
+   *
+   * @return array|float
+   */
+  function get_containing_block($i = null) {
+    return $this->_frame->get_containing_block($i);
+  }
+
+  /**
+   * @param integer $i
+   *
+   * @return array|float
+   */
+  function get_position($i = null) {
+    return $this->_frame->get_position($i);
+  }
+  
+  /**
+   * @return DOMPDF
+   */
+  function get_dompdf() {
+    return $this->_dompdf;
+  }
+
+  /**
+   * @return float
+   */
+  function get_margin_height() {
+    return $this->_frame->get_margin_height();
+  }
+
+  /**
+   * @return float
+   */
+  function get_margin_width() {
+    return $this->_frame->get_margin_width();
+  }
+
+  /**
+   * @return array
+   */
+  function get_padding_box() {
+    return $this->_frame->get_padding_box();
+  }
+
+  /**
+   * @return array
+   */
+  function get_border_box() {
+    return $this->_frame->get_border_box();
+  }
+
+  /**
+   * @param integer $id
+   */
+  function set_id($id) {
+    $this->_frame->set_id($id);
+  }
+
+  /**
+   * @param Style $style
+   */
+  function set_style(Style $style) {
+    $this->_frame->set_style($style);
+  }
+
+  /**
+   * @param float $x
+   * @param float $y
+   * @param float $w
+   * @param float $h
+   */
+  function set_containing_block($x = null, $y = null, $w = null, $h = null) {
+    $this->_frame->set_containing_block($x, $y, $w, $h);
+  }
+
+  /**
+   * @param float $x
+   * @param float $y
+   */
+  function set_position($x = null, $y = null) {
+    $this->_frame->set_position($x, $y);
+  }
+
+  /**
+   * @return string
+   */
+  function __toString() {
+    return $this->_frame->__toString();
+  }
+
+  /**
+   * @param Frame $child
+   * @param bool  $update_node
+   */
+  function prepend_child(Frame $child, $update_node = true) {
+    while ( $child instanceof Frame_Decorator ) {
+      $child = $child->_frame;
+    }
+    
+    $this->_frame->prepend_child($child, $update_node);
+  }
+
+  /**
+   * @param Frame $child
+   * @param bool  $update_node
+   */
+  function append_child(Frame $child, $update_node = true) {
+    while ( $child instanceof Frame_Decorator ) {
+      $child = $child->_frame;
+    }
+
+    $this->_frame->append_child($child, $update_node);
+  }
+
+  /**
+   * @param Frame $new_child
+   * @param Frame $ref
+   * @param bool  $update_node
+   */
+  function insert_child_before(Frame $new_child, Frame $ref, $update_node = true) {
+    while ( $new_child instanceof Frame_Decorator ) {
+      $new_child = $new_child->_frame;
+    }
+
+    if ( $ref instanceof Frame_Decorator ) {
+      $ref = $ref->_frame;
+    }
+
+    $this->_frame->insert_child_before($new_child, $ref, $update_node);
+  }
+
+  /**
+   * @param Frame $new_child
+   * @param Frame $ref
+   * @param bool  $update_node
+   */
+  function insert_child_after(Frame $new_child, Frame $ref, $update_node = true) {
+    while ( $new_child instanceof Frame_Decorator ) {
+      $new_child = $new_child->_frame;
+    }
+
+    while ( $ref instanceof Frame_Decorator ) {
+      $ref = $ref->_frame;
+    }
+    
+    $this->_frame->insert_child_after($new_child, $ref, $update_node);
+  }
+
+  /**
+   * @param Frame $child
+   * @param bool  $update_node
+   *
+   * @return Frame
+   */
+  function remove_child(Frame $child, $update_node = true) {
+    while  ( $child instanceof Frame_Decorator ) {
+      $child = $child->_frame;
+    }
+
+    return $this->_frame->remove_child($child, $update_node);
+  }
+
+  /**
+   * @return Frame_Decorator
+   */
+  function get_parent() {
+    $p = $this->_frame->get_parent();
+    if ( $p && $deco = $p->get_decorator() ) {
+      while ( $tmp = $deco->get_decorator() ) {
+        $deco = $tmp;
+      }
+      
+      return $deco;
+    }
+    else if ( $p ) {
+      return $p;
+    }
+    
+    return null;
+  }
+
+  /**
+   * @return Frame_Decorator
+   */
+  function get_first_child() {
+    $c = $this->_frame->get_first_child();
+    if ( $c && $deco = $c->get_decorator() ) {
+      while ( $tmp = $deco->get_decorator() ) {
+        $deco = $tmp;
+      }
+      
+      return $deco;
+    }
+    else if ( $c ) {
+      return $c;
+    }
+    
+    return null;
+  }
+
+  /**
+   * @return Frame_Decorator
+   */
+  function get_last_child() {
+    $c = $this->_frame->get_last_child();
+    if ( $c && $deco = $c->get_decorator() ) {
+      while ( $tmp = $deco->get_decorator() ) {
+        $deco = $tmp;
+      }
+      
+      return $deco;
+    }
+    else if ( $c ) {
+      return $c;
+    }
+    
+    return null;
+  }
+
+  /**
+   * @return Frame_Decorator
+   */
+  function get_prev_sibling() {
+    $s = $this->_frame->get_prev_sibling();
+    if ( $s && $deco = $s->get_decorator() ) {
+      while ( $tmp = $deco->get_decorator() ) {
+        $deco = $tmp;
+      }
+      return $deco;
+    }
+    else if ( $s ) {
+      return $s;
+    }
+    
+    return null;
+  }
+  
+  /**
+   * @return Frame_Decorator
+   */
+  function get_next_sibling() {
+    $s = $this->_frame->get_next_sibling();
+    if ( $s && $deco = $s->get_decorator() ) {
+      while ( $tmp = $deco->get_decorator() ) {
+        $deco = $tmp;
+      }
+      
+      return $deco;
+    }
+    else if ( $s ) {
+      return $s;
+    }
+    
+    return null;
+  }
+
+  /**
+   * @return FrameTreeList
+   */
+  function get_subtree() {
+    return new FrameTreeList($this);
+  }
+
+  function set_positioner(Positioner $posn) {
+    $this->_positioner = $posn;
+    if ( $this->_frame instanceof Frame_Decorator ) {
+      $this->_frame->set_positioner($posn);
+    }
+  }
+
+  function set_reflower(Frame_Reflower $reflower) {
+    $this->_reflower = $reflower;
+    if ( $this->_frame instanceof Frame_Decorator ) {
+      $this->_frame->set_reflower( $reflower );
+    }
+  }
+  
+  /**
+   * @return Frame_Reflower
+   */
+  function get_reflower() {
+    return $this->_reflower;
+  }
+
+  /**
+   * @param Frame $root
+   */
+  function set_root(Frame $root) {
+    $this->_root = $root;
+    
+    if ( $this->_frame instanceof Frame_Decorator ) {
+      $this->_frame->set_root($root);
+    }
+  }
+  
+  /**
+   * @return Page_Frame_Decorator
+   */
+  function get_root() {
+    return $this->_root;
+  }
+
+  /**
+   * @return Block_Frame_Decorator
+   */
+  function find_block_parent() {
+    // Find our nearest block level parent
+    $p = $this->get_parent();
+    
+    while ( $p ) {
+      if ( $p->is_block() ) {
+        break;
+      }
+      
+      $p = $p->get_parent();
+    }
+
+    return $this->_block_parent = $p;
+  }
+  
+  /**
+   * @return Frame_Decorator
+   */
+  function find_positionned_parent() {
+    // Find our nearest relative positionned parent
+    $p = $this->get_parent();
+    while ( $p ) {
+      if ( $p->is_positionned() ) {
+        break;
+      }
+      
+      $p = $p->get_parent();
+    }
+    
+    if ( !$p ) {
+      $p = $this->_root->get_first_child(); // <body>
+    }
+
+    return $this->_positionned_parent = $p;
+  }
+
+  /**
+   * split this frame at $child.
+   * The current frame is cloned and $child and all children following
+   * $child are added to the clone.  The clone is then passed to the
+   * current frame's parent->split() method.
+   *
+   * @param Frame   $child
+   * @param boolean $force_pagebreak
+   *
+   * @throws DOMPDF_Exception
+   * @return void
+   */
+  function split(Frame $child = null, $force_pagebreak = false) {
+    // decrement any counters that were incremented on the current node, unless that node is the body
+    $style = $this->_frame->get_style();
+    if ( $this->_frame->get_node()->nodeName !== "body" && $style->counter_increment && ($decrement = $style->counter_increment) !== "none" ) {
+      $this->decrement_counters($decrement);
+    }
+    
+    if ( is_null( $child ) ) {
+      // check for counter increment on :before content (always a child of the selected element @link Frame_Reflower::_set_content)
+      // this can push the current node to the next page before counter rules have bubbled up (but only if
+      // it's been rendered, thus the position check)
+      if ( !$this->is_text_node() && $this->get_node()->hasAttribute("dompdf_before_frame_id") ) {
+        foreach($this->_frame->get_children() as $child) {
+          if ( $this->get_node()->getAttribute("dompdf_before_frame_id") == $child->get_id() && $child->get_position('x') !== NULL ) {
+            $style = $child->get_style();
+            if ( $style->counter_increment && ($decrement = $style->counter_increment) !== "none" ) {
+              $this->decrement_counters($decrement);
+            }
+          }
+        }
+      }
+      $this->get_parent()->split($this, $force_pagebreak);
+      return;
+    }
+    
+    if ( $child->get_parent() !== $this ) {
+      throw new DOMPDF_Exception("Unable to split: frame is not a child of this one.");
+    }
+    
+    $node = $this->_frame->get_node();
+    
+    $split = $this->copy( $node->cloneNode() );
+    $split->reset();
+    $split->get_original_style()->text_indent = 0;
+    $split->_splitted = true;
+    
+    // The body's properties must be kept
+    if ( $node->nodeName !== "body" ) {
+      // Style reset on the first and second parts
+      $style = $this->_frame->get_style();
+      $style->margin_bottom = 0;
+      $style->padding_bottom = 0;
+      $style->border_bottom = 0;
+      
+      // second
+      $orig_style = $split->get_original_style();
+      $orig_style->text_indent = 0;
+      $orig_style->margin_top = 0;
+      $orig_style->padding_top = 0;
+      $orig_style->border_top = 0;
+    }
+    
+    $this->get_parent()->insert_child_after($split, $this);
+    
+    // Add $frame and all following siblings to the new split node
+    $iter = $child;
+    while ($iter) {
+      $frame = $iter;
+      $iter = $iter->get_next_sibling();
+      $frame->reset();
+      $split->append_child($frame);
+    }
+    
+    $this->get_parent()->split($split, $force_pagebreak);
+    
+    // If this node resets a counter save the current value to use when rendering on the next page
+    if ( $style->counter_reset && ( $reset = $style->counter_reset ) !== "none" ) {
+      $vars = preg_split( '/\s+/' , trim( $reset ) , 2 );
+      $split->_counters[ '__' . $vars[0] ] = $this->lookup_counter_frame( $vars[0] )->_counters[$vars[0]];
+    }
+  }
+
+  function reset_counter($id = self::DEFAULT_COUNTER, $value = 0) {
+    $this->get_parent()->_counters[$id] = intval($value);
+  }
+  
+  function decrement_counters($counters) {
+    foreach($counters as $id => $increment) {
+      $this->increment_counter($id, intval($increment) * -1);
+    }
+  }
+  
+  function increment_counters($counters) {
+    foreach($counters as $id => $increment) {
+      $this->increment_counter($id, intval($increment));
+    }
+  }
+
+  function increment_counter($id = self::DEFAULT_COUNTER, $increment = 1) {
+    $counter_frame = $this->lookup_counter_frame($id);
+
+    if ( $counter_frame ) {
+      if ( !isset($counter_frame->_counters[$id]) ) {
+        $counter_frame->_counters[$id] = 0;
+      }
+      
+      $counter_frame->_counters[$id] += $increment;
+    }
+  }
+  
+  function lookup_counter_frame($id = self::DEFAULT_COUNTER) {
+    $f = $this->get_parent();
+    
+    while( $f ) {
+      if( isset($f->_counters[$id]) ) {
+        return $f;
+      }
+      $fp = $f->get_parent();
+      
+      if ( !$fp ) {
+        return $f;
+      }
+      
+      $f = $fp;
+    }
+  }
+
+  // TODO: What version is the best : this one or the one in List_Bullet_Renderer ?
+  function counter_value($id = self::DEFAULT_COUNTER, $type = "decimal") {
+    $type = mb_strtolower($type);
+    
+    if ( !isset($this->_counters[$id]) ) {
+      $this->_counters[$id] = 0;
+    }
+
+    $value = $this->_counters[$id];
+    
+    switch ($type) {
+      default:
+      case "decimal":
+        return $value;
+  
+      case "decimal-leading-zero":
+        return str_pad($value, 2, "0");
+  
+      case "lower-roman":
+        return dec2roman($value);
+  
+      case "upper-roman":
+        return mb_strtoupper(dec2roman($value));
+  
+      case "lower-latin":
+      case "lower-alpha":
+        return chr( ($value % 26) + ord('a') - 1);
+  
+      case "upper-latin":
+      case "upper-alpha":
+        return chr( ($value % 26) + ord('A') - 1);
+  
+      case "lower-greek":
+        return unichr($value + 944);
+  
+      case "upper-greek":
+        return unichr($value + 912);
+    }
+  }
+
+  final function position() {
+    $this->_positioner->position();
+  }
+  
+  final function move($offset_x, $offset_y, $ignore_self = false) {
+    $this->_positioner->move($offset_x, $offset_y, $ignore_self); 
+  }
+  
+  final function reflow(Block_Frame_Decorator $block = null) {
+    // Uncomment this to see the frames before they're laid out, instead of
+    // during rendering.
+    //echo $this->_frame; flush();
+    $this->_reflower->reflow($block);
+  }
+
+  final function get_min_max_width() {
+    return $this->_reflower->get_min_max_width();
+  }
+}

vendor/dompdf/dompdf/include/frame_factory.cls.php

@@ -0,0 +1,252 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Contains frame decorating logic
+ *
+ * This class is responsible for assigning the correct {@link Frame_Decorator},
+ * {@link Positioner}, and {@link Frame_Reflower} objects to {@link Frame}
+ * objects.  This is determined primarily by the Frame's display type, but
+ * also by the Frame's node's type (e.g. DomElement vs. #text)
+ *
+ * @access private
+ * @package dompdf
+ */
+class Frame_Factory {
+
+  /**
+   * Decorate the root Frame
+   * 
+   * @param $root Frame The frame to decorate
+   * @param $dompdf DOMPDF The dompdf instance
+   * @return Page_Frame_Decorator
+   */
+  static function decorate_root(Frame $root, DOMPDF $dompdf) {
+    $frame = new Page_Frame_Decorator($root, $dompdf);
+    $frame->set_reflower( new Page_Frame_Reflower($frame) );
+    $root->set_decorator($frame);
+    return $frame;
+  }
+
+  /**
+   * Decorate a Frame
+   *
+   * @param Frame  $frame  The frame to decorate
+   * @param DOMPDF $dompdf The dompdf instance
+   * @param Frame  $root   The frame to decorate
+   *
+   * @throws DOMPDF_Exception
+   * @return Frame_Decorator
+   * FIXME: this is admittedly a little smelly...
+   */
+  static function decorate_frame(Frame $frame, DOMPDF $dompdf, Frame $root = null) {
+    if ( is_null($dompdf) ) {
+      throw new DOMPDF_Exception("The DOMPDF argument is required");
+    }
+    
+    $style = $frame->get_style();
+    
+    // Floating (and more generally out-of-flow) elements are blocks 
+    // http://coding.smashingmagazine.com/2007/05/01/css-float-theory-things-you-should-know/
+    if ( !$frame->is_in_flow() && in_array($style->display, Style::$INLINE_TYPES)) {
+      $style->display = "block";
+    }
+      
+    $display = $style->display;
+    
+    switch ($display) {
+      
+    case "block":
+      $positioner = "Block";        
+      $decorator = "Block";
+      $reflower = "Block";
+      break;
+    
+    case "inline-block":
+      $positioner = "Inline";
+      $decorator = "Block";
+      $reflower = "Block";
+      break;
+
+    case "inline":
+      $positioner = "Inline";
+      if ( $frame->is_text_node() ) {
+        $decorator = "Text";
+        $reflower = "Text";
+      } 
+      else {
+        $enable_css_float = $dompdf->get_option("enable_css_float");
+        if ( $enable_css_float && $style->float !== "none" ) {
+          $decorator = "Block";
+          $reflower = "Block";
+        }
+        else {
+          $decorator = "Inline";
+          $reflower = "Inline";
+        }
+      }
+      break;   
+
+    case "table":
+      $positioner = "Block";
+      $decorator = "Table";
+      $reflower = "Table";
+      break;
+      
+    case "inline-table":
+      $positioner = "Inline";
+      $decorator = "Table";
+      $reflower = "Table";
+      break;
+
+    case "table-row-group":
+    case "table-header-group":
+    case "table-footer-group":
+      $positioner = "Null";
+      $decorator = "Table_Row_Group";
+      $reflower = "Table_Row_Group";
+      break;
+      
+    case "table-row":
+      $positioner = "Null";
+      $decorator = "Table_Row";
+      $reflower = "Table_Row";
+      break;
+
+    case "table-cell":
+      $positioner = "Table_Cell";
+      $decorator = "Table_Cell";
+      $reflower = "Table_Cell";
+      break;
+        
+    case "list-item":
+      $positioner = "Block";
+      $decorator  = "Block";
+      $reflower   = "Block";
+      break;
+
+    case "-dompdf-list-bullet":
+      if ( $style->list_style_position === "inside" ) {
+        $positioner = "Inline";
+      }
+      else {        
+        $positioner = "List_Bullet";
+      }
+
+      if ( $style->list_style_image !== "none" ) {
+        $decorator = "List_Bullet_Image";
+      }
+      else {
+        $decorator = "List_Bullet";
+      }
+      
+      $reflower = "List_Bullet";
+      break;
+
+    case "-dompdf-image":
+      $positioner = "Inline";
+      $decorator = "Image";
+      $reflower = "Image";
+      break;
+      
+    case "-dompdf-br":
+      $positioner = "Inline";
+      $decorator = "Inline";
+      $reflower = "Inline";
+      break;
+
+    default:
+      // FIXME: should throw some sort of warning or something?
+    case "none":
+      if ( $style->_dompdf_keep !== "yes" ) {
+        // Remove the node and the frame
+        $frame->get_parent()->remove_child($frame);
+        return;
+      }
+
+      $positioner = "Null";
+      $decorator = "Null";
+      $reflower = "Null";
+      break;
+    }
+
+    // Handle CSS position
+    $position = $style->position;
+    
+    if ( $position === "absolute" ) {
+      $positioner = "Absolute";
+    }
+    else if ( $position === "fixed" ) {
+      $positioner = "Fixed";
+    }
+      
+    $node = $frame->get_node();
+    
+    // Handle nodeName
+    if ( $node->nodeName === "img" ) {
+      $style->display = "-dompdf-image";
+      $decorator = "Image";
+      $reflower = "Image";
+    }
+  
+    $positioner .= "_Positioner";
+    $decorator .= "_Frame_Decorator";
+    $reflower .= "_Frame_Reflower";
+
+    $deco = new $decorator($frame, $dompdf);
+    
+    $deco->set_positioner( new $positioner($deco) );
+    $deco->set_reflower( new $reflower($deco) );
+    
+    if ( $root ) {
+      $deco->set_root($root);
+    }
+    
+    if ( $display === "list-item" ) {
+      // Insert a list-bullet frame
+      $xml = $dompdf->get_dom();
+      $bullet_node = $xml->createElement("bullet"); // arbitrary choice
+      $b_f = new Frame($bullet_node);
+
+      $node = $frame->get_node();
+      $parent_node = $node->parentNode;
+      
+      if ( $parent_node ) {
+        if ( !$parent_node->hasAttribute("dompdf-children-count") ) {
+          $xpath = new DOMXPath($xml);
+          $count = $xpath->query("li", $parent_node)->length;
+          $parent_node->setAttribute("dompdf-children-count", $count);
+        }
+        
+        if ( is_numeric($node->getAttribute("value")) ) {
+          $index = intval($node->getAttribute("value"));
+        }
+        else {
+          if ( !$parent_node->hasAttribute("dompdf-counter") ) {
+            $index = ($parent_node->hasAttribute("start") ? $parent_node->getAttribute("start") : 1);
+          }
+          else {
+            $index = $parent_node->getAttribute("dompdf-counter")+1;
+          }
+        }
+        
+        $parent_node->setAttribute("dompdf-counter", $index);
+        $bullet_node->setAttribute("dompdf-counter", $index);
+      }
+      
+      $new_style = $dompdf->get_css()->create_style();
+      $new_style->display = "-dompdf-list-bullet";
+      $new_style->inherit($style);
+      $b_f->set_style($new_style);
+      
+      $deco->prepend_child( Frame_Factory::decorate_frame($b_f, $dompdf, $root) );
+    }
+    
+    return $deco;
+  }
+}

vendor/dompdf/dompdf/include/frame_reflower.cls.php

@@ -0,0 +1,458 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Base reflower class
+ *
+ * Reflower objects are responsible for determining the width and height of
+ * individual frames.  They also create line and page breaks as necessary.
+ *
+ * @access private
+ * @package dompdf
+ */
+abstract class Frame_Reflower {
+
+  /**
+   * Frame for this reflower
+   *
+   * @var Frame
+   */
+  protected $_frame;
+
+  /**
+   * Cached min/max size
+   *
+   * @var array
+   */
+  protected $_min_max_cache;
+  
+  function __construct(Frame $frame) {
+    $this->_frame = $frame;
+    $this->_min_max_cache = null;
+  }
+
+  function dispose() {
+    clear_object($this);
+  }
+
+  /**
+   * @return DOMPDF
+   */
+  function get_dompdf() {
+    return $this->_frame->get_dompdf();
+  }
+
+  /**
+   * Collapse frames margins
+   * http://www.w3.org/TR/CSS2/box.html#collapsing-margins
+   */
+  protected function _collapse_margins() {
+    $frame = $this->_frame;
+    $cb = $frame->get_containing_block();
+    $style = $frame->get_style();
+    
+    if ( !$frame->is_in_flow() ) {
+      return;
+    }
+
+    $t = $style->length_in_pt($style->margin_top, $cb["h"]);
+    $b = $style->length_in_pt($style->margin_bottom, $cb["h"]);
+
+    // Handle 'auto' values
+    if ( $t === "auto" ) {
+      $style->margin_top = "0pt";
+      $t = 0;
+    }
+
+    if ( $b === "auto" ) {
+      $style->margin_bottom = "0pt";
+      $b = 0;
+    }
+
+    // Collapse vertical margins:
+    $n = $frame->get_next_sibling();
+    if ( $n && !$n->is_block() ) {
+      while ( $n = $n->get_next_sibling() ) {
+        if ( $n->is_block() ) {
+          break;
+        }
+        
+        if ( !$n->get_first_child() ) {
+          $n = null;
+          break;
+        }
+      }
+    }
+    
+    if ( $n ) {
+      $n_style = $n->get_style();
+      $b = max($b, $n_style->length_in_pt($n_style->margin_top, $cb["h"]));
+      $n_style->margin_top = "0pt";
+      $style->margin_bottom = $b."pt";
+    }
+
+    // Collapse our first child's margin
+    /*$f = $this->_frame->get_first_child();
+    if ( $f && !$f->is_block() ) {
+      while ( $f = $f->get_next_sibling() ) {
+        if ( $f->is_block() ) {
+          break;
+        }
+        
+        if ( !$f->get_first_child() ) {
+          $f = null;
+          break;
+        }
+      }
+    }
+
+    // Margin are collapsed only between block elements
+    if ( $f ) {
+      $f_style = $f->get_style();
+      $t = max($t, $f_style->length_in_pt($f_style->margin_top, $cb["h"]));
+      $style->margin_top = $t."pt";
+      $f_style->margin_bottom = "0pt";
+    }*/
+  }
+
+  //........................................................................
+
+  abstract function reflow(Block_Frame_Decorator $block = null);
+
+  //........................................................................
+
+  // Required for table layout: Returns an array(0 => min, 1 => max, "min"
+  // => min, "max" => max) of the minimum and maximum widths of this frame.
+  // This provides a basic implementation.  Child classes should override
+  // this if necessary.
+  function get_min_max_width() {
+    if ( !is_null($this->_min_max_cache) ) {
+      return $this->_min_max_cache;
+    }
+    
+    $style = $this->_frame->get_style();
+
+    // Account for margins & padding
+    $dims = array($style->padding_left,
+                  $style->padding_right,
+                  $style->border_left_width,
+                  $style->border_right_width,
+                  $style->margin_left,
+                  $style->margin_right);
+
+    $cb_w = $this->_frame->get_containing_block("w");
+    $delta = $style->length_in_pt($dims, $cb_w);
+
+    // Handle degenerate case
+    if ( !$this->_frame->get_first_child() ) {
+      return $this->_min_max_cache = array(
+        $delta, $delta,
+        "min" => $delta, 
+        "max" => $delta,
+      );
+    }
+
+    $low = array();
+    $high = array();
+
+    for ( $iter = $this->_frame->get_children()->getIterator();
+          $iter->valid();
+          $iter->next() ) {
+
+      $inline_min = 0;
+      $inline_max = 0;
+
+      // Add all adjacent inline widths together to calculate max width
+      while ( $iter->valid() && in_array( $iter->current()->get_style()->display, Style::$INLINE_TYPES ) ) {
+
+        $child = $iter->current();
+
+        $minmax = $child->get_min_max_width();
+
+        if ( in_array( $iter->current()->get_style()->white_space, array("pre", "nowrap") ) ) {
+          $inline_min += $minmax["min"];
+        }
+        else {
+          $low[] = $minmax["min"];
+        }
+
+        $inline_max += $minmax["max"];
+        $iter->next();
+
+      }
+
+      if ( $inline_max > 0 ) $high[] = $inline_max;
+      if ( $inline_min > 0 ) $low[]  = $inline_min;
+
+      if ( $iter->valid() ) {
+        list($low[], $high[]) = $iter->current()->get_min_max_width();
+        continue;
+      }
+
+    }
+    $min = count($low) ? max($low) : 0;
+    $max = count($high) ? max($high) : 0;
+
+    // Use specified width if it is greater than the minimum defined by the
+    // content.  If the width is a percentage ignore it for now.
+    $width = $style->width;
+    if ( $width !== "auto" && !is_percent($width) ) {
+      $width = $style->length_in_pt($width, $cb_w);
+      if ( $min < $width ) $min = $width;
+      if ( $max < $width ) $max = $width;
+    }
+
+    $min += $delta;
+    $max += $delta;
+    return $this->_min_max_cache = array($min, $max, "min"=>$min, "max"=>$max);
+  }
+
+  /**
+   * Parses a CSS string containing quotes and escaped hex characters
+   * 
+   * @param $string string The CSS string to parse
+   * @param $single_trim
+   * @return string
+   */
+  protected function _parse_string($string, $single_trim = false) {
+    if ( $single_trim ) {
+      $string = preg_replace('/^[\"\']/', "", $string);
+      $string = preg_replace('/[\"\']$/', "", $string);
+    }
+    else {
+      $string = trim($string, "'\"");
+    }
+    
+    $string = str_replace(array("\\\n",'\\"',"\\'"),
+                          array("",'"',"'"), $string);
+
+    // Convert escaped hex characters into ascii characters (e.g. \A => newline)
+    $string = preg_replace_callback("/\\\\([0-9a-fA-F]{0,6})/",
+                                    create_function('$matches',
+                                                    'return unichr(hexdec($matches[1]));'),
+                                    $string);
+    return $string;
+  }
+  
+  /**
+   * Parses a CSS "quotes" property
+   * 
+   * @return array|null An array of pairs of quotes
+   */
+  protected function _parse_quotes() {
+    
+    // Matches quote types
+    $re = '/(\'[^\']*\')|(\"[^\"]*\")/';
+    
+    $quotes = $this->_frame->get_style()->quotes;
+      
+    // split on spaces, except within quotes
+    if ( !preg_match_all($re, "$quotes", $matches, PREG_SET_ORDER) ) {
+      return null;
+    }
+      
+    $quotes_array = array();
+    foreach($matches as &$_quote){
+      $quotes_array[] = $this->_parse_string($_quote[0], true);
+    }
+    
+    if ( empty($quotes_array) ) {
+      $quotes_array = array('"', '"');
+    }
+    
+    return array_chunk($quotes_array, 2);
+  }
+
+  /**
+   * Parses the CSS "content" property
+   * 
+   * @return string|null The resulting string
+   */
+  protected function _parse_content() {
+
+    // Matches generated content
+    $re = "/\n".
+      "\s(counters?\\([^)]*\\))|\n".
+      "\A(counters?\\([^)]*\\))|\n".
+      "\s([\"']) ( (?:[^\"']|\\\\[\"'])+ )(?<!\\\\)\\3|\n".
+      "\A([\"']) ( (?:[^\"']|\\\\[\"'])+ )(?<!\\\\)\\5|\n" .
+      "\s([^\s\"']+)|\n" .
+      "\A([^\s\"']+)\n".
+      "/xi";
+    
+    $content = $this->_frame->get_style()->content;
+
+    $quotes = $this->_parse_quotes();
+    
+    // split on spaces, except within quotes
+    if ( !preg_match_all($re, $content, $matches, PREG_SET_ORDER) ) {
+      return null;
+    }
+      
+    $text = "";
+
+    foreach ($matches as $match) {
+      
+      if ( isset($match[2]) && $match[2] !== "" ) {
+        $match[1] = $match[2];
+      }
+      
+      if ( isset($match[6]) && $match[6] !== "" ) {
+        $match[4] = $match[6];
+      }
+
+      if ( isset($match[8]) && $match[8] !== "" ) {
+        $match[7] = $match[8];
+      }
+
+      if ( isset($match[1]) && $match[1] !== "" ) {
+        
+        // counters?(...)
+        $match[1] = mb_strtolower(trim($match[1]));
+
+        // Handle counter() references:
+        // http://www.w3.org/TR/CSS21/generate.html#content
+
+        $i = mb_strpos($match[1], ")");
+        if ( $i === false ) {
+          continue;
+        }
+
+        preg_match( '/(counters?)(^\()*?\(\s*([^\s,]+)\s*(,\s*["\']?([^"\'\)]+)["\']?\s*(,\s*([^\s)]+)\s*)?)?\)/i' , $match[1] , $args );
+        $counter_id = $args[3];
+        if ( strtolower( $args[1] ) == 'counter' ) {
+          // counter(name [,style])
+          if ( isset( $args[5] ) ) {
+            $type = trim( $args[5] );
+          }
+          else {
+            $type = null;
+          }
+          $p = $this->_frame->lookup_counter_frame( $counter_id );
+          
+          $text .= $p->counter_value($counter_id, $type);
+          
+        }
+        else if ( strtolower( $args[1] ) == 'counters' ) {
+          // counters(name, string [,style])
+          if ( isset($args[5]) ) {
+            $string = $this->_parse_string( $args[5] );
+          }
+          else {
+            $string = "";
+          }
+          
+          if ( isset( $args[7] ) ) {
+            $type = trim( $args[7] );
+          }
+          else {
+            $type = null;
+          }
+          
+          $p = $this->_frame->lookup_counter_frame($counter_id);
+          $tmp = array();
+          while ($p) {
+            // We only want to use the counter values when they actually increment the counter
+            if ( array_key_exists( $counter_id , $p->_counters ) ) {
+              array_unshift( $tmp , $p->counter_value($counter_id, $type) );
+            }
+            $p = $p->lookup_counter_frame($counter_id);
+            
+          }
+          $text .= implode( $string , $tmp );
+          
+        }
+        else {
+          // countertops?
+          continue;
+        }
+        
+      }
+      else if ( isset($match[4]) && $match[4] !== "" ) {
+        // String match
+        $text .= $this->_parse_string($match[4]);
+      }
+      else if ( isset($match[7]) && $match[7] !== "" ) {
+        // Directive match
+
+        if ( $match[7] === "open-quote" ) {
+          // FIXME: do something here
+          $text .= $quotes[0][0];
+        }
+        else if ( $match[7] === "close-quote" ) {
+          // FIXME: do something else here
+          $text .= $quotes[0][1];
+        }
+        else if ( $match[7] === "no-open-quote" ) {
+          // FIXME:
+        }
+        else if ( $match[7] === "no-close-quote" ) {
+          // FIXME:
+        }
+        else if ( mb_strpos($match[7],"attr(") === 0 ) {
+
+          $i = mb_strpos($match[7],")");
+          if ( $i === false ) {
+            continue;
+          }
+
+          $attr = mb_substr($match[7], 5, $i - 5);
+          if ( $attr == "" ) {
+            continue;
+          }
+            
+          $text .= $this->_frame->get_parent()->get_node()->getAttribute($attr);
+        }
+        else {
+          continue;
+        }
+      }
+    }
+    
+    return $text;
+  }
+  
+  /**
+   * Sets the generated content of a generated frame
+   */
+  protected function _set_content(){
+    $frame = $this->_frame;
+    $style = $frame->get_style();
+    
+    // if the element was pushed to a new page use the saved counter value, otherwise use the CSS reset value
+    if ( $style->counter_reset && ($reset = $style->counter_reset) !== "none" ) {
+      $vars = preg_split('/\s+/', trim($reset), 2);
+      $frame->reset_counter( $vars[0] , ( isset($frame->_counters['__'.$vars[0]]) ? $frame->_counters['__'.$vars[0]] : ( isset($vars[1]) ? $vars[1] : 0 ) ) );
+    }
+    
+    if ( $style->counter_increment && ($increment = $style->counter_increment) !== "none" ) {
+      $frame->increment_counters($increment);
+    }
+  
+    if ( $style->content && !$frame->get_first_child() && $frame->get_node()->nodeName === "dompdf_generated" ) {
+      $content = $this->_parse_content();
+      // add generated content to the font subset
+      // FIXME: This is currently too late because the font subset has already been generated.
+      //        See notes in issue #750.
+      if ( $frame->get_dompdf()->get_option("enable_font_subsetting") && $frame->get_dompdf()->get_canvas() instanceof CPDF_Adapter ) {
+        $frame->get_dompdf()->get_canvas()->register_string_subset($style->font_family, $content);
+      }
+      
+      $node = $frame->get_node()->ownerDocument->createTextNode($content);
+      
+      $new_style = $style->get_stylesheet()->create_style();
+      $new_style->inherit($style);
+      
+      $new_frame = new Frame($node);
+      $new_frame->set_style($new_style);
+      
+      Frame_Factory::decorate_frame($new_frame, $frame->get_dompdf(), $frame->get_root());
+      $frame->append_child($new_frame);
+    }
+  }
+}

vendor/dompdf/dompdf/include/frame_tree.cls.php

@@ -0,0 +1,241 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Represents an entire document as a tree of frames
+ *
+ * The Frame_Tree consists of {@link Frame} objects each tied to specific
+ * DOMNode objects in a specific DomDocument.  The Frame_Tree has the same
+ * structure as the DomDocument, but adds additional capabalities for
+ * styling and layout.
+ *
+ * @package dompdf
+ * @access protected
+ */
+class Frame_Tree {
+    
+  /**
+   * Tags to ignore while parsing the tree
+   *
+   * @var array
+   */
+  static protected $_HIDDEN_TAGS = array("area", "base", "basefont", "head", "style",
+                                         "meta", "title", "colgroup",
+                                         "noembed", "noscript", "param", "#comment");  
+  /**
+   * The main DomDocument
+   *
+   * @see http://ca2.php.net/manual/en/ref.dom.php
+   * @var DomDocument
+   */
+  protected $_dom;
+
+  /**
+   * The root node of the FrameTree.
+   *
+   * @var Frame
+   */
+  protected $_root;
+
+  /**
+   * Subtrees of absolutely positioned elements
+   *
+   * @var array of Frames
+   */
+  protected $_absolute_frames;
+
+  /**
+   * A mapping of {@link Frame} objects to DOMNode objects
+   *
+   * @var array
+   */
+  protected $_registry;
+  
+
+  /**
+   * Class constructor
+   *
+   * @param DomDocument $dom the main DomDocument object representing the current html document
+   */
+  function __construct(DomDocument $dom) {
+    $this->_dom = $dom;
+    $this->_root = null;
+    $this->_registry = array();
+  }
+  
+  function __destruct() {
+    clear_object($this);
+  }
+
+  /**
+   * Returns the DomDocument object representing the curent html document
+   *
+   * @return DOMDocument
+   */
+  function get_dom() {
+    return $this->_dom;
+  }
+
+  /**
+   * Returns the root frame of the tree
+   * 
+   * @return Page_Frame_Decorator
+   */
+  function get_root() {
+    return $this->_root;
+  }
+
+  /**
+   * Returns a specific frame given its id
+   *
+   * @param string $id
+   * @return Frame
+   */
+  function get_frame($id) {
+    return isset($this->_registry[$id]) ? $this->_registry[$id] : null;
+  }
+
+  /**
+   * Returns a post-order iterator for all frames in the tree
+   *
+   * @return FrameTreeList|Frame[]
+   */
+  function get_frames() {
+    return new FrameTreeList($this->_root);
+  }
+      
+  /**
+   * Builds the tree
+   */
+  function build_tree() {
+    $html = $this->_dom->getElementsByTagName("html")->item(0);
+    if ( is_null($html) ) {
+      $html = $this->_dom->firstChild;
+    }
+
+    if ( is_null($html) ) {
+      throw new DOMPDF_Exception("Requested HTML document contains no data.");
+    }
+
+    $this->fix_tables();
+    
+    $this->_root = $this->_build_tree_r($html);
+  }
+  
+  /**
+   * Adds missing TBODYs around TR
+   */
+  protected function fix_tables(){
+    $xp = new DOMXPath($this->_dom);
+    
+    // Move table caption before the table
+    // FIXME find a better way to deal with it...
+    $captions = $xp->query("//table/caption");
+    foreach($captions as $caption) {
+      $table = $caption->parentNode;
+      $table->parentNode->insertBefore($caption, $table);
+    }
+    
+    $rows = $xp->query("//table/tr");
+    foreach($rows as $row) {
+      $tbody = $this->_dom->createElement("tbody");
+      $tbody = $row->parentNode->insertBefore($tbody, $row);
+      $tbody->appendChild($row);
+    }
+  }
+
+  /**
+   * Recursively adds {@link Frame} objects to the tree
+   *
+   * Recursively build a tree of Frame objects based on a dom tree.
+   * No layout information is calculated at this time, although the
+   * tree may be adjusted (i.e. nodes and frames for generated content
+   * and images may be created).
+   *
+   * @param DOMNode $node the current DOMNode being considered
+   * @return Frame
+   */
+  protected function _build_tree_r(DOMNode $node) {
+    
+    $frame = new Frame($node);
+    $id = $frame->get_id();
+    $this->_registry[ $id ] = $frame;
+    
+    if ( !$node->hasChildNodes() ) {
+      return $frame;
+    }
+
+    // Fixes 'cannot access undefined property for object with
+    // overloaded access', fix by Stefan radulian
+    // <stefan.radulian@symbion.at>    
+    //foreach ($node->childNodes as $child) {
+
+    // Store the children in an array so that the tree can be modified
+    $children = array();
+    for ($i = 0; $i < $node->childNodes->length; $i++) {
+      $children[] = $node->childNodes->item($i);
+    }
+
+    foreach ($children as $child) {
+      $node_name = mb_strtolower($child->nodeName);
+      
+      // Skip non-displaying nodes
+      if ( in_array($node_name, self::$_HIDDEN_TAGS) )  {
+        if ( $node_name !== "head" && $node_name !== "style" ) {
+          $child->parentNode->removeChild($child);
+        }
+        
+        continue;
+      }
+
+      // Skip empty text nodes
+      if ( $node_name === "#text" && $child->nodeValue == "" ) {
+        $child->parentNode->removeChild($child);
+        continue;
+      }
+
+      // Skip empty image nodes
+      if ( $node_name === "img" && $child->getAttribute("src") == "" ) {
+        $child->parentNode->removeChild($child);
+        continue;
+      }
+      
+      $frame->append_child($this->_build_tree_r($child), false);
+    }
+    
+    return $frame;
+  }
+  
+  public function insert_node(DOMNode $node, DOMNode $new_node, $pos) {
+    if ( $pos === "after" || !$node->firstChild ) {
+      $node->appendChild($new_node);
+    }
+    else {
+      $node->insertBefore($new_node, $node->firstChild);
+    }
+    
+    $this->_build_tree_r($new_node);
+    
+    $frame_id = $new_node->getAttribute("frame_id");
+    $frame = $this->get_frame($frame_id);
+    
+    $parent_id = $node->getAttribute("frame_id");
+    $parent = $this->get_frame($parent_id);
+    
+    if ( $parent ) {
+      if ( $pos === "before" ) {
+        $parent->prepend_child($frame, false);
+      }
+      else {
+        $parent->append_child($frame, false);
+      }
+    }
+    
+    return $frame_id;
+  }
+}

vendor/dompdf/dompdf/include/gd_adapter.cls.php

@@ -0,0 +1,840 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Image rendering interface
+ *
+ * Renders to an image format supported by GD (jpeg, gif, png, xpm).
+ * Not super-useful day-to-day but handy nonetheless
+ *
+ * @package dompdf
+ */
+class GD_Adapter implements Canvas {
+  /**
+   * @var DOMPDF
+   */
+  private $_dompdf;
+
+  /**
+   * Resource handle for the image
+   *
+   * @var resource
+   */
+  private $_img;
+
+  /**
+   * Image width in pixels
+   *
+   * @var int
+   */
+  private $_width;
+
+  /**
+   * Image height in pixels
+   *
+   * @var int
+   */
+  private $_height;
+
+  /**
+   * Current page number
+   *
+   * @var int
+   */
+  private $_page_number;
+
+  /**
+   * Total number of pages
+   *
+   * @var int
+   */
+  private $_page_count;
+
+  /**
+   * Image antialias factor
+   *
+   * @var float
+   */
+  private $_aa_factor;
+
+  /**
+   * Allocated colors
+   *
+   * @var array
+   */
+  private $_colors;
+
+  /**
+   * Background color
+   *
+   * @var int
+   */
+  private $_bg_color;
+
+  /**
+   * Class constructor
+   *
+   * @param mixed  $size         The size of image to create: array(x1,y1,x2,y2) or "letter", "legal", etc.
+   * @param string $orientation  The orientation of the document (either 'landscape' or 'portrait')
+   * @param DOMPDF $dompdf
+   * @param float  $aa_factor    Anti-aliasing factor, 1 for no AA
+   * @param array  $bg_color     Image background color: array(r,g,b,a), 0 <= r,g,b,a <= 1
+   */
+  function __construct($size, $orientation = "portrait", DOMPDF $dompdf, $aa_factor = 1.0, $bg_color = array(1,1,1,0) ) {
+
+    if ( !is_array($size) ) {
+      $size = strtolower($size);
+      
+      if ( isset(CPDF_Adapter::$PAPER_SIZES[$size]) ) {
+        $size = CPDF_Adapter::$PAPER_SIZES[$size];
+      }
+      else {
+        $size = CPDF_Adapter::$PAPER_SIZES["letter"];
+      }
+    }
+
+    if ( strtolower($orientation) === "landscape" ) {
+      list($size[2],$size[3]) = array($size[3],$size[2]);
+    }
+
+    $this->_dompdf = $dompdf;
+
+    if ( $aa_factor < 1 ) {
+      $aa_factor = 1;
+    }
+
+    $this->_aa_factor = $aa_factor;
+    
+    $size[2] *= $aa_factor;
+    $size[3] *= $aa_factor;
+    
+    $this->_width = $size[2] - $size[0];
+    $this->_height = $size[3] - $size[1];
+
+    $this->_img = imagecreatetruecolor($this->_width, $this->_height);
+
+    if ( is_null($bg_color) || !is_array($bg_color) ) {
+      // Pure white bg
+      $bg_color = array(1,1,1,0);
+    }
+
+    $this->_bg_color = $this->_allocate_color($bg_color);
+    imagealphablending($this->_img, true);
+    imagesavealpha($this->_img, true);
+    imagefill($this->_img, 0, 0, $this->_bg_color);
+    
+  }
+
+  function get_dompdf(){
+    return $this->_dompdf;
+  }
+
+  /**
+   * Return the GF image resource
+   *
+   * @return resource
+   */
+  function get_image() { return $this->_img; }
+
+  /**
+   * Return the image's width in pixels
+   *
+   * @return float
+   */
+  function get_width() { return $this->_width / $this->_aa_factor; }
+
+  /**
+   * Return the image's height in pixels
+   *
+   * @return float
+   */
+  function get_height() { return $this->_height / $this->_aa_factor; }
+
+  /**
+   * Returns the current page number
+   * @return int
+   */
+  function get_page_number() { return $this->_page_number; }
+
+  /**
+   * Returns the total number of pages in the document
+   * @return int
+   */
+  function get_page_count() { return $this->_page_count; }
+
+  /**
+   * Sets the current page number
+   *
+   * @param int $num
+   */
+  function set_page_number($num) { $this->_page_number = $num; }
+
+  /**
+   * Sets the page count
+   *
+   * @param int $count
+   */
+  function set_page_count($count) {  $this->_page_count = $count; }
+  
+  /**
+   * Sets the opacity 
+   * 
+   * @param $opacity
+   * @param $mode
+   */
+  function set_opacity($opacity, $mode = "Normal") {
+    // FIXME
+  }
+
+  /**
+   * Allocate a new color.  Allocate with GD as needed and store
+   * previously allocated colors in $this->_colors.
+   *
+   * @param array $color  The new current color
+   * @return int           The allocated color
+   */
+  private function _allocate_color($color) {
+    
+    if ( isset($color["c"]) ) {
+      $color = cmyk_to_rgb($color);
+    }
+    
+    // Full opacity if no alpha set
+    if ( !isset($color[3]) ) 
+      $color[3] = 0;
+    
+    list($r,$g,$b,$a) = $color;
+    
+    $r *= 255;
+    $g *= 255;
+    $b *= 255;
+    $a *= 127;
+    
+    // Clip values
+    $r = $r > 255 ? 255 : $r;
+    $g = $g > 255 ? 255 : $g;
+    $b = $b > 255 ? 255 : $b;
+    $a = $a > 127 ? 127 : $a;
+      
+    $r = $r < 0 ? 0 : $r;
+    $g = $g < 0 ? 0 : $g;
+    $b = $b < 0 ? 0 : $b;
+    $a = $a < 0 ? 0 : $a;
+      
+    $key = sprintf("#%02X%02X%02X%02X", $r, $g, $b, $a);
+      
+    if ( isset($this->_colors[$key]) )
+      return $this->_colors[$key];
+
+    if ( $a != 0 ) 
+      $this->_colors[$key] = imagecolorallocatealpha($this->_img, $r, $g, $b, $a);
+    else
+      $this->_colors[$key] = imagecolorallocate($this->_img, $r, $g, $b);
+      
+    return $this->_colors[$key];
+    
+  }
+  
+  /**
+   * Draws a line from x1,y1 to x2,y2
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the format of the
+   * $style parameter (aka dash).
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $x2
+   * @param float $y2
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   */
+  function line($x1, $y1, $x2, $y2, $color, $width, $style = null) {
+
+    // Scale by the AA factor
+    $x1 *= $this->_aa_factor;
+    $y1 *= $this->_aa_factor;
+    $x2 *= $this->_aa_factor;
+    $y2 *= $this->_aa_factor;
+    $width *= $this->_aa_factor;
+
+    $c = $this->_allocate_color($color);
+
+    // Convert the style array if required
+    if ( !is_null($style) ) {
+      $gd_style = array();
+
+      if ( count($style) == 1 ) {
+        for ($i = 0; $i < $style[0] * $this->_aa_factor; $i++) {
+          $gd_style[] = $c;
+        }
+
+        for ($i = 0; $i < $style[0] * $this->_aa_factor; $i++) {
+          $gd_style[] = $this->_bg_color;
+        }
+
+      } else {
+
+        $i = 0;
+        foreach ($style as $length) {
+
+          if ( $i % 2 == 0 ) {
+            // 'On' pattern
+            for ($i = 0; $i < $style[0] * $this->_aa_factor; $i++) 
+              $gd_style[] = $c;
+            
+          } else {
+            // Off pattern
+            for ($i = 0; $i < $style[0] * $this->_aa_factor; $i++) 
+              $gd_style[] = $this->_bg_color;
+            
+          }
+          $i++;
+        }
+      }
+      
+      imagesetstyle($this->_img, $gd_style);
+      $c = IMG_COLOR_STYLED;
+    }
+    
+    imagesetthickness($this->_img, $width);
+
+    imageline($this->_img, $x1, $y1, $x2, $y2, $c);
+    
+  }
+
+  function arc($x1, $y1, $r1, $r2, $astart, $aend, $color, $width, $style = array()) {
+    // @todo
+  }
+
+  /**
+   * Draws a rectangle at x1,y1 with width w and height h
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   */   
+  function rectangle($x1, $y1, $w, $h, $color, $width, $style = null) {
+
+    // Scale by the AA factor
+    $x1 *= $this->_aa_factor;
+    $y1 *= $this->_aa_factor;
+    $w *= $this->_aa_factor;
+    $h *= $this->_aa_factor;
+
+    $c = $this->_allocate_color($color);
+
+    // Convert the style array if required
+    if ( !is_null($style) ) {
+      $gd_style = array();
+
+      foreach ($style as $length) {
+        for ($i = 0; $i < $length; $i++) {
+          $gd_style[] = $c;
+        }
+      }
+
+      imagesetstyle($this->_img, $gd_style);
+      $c = IMG_COLOR_STYLED;
+    }
+
+    imagesetthickness($this->_img, $width);
+
+    imagerectangle($this->_img, $x1, $y1, $x1 + $w, $y1 + $h, $c);
+    
+  }
+
+  /**
+   * Draws a filled rectangle at x1,y1 with width w and height h
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   * @param array $color
+   */   
+  function filled_rectangle($x1, $y1, $w, $h, $color) {
+
+    // Scale by the AA factor
+    $x1 *= $this->_aa_factor;
+    $y1 *= $this->_aa_factor;
+    $w *= $this->_aa_factor;
+    $h *= $this->_aa_factor;
+
+    $c = $this->_allocate_color($color);
+
+    imagefilledrectangle($this->_img, $x1, $y1, $x1 + $w, $y1 + $h, $c);
+
+  }
+  
+  /**
+   * Starts a clipping rectangle at x1,y1 with width w and height h
+   *
+   * @param float $x1
+   * @param float $y1
+   * @param float $w
+   * @param float $h
+   */
+  function clipping_rectangle($x1, $y1, $w, $h) {
+    // @todo
+  }
+  
+  function clipping_roundrectangle($x1, $y1, $w, $h, $rTL, $rTR, $rBR, $rBL) {
+    // @todo
+  }
+  
+  /**
+   * Ends the last clipping shape
+   */  
+  function clipping_end() {
+    // @todo
+  }
+  
+  function save() {
+    // @todo
+  }
+  
+  function restore() {
+    // @todo
+  }
+  
+  function rotate($angle, $x, $y) {
+    // @todo
+  }
+  
+  function skew($angle_x, $angle_y, $x, $y) {
+    // @todo
+  }
+  
+  function scale($s_x, $s_y, $x, $y) {
+    // @todo
+  }
+  
+  function translate($t_x, $t_y) {
+    // @todo
+  }
+  
+  function transform($a, $b, $c, $d, $e, $f) {
+    // @todo
+  }
+
+  /**
+   * Draws a polygon
+   *
+   * The polygon is formed by joining all the points stored in the $points
+   * array.  $points has the following structure:
+   * <code>
+   * array(0 => x1,
+   *       1 => y1,
+   *       2 => x2,
+   *       3 => y2,
+   *       ...
+   *       );
+   * </code>
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)   
+   *
+   * @param array $points
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   * @param bool  $fill  Fills the polygon if true
+   */
+  function polygon($points, $color, $width = null, $style = null, $fill = false) {
+
+    // Scale each point by the AA factor
+    foreach (array_keys($points) as $i)
+      $points[$i] *= $this->_aa_factor;
+
+    $c = $this->_allocate_color($color);
+
+    // Convert the style array if required
+    if ( !is_null($style) && !$fill ) {
+      $gd_style = array();
+
+      foreach ($style as $length) {
+        for ($i = 0; $i < $length; $i++) {
+          $gd_style[] = $c;
+        }
+      }
+
+      imagesetstyle($this->_img, $gd_style);
+      $c = IMG_COLOR_STYLED;
+    }
+
+    imagesetthickness($this->_img, $width);
+
+    if ( $fill ) 
+      imagefilledpolygon($this->_img, $points, count($points) / 2, $c);
+    else
+      imagepolygon($this->_img, $points, count($points) / 2, $c);
+        
+  }
+
+  /**
+   * Draws a circle at $x,$y with radius $r
+   *
+   * See {@link Style::munge_color()} for the format of the color array.
+   * See {@link Cpdf::setLineStyle()} for a description of the $style
+   * parameter (aka dash)
+   *
+   * @param float $x
+   * @param float $y
+   * @param float $r
+   * @param array $color
+   * @param float $width
+   * @param array $style
+   * @param bool $fill Fills the circle if true   
+   */   
+  function circle($x, $y, $r, $color, $width = null, $style = null, $fill = false) {
+
+    // Scale by the AA factor
+    $x *= $this->_aa_factor;
+    $y *= $this->_aa_factor;
+    $r *= $this->_aa_factor;
+
+    $c = $this->_allocate_color($color);
+
+    // Convert the style array if required
+    if ( !is_null($style) && !$fill ) {
+      $gd_style = array();
+
+      foreach ($style as $length) {
+        for ($i = 0; $i < $length; $i++) {
+          $gd_style[] = $c;
+        }
+      }
+
+      imagesetstyle($this->_img, $gd_style);
+      $c = IMG_COLOR_STYLED;
+    }
+
+    imagesetthickness($this->_img, $width);
+
+    if ( $fill )
+      imagefilledellipse($this->_img, $x, $y, $r, $r, $c);
+    else
+      imageellipse($this->_img, $x, $y, $r, $r, $c);
+        
+  }
+
+  /**
+   * Add an image to the pdf.
+   * The image is placed at the specified x and y coordinates with the
+   * given width and height.
+   *
+   * @param string $img_url the path to the image
+   * @param float  $x       x position
+   * @param float  $y       y position
+   * @param int    $w       width (in pixels)
+   * @param int    $h       height (in pixels)
+   * @param string $resolution
+   *
+   * @return void
+   * @internal param string $img_type the type (e.g. extension) of the image
+   */
+  function image($img_url, $x, $y, $w, $h, $resolution = "normal") {
+    $img_type = Image_Cache::detect_type($img_url, $this->_dompdf->get_http_context());
+    $img_ext  = Image_Cache::type_to_ext($img_type);
+
+    if ( !$img_ext ) {
+      return;
+    }
+    
+    $func = "imagecreatefrom$img_ext";
+    $src = @$func($img_url);
+
+    if ( !$src ) {
+      return; // Probably should add to $_dompdf_errors or whatever here
+    }
+    
+    // Scale by the AA factor
+    $x *= $this->_aa_factor;
+    $y *= $this->_aa_factor;
+
+    $w *= $this->_aa_factor;
+    $h *= $this->_aa_factor;
+    
+    $img_w = imagesx($src);
+    $img_h = imagesy($src);
+    
+    imagecopyresampled($this->_img, $src, $x, $y, 0, 0, $w, $h, $img_w, $img_h);
+    
+  }
+
+  /**
+   * Writes text at the specified x and y coordinates
+   * See {@link Style::munge_color()} for the format of the color array.
+   *
+   * @param float  $x
+   * @param float  $y
+   * @param string $text  the text to write
+   * @param string $font  the font file to use
+   * @param float  $size  the font size, in points
+   * @param array  $color
+   * @param float  $word_spacing word spacing adjustment
+   * @param float  $char_spacing
+   * @param float  $angle Text angle
+   *
+   * @return void
+   */
+  function text($x, $y, $text, $font, $size, $color = array(0,0,0), $word_spacing = 0.0, $char_spacing = 0.0, $angle = 0.0) {
+
+    // Scale by the AA factor
+    $x *= $this->_aa_factor;
+    $y *= $this->_aa_factor;
+    $size *= $this->_aa_factor;
+    
+    $h = $this->get_font_height($font, $size);
+    $c = $this->_allocate_color($color);
+    
+    $text = mb_encode_numericentity($text, array(0x0080, 0xff, 0, 0xff), 'UTF-8');
+
+    $font = $this->get_ttf_file($font);
+
+    // FIXME: word spacing
+    @imagettftext($this->_img, $size, $angle, $x, $y + $h, $c, $font, $text);
+    
+  }
+  
+  function javascript($code) {
+    // Not implemented
+  }
+
+  /**
+   * Add a named destination (similar to <a name="foo">...</a> in html)
+   *
+   * @param string $anchorname The name of the named destination
+   */
+  function add_named_dest($anchorname) {
+    // Not implemented
+  }
+
+  /**
+   * Add a link to the pdf
+   *
+   * @param string $url    The url to link to
+   * @param float  $x      The x position of the link
+   * @param float  $y      The y position of the link
+   * @param float  $width  The width of the link
+   * @param float  $height The height of the link
+   */
+  function add_link($url, $x, $y, $width, $height) {
+    // Not implemented
+  }
+
+  /**
+   * Add meta information to the PDF
+   *
+   * @param string $label  label of the value (Creator, Producer, etc.)
+   * @param string $value  the text to set
+   */
+  function add_info($label, $value) {
+    // N/A
+  }
+  
+  function set_default_view($view, $options = array()) {
+    // N/A
+  }
+
+  /**
+   * Calculates text size, in points
+   *
+   * @param string $text the text to be sized
+   * @param string $font the desired font
+   * @param float  $size the desired font size
+   * @param float  $word_spacing word spacing, if any
+   * @param float  $char_spacing char spacing, if any
+   *
+   * @return float
+   */
+  function get_text_width($text, $font, $size, $word_spacing = 0.0, $char_spacing = 0.0) {
+    $font = $this->get_ttf_file($font);
+      
+    $text = mb_encode_numericentity($text, array(0x0080, 0xffff, 0, 0xffff), 'UTF-8');
+
+    // FIXME: word spacing
+    list($x1,,$x2) = @imagettfbbox($size, 0, $font, $text);
+    return $x2 - $x1;
+  }
+  
+  function get_ttf_file($font) {
+    if ( strpos($font, '.ttf') === false )
+      $font .= ".ttf";
+    
+    /*$filename = substr(strtolower(basename($font)), 0, -4);
+    
+    if ( in_array($filename, DOMPDF::$native_fonts) ) {
+      return "arial.ttf";
+    }*/
+    
+    return $font;
+  }
+
+  /**
+   * Calculates font height, in points
+   *
+   * @param string $font
+   * @param float $size
+   * @return float
+   */
+  function get_font_height($font, $size) {
+    $font = $this->get_ttf_file($font);
+    $ratio = $this->_dompdf->get_option("font_height_ratio");
+
+    // FIXME: word spacing
+    list(,$y2,,,,$y1) = imagettfbbox($size, 0, $font, "MXjpqytfhl");  // Test string with ascenders, descenders and caps
+    return ($y2 - $y1) * $ratio;
+  }
+  
+  function get_font_baseline($font, $size) {
+    $ratio = $this->_dompdf->get_option("font_height_ratio");
+    return $this->get_font_height($font, $size) / $ratio;
+  }
+  
+  /**
+   * Starts a new page
+   *
+   * Subsequent drawing operations will appear on the new page.
+   */
+  function new_page() {
+    $this->_page_number++;
+    $this->_page_count++;
+  }    
+
+  function open_object(){
+    // N/A
+  }
+
+  function close_object(){
+    // N/A
+  }
+
+  function add_object(){
+    // N/A
+  }
+
+  function page_text(){
+    // N/A
+  }
+  
+  /**
+   * Streams the image directly to the browser
+   *
+   * @param string $filename the name of the image file (ignored)
+   * @param array  $options associative array, 'type' => jpeg|jpg|png, 'quality' => 0 - 100 (jpeg only)
+   */
+  function stream($filename, $options = null) {
+
+    // Perform any antialiasing
+    if ( $this->_aa_factor != 1 ) {
+      $dst_w = $this->_width / $this->_aa_factor;
+      $dst_h = $this->_height / $this->_aa_factor;
+      $dst = imagecreatetruecolor($dst_w, $dst_h);
+      imagecopyresampled($dst, $this->_img, 0, 0, 0, 0,
+                         $dst_w, $dst_h,
+                         $this->_width, $this->_height);
+    } else {
+      $dst = $this->_img;
+    }
+
+    if ( !isset($options["type"]) )
+      $options["type"] = "png";
+
+    $type = strtolower($options["type"]);
+    
+    header("Cache-Control: private");
+    
+    switch ($type) {
+
+    case "jpg":
+    case "jpeg":
+      if ( !isset($options["quality"]) )
+        $options["quality"] = 75;
+      
+      header("Content-type: image/jpeg");
+      imagejpeg($dst, '', $options["quality"]);
+      break;
+
+    case "png":
+    default:
+      header("Content-type: image/png");
+      imagepng($dst);
+      break;
+    }
+
+    if ( $this->_aa_factor != 1 ) 
+      imagedestroy($dst);
+  }
+
+  /**
+   * Returns the PNG as a string
+   *
+   * @param array  $options associative array, 'type' => jpeg|jpg|png, 'quality' => 0 - 100 (jpeg only)
+   * @return string
+   */
+  function output($options = null) {
+
+    if ( $this->_aa_factor != 1 ) {
+      $dst_w = $this->_width / $this->_aa_factor;
+      $dst_h = $this->_height / $this->_aa_factor;
+      $dst = imagecreatetruecolor($dst_w, $dst_h);
+      imagecopyresampled($dst, $this->_img, 0, 0, 0, 0,
+                         $dst_w, $dst_h,
+                         $this->_width, $this->_height);
+    } else {
+      $dst = $this->_img;
+    }
+    
+    if ( !isset($options["type"]) )
+      $options["type"] = "png";
+
+    $type = $options["type"];
+    
+    ob_start();
+
+    switch ($type) {
+
+    case "jpg":
+    case "jpeg":
+      if ( !isset($options["quality"]) )
+        $options["quality"] = 75;
+      
+      imagejpeg($dst, '', $options["quality"]);
+      break;
+
+    case "png":
+    default:
+      imagepng($dst);
+      break;
+    }
+
+    $image = ob_get_clean();
+
+    if ( $this->_aa_factor != 1 )
+      imagedestroy($dst);
+    
+    return $image;
+  }
+  
+  
+}

vendor/dompdf/dompdf/include/image_cache.cls.php

@@ -0,0 +1,185 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Static class that resolves image urls and downloads and caches
+ * remote images if required.
+ *
+ * @access private
+ * @package dompdf
+ */
+class Image_Cache {
+
+  /**
+   * Array of downloaded images.  Cached so that identical images are
+   * not needlessly downloaded.
+   *
+   * @var array
+   */
+  static protected $_cache = array();
+  
+  /**
+   * The url to the "broken image" used when images can't be loade
+   * 
+   * @var string
+   */
+  public static $broken_image;
+
+  /**
+   * Resolve and fetch an image for use.
+   *
+   * @param string $url        The url of the image
+   * @param string $protocol   Default protocol if none specified in $url
+   * @param string $host       Default host if none specified in $url
+   * @param string $base_path  Default path if none specified in $url
+   * @param DOMPDF $dompdf     The DOMPDF instance
+   *
+   * @throws DOMPDF_Image_Exception
+   * @return array             An array with two elements: The local path to the image and the image extension
+   */
+  static function resolve_url($url, $protocol, $host, $base_path, DOMPDF $dompdf) {
+    $protocol = mb_strtolower($protocol);
+    $parsed_url = explode_url($url);
+    $message = null;
+
+    $remote = ($protocol && $protocol !== "file://") || ($parsed_url['protocol'] != "");
+    
+    $data_uri = strpos($parsed_url['protocol'], "data:") === 0;
+    $full_url = null;
+    $enable_remote = $dompdf->get_option("enable_remote");
+
+    try {
+      
+      // Remote not allowed and is not DataURI
+      if ( !$enable_remote && $remote && !$data_uri ) {
+        throw new DOMPDF_Image_Exception("DOMPDF_ENABLE_REMOTE is set to FALSE");
+      } 
+      
+      // Remote allowed or DataURI
+      else if ( $enable_remote && $remote || $data_uri ) {
+        // Download remote files to a temporary directory
+        $full_url = build_url($protocol, $host, $base_path, $url);
+  
+        // From cache
+        if ( isset(self::$_cache[$full_url]) ) {
+          $resolved_url = self::$_cache[$full_url];
+        }
+        
+        // From remote
+        else {
+          $tmp_dir = $dompdf->get_option("temp_dir");
+          $resolved_url = tempnam($tmp_dir, "ca_dompdf_img_");
+          $image = "";
+
+          if ($data_uri) {
+            if ($parsed_data_uri = parse_data_uri($url)) {
+              $image = $parsed_data_uri['data'];
+            }
+          }
+          else {
+            set_error_handler("record_warnings");
+            $image = file_get_contents($full_url, null, $dompdf->get_http_context());
+            restore_error_handler();
+          }
+  
+          // Image not found or invalid
+          if ( strlen($image) == 0 ) {
+            $msg = ($data_uri ? "Data-URI could not be parsed" : "Image not found");
+            throw new DOMPDF_Image_Exception($msg);
+          }
+          
+          // Image found, put in cache and process
+          else {
+            //e.g. fetch.php?media=url.jpg&cache=1
+            //- Image file name might be one of the dynamic parts of the url, don't strip off!
+            //- a remote url does not need to have a file extension at all
+            //- local cached file does not have a matching file extension
+            //Therefore get image type from the content
+            file_put_contents($resolved_url, $image);
+          }
+        }
+      }
+      
+      // Not remote, local image
+      else {
+        $resolved_url = build_url($protocol, $host, $base_path, $url);
+      }
+  
+      // Check if the local file is readable
+      if ( !is_readable($resolved_url) || !filesize($resolved_url) ) {
+        throw new DOMPDF_Image_Exception("Image not readable or empty");
+      }
+      
+      // Check is the file is an image
+      else {
+        list($width, $height, $type) = dompdf_getimagesize($resolved_url, $dompdf->get_http_context());
+        
+        // Known image type
+        if ( $width && $height && in_array($type, array(IMAGETYPE_GIF, IMAGETYPE_PNG, IMAGETYPE_JPEG, IMAGETYPE_BMP)) ) {
+          //Don't put replacement image into cache - otherwise it will be deleted on cache cleanup.
+          //Only execute on successful caching of remote image.
+          if ( $enable_remote && $remote || $data_uri ) {
+            self::$_cache[$full_url] = $resolved_url;
+          }
+        }
+        
+        // Unknown image type
+        else {
+          throw new DOMPDF_Image_Exception("Image type unknown");
+        }
+      }
+    }
+    catch(DOMPDF_Image_Exception $e) {
+      $resolved_url = self::$broken_image;
+      $type = IMAGETYPE_PNG;
+      $message = "Image not found or type unknown";
+      $_dompdf_warnings[] = $e->getMessage()." :: $url";
+    }
+
+    return array($resolved_url, $type, $message);
+  }
+
+  /**
+   * Unlink all cached images (i.e. temporary images either downloaded
+   * or converted)
+   */
+  static function clear() {
+    if ( empty(self::$_cache) || DEBUGKEEPTEMP ) return;
+    
+    foreach ( self::$_cache as $file ) {
+      if (DEBUGPNG) print "[clear unlink $file]";
+      unlink($file);
+    }
+    
+    self::$_cache = array();
+  }
+  
+  static function detect_type($file, $context = null) {
+    list(, , $type) = dompdf_getimagesize($file, $context);
+    return $type;
+  }
+  
+  static function type_to_ext($type) {
+    $image_types = array(
+      IMAGETYPE_GIF  => "gif",
+      IMAGETYPE_PNG  => "png",
+      IMAGETYPE_JPEG => "jpeg",
+      IMAGETYPE_BMP  => "bmp",
+    );
+    
+    return (isset($image_types[$type]) ? $image_types[$type] : null);
+  }
+  
+  static function is_broken($url) {
+    return $url === self::$broken_image;
+  }
+}
+
+Image_Cache::$broken_image = DOMPDF_LIB_DIR . "/res/broken_image.png";

vendor/dompdf/dompdf/include/image_frame_decorator.cls.php

@@ -0,0 +1,80 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for image layout and rendering
+ *
+ * @access private
+ * @package dompdf
+ */
+class Image_Frame_Decorator extends Frame_Decorator {
+
+  /**
+   * The path to the image file (note that remote images are
+   * downloaded locally to DOMPDF_TEMP_DIR).
+   *
+   * @var string
+   */
+  protected $_image_url;
+  
+  /**
+   * The image's file error message
+   *
+   * @var string
+   */
+  protected $_image_msg;
+
+  /**
+   * Class constructor
+   *
+   * @param Frame $frame the frame to decorate
+   * @param DOMPDF $dompdf the document's dompdf object (required to resolve relative & remote urls)
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    $url = $frame->get_node()->getAttribute("src");
+
+    $debug_png = $dompdf->get_option("debug_png");
+    if ($debug_png) print '[__construct '.$url.']';
+
+    list($this->_image_url, /*$type*/, $this->_image_msg) = Image_Cache::resolve_url(
+      $url,
+      $dompdf->get_protocol(),
+      $dompdf->get_host(),
+      $dompdf->get_base_path(),
+      $dompdf
+    );
+
+    if ( Image_Cache::is_broken($this->_image_url) &&
+         $alt = $frame->get_node()->getAttribute("alt") ) {
+      $style = $frame->get_style();
+      $style->width  = (4/3)*Font_Metrics::get_text_width($alt, $style->font_family, $style->font_size, $style->word_spacing);
+      $style->height = Font_Metrics::get_font_height($style->font_family, $style->font_size);
+    }
+  }
+
+  /**
+   * Return the image's url
+   *
+   * @return string The url of this image
+   */
+  function get_image_url() {
+    return $this->_image_url;
+  }
+
+  /**
+   * Return the image's error message
+   *
+   * @return string The image's error message
+   */
+  function get_image_msg() {
+    return $this->_image_msg;
+  }
+  
+}

vendor/dompdf/dompdf/include/image_frame_reflower.cls.php

@@ -0,0 +1,186 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Image reflower class
+ *
+ * @access private
+ * @package dompdf
+ */
+class Image_Frame_Reflower extends Frame_Reflower {
+
+  function __construct(Image_Frame_Decorator $frame) {
+    parent::__construct($frame);
+  }
+
+  function reflow(Block_Frame_Decorator $block = null) {
+    $this->_frame->position();
+    
+    //FLOAT
+    //$frame = $this->_frame;
+    //$page = $frame->get_root();
+
+    //$enable_css_float = $this->get_dompdf()->get_option("enable_css_float");
+    //if ($enable_css_float && $frame->get_style()->float !== "none" ) {
+    //  $page->add_floating_frame($this);
+    //}
+    // Set the frame's width
+    $this->get_min_max_width();
+    
+    if ( $block ) {
+      $block->add_frame_to_line($this->_frame);
+    }
+  }
+
+  function get_min_max_width() {
+    if (DEBUGPNG) {
+      // Determine the image's size. Time consuming. Only when really needed?
+      list($img_width, $img_height) = dompdf_getimagesize($this->_frame->get_image_url(), $this->get_dompdf()->get_http_context());
+      print "get_min_max_width() ".
+        $this->_frame->get_style()->width.' '.
+        $this->_frame->get_style()->height.';'.
+        $this->_frame->get_parent()->get_style()->width." ".
+        $this->_frame->get_parent()->get_style()->height.";".
+        $this->_frame->get_parent()->get_parent()->get_style()->width.' '.
+        $this->_frame->get_parent()->get_parent()->get_style()->height.';'.
+        $img_width. ' '.
+        $img_height.'|' ;
+    }
+
+    $style = $this->_frame->get_style();
+    
+    $width_forced = true;
+    $height_forced = true;
+
+    //own style auto or invalid value: use natural size in px
+    //own style value: ignore suffix text including unit, use given number as px
+    //own style %: walk up parent chain until found available space in pt; fill available space
+    //
+    //special ignored unit: e.g. 10ex: e treated as exponent; x ignored; 10e completely invalid ->like auto
+
+    $width = ($style->width > 0 ? $style->width : 0);
+    if ( is_percent($width) ) {
+      $t = 0.0;
+      for ($f = $this->_frame->get_parent(); $f; $f = $f->get_parent()) {
+        $f_style = $f->get_style();
+        $t = $f_style->length_in_pt($f_style->width);
+        if ($t != 0) {
+          break;
+        }
+      }
+      $width = ((float)rtrim($width,"%") * $t)/100; //maybe 0
+    } elseif ( !mb_strpos($width, 'pt') ) {
+      // Don't set image original size if "%" branch was 0 or size not given.
+      // Otherwise aspect changed on %/auto combination for width/height
+      // Resample according to px per inch
+      // See also List_Bullet_Image_Frame_Decorator::__construct
+      $width = $style->length_in_pt($width);
+    }
+
+    $height = ($style->height > 0 ? $style->height : 0);
+    if ( is_percent($height) ) {
+      $t = 0.0;
+      for ($f = $this->_frame->get_parent(); $f; $f = $f->get_parent()) {
+        $f_style = $f->get_style();
+        $t = $f_style->length_in_pt($f_style->height);
+        if ($t != 0) {
+          break;
+        }
+      }
+      $height = ((float)rtrim($height,"%") * $t)/100; //maybe 0
+    } elseif ( !mb_strpos($height, 'pt') ) {
+      // Don't set image original size if "%" branch was 0 or size not given.
+      // Otherwise aspect changed on %/auto combination for width/height
+      // Resample according to px per inch
+      // See also List_Bullet_Image_Frame_Decorator::__construct
+      $height = $style->length_in_pt($height);
+    }
+
+    if ($width == 0 || $height == 0) {
+      // Determine the image's size. Time consuming. Only when really needed!
+      list($img_width, $img_height) = dompdf_getimagesize($this->_frame->get_image_url(), $this->get_dompdf()->get_http_context());
+      
+      // don't treat 0 as error. Can be downscaled or can be catched elsewhere if image not readable.
+      // Resample according to px per inch
+      // See also List_Bullet_Image_Frame_Decorator::__construct
+      if ($width == 0 && $height == 0) {
+        $dpi = $this->_frame->get_dompdf()->get_option("dpi");
+        $width = (float)($img_width * 72) / $dpi;
+        $height = (float)($img_height * 72) / $dpi;
+        $width_forced = false;
+        $height_forced = false;
+      } elseif ($height == 0 && $width != 0) {
+        $height_forced = false;
+        $height = ($width / $img_width) * $img_height; //keep aspect ratio
+      } elseif ($width == 0 && $height != 0) {
+        $width_forced = false;
+        $width = ($height / $img_height) * $img_width; //keep aspect ratio
+      }
+    }
+    
+    // Handle min/max width/height
+    if ( $style->min_width  !== "none" || 
+         $style->max_width  !== "none" || 
+         $style->min_height !== "none" || 
+         $style->max_height !== "none" ) {
+           
+      list(/*$x*/, /*$y*/, $w, $h) = $this->_frame->get_containing_block();
+      
+      $min_width = $style->length_in_pt($style->min_width, $w);
+      $max_width = $style->length_in_pt($style->max_width, $w);
+      $min_height = $style->length_in_pt($style->min_height, $h);
+      $max_height = $style->length_in_pt($style->max_height, $h);
+  
+      if ( $max_width !== "none" && $width > $max_width ) {
+        if ( !$height_forced ) {
+          $height *= $max_width / $width;
+        }
+        
+        $width = $max_width;
+      }
+  
+      if ( $min_width !== "none" && $width < $min_width ) {
+        if ( !$height_forced ) {
+          $height *= $min_width / $width;
+        }
+        
+        $width = $min_width;
+      }
+      
+      if ( $max_height !== "none" && $height > $max_height ) {
+        if ( !$width_forced ) {
+          $width *= $max_height / $height;
+        }
+        
+        $height = $max_height;
+      }
+      
+      if ( $min_height !== "none" && $height < $min_height ) {
+        if ( !$width_forced ) {
+          $width *= $min_height / $height;
+        }
+        
+        $height = $min_height;
+      }
+    }
+    
+    if (DEBUGPNG) print $width.' '.$height.';';
+
+    $style->width = $width . "pt";
+    $style->height = $height . "pt";
+    
+    $style->min_width = "none";
+    $style->max_width = "none";
+    $style->min_height = "none";
+    $style->max_height = "none";
+
+    return array( $width, $width, "min" => $width, "max" => $width);
+    
+  }
+}

vendor/dompdf/dompdf/include/image_renderer.cls.php

@@ -0,0 +1,119 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Image renderer
+ *
+ * @access private
+ * @package dompdf
+ */
+class Image_Renderer extends Block_Renderer {
+
+  function render(Frame $frame) {
+    // Render background & borders
+    $style = $frame->get_style();
+    $cb = $frame->get_containing_block();
+    list($x, $y, $w, $h) = $frame->get_border_box();
+  
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+    
+    list($tl, $tr, $br, $bl) = $style->get_computed_border_radius($w, $h);
+    
+    $has_border_radius = $tl + $tr + $br + $bl > 0;
+    
+    if ( $has_border_radius ) {
+      $this->_canvas->clipping_roundrectangle( $x, $y, $w, $h, $tl, $tr, $br, $bl );
+    }
+
+    if ( ($bg = $style->background_color) !== "transparent" ) {
+      $this->_canvas->filled_rectangle($x, $y, $w, $h, $bg);
+    }
+
+    if ( ($url = $style->background_image) && $url !== "none" ) {
+      $this->_background_image($url, $x, $y, $w, $h, $style);
+    }
+    
+    if ( $has_border_radius ) {
+      $this->_canvas->clipping_end();
+    }
+         
+    $this->_render_border($frame);
+    $this->_render_outline($frame);
+    
+    list($x, $y) = $frame->get_padding_box();
+    
+    $x += $style->length_in_pt($style->padding_left, $cb["w"]);
+    $y += $style->length_in_pt($style->padding_top, $cb["h"]);
+    
+    $w = $style->length_in_pt($style->width, $cb["w"]);
+    $h = $style->length_in_pt($style->height, $cb["h"]);
+    
+    if ( $has_border_radius ) {
+      list($wt, $wr, $wb, $wl) = array(
+        $style->border_top_width,
+        $style->border_right_width,
+        $style->border_bottom_width,
+        $style->border_left_width,
+      );
+      
+      // we have to get the "inner" radius
+      if ( $tl > 0 ) {
+        $tl -= ($wt + $wl) / 2;
+      }
+      if ( $tr > 0 ) {
+        $tr -= ($wt + $wr) / 2;
+      }
+      if ( $br > 0 ) {
+        $br -= ($wb + $wr) / 2;
+      }
+      if ( $bl > 0 ) {
+        $bl -= ($wb + $wl) / 2;
+      }
+      
+      $this->_canvas->clipping_roundrectangle( $x, $y, $w, $h, $tl, $tr, $br, $bl );
+    }
+    
+    $src = $frame->get_image_url();
+    $alt = null;
+
+    if ( Image_Cache::is_broken($src) &&
+      $alt = $frame->get_node()->getAttribute("alt") ) {
+      $font = $style->font_family;
+      $size = $style->font_size;
+      $spacing = $style->word_spacing;
+      $this->_canvas->text($x, $y, $alt,
+                           $font, $size,
+                           $style->color, $spacing);
+    }
+    else {
+      $this->_canvas->image( $src, $x, $y, $w, $h, $style->image_resolution);
+    }
+    
+    if ( $has_border_radius ) {
+      $this->_canvas->clipping_end();
+    }
+    
+    if ( $msg = $frame->get_image_msg() ) {
+      $parts = preg_split("/\s*\n\s*/", $msg);
+      $height = 10;
+      $_y = $alt ? $y+$h-count($parts)*$height : $y;
+      
+      foreach($parts as $i => $_part) {
+        $this->_canvas->text($x, $_y + $i*$height, $_part, "times", $height*0.8, array(0.5, 0.5, 0.5));
+      }
+    }
+    
+    if (DEBUG_LAYOUT && DEBUG_LAYOUT_BLOCKS) {
+      $this->_debug_layout($frame->get_border_box(), "blue");
+      if (DEBUG_LAYOUT_PADDINGBOX) {
+        $this->_debug_layout($frame->get_padding_box(), "blue", array(0.5, 0.5));
+      }
+    }
+  }
+}

vendor/dompdf/dompdf/include/inline_frame_decorator.cls.php

@@ -0,0 +1,74 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for inline layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Inline_Frame_Decorator extends Frame_Decorator {
+  
+  function __construct(Frame $frame, DOMPDF $dompdf) { parent::__construct($frame, $dompdf); }
+
+  function split(Frame $frame = null, $force_pagebreak = false) {
+
+    if ( is_null($frame) ) {
+      $this->get_parent()->split($this, $force_pagebreak);
+      return;
+    }
+
+    if ( $frame->get_parent() !== $this )
+      throw new DOMPDF_Exception("Unable to split: frame is not a child of this one.");
+        
+    $split = $this->copy( $this->_frame->get_node()->cloneNode() ); 
+    $this->get_parent()->insert_child_after($split, $this);
+
+    // Unset the current node's right style properties
+    $style = $this->_frame->get_style();
+    $style->margin_right = 0;
+    $style->padding_right = 0;
+    $style->border_right_width = 0;
+
+    // Unset the split node's left style properties since we don't want them
+    // to propagate
+    $style = $split->get_style();
+    $style->margin_left = 0;
+    $style->padding_left = 0;
+    $style->border_left_width = 0;
+
+    //On continuation of inline element on next line,
+    //don't repeat non-vertically repeatble background images
+    //See e.g. in testcase image_variants, long desriptions
+    if ( ($url = $style->background_image) && $url !== "none"
+         && ($repeat = $style->background_repeat) && $repeat !== "repeat" &&  $repeat !== "repeat-y"
+       ) {
+      $style->background_image = "none";
+    }           
+
+    // Add $frame and all following siblings to the new split node
+    $iter = $frame;
+    while ($iter) {
+      $frame = $iter;      
+      $iter = $iter->get_next_sibling();
+      $frame->reset();
+      $split->append_child($frame);
+    }
+    
+    $page_breaks = array("always", "left", "right");
+    $frame_style = $frame->get_style();
+    if( $force_pagebreak ||
+      in_array($frame_style->page_break_before, $page_breaks) ||
+      in_array($frame_style->page_break_after, $page_breaks) ) {
+
+      $this->get_parent()->split($split, true);
+    }
+  }
+  
+} 

vendor/dompdf/dompdf/include/inline_frame_reflower.cls.php

@@ -0,0 +1,66 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows inline frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Inline_Frame_Reflower extends Frame_Reflower {
+
+  function __construct(Frame $frame) { parent::__construct($frame); }
+  
+  //........................................................................
+
+  function reflow(Block_Frame_Decorator $block = null) {
+    $frame = $this->_frame;
+    
+    // Check if a page break is forced
+    $page = $frame->get_root();
+    $page->check_forced_page_break($frame);
+    
+    if ( $page->is_full() )
+      return;
+      
+    $style = $frame->get_style();
+    
+    // Generated content
+    $this->_set_content();
+    
+    $frame->position();
+
+    $cb = $frame->get_containing_block();
+
+    // Add our margin, padding & border to the first and last children
+    if ( ($f = $frame->get_first_child()) && $f instanceof Text_Frame_Decorator ) {
+      $f_style = $f->get_style();
+      $f_style->margin_left  = $style->margin_left;
+      $f_style->padding_left = $style->padding_left;
+      $f_style->border_left  = $style->border_left;
+    }
+
+    if ( ($l = $frame->get_last_child()) && $l instanceof Text_Frame_Decorator ) {
+      $l_style = $l->get_style();
+      $l_style->margin_right  = $style->margin_right;
+      $l_style->padding_right = $style->padding_right;
+      $l_style->border_right  = $style->border_right;
+    }
+    
+    if ( $block ) {
+      $block->add_frame_to_line($this->_frame);
+    }
+
+    // Set the containing blocks and reflow each child.  The containing
+    // block is not changed by line boxes.
+    foreach ( $frame->get_children() as $child ) {
+      $child->set_containing_block($cb);
+      $child->reflow($block);
+    }
+  }
+}

vendor/dompdf/dompdf/include/inline_positioner.cls.php

@@ -0,0 +1,70 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions inline frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Inline_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+
+  //........................................................................
+
+  function position() {
+    /**
+     * Find our nearest block level parent and access its lines property.
+     * @var Block_Frame_Decorator
+     */ 
+    $p = $this->_frame->find_block_parent();
+
+    // Debugging code:
+
+//     pre_r("\nPositioning:");
+//     pre_r("Me: " . $this->_frame->get_node()->nodeName . " (" . spl_object_hash($this->_frame->get_node()) . ")");
+//     pre_r("Parent: " . $p->get_node()->nodeName . " (" . spl_object_hash($p->get_node()) . ")");
+
+    // End debugging
+
+    if ( !$p )
+      throw new DOMPDF_Exception("No block-level parent found.  Not good.");
+
+    $f = $this->_frame;
+    
+    $cb = $f->get_containing_block();
+    $line = $p->get_current_line_box();
+
+    // Skip the page break if in a fixed position element
+    $is_fixed = false;
+    while($f = $f->get_parent()) {
+      if($f->get_style()->position === "fixed") {
+        $is_fixed = true;
+        break;
+      }
+    }
+
+    $f = $this->_frame;
+
+    if ( !$is_fixed && $f->get_parent() &&
+         $f->get_parent() instanceof Inline_Frame_Decorator &&
+         $f->is_text_node() ) {
+      
+      $min_max = $f->get_reflower()->get_min_max_width();
+      
+      // If the frame doesn't fit in the current line, a line break occurs
+      if ( $min_max["min"] > ($cb["w"] - $line->left - $line->w - $line->right) ) {
+        $p->add_line();
+      }
+    }
+    
+    $f->set_position($cb["x"] + $line->w, $line->y);
+
+  }
+}

vendor/dompdf/dompdf/include/inline_renderer.cls.php

@@ -0,0 +1,190 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Renders inline frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Inline_Renderer extends Abstract_Renderer {
+  
+  //........................................................................
+
+  function render(Frame $frame) {
+    $style = $frame->get_style();
+
+    if ( !$frame->get_first_child() )
+      return; // No children, no service
+    
+    // Draw the left border if applicable
+    $bp = $style->get_border_properties();
+    $widths = array($style->length_in_pt($bp["top"]["width"]),
+                    $style->length_in_pt($bp["right"]["width"]),
+                    $style->length_in_pt($bp["bottom"]["width"]),
+                    $style->length_in_pt($bp["left"]["width"]));
+
+    // Draw the background & border behind each child.  To do this we need
+    // to figure out just how much space each child takes:
+    list($x, $y) = $frame->get_first_child()->get_position();
+    $w = null;
+    $h = 0;
+//     $x += $widths[3];
+//     $y += $widths[0];
+    
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+    
+    $first_row = true;
+
+    foreach ($frame->get_children() as $child) {
+      list($child_x, $child_y, $child_w, $child_h) = $child->get_padding_box();
+      
+      if ( !is_null($w) && $child_x < $x + $w ) {
+        //This branch seems to be supposed to being called on the first part
+        //of an inline html element, and the part after the if clause for the
+        //parts after a line break.
+        //But because $w initially mostly is 0, and gets updated only on the next
+        //round, this seem to be never executed and the common close always.
+
+        // The next child is on another line.  Draw the background &
+        // borders on this line.
+
+        // Background:
+        if ( ($bg = $style->background_color) !== "transparent" )
+          $this->_canvas->filled_rectangle( $x, $y, $w, $h, $bg);
+
+        if ( ($url = $style->background_image) && $url !== "none" ) {
+          $this->_background_image($url, $x, $y, $w, $h, $style);
+        }
+
+        // If this is the first row, draw the left border
+        if ( $first_row ) {
+
+          if ( $bp["left"]["style"] !== "none" && $bp["left"]["color"] !== "transparent" && $bp["left"]["width"] > 0 ) {
+            $method = "_border_" . $bp["left"]["style"];            
+            $this->$method($x, $y, $h + $widths[0] + $widths[2], $bp["left"]["color"], $widths, "left");
+          }
+          $first_row = false;
+        }
+
+        // Draw the top & bottom borders
+        if ( $bp["top"]["style"] !== "none" && $bp["top"]["color"] !== "transparent" && $bp["top"]["width"] > 0 ) {
+          $method = "_border_" . $bp["top"]["style"];
+          $this->$method($x, $y, $w + $widths[1] + $widths[3], $bp["top"]["color"], $widths, "top");
+        }
+        
+        if ( $bp["bottom"]["style"] !== "none" && $bp["bottom"]["color"] !== "transparent" && $bp["bottom"]["width"] > 0 ) {
+          $method = "_border_" . $bp["bottom"]["style"];
+          $this->$method($x, $y + $h + $widths[0] + $widths[2], $w + $widths[1] + $widths[3], $bp["bottom"]["color"], $widths, "bottom");
+        }
+
+        // Handle anchors & links
+        $link_node = null;
+        if ( $frame->get_node()->nodeName === "a" ) {
+          $link_node = $frame->get_node();
+        }
+        else if ( $frame->get_parent()->get_node()->nodeName === "a" ){
+          $link_node = $frame->get_parent()->get_node();
+        }
+        
+        if ( $link_node && $href = $link_node->getAttribute("href") ) {
+          $this->_canvas->add_link($href, $x, $y, $w, $h);
+        }
+
+        $x = $child_x;
+        $y = $child_y;
+        $w = $child_w;
+        $h = $child_h;
+        continue;
+      }
+
+      if ( is_null($w) )
+        $w = $child_w;
+      else
+        $w += $child_w;
+      
+      $h = max($h, $child_h);
+
+      if (DEBUG_LAYOUT && DEBUG_LAYOUT_INLINE) {
+        $this->_debug_layout($child->get_border_box(), "blue");
+        if (DEBUG_LAYOUT_PADDINGBOX) {
+          $this->_debug_layout($child->get_padding_box(), "blue", array(0.5, 0.5));
+        }
+      }
+    }
+
+    
+    // Handle the last child
+    if ( ($bg = $style->background_color) !== "transparent" ) 
+      $this->_canvas->filled_rectangle( $x + $widths[3], $y + $widths[0], $w, $h, $bg);
+
+    //On continuation lines (after line break) of inline elements, the style got copied.
+    //But a non repeatable background image should not be repeated on the next line.
+    //But removing the background image above has never an effect, and removing it below
+    //removes it always, even on the initial line.
+    //Need to handle it elsewhere, e.g. on certain ...clone()... usages.    
+    // Repeat not given: default is Style::__construct
+    // ... && (!($repeat = $style->background_repeat) || $repeat === "repeat" ...
+    //different position? $this->_background_image($url, $x, $y, $w, $h, $style);
+    if ( ($url = $style->background_image) && $url !== "none" )           
+      $this->_background_image($url, $x + $widths[3], $y + $widths[0], $w, $h, $style);
+        
+    // Add the border widths
+    $w += $widths[1] + $widths[3];
+    $h += $widths[0] + $widths[2];
+
+    // make sure the border and background start inside the left margin
+    $left_margin = $style->length_in_pt($style->margin_left);
+    $x += $left_margin;
+
+    // If this is the first row, draw the left border too
+    if ( $first_row && $bp["left"]["style"] !== "none" && $bp["left"]["color"] !== "transparent" && $widths[3] > 0 ) {
+      $method = "_border_" . $bp["left"]["style"];
+      $this->$method($x, $y, $h, $bp["left"]["color"], $widths, "left");
+    }
+    
+    // Draw the top & bottom borders
+    if ( $bp["top"]["style"] !== "none" && $bp["top"]["color"] !== "transparent" && $widths[0] > 0 ) {
+      $method = "_border_" . $bp["top"]["style"];
+      $this->$method($x, $y, $w, $bp["top"]["color"], $widths, "top");
+    }
+    
+    if ( $bp["bottom"]["style"] !== "none" && $bp["bottom"]["color"] !== "transparent" && $widths[2] > 0 ) {
+      $method = "_border_" . $bp["bottom"]["style"];
+      $this->$method($x, $y + $h, $w, $bp["bottom"]["color"], $widths, "bottom");
+    }
+
+    //    pre_var_dump(get_class($frame->get_next_sibling()));
+    //    $last_row = get_class($frame->get_next_sibling()) !== 'Inline_Frame_Decorator';
+    // Draw the right border if this is the last row
+    if ( $bp["right"]["style"] !== "none" && $bp["right"]["color"] !== "transparent" && $widths[1] > 0 ) {
+      $method = "_border_" . $bp["right"]["style"];
+      $this->$method($x + $w, $y, $h, $bp["right"]["color"], $widths, "right");
+    }
+
+    // Only two levels of links frames
+    $link_node = null;
+    if ( $frame->get_node()->nodeName === "a" ) {
+      $link_node = $frame->get_node();
+      
+      if ( ($name = $link_node->getAttribute("name")) || ($name = $link_node->getAttribute("id")) ) {
+        $this->_canvas->add_named_dest($name);
+      }
+    }
+    
+    if ( $frame->get_parent() && $frame->get_parent()->get_node()->nodeName === "a" ){
+      $link_node = $frame->get_parent()->get_node();
+    }
+    
+    // Handle anchors & links
+    if ( $link_node ) {
+      if ( $href = $link_node->getAttribute("href") )
+        $this->_canvas->add_link($href, $x, $y, $w, $h);
+    }
+  }
+}

vendor/dompdf/dompdf/include/javascript_embedder.cls.php

@@ -0,0 +1,37 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Embeds Javascript into the PDF document
+ *
+ * @access private
+ * @package dompdf
+ */
+class Javascript_Embedder {
+  
+  /**
+   * @var DOMPDF
+   */
+  protected $_dompdf;
+
+  function __construct(DOMPDF $dompdf) {
+    $this->_dompdf = $dompdf;
+  }
+
+  function insert($script) {
+    $this->_dompdf->get_canvas()->javascript($script);
+  }
+
+  function render(Frame $frame) {
+    if ( !$this->_dompdf->get_option("enable_javascript") ) {
+      return;
+    }
+      
+    $this->insert($frame->get_node()->nodeValue);
+  }
+}

vendor/dompdf/dompdf/include/line_box.cls.php

@@ -0,0 +1,252 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * The line box class
+ *
+ * This class represents a line box
+ * http://www.w3.org/TR/CSS2/visuren.html#line-box
+ *
+ * @access protected
+ * @package dompdf
+ */
+class Line_Box {
+
+  /**
+   * @var Block_Frame_Decorator
+   */
+  protected $_block_frame;
+
+  /**
+   * @var Frame[]
+   */
+  protected $_frames = array();
+  
+  /**
+   * @var integer
+   */
+  public $wc = 0;
+  
+  /**
+   * @var float
+   */
+  public $y = null;
+  
+  /**
+   * @var float
+   */
+  public $w = 0.0;
+  
+  /**
+   * @var float
+   */
+  public $h = 0.0;
+  
+  /**
+   * @var float
+   */
+  public $left = 0.0;
+  
+  /**
+   * @var float
+   */
+  public $right = 0.0;
+  
+  /**
+   * @var Frame
+   */
+  public $tallest_frame = null;
+
+  /**
+   * @var bool[]
+   */
+  public $floating_blocks = array();
+  
+  /**
+   * @var bool
+   */
+  public $br = false;
+  
+  /**
+   * Class constructor
+   *
+   * @param Block_Frame_Decorator $frame the Block_Frame_Decorator containing this line
+   */
+  function __construct(Block_Frame_Decorator $frame, $y = 0) {
+    $this->_block_frame = $frame;
+    $this->_frames = array();
+    $this->y = $y;
+    
+    $this->get_float_offsets();
+  }
+  
+  /**
+   * Returns the floating elements inside the first floating parent
+   *
+   * @param Page_Frame_Decorator $root
+   *
+   * @return Frame[]
+   */
+  function get_floats_inside(Page_Frame_Decorator $root) {
+    $floating_frames = $root->get_floating_frames();
+    
+    if ( count($floating_frames) == 0 ) {
+      return $floating_frames;
+    }
+    
+    // Find nearest floating element
+    $p = $this->_block_frame;
+    while( $p->get_style()->float === "none" ) {
+      $parent = $p->get_parent();
+      
+      if ( !$parent ) {
+        break;
+      }
+      
+      $p = $parent;
+    }
+    
+    if ( $p == $root ) {
+      return $floating_frames;
+    }
+    
+    $parent = $p;
+    
+    $childs = array();
+    
+    foreach ($floating_frames as $_floating) {
+      $p = $_floating->get_parent();
+      
+      while (($p = $p->get_parent()) && $p !== $parent);
+      
+      if ( $p ) {
+        $childs[] = $p;
+      }
+    }
+    
+    return $childs;
+  }
+  
+  function get_float_offsets() {
+    $enable_css_float = $this->_block_frame->get_dompdf()->get_option("enable_css_float");
+    if ( !$enable_css_float ) {
+      return;
+    }
+      
+    static $anti_infinite_loop = 500; // FIXME smelly hack
+    
+    $reflower = $this->_block_frame->get_reflower();
+    
+    if ( !$reflower ) {
+      return;
+    }
+    
+    $cb_w = null;
+  
+    $block = $this->_block_frame;
+    $root = $block->get_root();
+    
+    if ( !$root ) {
+      return;
+    }
+    
+    $floating_frames = $this->get_floats_inside($root);
+    
+    foreach ( $floating_frames as $child_key => $floating_frame ) {
+      $id = $floating_frame->get_id();
+      
+      if ( isset($this->floating_blocks[$id]) ) {
+        continue;
+      }
+      
+      $floating_style = $floating_frame->get_style();
+      $float = $floating_style->float;
+      
+      $floating_width = $floating_frame->get_margin_width();
+      
+      if (!$cb_w) {
+        $cb_w = $floating_frame->get_containing_block("w");
+      }
+      
+      $line_w = $this->get_width();
+      
+      if ( !$floating_frame->_float_next_line && ($cb_w <= $line_w + $floating_width) && ($cb_w > $line_w) ) {
+        $floating_frame->_float_next_line = true;
+        continue;
+      }
+      
+      // If the child is still shifted by the floating element
+      if ( $anti_infinite_loop-- > 0 &&
+           $floating_frame->get_position("y") + $floating_frame->get_margin_height() > $this->y && 
+           $block->get_position("x") + $block->get_margin_width() > $floating_frame->get_position("x")
+           ) {
+        if ( $float === "left" )
+          $this->left  += $floating_width;
+        else
+          $this->right += $floating_width;
+        
+        $this->floating_blocks[$id] = true;
+      }
+      
+      // else, the floating element won't shift anymore
+      else {
+        $root->remove_floating_frame($child_key);
+      }
+    }
+  }
+
+  /**
+   * @return float
+   */
+  function get_width(){
+    return $this->left + $this->w + $this->right;
+  }
+
+  /**
+   * @return Block_Frame_Decorator
+   */
+  function get_block_frame() {
+    return $this->_block_frame;
+  }
+
+  /**
+   * @return Frame[]
+   */
+  function &get_frames() {
+    return $this->_frames;
+  }
+
+  /**
+   * @param Frame $frame
+   */
+  function add_frame(Frame $frame) {
+    $this->_frames[] = $frame;
+  }
+  
+  function __toString(){
+    $props = array("wc", "y", "w", "h", "left", "right", "br");
+    $s = "";
+    foreach($props as $prop) {
+      $s .= "$prop: ".$this->$prop."\n";
+    }
+    $s .= count($this->_frames)." frames\n";
+    return $s;
+  }
+  /*function __get($prop) {
+    if (!isset($this->{"_$prop"})) return;
+    return $this->{"_$prop"};
+  }*/
+}
+
+/*
+class LineBoxList implements Iterator {
+  private $_p = 0;
+  private $_lines = array();
+  
+}
+*/

vendor/dompdf/dompdf/include/list_bullet_frame_decorator.cls.php

@@ -0,0 +1,65 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for list bullet rendering
+ *
+ * @access private
+ * @package dompdf 
+ */
+class List_Bullet_Frame_Decorator extends Frame_Decorator {
+
+  const BULLET_PADDING = 1; // Distance from bullet to text in pt
+  // As fraction of font size (including descent). See also DECO_THICKNESS.
+  const BULLET_THICKNESS = 0.04;   // Thickness of bullet outline. Screen: 0.08, print: better less, e.g. 0.04
+  const BULLET_DESCENT = 0.3;  //descent of font below baseline. Todo: Guessed for now.
+  const BULLET_SIZE = 0.35;   // bullet diameter. For now 0.5 of font_size without descent.
+  
+  static $BULLET_TYPES = array("disc", "circle", "square");
+  
+  //........................................................................
+
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+  }
+  
+  function get_margin_width() {
+    $style = $this->_frame->get_style();
+    
+    // Small hack to prevent extra indenting of list text on list_style_position === "inside"
+    // and on suppressed bullet
+    if ( $style->list_style_position === "outside" ||
+         $style->list_style_type === "none" ) {
+      return 0;
+    }
+    
+    return $style->get_font_size() * self::BULLET_SIZE + 2 * self::BULLET_PADDING;
+  }
+
+  //hits only on "inset" lists items, to increase height of box
+  function get_margin_height() {
+    $style = $this->_frame->get_style();
+    
+    if ( $style->list_style_type === "none" ) {
+      return 0;
+    }
+    
+    return $style->get_font_size() * self::BULLET_SIZE + 2 * self::BULLET_PADDING;
+  }
+
+  function get_width() {
+    return $this->get_margin_height();
+  }
+  
+  function get_height() {
+    return $this->get_margin_height();
+  }
+  
+  //........................................................................
+}

vendor/dompdf/dompdf/include/list_bullet_frame_reflower.cls.php

@@ -0,0 +1,33 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows list bullets
+ *
+ * @access private
+ * @package dompdf
+ */
+class List_Bullet_Frame_Reflower extends Frame_Reflower {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+    
+  //........................................................................
+
+  function reflow(Block_Frame_Decorator $block = null) {
+    $style = $this->_frame->get_style();
+
+    $style->width = $this->_frame->get_width();
+    $this->_frame->position();
+
+    if ( $style->list_style_position === "inside" ) {
+      $p = $this->_frame->find_block_parent();
+      $p->add_frame_to_line($this->_frame);
+    }
+
+  }
+}

vendor/dompdf/dompdf/include/list_bullet_image_frame_decorator.cls.php

@@ -0,0 +1,143 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for list bullets with custom images
+ *
+ * @access private
+ * @package dompdf
+ */
+class List_Bullet_Image_Frame_Decorator extends Frame_Decorator {
+
+  /**
+   * The underlying image frame
+   * 
+   * @var Image_Frame_Decorator
+   */
+  protected $_img;
+
+  /**
+   * The image's width in pixels
+   *
+   * @var int
+   */
+  protected $_width;
+  
+  /**
+   * The image's height in pixels
+   *
+   * @var int
+   */
+  protected $_height;
+
+  /**
+   * Class constructor
+   *
+   * @param Frame $frame the bullet frame to decorate
+   * @param DOMPDF $dompdf the document's dompdf object
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    $style = $frame->get_style();
+    $url = $style->list_style_image;
+    $frame->get_node()->setAttribute("src", $url);
+    $this->_img = new Image_Frame_Decorator($frame, $dompdf);
+    parent::__construct($this->_img, $dompdf);
+    list($width, $height) = dompdf_getimagesize($this->_img->get_image_url(), $dompdf->get_http_context());
+
+    // Resample the bullet image to be consistent with 'auto' sized images
+    // See also Image_Frame_Reflower::get_min_max_width
+    // Tested php ver: value measured in px, suffix "px" not in value: rtrim unnecessary.
+    $dpi = $this->_dompdf->get_option("dpi");
+    $this->_width = ((float)rtrim($width, "px") * 72) / $dpi;
+    $this->_height = ((float)rtrim($height, "px") * 72) / $dpi;
+ 
+    //If an image is taller as the containing block/box, the box should be extended.
+    //Neighbour elements are overwriting the overlapping image areas.
+    //Todo: Where can the box size be extended?   
+    //Code below has no effect.
+    //See block_frame_reflower _calculate_restricted_height
+    //See generated_frame_reflower, Dompdf:render() "list-item", "-dompdf-list-bullet"S.
+    //Leave for now    
+    //if ($style->min_height < $this->_height ) {
+    //  $style->min_height = $this->_height;
+    //}
+    //$style->height = "auto";   
+  }
+
+  /**
+   * Return the bullet's width
+   *
+   * @return int
+   */
+  function get_width() {
+    //ignore image width, use same width as on predefined bullet List_Bullet_Frame_Decorator
+    //for proper alignment of bullet image and text. Allow image to not fitting on left border.
+    //This controls the distance between bullet image and text 
+    //return $this->_width;
+    return $this->_frame->get_style()->get_font_size()*List_Bullet_Frame_Decorator::BULLET_SIZE + 
+      2 * List_Bullet_Frame_Decorator::BULLET_PADDING;
+  }
+
+  /**
+   * Return the bullet's height
+   *
+   * @return int
+   */
+  function get_height() {
+    //based on image height
+    return $this->_height;
+  }
+  
+  /**
+   * Override get_margin_width
+   *
+   * @return int
+   */
+  function get_margin_width() {
+    //ignore image width, use same width as on predefined bullet List_Bullet_Frame_Decorator
+    //for proper alignment of bullet image and text. Allow image to not fitting on left border.
+    //This controls the extra indentation of text to make room for the bullet image.
+    //Here use actual image size, not predefined bullet size 
+    //return $this->_frame->get_style()->get_font_size()*List_Bullet_Frame_Decorator::BULLET_SIZE + 
+    //  2 * List_Bullet_Frame_Decorator::BULLET_PADDING;
+
+    // Small hack to prevent indenting of list text
+    // Image Might not exist, then position like on list_bullet_frame_decorator fallback to none. 
+    if ( $this->_frame->get_style()->list_style_position === "outside" ||
+         $this->_width == 0) 
+      return 0;
+    //This aligns the "inside" image position with the text.
+    //The text starts to the right of the image.
+    //Between the image and the text there is an added margin of image width.
+    //Where this comes from is unknown.
+    //The corresponding List_Bullet_Frame_Decorator sets a smaller margin. bullet size?
+    return $this->_width + 2 * List_Bullet_Frame_Decorator::BULLET_PADDING;
+  }
+
+  /**
+   * Override get_margin_height()
+   *
+   * @return int
+   */
+  function get_margin_height() {
+    //Hits only on "inset" lists items, to increase height of box
+    //based on image height
+    return $this->_height + 2 * List_Bullet_Frame_Decorator::BULLET_PADDING;
+  }
+
+  /**
+   * Return image url
+   *
+   * @return string
+   */
+  function get_image_url() {
+    return $this->_img->get_image_url();
+  }
+  
+}

vendor/dompdf/dompdf/include/list_bullet_positioner.cls.php

@@ -0,0 +1,73 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions list bullets
+ *
+ * @access private
+ * @package dompdf
+ */
+class List_Bullet_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+  
+  //........................................................................
+
+  function position() {
+    
+    // Bullets & friends are positioned an absolute distance to the left of
+    // the content edge of their parent element
+    $cb = $this->_frame->get_containing_block();
+    
+    // Note: this differs from most frames in that we must position
+    // ourselves after determining our width
+    $x = $cb["x"] - $this->_frame->get_width();
+
+    $p = $this->_frame->find_block_parent();
+
+    $y = $p->get_current_line_box()->y;
+
+    // This is a bit of a hack...
+    $n = $this->_frame->get_next_sibling();
+    if ( $n ) {
+      $style = $n->get_style();
+      $line_height = $style->length_in_pt($style->line_height, $style->get_font_size());
+      $offset = $style->length_in_pt($line_height, $n->get_containing_block("h")) - $this->_frame->get_height();             
+      $y += $offset / 2;
+    }
+
+  // Now the position is the left top of the block which should be marked with the bullet.
+  // We tried to find out the y of the start of the first text character within the block.
+  // But the top margin/padding does not fit, neither from this nor from the next sibling
+  // The "bit of a hack" above does not work also.
+  
+  // Instead let's position the bullet vertically centered to the block which should be marked.
+  // But for get_next_sibling() the get_containing_block is all zero, and for find_block_parent()
+  // the get_containing_block is paper width and the entire list as height.
+  
+    // if ($p) {
+    //   //$cb = $n->get_containing_block();
+    //   $cb = $p->get_containing_block();
+    //   $y += $cb["h"]/2;
+    // print 'cb:'.$cb["x"].':'.$cb["y"].':'.$cb["w"].':'.$cb["h"].':';
+    // }   
+
+  // Todo:
+  // For now give up on the above. Use Guesswork with font y-pos in the middle of the line spacing
+
+    /*$style = $p->get_style();
+    $font_size = $style->get_font_size();
+    $line_height = $style->length_in_pt($style->line_height, $font_size);
+    $y += ($line_height - $font_size) / 2;    */
+   
+    //Position is x-end y-top of character position of the bullet.    
+    $this->_frame->set_position($x, $y);
+    
+  }
+}

vendor/dompdf/dompdf/include/list_bullet_renderer.cls.php

@@ -0,0 +1,236 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Helmut Tischer <htischer@weihenstephan.org>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Renders list bullets
+ *
+ * @access private
+ * @package dompdf
+ */
+class List_Bullet_Renderer extends Abstract_Renderer {
+  static function get_counter_chars($type) {
+    static $cache = array();
+    
+    if ( isset($cache[$type]) ) {
+      return $cache[$type];
+    }
+    
+    $uppercase = false;
+    $text = "";
+    
+    switch ($type) {
+      case "decimal-leading-zero":
+      case "decimal":
+      case "1":
+        return "0123456789";
+      
+      case "upper-alpha":
+      case "upper-latin":
+      case "A":
+        $uppercase = true;
+      case "lower-alpha":
+      case "lower-latin":
+      case "a":
+        $text = "abcdefghijklmnopqrstuvwxyz";
+        break;
+        
+      case "upper-roman":
+      case "I":
+        $uppercase = true;
+      case "lower-roman":
+      case "i":
+        $text = "ivxlcdm";
+        break;
+      
+      case "lower-greek":
+        for($i = 0; $i < 24; $i++) {
+          $text .= unichr($i+944);
+        }
+        break;
+    }
+    
+    if ( $uppercase ) {
+      $text = strtoupper($text);
+    }
+    
+    return $cache[$type] = "$text.";
+  }
+
+  /**
+   * @param integer $n
+   * @param string  $type
+   * @param integer $pad
+   *
+   * @return string
+   */
+  private function make_counter($n, $type, $pad = null){
+    $n = intval($n);
+    $text = "";
+    $uppercase = false;
+    
+    switch ($type) {
+      case "decimal-leading-zero":
+      case "decimal":
+      case "1":
+        if ($pad) 
+          $text = str_pad($n, $pad, "0", STR_PAD_LEFT);
+        else 
+          $text = $n;
+        break;
+      
+      case "upper-alpha":
+      case "upper-latin":
+      case "A":
+        $uppercase = true;
+      case "lower-alpha":
+      case "lower-latin":
+      case "a":
+        $text = chr( ($n % 26) + ord('a') - 1);
+        break;
+        
+      case "upper-roman":
+      case "I":
+        $uppercase = true;
+      case "lower-roman":
+      case "i":
+        $text = dec2roman($n);
+        break;
+      
+      case "lower-greek":
+        $text = unichr($n + 944);
+        break;
+    }
+    
+    if ( $uppercase ) {
+      $text = strtoupper($text);
+    }
+    
+    return "$text.";
+  }
+  
+  function render(Frame $frame) {
+    $style = $frame->get_style();
+    $font_size = $style->get_font_size();
+    $line_height = $style->length_in_pt($style->line_height, $frame->get_containing_block("w"));
+
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+
+    $li = $frame->get_parent();
+
+    // Don't render bullets twice if if was split
+    if ($li->_splitted) {
+      return;
+    }
+
+    // Handle list-style-image
+    // If list style image is requested but missing, fall back to predefined types
+    if ( $style->list_style_image !== "none" &&
+         !Image_Cache::is_broken($img = $frame->get_image_url())) {
+
+      list($x,$y) = $frame->get_position();
+      
+      //For expected size and aspect, instead of box size, use image natural size scaled to DPI.
+      // Resample the bullet image to be consistent with 'auto' sized images
+      // See also Image_Frame_Reflower::get_min_max_width
+      // Tested php ver: value measured in px, suffix "px" not in value: rtrim unnecessary.
+      //$w = $frame->get_width();
+      //$h = $frame->get_height();
+      list($width, $height) = dompdf_getimagesize($img, $this->_dompdf->get_http_context());
+      $dpi = $this->_dompdf->get_option("dpi");
+      $w = ((float)rtrim($width, "px") * 72) / $dpi;
+      $h = ((float)rtrim($height, "px") * 72) / $dpi;
+      
+      $x -= $w;
+      $y -= ($line_height - $font_size)/2; //Reverse hinting of list_bullet_positioner
+
+      $this->_canvas->image( $img, $x, $y, $w, $h);
+
+    } else {
+
+      $bullet_style = $style->list_style_type;
+
+      $fill = false;
+
+      switch ($bullet_style) {
+
+      default:
+      case "disc":
+        $fill = true;
+
+      case "circle":
+        list($x,$y) = $frame->get_position();
+        $r = ($font_size*(List_Bullet_Frame_Decorator::BULLET_SIZE /*-List_Bullet_Frame_Decorator::BULLET_THICKNESS*/ ))/2;
+        $x -= $font_size*(List_Bullet_Frame_Decorator::BULLET_SIZE/2);
+        $y += ($font_size*(1-List_Bullet_Frame_Decorator::BULLET_DESCENT))/2;
+        $o = $font_size*List_Bullet_Frame_Decorator::BULLET_THICKNESS;
+        $this->_canvas->circle($x, $y, $r, $style->color, $o, null, $fill);
+        break;
+
+      case "square":
+        list($x, $y) = $frame->get_position();
+        $w = $font_size*List_Bullet_Frame_Decorator::BULLET_SIZE;
+        $x -= $w;
+        $y += ($font_size*(1-List_Bullet_Frame_Decorator::BULLET_DESCENT-List_Bullet_Frame_Decorator::BULLET_SIZE))/2;
+        $this->_canvas->filled_rectangle($x, $y, $w, $w, $style->color);
+        break;
+    
+      case "decimal-leading-zero":
+      case "decimal":
+      case "lower-alpha":
+      case "lower-latin":
+      case "lower-roman":
+      case "lower-greek":
+      case "upper-alpha":
+      case "upper-latin":
+      case "upper-roman":
+      case "1": // HTML 4.0 compatibility
+      case "a":
+      case "i":
+      case "A":
+      case "I":
+        $pad = null;
+        if ( $bullet_style === "decimal-leading-zero" ) {
+          $pad = strlen($li->get_parent()->get_node()->getAttribute("dompdf-children-count"));
+        }
+
+        $node = $frame->get_node();
+
+        if ( !$node->hasAttribute("dompdf-counter") ) {
+          return;
+        }
+
+        $index = $node->getAttribute("dompdf-counter");
+        $text = $this->make_counter($index, $bullet_style, $pad);
+
+        if ( trim($text) == "" ) {
+          return;
+        }
+        
+        $spacing = 0;
+        $font_family = $style->font_family;
+        
+        $line = $li->get_containing_line();
+        list($x, $y) = array($frame->get_position("x"), $line->y);
+
+        $x -= Font_Metrics::get_text_width($text, $font_family, $font_size, $spacing);
+        
+        // Take line-height into account
+        $line_height = $style->line_height;
+        $y += ($line_height - $font_size) / 4; // FIXME I thought it should be 2, but 4 gives better results
+        
+        $this->_canvas->text($x, $y, $text,
+                             $font_family, $font_size,
+                             $style->color, $spacing);
+      
+      case "none":
+        break;
+      }
+    }
+  }
+}

vendor/dompdf/dompdf/include/null_frame_decorator.cls.php

@@ -0,0 +1,26 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Dummy decorator
+ *
+ * @access private
+ * @package dompdf
+ */
+class Null_Frame_Decorator extends Frame_Decorator {
+
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    $style = $this->_frame->get_style();
+    $style->width = 0;
+    $style->height = 0;
+    $style->margin = 0;
+    $style->padding = 0;
+  }
+
+}

vendor/dompdf/dompdf/include/null_frame_reflower.cls.php

@@ -0,0 +1,21 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Dummy reflower
+ *
+ * @access private
+ * @package dompdf
+ */
+class Null_Frame_Reflower extends Frame_Reflower {
+
+  function __construct(Frame $frame) { parent::__construct($frame); }
+
+  function reflow(Block_Frame_Decorator $block = null) { return; }
+  
+}

vendor/dompdf/dompdf/include/null_positioner.cls.php

@@ -0,0 +1,23 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Dummy positioner
+ *
+ * @access private
+ * @package dompdf
+ */
+class Null_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) {
+    parent::__construct($frame);
+  }
+
+  function position() { return; }
+  
+}

vendor/dompdf/dompdf/include/page_cache.cls.php

@@ -0,0 +1,126 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Caches individual rendered PDF pages
+ *
+ * Not totally implemented yet.  Use at your own risk ;)
+ * 
+ * @access private
+ * @package dompdf
+ * @static
+ */
+class Page_Cache {
+
+  const DB_USER = "dompdf_page_cache";
+  const DB_PASS = "some meaningful password";
+  const DB_NAME = "dompdf_page_cache";
+  
+  static private $__connection = null;
+  
+  static function init() {
+    if ( is_null(self::$__connection) ) {
+      $con_str = "host=" . DB_HOST .
+        " dbname=" . self::DB_NAME .
+        " user=" . self::DB_USER .
+        " password=" . self::DB_PASS;
+      
+      if ( !self::$__connection = pg_connect($con_str) )
+        throw new Exception("Database connection failed.");
+    }
+  }
+  
+  function __construct() { throw new Exception("Can not create instance of Page_Class.  Class is static."); }
+
+  private static function __query($sql) {
+    if ( !($res = pg_query(self::$__connection, $sql)) )
+      throw new Exception(pg_last_error(self::$__connection));
+    return $res;
+  }
+  
+  static function store_page($id, $page_num, $data) {
+    $where = "WHERE id='" . pg_escape_string($id) . "' AND ".
+      "page_num=". pg_escape_string($page_num);
+
+    $res = self::__query("SELECT timestamp FROM page_cache ". $where);
+
+    $row = pg_fetch_assoc($res);
+    
+    if ( $row ) 
+      self::__query("UPDATE page_cache SET data='" . pg_escape_string($data) . "' " . $where);
+    else 
+      self::__query("INSERT INTO page_cache (id, page_num, data) VALUES ('" . pg_escape_string($id) . "', ".
+                     pg_escape_string($page_num) . ", ".
+                     "'". pg_escape_string($data) . "')");
+
+  }
+
+  static function store_fonts($id, $fonts) {
+    self::__query("BEGIN");
+    // Update the font information
+    self::__query("DELETE FROM page_fonts WHERE id='" . pg_escape_string($id) . "'");
+
+    foreach (array_keys($fonts) as $font)
+      self::__query("INSERT INTO page_fonts (id, font_name) VALUES ('" .
+                    pg_escape_string($id) . "', '" . pg_escape_string($font) . "')");
+    self::__query("COMMIT");
+  }
+  
+//   static function retrieve_page($id, $page_num) {
+
+//     $res = self::__query("SELECT data FROM page_cache WHERE id='" . pg_escape_string($id) . "' AND ".
+//                           "page_num=". pg_escape_string($page_num));
+
+//     $row = pg_fetch_assoc($res);
+
+//     return pg_unescape_bytea($row["data"]);
+    
+//   }
+
+  static function get_page_timestamp($id, $page_num) {
+    $res = self::__query("SELECT timestamp FROM page_cache WHERE id='" . pg_escape_string($id) . "' AND ".
+                          "page_num=". pg_escape_string($page_num));
+
+    $row = pg_fetch_assoc($res);
+
+    return $row["timestamp"];
+    
+  }
+
+  // Adds the cached document referenced by $id to the provided pdf
+  static function insert_cached_document(CPDF_Adapter $pdf, $id, $new_page = true) {
+    $res = self::__query("SELECT font_name FROM page_fonts WHERE id='" . pg_escape_string($id) . "'");
+
+    // Ensure that the fonts needed by the cached document are loaded into
+    // the pdf
+    while ($row = pg_fetch_assoc($res)) 
+      $pdf->get_cpdf()->selectFont($row["font_name"]);
+    
+    $res = self::__query("SELECT data FROM page_cache WHERE id='" . pg_escape_string($id) . "'");
+
+    if ( $new_page )
+      $pdf->new_page();
+
+    $first = true;
+    while ($row = pg_fetch_assoc($res)) {
+
+      if ( !$first ) 
+        $pdf->new_page();
+      else 
+        $first = false;        
+      
+      $page = $pdf->reopen_serialized_object($row["data"]);
+      //$pdf->close_object();
+      $pdf->add_object($page, "add");
+
+    }
+      
+  }
+}
+
+Page_Cache::init();

vendor/dompdf/dompdf/include/page_frame_decorator.cls.php

@@ -0,0 +1,592 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates frames for page layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Page_Frame_Decorator extends Frame_Decorator {
+
+  /**
+   * y value of bottom page margin
+   *
+   * @var float
+   */
+  protected $_bottom_page_margin;
+
+  /**
+   * Flag indicating page is full.
+   *
+   * @var bool
+   */
+  protected $_page_full;
+
+  /**
+   * Number of tables currently being reflowed
+   *
+   * @var int
+   */
+  protected $_in_table;
+
+  /**
+   * The pdf renderer
+   *
+   * @var Renderer
+   */
+  protected $_renderer;
+  
+  /**
+   * This page's floating frames
+   * 
+   * @var array
+   */
+  protected $_floating_frames = array();
+
+  //........................................................................
+
+  /**
+   * Class constructor
+   *
+   * @param Frame  $frame the frame to decorate
+   * @param DOMPDF $dompdf
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    $this->_page_full = false;
+    $this->_in_table = 0;
+    $this->_bottom_page_margin = null;
+  }
+
+  /**
+   * Set the renderer used for this pdf
+   *
+   * @param Renderer $renderer the renderer to use
+   */
+  function set_renderer($renderer) {
+    $this->_renderer = $renderer;
+  }
+
+  /**
+   * Return the renderer used for this pdf
+   *
+   * @return Renderer
+   */
+  function get_renderer() {
+    return $this->_renderer;
+  }
+
+  /**
+   * Set the frame's containing block.  Overridden to set $this->_bottom_page_margin.
+   *
+   * @param float $x
+   * @param float $y
+   * @param float $w
+   * @param float $h
+   */
+  function set_containing_block($x = null, $y = null, $w = null, $h = null) {
+    parent::set_containing_block($x,$y,$w,$h);
+    //$w = $this->get_containing_block("w");
+    if ( isset($h) )
+      $this->_bottom_page_margin = $h; // - $this->_frame->get_style()->length_in_pt($this->_frame->get_style()->margin_bottom, $w);
+  }
+
+  /**
+   * Returns true if the page is full and is no longer accepting frames.
+   *
+   * @return bool
+   */
+  function is_full() {
+    return $this->_page_full;
+  }
+
+  /**
+   * Start a new page by resetting the full flag.
+   */
+  function next_page() {
+    $this->_floating_frames = array();
+    $this->_renderer->new_page();
+    $this->_page_full = false;
+  }
+
+  /**
+   * Indicate to the page that a table is currently being reflowed.
+   */
+  function table_reflow_start() {
+    $this->_in_table++;
+  }
+
+  /**
+   * Indicate to the page that table reflow is finished.
+   */
+  function table_reflow_end() {
+    $this->_in_table--;
+  }
+
+  /**
+   * Return whether we are currently in a nested table or not
+   *
+   * @return bool
+   */
+  function in_nested_table() {
+    return $this->_in_table > 1;
+  }
+  
+  /**
+   * Check if a forced page break is required before $frame.  This uses the
+   * frame's page_break_before property as well as the preceeding frame's
+   * page_break_after property.
+   *
+   * @link http://www.w3.org/TR/CSS21/page.html#forced
+   *
+   * @param Frame $frame the frame to check
+   * @return bool true if a page break occured
+   */
+  function check_forced_page_break(Frame $frame) {
+      
+    // Skip check if page is already split
+    if ( $this->_page_full )
+      return null;
+
+    $block_types = array("block", "list-item", "table", "inline");
+    $page_breaks = array("always", "left", "right");
+
+    $style = $frame->get_style();
+
+    if ( !in_array($style->display, $block_types) )
+      return false;
+
+    // Find the previous block-level sibling
+    $prev = $frame->get_prev_sibling();
+
+    while ( $prev && !in_array($prev->get_style()->display, $block_types) )
+      $prev = $prev->get_prev_sibling();
+
+
+    if ( in_array($style->page_break_before, $page_breaks) ) {
+
+      // Prevent cascading splits
+      $frame->split(null, true);
+      // We have to grab the style again here because split() resets
+      // $frame->style to the frame's orignal style.
+      $frame->get_style()->page_break_before = "auto";
+      $this->_page_full = true;
+      
+      return true;
+    }
+
+    if ( $prev && in_array($prev->get_style()->page_break_after, $page_breaks) ) {
+      // Prevent cascading splits
+      $frame->split(null, true);
+      $prev->get_style()->page_break_after = "auto";
+      $this->_page_full = true;
+      return true;
+    }
+    
+    if( $prev && $prev->get_last_child() && $frame->get_node()->nodeName != "body" ) {
+      $prev_last_child = $prev->get_last_child();
+      if ( in_array($prev_last_child->get_style()->page_break_after, $page_breaks) ) {
+        $frame->split(null, true);
+        $prev_last_child->get_style()->page_break_after = "auto";
+        $this->_page_full = true;
+        return true;
+      }
+    }
+
+
+    return false;
+  }
+
+  /**
+   * Determine if a page break is allowed before $frame
+   * http://www.w3.org/TR/CSS21/page.html#allowed-page-breaks
+   * 
+   * In the normal flow, page breaks can occur at the following places:
+   * 
+   *    1. In the vertical margin between block boxes. When a page
+   *    break occurs here, the used values of the relevant
+   *    'margin-top' and 'margin-bottom' properties are set to '0'.
+   *    2. Between line boxes inside a block box.
+   *
+   * These breaks are subject to the following rules:
+   * 
+   *   * Rule A: Breaking at (1) is allowed only if the
+   *     'page-break-after' and 'page-break-before' properties of
+   *     all the elements generating boxes that meet at this margin
+   *     allow it, which is when at least one of them has the value
+   *     'always', 'left', or 'right', or when all of them are
+   *     'auto'.
+   *
+   *   * Rule B: However, if all of them are 'auto' and the
+   *     nearest common ancestor of all the elements has a
+   *     'page-break-inside' value of 'avoid', then breaking here is
+   *     not allowed.
+   *
+   *   * Rule C: Breaking at (2) is allowed only if the number of
+   *     line boxes between the break and the start of the enclosing
+   *     block box is the value of 'orphans' or more, and the number
+   *     of line boxes between the break and the end of the box is
+   *     the value of 'widows' or more.
+   *
+   *   * Rule D: In addition, breaking at (2) is allowed only if
+   *     the 'page-break-inside' property is 'auto'.
+   *
+   * If the above doesn't provide enough break points to keep
+   * content from overflowing the page boxes, then rules B and D are
+   * dropped in order to find additional breakpoints.
+   *
+   * If that still does not lead to sufficient break points, rules A
+   * and C are dropped as well, to find still more break points.
+   *
+   * We will also allow breaks between table rows.  However, when
+   * splitting a table, the table headers should carry over to the
+   * next page (but they don't yet).
+   * 
+   * @param Frame $frame the frame to check
+   * @return bool true if a break is allowed, false otherwise
+   */
+  protected function _page_break_allowed(Frame $frame) {
+
+    $block_types = array("block", "list-item", "table", "-dompdf-image");
+    dompdf_debug("page-break", "_page_break_allowed(" . $frame->get_node()->nodeName. ")");
+    $display = $frame->get_style()->display;
+
+    // Block Frames (1):
+    if ( in_array($display, $block_types) ) {
+
+      // Avoid breaks within table-cells
+      if ( $this->_in_table ) {
+        dompdf_debug("page-break", "In table: " . $this->_in_table);
+        return false;
+      }
+
+      // Rules A & B
+
+      if ( $frame->get_style()->page_break_before === "avoid" ) {
+        dompdf_debug("page-break", "before: avoid");
+        return false;
+      }
+
+      // Find the preceeding block-level sibling
+      $prev = $frame->get_prev_sibling();
+      while ( $prev && !in_array($prev->get_style()->display, $block_types) )
+        $prev = $prev->get_prev_sibling();
+
+      // Does the previous element allow a page break after?
+      if ( $prev && $prev->get_style()->page_break_after === "avoid" ) {
+        dompdf_debug("page-break", "after: avoid");
+        return false;
+      }
+
+      // If both $prev & $frame have the same parent, check the parent's
+      // page_break_inside property.
+      $parent = $frame->get_parent();
+      if ( $prev && $parent && $parent->get_style()->page_break_inside === "avoid" ) {
+          dompdf_debug("page-break", "parent inside: avoid");
+        return false;
+      }
+
+      // To prevent cascading page breaks when a top-level element has
+      // page-break-inside: avoid, ensure that at least one frame is
+      // on the page before splitting.
+      if ( $parent->get_node()->nodeName === "body" && !$prev ) {
+        // We are the body's first child
+          dompdf_debug("page-break", "Body's first child.");
+        return false;
+      }
+
+      // If the frame is the first block-level frame, use the value from
+      // $frame's parent instead.
+      if ( !$prev && $parent )
+        return $this->_page_break_allowed( $parent );
+
+      dompdf_debug("page-break", "block: break allowed");
+      return true;
+
+    }
+
+    // Inline frames (2):
+    else if ( in_array($display, Style::$INLINE_TYPES) ) {
+
+      // Avoid breaks within table-cells
+      if ( $this->_in_table ) {
+          dompdf_debug("page-break", "In table: " . $this->_in_table);
+        return false;
+      }
+
+      // Rule C
+      $block_parent = $frame->find_block_parent();
+      if ( count($block_parent->get_line_boxes() ) < $frame->get_style()->orphans ) {
+          dompdf_debug("page-break", "orphans");
+        return false;
+      }
+
+      // FIXME: Checking widows is tricky without having laid out the
+      // remaining line boxes.  Just ignore it for now...
+
+      // Rule D
+      $p = $block_parent;
+      while ($p) {
+        if ( $p->get_style()->page_break_inside === "avoid" ) {
+          dompdf_debug("page-break", "parent->inside: avoid");
+          return false;
+        }
+        $p = $p->find_block_parent();
+      }
+
+      // To prevent cascading page breaks when a top-level element has
+      // page-break-inside: avoid, ensure that at least one frame with
+      // some content is on the page before splitting.
+      $prev = $frame->get_prev_sibling();
+      while ( $prev && ($prev->is_text_node() && trim($prev->get_node()->nodeValue) == "") )
+        $prev = $prev->get_prev_sibling();
+
+      if ( $block_parent->get_node()->nodeName === "body" && !$prev ) {
+        // We are the body's first child
+          dompdf_debug("page-break", "Body's first child.");
+        return false;
+      }
+
+      // Skip breaks on empty text nodes
+      if ( $frame->is_text_node() &&
+           $frame->get_node()->nodeValue == "" )
+        return false;
+
+      dompdf_debug("page-break", "inline: break allowed");
+      return true;
+
+    // Table-rows
+    } else if ( $display === "table-row" ) {
+
+      // Simply check if the parent table's page_break_inside property is
+      // not 'avoid'
+      $p = Table_Frame_Decorator::find_parent_table($frame);
+
+      while ($p) {
+        if ( $p->get_style()->page_break_inside === "avoid" ) {
+          dompdf_debug("page-break", "parent->inside: avoid");
+          return false;
+        }
+        $p = $p->find_block_parent();
+      }
+
+      // Avoid breaking after the first row of a table
+      if ( $p && $p->get_first_child() === $frame) {
+         dompdf_debug("page-break", "table: first-row");
+        return false;
+      }
+
+      // If this is a nested table, prevent the page from breaking
+      if ( $this->_in_table > 1 ) {
+        dompdf_debug("page-break", "table: nested table");
+        return false;
+      }
+
+      dompdf_debug("page-break","table-row/row-groups: break allowed");
+      return true;
+
+    } else if ( in_array($display, Table_Frame_Decorator::$ROW_GROUPS) ) {
+
+      // Disallow breaks at row-groups: only split at row boundaries
+      return false;
+
+    } else {
+
+      dompdf_debug("page-break", "? " . $frame->get_style()->display . "");
+      return false;
+    }
+
+  }
+
+  /**
+   * Check if $frame will fit on the page.  If the frame does not fit,
+   * the frame tree is modified so that a page break occurs in the
+   * correct location.
+   *
+   * @param Frame $frame the frame to check
+   * @return Frame the frame following the page break
+   */
+  function check_page_break(Frame $frame) {
+    // Do not split if we have already or if the frame was already 
+    // pushed to the next page (prevents infinite loops)
+    if ( $this->_page_full || $frame->_already_pushed ) {
+      return false;
+    }
+    
+    // If the frame is absolute of fixed it shouldn't break
+    $p = $frame;
+    do {
+      if ( $p->is_absolute() )
+        return false;
+    } while ( $p = $p->get_parent() );
+    
+    $margin_height = $frame->get_margin_height();
+    
+    // FIXME If the row is taller than the page and 
+    // if it the first of the page, we don't break
+    if ( $frame->get_style()->display === "table-row" &&
+         !$frame->get_prev_sibling() && 
+         $margin_height > $this->get_margin_height() )
+      return false;
+
+    // Determine the frame's maximum y value
+    $max_y = $frame->get_position("y") + $margin_height;
+
+    // If a split is to occur here, then the bottom margins & paddings of all
+    // parents of $frame must fit on the page as well:
+    $p = $frame->get_parent();
+    while ( $p ) {
+      $style = $p->get_style();
+      $max_y += $style->length_in_pt(array($style->margin_bottom,
+                                           $style->padding_bottom,
+                                           $style->border_bottom_width));
+      $p = $p->get_parent();
+    }
+
+
+    // Check if $frame flows off the page
+    if ( $max_y <= $this->_bottom_page_margin )
+      // no: do nothing
+      return false;
+
+    dompdf_debug("page-break", "check_page_break");
+    dompdf_debug("page-break", "in_table: " . $this->_in_table);
+
+    // yes: determine page break location
+    $iter = $frame;
+    $flg = false;
+
+    $in_table = $this->_in_table;
+
+    dompdf_debug("page-break","Starting search");
+    while ( $iter ) {
+      // echo "\nbacktrack: " .$iter->get_node()->nodeName ." ".spl_object_hash($iter->get_node()). "";
+      if ( $iter === $this ) {
+         dompdf_debug("page-break", "reached root.");
+        // We've reached the root in our search.  Just split at $frame.
+        break;
+      }
+
+      if ( $this->_page_break_allowed($iter) ) {
+        dompdf_debug("page-break","break allowed, splitting.");
+        $iter->split(null, true);
+        $this->_page_full = true;
+        $this->_in_table = $in_table;
+        $frame->_already_pushed = true;
+        return true;
+      }
+
+      if ( !$flg && $next = $iter->get_last_child() ) {
+         dompdf_debug("page-break", "following last child.");
+
+        if ( $next->is_table() )
+          $this->_in_table++;
+
+        $iter = $next;
+        continue;
+      }
+
+      if ( $next = $iter->get_prev_sibling() ) {
+         dompdf_debug("page-break", "following prev sibling.");
+
+        if ( $next->is_table() && !$iter->is_table() )
+          $this->_in_table++;
+
+        else if ( !$next->is_table() && $iter->is_table() )
+          $this->_in_table--;
+
+        $iter = $next;
+        $flg = false;
+        continue;
+      }
+
+      if ( $next = $iter->get_parent() ) {
+         dompdf_debug("page-break", "following parent.");
+
+        if ( $iter->is_table() )
+          $this->_in_table--;
+
+        $iter = $next;
+        $flg = true;
+        continue;
+      }
+
+      break;
+    }
+
+    $this->_in_table = $in_table;
+
+    // No valid page break found.  Just break at $frame.
+    dompdf_debug("page-break", "no valid break found, just splitting.");
+    
+    // If we are in a table, backtrack to the nearest top-level table row
+    if ( $this->_in_table ) {
+      $iter = $frame;
+      while ($iter && $iter->get_style()->display !== "table-row")
+        $iter = $iter->get_parent();
+      
+      $iter->split(null, true);
+    } else {
+      $frame->split(null, true);
+    }
+    
+    $this->_page_full = true;
+    $frame->_already_pushed = true;
+    return true;
+  }
+
+  //........................................................................
+
+  function split(Frame $frame = null, $force_pagebreak = false) {
+    // Do nothing
+  }
+
+  /**
+   * Add a floating frame
+   *
+   * @param Frame $frame
+   *
+   * @return void
+   */
+  function add_floating_frame(Frame $frame) {
+    array_unshift($this->_floating_frames, $frame);
+  }
+  
+  /**
+   * @return Frame[]
+   */
+  function get_floating_frames() { 
+    return $this->_floating_frames; 
+  }
+
+  public function remove_floating_frame($key) {
+    unset($this->_floating_frames[$key]);
+  }
+
+  public function get_lowest_float_offset(Frame $child) {
+    $style = $child->get_style();
+    $side = $style->clear;
+    $float = $style->float;
+    
+    $y = 0;
+    
+    foreach($this->_floating_frames as $key => $frame) {
+      if ( $side === "both" || $frame->get_style()->float === $side ) {
+        $y = max($y, $frame->get_position("y") + $frame->get_margin_height());
+        
+        if ( $float !== "none" ) {
+          $this->remove_floating_frame($key);
+        }
+      }
+    }
+    
+    return $y;
+  }
+
+}

vendor/dompdf/dompdf/include/page_frame_reflower.cls.php

@@ -0,0 +1,186 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @author  Fabien Ménager <fabien.menager@gmail.com>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows pages
+ *
+ * @access private
+ * @package dompdf
+ */
+class Page_Frame_Reflower extends Frame_Reflower {
+
+  /**
+   * Cache of the callbacks array
+   * 
+   * @var array
+   */
+  private $_callbacks;
+  
+  /**
+   * Cache of the canvas
+   *
+   * @var Canvas
+   */
+  private $_canvas;
+
+  function __construct(Page_Frame_Decorator $frame) { parent::__construct($frame); }
+  
+  function apply_page_style(Frame $frame, $page_number){
+    $style = $frame->get_style();
+    $page_styles = $style->get_stylesheet()->get_page_styles();
+    
+    // http://www.w3.org/TR/CSS21/page.html#page-selectors
+    if ( count($page_styles) > 1 ) {
+      $odd   = $page_number % 2 == 1;
+      $first = $page_number == 1;
+      
+      $style = clone $page_styles["base"];
+    
+      // FIXME RTL
+      if ( $odd && isset($page_styles[":right"]) ) {
+        $style->merge($page_styles[":right"]);
+      }
+      
+      if ( $odd && isset($page_styles[":odd"]) ) {
+        $style->merge($page_styles[":odd"]);
+      }
+  
+      // FIXME RTL
+      if ( !$odd && isset($page_styles[":left"]) ) {
+        $style->merge($page_styles[":left"]);
+      }
+  
+      if ( !$odd && isset($page_styles[":even"]) ) {
+        $style->merge($page_styles[":even"]);
+      }
+      
+      if ( $first && isset($page_styles[":first"]) ) {
+        $style->merge($page_styles[":first"]);
+      }
+      
+      $frame->set_style($style);
+    }
+  }
+  
+  //........................................................................
+
+  /**
+   * Paged layout:
+   * http://www.w3.org/TR/CSS21/page.html
+   */
+  function reflow(Block_Frame_Decorator $block = null) {
+    $fixed_children = array();
+    $prev_child = null;
+    $child = $this->_frame->get_first_child();
+    $current_page = 0;
+    
+    while ($child) {
+      $this->apply_page_style($this->_frame, $current_page + 1);
+      
+      $style = $this->_frame->get_style();
+  
+      // Pages are only concerned with margins
+      $cb = $this->_frame->get_containing_block();
+      $left   = $style->length_in_pt($style->margin_left,   $cb["w"]);
+      $right  = $style->length_in_pt($style->margin_right,  $cb["w"]);
+      $top    = $style->length_in_pt($style->margin_top,    $cb["h"]);
+      $bottom = $style->length_in_pt($style->margin_bottom, $cb["h"]);
+      
+      $content_x = $cb["x"] + $left;
+      $content_y = $cb["y"] + $top;
+      $content_width = $cb["w"] - $left - $right;
+      $content_height = $cb["h"] - $top - $bottom;
+      
+      // Only if it's the first page, we save the nodes with a fixed position
+      if ($current_page == 0) {
+        $children = $child->get_children();
+        foreach ($children as $onechild) {
+          if ($onechild->get_style()->position === "fixed") {
+            $fixed_children[] = $onechild->deep_copy();
+          }
+        }
+        $fixed_children = array_reverse($fixed_children);
+      }
+      
+      $child->set_containing_block($content_x, $content_y, $content_width, $content_height);
+      
+      // Check for begin reflow callback
+      $this->_check_callbacks("begin_page_reflow", $child);
+    
+      //Insert a copy of each node which have a fixed position
+      if ($current_page >= 1) {
+        foreach ($fixed_children as $fixed_child) {
+          $child->insert_child_before($fixed_child->deep_copy(), $child->get_first_child());
+        }
+      }
+      
+      $child->reflow();
+      $next_child = $child->get_next_sibling();
+      
+      // Check for begin render callback
+      $this->_check_callbacks("begin_page_render", $child);
+      
+      // Render the page
+      $this->_frame->get_renderer()->render($child);
+      
+      // Check for end render callback
+      $this->_check_callbacks("end_page_render", $child);
+      
+      if ( $next_child ) {
+        $this->_frame->next_page();
+      }
+
+      // Wait to dispose of all frames on the previous page
+      // so callback will have access to them
+      if ( $prev_child ) {
+        $prev_child->dispose(true);
+      }
+      $prev_child = $child;
+      $child = $next_child;
+      $current_page++;
+    }
+
+    // Dispose of previous page if it still exists
+    if ( $prev_child ) {
+      $prev_child->dispose(true);
+    }
+  }  
+  
+  //........................................................................
+  
+  /**
+   * Check for callbacks that need to be performed when a given event
+   * gets triggered on a page
+   *
+   * @param string $event the type of event
+   * @param Frame $frame the frame that event is triggered on
+   */
+  protected function _check_callbacks($event, $frame) {
+    if (!isset($this->_callbacks)) {
+      $dompdf = $this->_frame->get_dompdf();
+      $this->_callbacks = $dompdf->get_callbacks();
+      $this->_canvas = $dompdf->get_canvas();
+    }
+    
+    if (is_array($this->_callbacks) && isset($this->_callbacks[$event])) {
+      $info = array(0 => $this->_canvas, "canvas" => $this->_canvas,
+                    1 => $frame, "frame" => $frame);
+      $fs = $this->_callbacks[$event];
+      foreach ($fs as $f) {
+        if (is_callable($f)) {
+          if (is_array($f)) {
+            $f[0]->$f[1]($info);
+          } else {
+            $f($info);
+          }
+        }
+      }
+    }
+  }  
+}

vendor/dompdf/dompdf/include/php_evaluator.cls.php

@@ -0,0 +1,48 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Executes inline PHP code during the rendering process
+ *
+ * @access private
+ * @package dompdf
+ */
+class PHP_Evaluator {
+  
+  /**
+   * @var Canvas
+   */
+  protected $_canvas;
+
+  function __construct(Canvas $canvas) {
+    $this->_canvas = $canvas;
+  }
+
+  function evaluate($code, $vars = array()) {
+    if ( !$this->_canvas->get_dompdf()->get_option("enable_php") ) {
+      return;
+    }
+    
+    // Set up some variables for the inline code
+    $pdf = $this->_canvas;
+    $PAGE_NUM = $pdf->get_page_number();
+    $PAGE_COUNT = $pdf->get_page_count();
+    
+    // Override those variables if passed in
+    foreach ($vars as $k => $v) {
+      $$k = $v;
+    }
+
+    //$code = html_entity_decode($code); // @todo uncomment this when tested
+    eval($code); 
+  }
+
+  function render(Frame $frame) {
+    $this->evaluate($frame->get_node()->nodeValue);
+  }
+}

vendor/dompdf/dompdf/include/positioner.cls.php

@@ -0,0 +1,51 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Base Positioner class
+ *
+ * Defines postioner interface
+ *
+ * @access private
+ * @package dompdf
+ */
+abstract class Positioner {
+  
+  /**
+   * @var Frame_Decorator
+   */
+  protected $_frame;
+  
+  //........................................................................
+
+  function __construct(Frame_Decorator $frame) {
+    $this->_frame = $frame;
+  }
+  
+  /**
+   * Class destructor
+   */
+  function __destruct() {
+    clear_object($this);
+  }
+  //........................................................................
+
+  abstract function position();
+  
+  function move($offset_x, $offset_y, $ignore_self = false) {
+    list($x, $y) = $this->_frame->get_position();
+    
+    if ( !$ignore_self ) {
+      $this->_frame->set_position($x + $offset_x, $y + $offset_y);
+    }
+    
+    foreach($this->_frame->get_children() as $child) {
+      $child->move($offset_x, $offset_y);
+    }
+  }
+}

vendor/dompdf/dompdf/include/renderer.cls.php

@@ -0,0 +1,290 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Concrete renderer
+ *
+ * Instantiates several specific renderers in order to render any given
+ * frame.
+ *
+ * @access private
+ * @package dompdf
+ */
+class Renderer extends Abstract_Renderer {
+
+  /**
+   * Array of renderers for specific frame types
+   *
+   * @var Abstract_Renderer[]
+   */
+  protected $_renderers;
+    
+  /**
+   * Cache of the callbacks array
+   * 
+   * @var array
+   */
+  private $_callbacks;
+  
+  /**
+   * Class destructor
+   */
+  function __destruct() {
+    clear_object($this);
+  }
+  
+  /**
+   * Advance the canvas to the next page
+   */  
+  function new_page() {
+    $this->_canvas->new_page();
+  }
+
+  /**
+   * Render frames recursively
+   *
+   * @param Frame $frame the frame to render
+   */
+  function render(Frame $frame) {
+    global $_dompdf_debug;
+
+    if ( $_dompdf_debug ) {
+      echo $frame;
+      flush();
+    }
+    
+    $style = $frame->get_style();
+    
+    if ( in_array($style->visibility, array("hidden", "collapse")) ) {
+      return;
+    }
+    
+    $display = $style->display;
+    
+    // Starts the CSS transformation
+    if ( $style->transform && is_array($style->transform) ) {
+      $this->_canvas->save();
+      list($x, $y) = $frame->get_padding_box();
+      $origin = $style->transform_origin;
+      
+      foreach($style->transform as $transform) {
+        list($function, $values) = $transform;
+        if ( $function === "matrix" ) {
+          $function = "transform";
+        }
+        
+        $values = array_map("floatval", $values);
+        $values[] = $x + $style->length_in_pt($origin[0], $style->width);
+        $values[] = $y + $style->length_in_pt($origin[1], $style->height);
+        
+        call_user_func_array(array($this->_canvas, $function), $values);
+      }
+    }
+    
+    switch ($display) {
+      
+    case "block":
+    case "list-item":
+    case "inline-block":
+    case "table":
+    case "inline-table":
+      $this->_render_frame("block", $frame);
+      break;
+
+    case "inline":
+      if ( $frame->is_text_node() )
+        $this->_render_frame("text", $frame);
+      else
+        $this->_render_frame("inline", $frame);
+      break;
+
+    case "table-cell":
+      $this->_render_frame("table-cell", $frame);
+      break;
+
+    case "table-row-group":
+    case "table-header-group":
+    case "table-footer-group":
+      $this->_render_frame("table-row-group", $frame);
+      break;
+
+    case "-dompdf-list-bullet":
+      $this->_render_frame("list-bullet", $frame);
+      break;
+
+    case "-dompdf-image":
+      $this->_render_frame("image", $frame);
+      break;
+      
+    case "none":
+      $node = $frame->get_node();
+          
+      if ( $node->nodeName === "script" ) {
+        if ( $node->getAttribute("type") === "text/php" ||
+             $node->getAttribute("language") === "php" ) {
+          // Evaluate embedded php scripts
+          $this->_render_frame("php", $frame);
+        }
+        
+        elseif ( $node->getAttribute("type") === "text/javascript" ||
+             $node->getAttribute("language") === "javascript" ) {
+          // Insert JavaScript
+          $this->_render_frame("javascript", $frame);
+        }
+      }
+
+      // Don't render children, so skip to next iter
+      return;
+      
+    default:
+      break;
+
+    }
+
+    // Starts the overflow: hidden box
+    if ( $style->overflow === "hidden" ) {
+      list($x, $y, $w, $h) = $frame->get_padding_box();
+      
+      // get border radii
+      $style = $frame->get_style();
+      list($tl, $tr, $br, $bl) = $style->get_computed_border_radius($w, $h);
+      
+      if ( $tl + $tr + $br + $bl > 0 ) {
+        $this->_canvas->clipping_roundrectangle($x, $y, $w, $h, $tl, $tr, $br, $bl);
+      }
+      else {
+        $this->_canvas->clipping_rectangle($x, $y, $w, $h);
+      }
+    }
+
+    $stack = array();
+    
+    foreach ($frame->get_children() as $child) {
+      // < 0 : nagative z-index
+      // = 0 : no z-index, no stacking context
+      // = 1 : stacking context without z-index
+      // > 1 : z-index
+      $child_style = $child->get_style();
+      $child_z_index = $child_style->z_index;
+      $z_index = 0;
+      
+      if ( $child_z_index !== "auto" ) {
+        $z_index = intval($child_z_index) + 1;
+      } 
+      elseif ( $child_style->float !== "none" || $child->is_positionned()) {
+        $z_index = 1;
+      }
+      
+      $stack[$z_index][] = $child;
+    }
+    
+    ksort($stack);
+    
+    foreach ($stack as $by_index) {
+      foreach($by_index as $child) {
+        $this->render($child);
+      }
+    }
+     
+    // Ends the overflow: hidden box
+    if ( $style->overflow === "hidden" ) {
+      $this->_canvas->clipping_end();
+    }
+
+    if ( $style->transform && is_array($style->transform) ) {
+      $this->_canvas->restore();
+    }
+
+    // Check for end frame callback
+    $this->_check_callbacks("end_frame", $frame);
+  }
+  
+  /**
+   * Check for callbacks that need to be performed when a given event
+   * gets triggered on a frame
+   *
+   * @param string $event the type of event
+   * @param Frame $frame the frame that event is triggered on
+   */
+  protected function _check_callbacks($event, $frame) {
+    if (!isset($this->_callbacks)) {
+      $this->_callbacks = $this->_dompdf->get_callbacks();
+    }
+    
+    if (is_array($this->_callbacks) && isset($this->_callbacks[$event])) {
+      $info = array(0 => $this->_canvas, "canvas" => $this->_canvas,
+                    1 => $frame, "frame" => $frame);
+      $fs = $this->_callbacks[$event];
+      foreach ($fs as $f) {
+        if (is_callable($f)) {
+          if (is_array($f)) {
+            $f[0]->$f[1]($info);
+          } else {
+            $f($info);
+          }
+        }
+      }
+    }
+  }
+
+  /**
+   * Render a single frame
+   *
+   * Creates Renderer objects on demand
+   *
+   * @param string $type type of renderer to use
+   * @param Frame $frame the frame to render
+   */
+  protected function _render_frame($type, $frame) {
+
+    if ( !isset($this->_renderers[$type]) ) {
+      
+      switch ($type) {
+      case "block":
+        $this->_renderers[$type] = new Block_Renderer($this->_dompdf);
+        break;
+
+      case "inline":
+        $this->_renderers[$type] = new Inline_Renderer($this->_dompdf);
+        break;
+
+      case "text":
+        $this->_renderers[$type] = new Text_Renderer($this->_dompdf);
+        break;
+
+      case "image":
+        $this->_renderers[$type] = new Image_Renderer($this->_dompdf);
+        break;
+      
+      case "table-cell":
+        $this->_renderers[$type] = new Table_Cell_Renderer($this->_dompdf);
+        break;
+      
+      case "table-row-group":
+        $this->_renderers[$type] = new Table_Row_Group_Renderer($this->_dompdf);
+        break;
+
+      case "list-bullet":
+        $this->_renderers[$type] = new List_Bullet_Renderer($this->_dompdf);
+        break;
+
+      case "php":
+        $this->_renderers[$type] = new PHP_Evaluator($this->_canvas);
+        break;
+
+      case "javascript":
+        $this->_renderers[$type] = new Javascript_Embedder($this->_dompdf);
+        break;
+        
+      }
+    }
+    
+    $this->_renderers[$type]->render($frame);
+
+  }
+}

vendor/dompdf/dompdf/include/table_cell_frame_decorator.cls.php

@@ -0,0 +1,102 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates table cells for layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Cell_Frame_Decorator extends Block_Frame_Decorator {
+  
+  protected $_resolved_borders;
+  protected $_content_height;
+  
+  //........................................................................
+
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    $this->_resolved_borders = array();
+    $this->_content_height = 0;    
+  }
+
+  //........................................................................
+
+  function reset() {
+    parent::reset();
+    $this->_resolved_borders = array();
+    $this->_content_height = 0;
+    $this->_frame->reset();    
+  }
+  
+  function get_content_height() {
+    return $this->_content_height;
+  }
+
+  function set_content_height($height) {
+    $this->_content_height = $height;
+  }
+  
+  function set_cell_height($height) {
+    $style = $this->get_style();
+    $v_space = $style->length_in_pt(array($style->margin_top,
+                                          $style->padding_top,
+                                          $style->border_top_width,
+                                          $style->border_bottom_width,
+                                          $style->padding_bottom,
+                                          $style->margin_bottom),
+                                    $style->width);
+
+    $new_height = $height - $v_space;    
+    $style->height = $new_height;
+
+    if ( $new_height > $this->_content_height ) {
+      $y_offset = 0;
+      
+      // Adjust our vertical alignment
+      switch ($style->vertical_align) {
+        default:
+        case "baseline":
+          // FIXME: this isn't right
+          
+        case "top":
+          // Don't need to do anything
+          return;
+  
+        case "middle":
+          $y_offset = ($new_height - $this->_content_height) / 2;
+          break;
+  
+        case "bottom":
+          $y_offset = $new_height - $this->_content_height;
+          break;
+      }
+   
+      if ( $y_offset ) {
+        // Move our children
+        foreach ( $this->get_line_boxes() as $line ) {
+          foreach ( $line->get_frames() as $frame )
+            $frame->move( 0, $y_offset );
+        }
+      }
+   }
+        
+  }
+
+  function set_resolved_border($side, $border_spec) {    
+    $this->_resolved_borders[$side] = $border_spec;
+  }
+
+  //........................................................................
+
+  function get_resolved_border($side) {
+    return $this->_resolved_borders[$side];
+  }
+
+  function get_resolved_borders() { return $this->_resolved_borders; }
+}

vendor/dompdf/dompdf/include/table_cell_frame_reflower.cls.php

@@ -0,0 +1,119 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows table cells
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Cell_Frame_Reflower extends Block_Frame_Reflower {
+
+  //........................................................................
+
+  function __construct(Block_Frame_Decorator $frame) {
+    parent::__construct($frame);
+  }
+
+  //........................................................................
+
+  function reflow(Block_Frame_Decorator $block = null) {
+
+    $style = $this->_frame->get_style();
+
+    $table = Table_Frame_Decorator::find_parent_table($this->_frame);
+    $cellmap = $table->get_cellmap();
+
+    list($x, $y) = $cellmap->get_frame_position($this->_frame);
+    $this->_frame->set_position($x, $y);
+
+    $cells = $cellmap->get_spanned_cells($this->_frame);
+
+    $w = 0;
+    foreach ( $cells["columns"] as $i ) {
+      $col = $cellmap->get_column( $i );
+      $w += $col["used-width"];
+    }
+
+    //FIXME?
+    $h = $this->_frame->get_containing_block("h");
+
+    $left_space = $style->length_in_pt(array($style->margin_left,
+                                             $style->padding_left,
+                                             $style->border_left_width),
+                                       $w);
+
+    $right_space = $style->length_in_pt(array($style->padding_right,
+                                              $style->margin_right,
+                                              $style->border_right_width),
+                                        $w);
+
+    $top_space = $style->length_in_pt(array($style->margin_top,
+                                            $style->padding_top,
+                                            $style->border_top_width),
+                                      $h);
+    $bottom_space = $style->length_in_pt(array($style->margin_bottom,
+                                               $style->padding_bottom,
+                                               $style->border_bottom_width),
+                                      $h);
+
+    $style->width = $cb_w = $w - $left_space - $right_space;
+
+    $content_x = $x + $left_space;
+    $content_y = $line_y = $y + $top_space;
+
+    // Adjust the first line based on the text-indent property
+    $indent = $style->length_in_pt($style->text_indent, $w);
+    $this->_frame->increase_line_width($indent);
+
+    $page = $this->_frame->get_root();
+    
+    // Set the y position of the first line in the cell
+    $line_box = $this->_frame->get_current_line_box();
+    $line_box->y = $line_y;
+    
+    // Set the containing blocks and reflow each child
+    foreach ( $this->_frame->get_children() as $child ) {
+      
+      if ( $page->is_full() )
+        break;
+    
+      $child->set_containing_block($content_x, $content_y, $cb_w, $h);
+      
+      $this->process_clear($child);
+      
+      $child->reflow($this->_frame);
+    
+      $this->process_float($child, $x + $left_space, $w - $right_space - $left_space);
+    }
+
+    // Determine our height
+    $style_height = $style->length_in_pt($style->height, $h);
+
+    $this->_frame->set_content_height($this->_calculate_content_height());
+
+    $height = max($style_height, $this->_frame->get_content_height());
+
+    // Let the cellmap know our height
+    $cell_height = $height / count($cells["rows"]);
+
+    if ($style_height <= $height)
+      $cell_height += $top_space + $bottom_space;
+
+    foreach ($cells["rows"] as $i)
+      $cellmap->set_row_height($i, $cell_height);
+
+    $style->height = $height;
+
+    $this->_text_align();
+
+    $this->vertical_align();
+
+  }
+
+}

vendor/dompdf/dompdf/include/table_cell_positioner.cls.php

@@ -0,0 +1,28 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Positions table cells
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Cell_Positioner extends Positioner {
+
+  function __construct(Frame_Decorator $frame) { parent::__construct($frame); }
+  
+  //........................................................................
+
+  function position() {
+
+    $table = Table_Frame_Decorator::find_parent_table($this->_frame);
+    $cellmap = $table->get_cellmap();
+    $this->_frame->set_position($cellmap->get_frame_position($this->_frame));
+
+  }
+}

vendor/dompdf/dompdf/include/table_cell_renderer.cls.php

@@ -0,0 +1,155 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Renders table cells
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Cell_Renderer extends Block_Renderer {
+
+  //........................................................................
+
+  function render(Frame $frame) {
+    $style = $frame->get_style();
+    
+    if ( trim($frame->get_node()->nodeValue) === "" && $style->empty_cells === "hide" ) {
+      return;
+    }
+
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+    list($x, $y, $w, $h) = $frame->get_border_box();
+    
+    // Draw our background, border and content
+    if ( ($bg = $style->background_color) !== "transparent" ) {
+      $this->_canvas->filled_rectangle($x, $y, $w, $h, $bg);
+    }
+
+    if ( ($url = $style->background_image) && $url !== "none" ) {
+      $this->_background_image($url, $x, $y, $w, $h, $style);
+    }
+    
+    $table = Table_Frame_Decorator::find_parent_table($frame);
+
+    if ( $table->get_style()->border_collapse !== "collapse" ) {
+      $this->_render_border($frame);
+      $this->_render_outline($frame);
+      return;
+    }
+
+    // The collapsed case is slightly complicated...
+    // @todo Add support for outlines here
+
+    $cellmap  = $table->get_cellmap();
+    $cells    = $cellmap->get_spanned_cells($frame);
+    $num_rows = $cellmap->get_num_rows();
+    $num_cols = $cellmap->get_num_cols();
+
+    // Determine the top row spanned by this cell
+    $i = $cells["rows"][0];
+    $top_row = $cellmap->get_row($i);
+
+    // Determine if this cell borders on the bottom of the table.  If so,
+    // then we draw its bottom border.  Otherwise the next row down will
+    // draw its top border instead.
+    if (in_array( $num_rows - 1, $cells["rows"])) {
+      $draw_bottom = true;
+      $bottom_row = $cellmap->get_row($num_rows - 1);
+    } else
+      $draw_bottom = false;
+
+
+    // Draw the horizontal borders
+    foreach ( $cells["columns"] as $j ) {
+      $bp = $cellmap->get_border_properties($i, $j);
+
+      $y = $top_row["y"] - $bp["top"]["width"] / 2;
+
+      $col = $cellmap->get_column($j);
+      $x = $col["x"] - $bp["left"]["width"] / 2;
+      $w = $col["used-width"] + ($bp["left"]["width"] + $bp["right"]["width"] ) / 2;
+
+      if ( $bp["top"]["style"] !== "none" && $bp["top"]["width"] > 0 ) {
+        $widths = array($bp["top"]["width"],
+                        $bp["right"]["width"],
+                        $bp["bottom"]["width"],
+                        $bp["left"]["width"]);
+        $method = "_border_". $bp["top"]["style"];
+        $this->$method($x, $y, $w, $bp["top"]["color"], $widths, "top", "square");
+      }
+
+      if ( $draw_bottom ) {
+        $bp = $cellmap->get_border_properties($num_rows - 1, $j);
+        if ( $bp["bottom"]["style"] === "none" || $bp["bottom"]["width"] <= 0 )
+          continue;
+
+        $y = $bottom_row["y"] + $bottom_row["height"] + $bp["bottom"]["width"] / 2;
+
+        $widths = array($bp["top"]["width"],
+                        $bp["right"]["width"],
+                        $bp["bottom"]["width"],
+                        $bp["left"]["width"]);
+        $method = "_border_". $bp["bottom"]["style"];
+        $this->$method($x, $y, $w, $bp["bottom"]["color"], $widths, "bottom", "square");
+
+      }
+    }
+
+    $j = $cells["columns"][0];
+
+    $left_col = $cellmap->get_column($j);
+
+    if (in_array($num_cols - 1, $cells["columns"])) {
+      $draw_right = true;
+      $right_col = $cellmap->get_column($num_cols - 1);
+    } else
+      $draw_right = false;
+
+    // Draw the vertical borders
+    foreach ( $cells["rows"] as $i ) {
+      $bp = $cellmap->get_border_properties($i, $j);
+
+      $x = $left_col["x"] - $bp["left"]["width"] / 2;
+
+      $row = $cellmap->get_row($i);
+
+      $y = $row["y"] - $bp["top"]["width"] / 2;
+      $h = $row["height"] + ($bp["top"]["width"] + $bp["bottom"]["width"])/ 2;
+
+      if ( $bp["left"]["style"] !== "none" && $bp["left"]["width"] > 0 ) {
+
+        $widths = array($bp["top"]["width"],
+                        $bp["right"]["width"],
+                        $bp["bottom"]["width"],
+                        $bp["left"]["width"]);
+
+        $method = "_border_" . $bp["left"]["style"];
+        $this->$method($x, $y, $h, $bp["left"]["color"], $widths, "left", "square");
+      }
+
+      if ( $draw_right ) {
+        $bp = $cellmap->get_border_properties($i, $num_cols - 1);
+        if ( $bp["right"]["style"] === "none" || $bp["right"]["width"] <= 0 )
+          continue;
+
+        $x = $right_col["x"] + $right_col["used-width"] + $bp["right"]["width"] / 2;
+
+        $widths = array($bp["top"]["width"],
+                        $bp["right"]["width"],
+                        $bp["bottom"]["width"],
+                        $bp["left"]["width"]);
+
+        $method = "_border_" . $bp["right"]["style"];
+        $this->$method($x, $y, $h, $bp["right"]["color"], $widths, "right", "square");
+
+      }
+    }
+
+  }
+}

vendor/dompdf/dompdf/include/table_frame_decorator.cls.php

@@ -0,0 +1,334 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates Frames for table layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Frame_Decorator extends Frame_Decorator {
+  static $VALID_CHILDREN = array("table-row-group",
+                                 "table-row",
+                                 "table-header-group",
+                                 "table-footer-group",
+                                 "table-column",
+                                 "table-column-group",
+                                 "table-caption",
+                                 "table-cell");
+
+  static $ROW_GROUPS = array('table-row-group',
+                             'table-header-group',
+                             'table-footer-group');
+
+  /**
+   * The Cellmap object for this table.  The cellmap maps table cells
+   * to rows and columns, and aids in calculating column widths.
+   *
+   * @var Cellmap
+   */
+  protected $_cellmap;
+
+  /**
+   * The minimum width of the table, in pt
+   *
+   * @var float
+   */
+  protected $_min_width;
+
+  /**
+   * The maximum width of the table, in pt
+   *
+   * @var float
+   */
+  protected $_max_width;
+
+  /**
+   * Table header rows.  Each table header is duplicated when a table
+   * spans pages.
+   *
+   * @var array
+   */
+  protected $_headers;
+
+  /**
+   * Table footer rows.  Each table footer is duplicated when a table
+   * spans pages.
+   *
+   * @var array
+   */
+  protected $_footers;
+
+  /**
+   * Class constructor
+   *
+   * @param Frame  $frame the frame to decorate
+   * @param DOMPDF $dompdf
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+    $this->_cellmap = new Cellmap($this);
+    
+    if ( $frame->get_style()->table_layout === "fixed" ) {
+      $this->_cellmap->set_layout_fixed(true);
+    }
+    
+    $this->_min_width = null;
+    $this->_max_width = null;
+    $this->_headers = array();
+    $this->_footers = array();
+  }
+
+
+  function reset() {
+    parent::reset();
+    $this->_cellmap->reset();
+    $this->_min_width = null;
+    $this->_max_width = null;
+    $this->_headers = array();
+    $this->_footers = array();
+    $this->_reflower->reset();
+  }
+
+  //........................................................................
+
+  /**
+   * split the table at $row.  $row and all subsequent rows will be
+   * added to the clone.  This method is overidden in order to remove
+   * frames from the cellmap properly.
+   *
+   * @param Frame $child
+   * @param bool  $force_pagebreak
+   *
+   * @return void
+   */
+  function split(Frame $child = null, $force_pagebreak = false) {
+
+    if ( is_null($child) ) {
+      parent::split();
+      return;
+    }
+
+    // If $child is a header or if it is the first non-header row, do
+    // not duplicate headers, simply move the table to the next page.
+    if ( count($this->_headers) && !in_array($child, $this->_headers, true) &&
+         !in_array($child->get_prev_sibling(), $this->_headers, true) ) {
+
+      $first_header = null;
+
+      // Insert copies of the table headers before $child
+      foreach ($this->_headers as $header) {
+
+        $new_header = $header->deep_copy();
+
+        if ( is_null($first_header) )
+          $first_header = $new_header;
+
+        $this->insert_child_before($new_header, $child);
+      }
+
+      parent::split($first_header);
+
+    } else if ( in_array($child->get_style()->display, self::$ROW_GROUPS) ) {
+
+      // Individual rows should have already been handled
+      parent::split($child);
+
+    } else {
+
+      $iter = $child;
+
+      while ($iter) {
+        $this->_cellmap->remove_row($iter);
+        $iter = $iter->get_next_sibling();
+      }
+
+      parent::split($child);
+    }
+  }
+
+  /**
+   * Return a copy of this frame with $node as its node
+   * 
+   * @param DOMNode $node
+   * @return Frame
+   */ 
+  function copy(DOMNode $node) {
+    $deco = parent::copy($node);
+    
+    // In order to keep columns' widths through pages
+    $deco->_cellmap->set_columns($this->_cellmap->get_columns());
+    $deco->_cellmap->lock_columns();
+
+    return $deco;
+  }
+
+  /**
+   * Static function to locate the parent table of a frame
+   *
+   * @param Frame $frame
+   * @return Table_Frame_Decorator the table that is an ancestor of $frame
+   */
+  static function find_parent_table(Frame $frame) {
+
+    while ( $frame = $frame->get_parent() )
+      if ( $frame->is_table() )
+        break;
+
+    return $frame;
+  }
+
+  /**
+   * Return this table's Cellmap
+   *
+   * @return Cellmap
+   */
+  function get_cellmap() { return $this->_cellmap; }
+
+  /**
+   * Return the minimum width of this table
+   *
+   * @return float
+   */
+  function get_min_width() { return $this->_min_width; }
+
+  /**
+   * Return the maximum width of this table
+   *
+   * @return float
+   */
+  function get_max_width() { return $this->_max_width; }
+
+  /**
+   * Set the minimum width of the table
+   *
+   * @param float $width the new minimum width
+   */
+  function set_min_width($width) { $this->_min_width = $width; }
+
+  /**
+   * Set the maximum width of the table
+   *
+   * @param float $width the new maximum width
+   */
+  function set_max_width($width) { $this->_max_width = $width; }
+
+  /**
+   * Restructure tree so that the table has the correct structure.
+   * Invalid children (i.e. all non-table-rows) are moved below the
+   * table.
+   */
+  function normalise() {
+
+    // Store frames generated by invalid tags and move them outside the table
+    $erroneous_frames = array();
+    $anon_row = false;
+    $iter = $this->get_first_child();
+    while ( $iter ) {
+      $child = $iter;
+      $iter = $iter->get_next_sibling();
+
+      $display = $child->get_style()->display;
+
+      if ( $anon_row ) {
+
+        if ( $display === "table-row" ) {
+          // Add the previous anonymous row
+          $this->insert_child_before($table_row, $child);
+
+          $table_row->normalise();
+          $child->normalise();
+          $anon_row = false;
+          continue;
+        }
+
+        // add the child to the anonymous row
+        $table_row->append_child($child);
+        continue;
+
+      } else {
+
+        if ( $display === "table-row" ) {
+          $child->normalise();
+          continue;
+        }
+
+        if ( $display === "table-cell" ) {
+          // Create an anonymous table row
+          $tr = $this->get_node()->ownerDocument->createElement("tr");
+
+          $frame = new Frame($tr);
+
+          $css = $this->get_style()->get_stylesheet();
+          $style = $css->create_style();
+          $style->inherit($this->get_style());
+
+          // Lookup styles for tr tags.  If the user wants styles to work
+          // better, they should make the tr explicit... I'm not going to
+          // try to guess what they intended.
+          if ( $tr_style = $css->lookup("tr") )
+            $style->merge($tr_style);
+
+          // Okay, I have absolutely no idea why I need this clone here, but
+          // if it's omitted, php (as of 2004-07-28) segfaults.
+          $frame->set_style(clone $style);
+          $table_row = Frame_Factory::decorate_frame($frame, $this->_dompdf, $this->_root);
+
+          // Add the cell to the row
+          $table_row->append_child($child);
+
+          $anon_row = true;
+          continue;
+        }
+
+        if ( !in_array($display, self::$VALID_CHILDREN) ) {
+          $erroneous_frames[] = $child;
+          continue;
+        }
+
+        // Normalise other table parts (i.e. row groups)
+        foreach ($child->get_children() as $grandchild) {
+          if ( $grandchild->get_style()->display === "table-row" ) {
+            $grandchild->normalise();
+          }
+        }
+
+        // Add headers and footers
+        if ( $display === "table-header-group" )
+          $this->_headers[] = $child;
+
+        else if ( $display === "table-footer-group" )
+          $this->_footers[] = $child;
+      }
+    }
+
+    if ( $anon_row ) {
+      // Add the row to the table
+      $this->_frame->append_child($table_row);
+      $table_row->normalise();
+      $this->_cellmap->add_row();
+    }
+
+    foreach ($erroneous_frames as $frame)
+      $this->move_after($frame);
+
+  }
+
+  //........................................................................
+
+  /**
+   * Moves the specified frame and it's corresponding node outside of
+   * the table.
+   *
+   * @param Frame $frame the frame to move
+   */
+  function move_after(Frame $frame) {
+    $this->get_parent()->insert_child_after($frame, $this);
+  }
+
+}

vendor/dompdf/dompdf/include/table_frame_reflower.cls.php

@@ -0,0 +1,578 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows tables
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Frame_Reflower extends Frame_Reflower {
+  /**
+   * Frame for this reflower
+   *
+   * @var Table_Frame_Decorator
+   */
+  protected $_frame;
+
+  /**
+   * Cache of results between call to get_min_max_width and assign_widths
+   *
+   * @var array
+   */
+  protected $_state;
+
+  function __construct(Table_Frame_Decorator $frame) {
+    $this->_state = null;
+    parent::__construct($frame);
+  }
+
+  /**
+   * State is held here so it needs to be reset along with the decorator
+   */
+  function reset() {
+    $this->_state = null;
+    $this->_min_max_cache = null;
+  }
+
+  //........................................................................
+
+  protected function _assign_widths() {
+    $style = $this->_frame->get_style();
+
+    // Find the min/max width of the table and sort the columns into
+    // absolute/percent/auto arrays
+    $min_width = $this->_state["min_width"];
+    $max_width = $this->_state["max_width"];
+    $percent_used = $this->_state["percent_used"];
+    $absolute_used = $this->_state["absolute_used"];
+    $auto_min = $this->_state["auto_min"];
+
+    $absolute =& $this->_state["absolute"];
+    $percent =& $this->_state["percent"];
+    $auto =& $this->_state["auto"];
+
+    // Determine the actual width of the table
+    $cb = $this->_frame->get_containing_block();
+    $columns =& $this->_frame->get_cellmap()->get_columns();
+
+    $width = $style->width;
+
+    // Calculate padding & border fudge factor
+    $left = $style->margin_left;
+    $right = $style->margin_right;
+    
+    $centered = ( $left === "auto" && $right === "auto" );
+
+    $left  = $left  === "auto" ? 0 : $style->length_in_pt($left, $cb["w"]);
+    $right = $right === "auto" ? 0 : $style->length_in_pt($right, $cb["w"]);
+
+    $delta = $left + $right;
+    
+    if ( !$centered ) {
+      $delta += $style->length_in_pt(array(
+        $style->padding_left,
+        $style->border_left_width,
+        $style->border_right_width,
+        $style->padding_right), 
+      $cb["w"]);
+    }
+    
+    $min_table_width = $style->length_in_pt( $style->min_width, $cb["w"] - $delta );
+
+    // min & max widths already include borders & padding
+    $min_width -= $delta;
+    $max_width -= $delta;
+    
+    if ( $width !== "auto" ) {
+
+      $preferred_width = $style->length_in_pt($width, $cb["w"]) - $delta;
+
+      if ( $preferred_width < $min_table_width )
+        $preferred_width = $min_table_width;
+
+      if ( $preferred_width > $min_width )
+        $width = $preferred_width;
+      else
+        $width = $min_width;
+
+    } else {
+
+      if ( $max_width + $delta < $cb["w"] )
+        $width = $max_width;
+      else if ( $cb["w"] - $delta > $min_width )
+        $width = $cb["w"] - $delta;
+      else
+        $width = $min_width;
+
+      if ( $width < $min_table_width )
+        $width = $min_table_width;
+
+    }
+
+    // Store our resolved width
+    $style->width = $width;
+
+    $cellmap = $this->_frame->get_cellmap();
+    
+    if ( $cellmap->is_columns_locked() ) {
+      return;
+    }
+
+    // If the whole table fits on the page, then assign each column it's max width
+    if ( $width == $max_width ) {
+
+      foreach (array_keys($columns) as $i)
+        $cellmap->set_column_width($i, $columns[$i]["max-width"]);
+
+      return;
+    }
+
+    // Determine leftover and assign it evenly to all columns
+    if ( $width > $min_width ) {
+
+      // We have four cases to deal with:
+      //
+      // 1. All columns are auto--no widths have been specified.  In this
+      // case we distribute extra space across all columns weighted by max-width.
+      //
+      // 2. Only absolute widths have been specified.  In this case we
+      // distribute any extra space equally among 'width: auto' columns, or all
+      // columns if no auto columns have been specified.
+      //
+      // 3. Only percentage widths have been specified.  In this case we
+      // normalize the percentage values and distribute any remaining % to
+      // width: auto columns.  We then proceed to assign widths as fractions
+      // of the table width.
+      //
+      // 4. Both absolute and percentage widths have been specified.
+
+      $increment = 0;
+
+      // Case 1:
+      if ( $absolute_used == 0 && $percent_used == 0 ) {
+        $increment = $width - $min_width;
+
+        foreach (array_keys($columns) as $i) {
+          $cellmap->set_column_width($i, $columns[$i]["min-width"] + $increment * ($columns[$i]["max-width"] / $max_width));
+        }
+        return;
+      }
+
+
+      // Case 2
+      if ( $absolute_used > 0 && $percent_used == 0 ) {
+
+        if ( count($auto) > 0 )
+          $increment = ($width - $auto_min - $absolute_used) / count($auto);
+
+        // Use the absolutely specified width or the increment
+        foreach (array_keys($columns) as $i) {
+
+          if ( $columns[$i]["absolute"] > 0 && count($auto) )
+            $cellmap->set_column_width($i, $columns[$i]["min-width"]);
+          else if ( count($auto) ) 
+            $cellmap->set_column_width($i, $columns[$i]["min-width"] + $increment);
+          else {
+            // All absolute columns
+            $increment = ($width - $absolute_used) * $columns[$i]["absolute"] / $absolute_used;
+
+            $cellmap->set_column_width($i, $columns[$i]["min-width"] + $increment);
+          }
+
+        }
+        return;
+      }
+
+
+      // Case 3:
+      if ( $absolute_used == 0 && $percent_used > 0 ) {
+
+        $scale = null;
+        $remaining = null;
+
+        // Scale percent values if the total percentage is > 100, or if all
+        // values are specified as percentages.
+        if ( $percent_used > 100 || count($auto) == 0)
+          $scale = 100 / $percent_used;
+        else
+          $scale = 1;
+
+        // Account for the minimum space used by the unassigned auto columns
+        $used_width = $auto_min;
+
+        foreach ($percent as $i) {
+          $columns[$i]["percent"] *= $scale;
+
+          $slack = $width - $used_width;
+
+          $w = min($columns[$i]["percent"] * $width/100, $slack);
+
+          if ( $w < $columns[$i]["min-width"] )
+            $w = $columns[$i]["min-width"];
+
+          $cellmap->set_column_width($i, $w);
+          $used_width += $w;
+
+        }
+
+        // This works because $used_width includes the min-width of each
+        // unassigned column
+        if ( count($auto) > 0 ) {
+          $increment = ($width - $used_width) / count($auto);
+
+          foreach ($auto as $i)
+            $cellmap->set_column_width($i, $columns[$i]["min-width"] + $increment);
+
+        }
+        return;
+      }
+
+      // Case 4:
+
+      // First-come, first served
+      if ( $absolute_used > 0 && $percent_used > 0 ) {
+
+        $used_width = $auto_min;
+
+        foreach ($absolute as $i) {
+          $cellmap->set_column_width($i, $columns[$i]["min-width"]);
+          $used_width +=  $columns[$i]["min-width"];
+        }
+
+        // Scale percent values if the total percentage is > 100 or there
+        // are no auto values to take up slack
+        if ( $percent_used > 100 || count($auto) == 0 )
+          $scale = 100 / $percent_used;
+        else
+          $scale = 1;
+
+        $remaining_width = $width - $used_width;
+
+        foreach ($percent as $i) {
+          $slack = $remaining_width - $used_width;
+
+          $columns[$i]["percent"] *= $scale;
+          $w = min($columns[$i]["percent"] * $remaining_width / 100, $slack);
+
+          if ( $w < $columns[$i]["min-width"] )
+            $w = $columns[$i]["min-width"];
+
+          $columns[$i]["used-width"] = $w;
+          $used_width += $w;
+        }
+
+        if ( count($auto) > 0 ) {
+          $increment = ($width - $used_width) / count($auto);
+
+          foreach ($auto as $i)
+            $cellmap->set_column_width($i, $columns[$i]["min-width"] + $increment);
+
+        }
+
+        return;
+      }
+
+
+    } else { // we are over constrained
+
+      // Each column gets its minimum width
+      foreach (array_keys($columns) as $i)
+        $cellmap->set_column_width($i, $columns[$i]["min-width"]);
+
+    }
+  }
+
+  //........................................................................
+
+  // Determine the frame's height based on min/max height
+  protected function _calculate_height() {
+
+    $style = $this->_frame->get_style();
+    $height = $style->height;
+
+    $cellmap = $this->_frame->get_cellmap();
+    $cellmap->assign_frame_heights();
+    $rows = $cellmap->get_rows();
+
+    // Determine our content height
+    $content_height = 0;
+    foreach ( $rows as $r )
+      $content_height += $r["height"];
+
+    $cb = $this->_frame->get_containing_block();
+
+    if ( !($style->overflow === "visible" ||
+           ($style->overflow === "hidden" && $height === "auto")) ) {
+
+      // Only handle min/max height if the height is independent of the frame's content
+
+      $min_height = $style->min_height;
+      $max_height = $style->max_height;
+
+      if ( isset($cb["h"]) ) {
+        $min_height = $style->length_in_pt($min_height, $cb["h"]);
+        $max_height = $style->length_in_pt($max_height, $cb["h"]);
+
+      } else if ( isset($cb["w"]) ) {
+
+        if ( mb_strpos($min_height, "%") !== false )
+          $min_height = 0;
+        else
+          $min_height = $style->length_in_pt($min_height, $cb["w"]);
+
+        if ( mb_strpos($max_height, "%") !== false )
+          $max_height = "none";
+        else
+          $max_height = $style->length_in_pt($max_height, $cb["w"]);
+      }
+
+      if ( $max_height !== "none" && $min_height > $max_height )
+        // Swap 'em
+        list($max_height, $min_height) = array($min_height, $max_height);
+
+      if ( $max_height !== "none" && $height > $max_height )
+        $height = $max_height;
+
+      if ( $height < $min_height )
+        $height = $min_height;
+
+    } else {
+
+      // Use the content height or the height value, whichever is greater
+      if ( $height !== "auto" ) {
+        $height = $style->length_in_pt($height, $cb["h"]);
+
+        if ( $height <= $content_height )
+          $height = $content_height;
+        else
+          $cellmap->set_frame_heights($height,$content_height);
+
+      } else
+        $height = $content_height;
+
+    }
+
+    return $height;
+
+  }
+  //........................................................................
+
+  /**
+   * @param Block_Frame_Decorator $block
+   */
+  function reflow(Block_Frame_Decorator $block = null) {
+    /**
+     * @var Table_Frame_Decorator
+     */
+    $frame = $this->_frame;
+    
+    // Check if a page break is forced
+    $page = $frame->get_root();
+    $page->check_forced_page_break($frame);
+
+    // Bail if the page is full
+    if ( $page->is_full() )
+      return;
+    
+    // Let the page know that we're reflowing a table so that splits
+    // are suppressed (simply setting page-break-inside: avoid won't
+    // work because we may have an arbitrary number of block elements
+    // inside tds.)
+    $page->table_reflow_start();
+    
+    // Collapse vertical margins, if required
+    $this->_collapse_margins();
+
+    $frame->position();
+
+    // Table layout algorithm:
+    // http://www.w3.org/TR/CSS21/tables.html#auto-table-layout
+
+    if ( is_null($this->_state) )
+      $this->get_min_max_width();
+
+    $cb = $frame->get_containing_block();
+    $style = $frame->get_style();
+
+    // This is slightly inexact, but should be okay.  Add half the
+    // border-spacing to the table as padding.  The other half is added to
+    // the cells themselves.
+    if ( $style->border_collapse === "separate" ) {
+      list($h, $v) = $style->border_spacing;
+
+      $v = $style->length_in_pt($v) / 2;
+      $h = $style->length_in_pt($h) / 2;
+
+      $style->padding_left   = $style->length_in_pt($style->padding_left,   $cb["w"]) + $h;
+      $style->padding_right  = $style->length_in_pt($style->padding_right,  $cb["w"]) + $h;
+      $style->padding_top    = $style->length_in_pt($style->padding_top,    $cb["h"]) + $v;
+      $style->padding_bottom = $style->length_in_pt($style->padding_bottom, $cb["h"]) + $v;
+
+    }
+
+    $this->_assign_widths();
+
+    // Adjust left & right margins, if they are auto
+    $width = $style->width;
+    $left = $style->margin_left;
+    $right = $style->margin_right;
+
+    $diff = $cb["w"] - $width;
+
+    if ( $left === "auto" && $right === "auto" ) {
+      if ( $diff < 0 ) {
+        $left = 0;
+        $right = $diff;
+      }
+      else {
+        $left = $right = $diff / 2;
+      }
+      
+      $style->margin_left = "$left pt";
+      $style->margin_right = "$right pt";
+
+    } else {
+      if ( $left === "auto" ) {
+        $left = $style->length_in_pt($cb["w"] - $right - $width, $cb["w"]);
+      }
+      if ( $right === "auto" ) {
+        $left = $style->length_in_pt($left, $cb["w"]);
+      }
+    }
+
+    list($x, $y) = $frame->get_position();
+
+    // Determine the content edge
+    $content_x = $x + $left + $style->length_in_pt(array($style->padding_left,
+                                                         $style->border_left_width), $cb["w"]);
+    $content_y = $y + $style->length_in_pt(array($style->margin_top,
+                                                 $style->border_top_width,
+                                                 $style->padding_top), $cb["h"]);
+
+    if ( isset($cb["h"]) )
+      $h = $cb["h"];
+    else
+      $h = null;
+
+    $cellmap = $frame->get_cellmap();
+    $col =& $cellmap->get_column(0);
+    $col["x"] = $content_x;
+
+    $row =& $cellmap->get_row(0);
+    $row["y"] = $content_y;
+
+    $cellmap->assign_x_positions();
+
+    // Set the containing block of each child & reflow
+    foreach ( $frame->get_children() as $child ) {
+
+      // Bail if the page is full
+      if ( !$page->in_nested_table() && $page->is_full() )
+        break;
+
+      $child->set_containing_block($content_x, $content_y, $width, $h);
+      $child->reflow();
+
+      if ( !$page->in_nested_table() )
+        // Check if a split has occured
+        $page->check_page_break($child);
+
+    }
+
+    // Assign heights to our cells:
+    $style->height = $this->_calculate_height();
+
+    if ( $style->border_collapse === "collapse" ) {
+      // Unset our borders because our cells are now using them
+      $style->border_style = "none";
+    }
+
+    $page->table_reflow_end();
+
+    // Debugging:
+    //echo ($this->_frame->get_cellmap());
+    
+    if ( $block && $style->float === "none" && $frame->is_in_flow() ) {
+      $block->add_frame_to_line($frame);
+      $block->add_line();
+    }
+  }
+
+  //........................................................................
+
+  function get_min_max_width() {
+
+    if ( !is_null($this->_min_max_cache)  )
+      return $this->_min_max_cache;
+
+    $style = $this->_frame->get_style();
+
+    $this->_frame->normalise();
+
+    // Add the cells to the cellmap (this will calcluate column widths as
+    // frames are added)
+    $this->_frame->get_cellmap()->add_frame($this->_frame);
+
+    // Find the min/max width of the table and sort the columns into
+    // absolute/percent/auto arrays
+    $this->_state = array();
+    $this->_state["min_width"] = 0;
+    $this->_state["max_width"] = 0;
+
+    $this->_state["percent_used"] = 0;
+    $this->_state["absolute_used"] = 0;
+    $this->_state["auto_min"] = 0;
+
+    $this->_state["absolute"] = array();
+    $this->_state["percent"] = array();
+    $this->_state["auto"] = array();
+
+    $columns =& $this->_frame->get_cellmap()->get_columns();
+    foreach (array_keys($columns) as $i) {
+      $this->_state["min_width"] += $columns[$i]["min-width"];
+      $this->_state["max_width"] += $columns[$i]["max-width"];
+
+      if ( $columns[$i]["absolute"] > 0 ) {
+        $this->_state["absolute"][] = $i;
+        $this->_state["absolute_used"] += $columns[$i]["absolute"];
+
+      } else if ( $columns[$i]["percent"] > 0 ) {
+        $this->_state["percent"][] = $i;
+        $this->_state["percent_used"] += $columns[$i]["percent"];
+
+      } else {
+        $this->_state["auto"][] = $i;
+        $this->_state["auto_min"] += $columns[$i]["min-width"];
+      }
+    }
+
+    // Account for margins & padding
+    $dims = array($style->border_left_width,
+                  $style->border_right_width,
+                  $style->padding_left,
+                  $style->padding_right,
+                  $style->margin_left,
+                  $style->margin_right);
+
+    if ( $style->border_collapse !== "collapse" ) 
+      list($dims[]) = $style->border_spacing;
+
+    $delta = $style->length_in_pt($dims, $this->_frame->get_containing_block("w"));
+
+    $this->_state["min_width"] += $delta;
+    $this->_state["max_width"] += $delta;
+
+    return $this->_min_max_cache = array(
+      $this->_state["min_width"], 
+      $this->_state["max_width"],
+      "min" => $this->_state["min_width"], 
+      "max" => $this->_state["max_width"],
+    );
+  }
+}

vendor/dompdf/dompdf/include/table_row_frame_decorator.cls.php

@@ -0,0 +1,48 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Decorates Frames for table row layout
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Row_Frame_Decorator extends Frame_Decorator {
+
+  // protected members
+  
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+  }
+  
+  //........................................................................ 
+
+  /**
+   * Remove all non table-cell frames from this row and move them after
+   * the table.
+   */
+  function normalise() {
+
+    // Find our table parent
+    $p = Table_Frame_Decorator::find_parent_table($this);
+    
+    $erroneous_frames = array();
+    foreach ($this->get_children() as $child) {      
+      $display = $child->get_style()->display;
+
+      if ( $display !== "table-cell" )
+        $erroneous_frames[] = $child;
+    }
+    
+    //  dump the extra nodes after the table.
+    foreach ($erroneous_frames as $frame) 
+      $p->move_after($frame);
+  }
+  
+  
+}

vendor/dompdf/dompdf/include/table_row_frame_reflower.cls.php

@@ -0,0 +1,61 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows table rows
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Row_Frame_Reflower extends Frame_Reflower {
+
+
+  function __construct(Table_Row_Frame_Decorator $frame) {
+    parent::__construct($frame);
+  }
+
+  //........................................................................
+
+  function reflow(Block_Frame_Decorator $block = null) {
+    $page = $this->_frame->get_root();
+
+    if ( $page->is_full() )
+      return;
+
+    $this->_frame->position();
+    $style = $this->_frame->get_style();
+    $cb = $this->_frame->get_containing_block();
+
+    foreach ($this->_frame->get_children() as $child) {
+
+      if ( $page->is_full() )
+        return;
+
+      $child->set_containing_block($cb);
+      $child->reflow();
+
+    }
+
+    if ( $page->is_full() )
+      return;
+
+    $table = Table_Frame_Decorator::find_parent_table($this->_frame);
+    $cellmap = $table->get_cellmap();
+    $style->width = $cellmap->get_frame_width($this->_frame);
+    $style->height = $cellmap->get_frame_height($this->_frame);
+
+    $this->_frame->set_position($cellmap->get_frame_position($this->_frame));
+
+  }
+
+  //........................................................................
+
+  function get_min_max_width() {
+    throw new DOMPDF_Exception("Min/max width is undefined for table rows");
+  }
+}

vendor/dompdf/dompdf/include/table_row_group_frame_decorator.cls.php

@@ -0,0 +1,66 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Table row group decorator
+ *
+ * Overrides split() method for tbody, thead & tfoot elements
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Row_Group_Frame_Decorator extends Frame_Decorator {
+
+  /**
+   * Class constructor
+   *
+   * @param Frame $frame   Frame to decorate
+   * @param DOMPDF $dompdf Current dompdf instance
+   */
+  function __construct(Frame $frame, DOMPDF $dompdf) {
+    parent::__construct($frame, $dompdf);
+  }
+
+  /**
+   * Override split() to remove all child rows and this element from the cellmap
+   *
+   * @param Frame $child
+   * @param bool  $force_pagebreak
+   *
+   * @return void
+   */
+  function split(Frame $child = null, $force_pagebreak = false) {
+
+    if ( is_null($child) ) {
+      parent::split();
+      return;
+    }
+
+    // Remove child & all subsequent rows from the cellmap
+    $cellmap = $this->get_parent()->get_cellmap();
+    $iter = $child;
+
+    while ( $iter ) {
+      $cellmap->remove_row($iter);
+      $iter = $iter->get_next_sibling();
+    }
+
+    // If we are splitting at the first child remove the
+    // table-row-group from the cellmap as well
+    if ( $child === $this->get_first_child() ) {
+      $cellmap->remove_row_group($this);
+      parent::split();
+      return;
+    }
+    
+    $cellmap->update_row_group($this, $child->get_prev_sibling());
+    parent::split($child);
+    
+  }
+}
+ 

vendor/dompdf/dompdf/include/table_row_group_frame_reflower.cls.php

@@ -0,0 +1,59 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Reflows table row groups (e.g. tbody tags)
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Row_Group_Frame_Reflower extends Frame_Reflower {
+
+  function __construct($frame) {
+    parent::__construct($frame);
+  }
+
+  function reflow(Block_Frame_Decorator $block = null) {
+    $page = $this->_frame->get_root();
+
+    $style = $this->_frame->get_style();
+    
+    // Our width is equal to the width of our parent table
+    $table = Table_Frame_Decorator::find_parent_table($this->_frame);
+    
+    $cb = $this->_frame->get_containing_block();
+    
+    foreach ( $this->_frame->get_children() as $child) {
+      // Bail if the page is full
+      if ( $page->is_full() )
+        return;
+
+      $child->set_containing_block($cb["x"], $cb["y"], $cb["w"], $cb["h"]);
+      $child->reflow();
+
+      // Check if a split has occured
+      $page->check_page_break($child);
+
+    }
+
+    if ( $page->is_full() )
+      return;
+
+    $cellmap = $table->get_cellmap();
+    $style->width = $cellmap->get_frame_width($this->_frame);
+    $style->height = $cellmap->get_frame_height($this->_frame);
+
+    $this->_frame->set_position($cellmap->get_frame_position($this->_frame));
+    
+    if ( $table->get_style()->border_collapse === "collapse" ) 
+      // Unset our borders because our cells are now using them
+      $style->border_style = "none";
+ 
+  }
+
+}

vendor/dompdf/dompdf/include/table_row_group_renderer.cls.php

@@ -0,0 +1,40 @@
+<?php
+/**
+ * @package dompdf
+ * @link    http://dompdf.github.com/
+ * @author  Benj Carson <benjcarson@digitaljunkies.ca>
+ * @license http://www.gnu.org/copyleft/lesser.html GNU Lesser General Public License
+ */
+
+/**
+ * Renders block frames
+ *
+ * @access private
+ * @package dompdf
+ */
+class Table_Row_Group_Renderer extends Block_Renderer {
+
+  //........................................................................
+
+  function render(Frame $frame) {
+    $style = $frame->get_style(); 
+    
+    $this->_set_opacity( $frame->get_opacity( $style->opacity ) );
+
+    $this->_render_border($frame);
+    $this->_render_outline($frame);
+    
+    if (DEBUG_LAYOUT && DEBUG_LAYOUT_BLOCKS) {
+      $this->_debug_layout($frame->get_border_box(), "red");
+      if (DEBUG_LAYOUT_PADDINGBOX) {
+        $this->_debug_layout($frame->get_padding_box(), "red", array(0.5, 0.5));
+      }
+    }
+    
+    if (DEBUG_LAYOUT && DEBUG_LAYOUT_LINES && $frame->get_decorator()) {
+      foreach ($frame->get_decorator()->get_line_boxes() as $line) {
+        $frame->_debug_layout(array($line->x, $line->y, $line->w, $line->h), "orange");
+      }
+    }
+  }
+}